[go-diff] GO update 10/24/2007

Remote CVS for Gene Ontology gocvs at genome.Stanford.EDU
Wed Oct 24 21:31:05 PDT 2007


OBODIFF of gene_ontology_edit.obo version 5.521 by 5.524

Starting obodiff at /share/go/bin/oboedit/current using 256M of memory
* Created object of type obo:TERM with id GO:0010452
* Populated new object GO:0010452 (macro)
  * Changed name of GO:0010452 from "<new term>" to "histone H3-K36 methylation"
  * Set definition of GO:0010452 to "The modification of histone H3 by addition of a methyl group to lysine at position 36 of the histone."
  * Added definition dbxref GOC:tb to GO:0010452
  * Added synonym "histone H3 K36 methylation" to GO:0010452
  * Added general dbxref GOC:tb to synonym histone H3 K36 methylation of GO:0010452
  * Changed synonym scope of GO:0010452 from "Related" to "Exact"
  * Added synonym "histone H3K36me" to GO:0010452
  * Added general dbxref GOC:tb to synonym histone H3K36me of GO:0010452
  * Changed synonym scope of GO:0010452 from "Related" to "Exact"
  * Added synonym "histone lysine H3 K36 methylation" to GO:0010452
  * Added general dbxref GOC:tb to synonym histone lysine H3 K36 methylation of GO:0010452
  * Changed synonym scope of GO:0010452 from "Related" to "Exact"
  * Copied GO:0010452 to GO:0016571 with type OBO_REL:is_a
  * Assigned namespace "biological_process" to GO:0010452
* Added synonym "all-trans-hexaprenyl-diphosphate:isopentenyl-diphosphate hexaprenyltranstransferase activity" to GO:0000010
* Added general dbxref EC:2.5.1.30 to synonym all-trans-hexaprenyl-diphosphate:isopentenyl-diphosphate hexaprenyltranstransferase activity of GO:0000010
* Changed synonym scope of GO:0000010 from "Related" to "Exact"
* Added synonym "heptaprenyl pyrophosphate synthase activity" to GO:0000010
* Added general dbxref EC:2.5.1.30 to synonym heptaprenyl pyrophosphate synthase activity of GO:0000010
* Changed synonym scope of GO:0000010 from "Related" to "Exact"
* Added synonym "lactase-phlorizin hydrolase activity" to GO:0000016
* Added general dbxref EC:3.2.1.108 to synonym lactase-phlorizin hydrolase activity of GO:0000016
* Changed synonym scope of GO:0000016 from "Related" to "Broad"
* Added synonym "lactose galactohydrolase activity" to GO:0000016
* Added general dbxref EC:3.2.1.108 to synonym lactose galactohydrolase activity of GO:0000016
* Changed synonym scope of GO:0000016 from "Related" to "Exact"
* Added synonym "ADase activity" to GO:0000034
* Added general dbxref EC:3.5.4.2 to synonym ADase activity of GO:0000034
* Changed synonym scope of GO:0000034 from "Related" to "Exact"
* Added synonym "adenine aminohydrolase activity" to GO:0000034
* Added general dbxref EC:3.5.4.2 to synonym adenine aminohydrolase activity of GO:0000034
* Changed synonym scope of GO:0000034 from "Related" to "Exact"
* Added synonym "peptidyl-tRNA:aminoacyl-tRNA N-peptidyltransferase activity" to GO:0000048
* Added general dbxref EC:2.3.2.12 to synonym peptidyl-tRNA:aminoacyl-tRNA N-peptidyltransferase activity of GO:0000048
* Changed synonym scope of GO:0000048 from "Related" to "Exact"
* Added synonym "succinate oxidoreductase activity" to GO:0000104
* Added general dbxref EC:1.3.99.1 to synonym succinate oxidoreductase activity of GO:0000104
* Changed synonym scope of GO:0000104 from "Related" to "Exact"
* Added synonym "succinate:(acceptor) oxidoreductase activity" to GO:0000104
* Added general dbxref EC:1.3.99.1 to synonym succinate:(acceptor) oxidoreductase activity of GO:0000104
* Changed synonym scope of GO:0000104 from "Related" to "Exact"
* Added synonym "succinate:acceptor oxidoreductase activity" to GO:0000104
* Added general dbxref EC:1.3.99.1 to synonym succinate:acceptor oxidoreductase activity of GO:0000104
* Changed synonym scope of GO:0000104 from "Related" to "Exact"
* Added synonym "succinic acid dehydrogenase activity" to GO:0000104
* Added general dbxref EC:1.3.99.1 to synonym succinic acid dehydrogenase activity of GO:0000104
* Changed synonym scope of GO:0000104 from "Related" to "Exact"
* Added synonym "succinodehydrogenase activity" to GO:0000104
* Added general dbxref EC:1.3.99.1 to synonym succinodehydrogenase activity of GO:0000104
* Changed synonym scope of GO:0000104 from "Related" to "Exact"
* Added synonym "succinyl dehydrogenase activity" to GO:0000104
* Added general dbxref EC:1.3.99.1 to synonym succinyl dehydrogenase activity of GO:0000104
* Changed synonym scope of GO:0000104 from "Related" to "Exact"
* Deleted synonym "glutamine amidotransferase:cyclase" from GO:0000107
* Deleted synonym "imidazole glycerol phosphate synthase" from GO:0000107
* Deleted synonym "imidazole-glycerol-phosphate synthase" from GO:0000107
* Added synonym "glutamine amidotransferase:cyclase activity" to GO:0000107
* Changed synonym scope of GO:0000107 from "Related" to "Broad"
* Added synonym "imidazole glycerol phosphate synthase activity" to GO:0000107
* Changed synonym scope of GO:0000107 from "Related" to "Exact"
* Added synonym "imidazole-glycerol-phosphate synthase activity" to GO:0000107
* Added synonym "alpha-glycerol phosphatase activity" to GO:0000121
* Added general dbxref EC:3.1.3.21 to synonym alpha-glycerol phosphatase activity of GO:0000121
* Changed synonym scope of GO:0000121 from "Related" to "Exact"
* Added synonym "alpha-glycerophosphatase activity" to GO:0000121
* Added general dbxref EC:3.1.3.21 to synonym alpha-glycerophosphatase activity of GO:0000121
* Changed synonym scope of GO:0000121 from "Related" to "Exact"
* Added synonym "glycerol 3-phosphatase activity" to GO:0000121
* Added general dbxref EC:3.1.3.21 to synonym glycerol 3-phosphatase activity of GO:0000121
* Changed synonym scope of GO:0000121 from "Related" to "Exact"
* Added synonym "glycerol 3-phosphate phosphohydrolase activity" to GO:0000121
* Added general dbxref EC:3.1.3.21 to synonym glycerol 3-phosphate phosphohydrolase activity of GO:0000121
* Changed synonym scope of GO:0000121 from "Related" to "Exact"
* Added synonym "glycerol-1-phosphate phosphohydrolase activity" to GO:0000121
* Added general dbxref EC:3.1.3.21 to synonym glycerol-1-phosphate phosphohydrolase activity of GO:0000121
* Changed synonym scope of GO:0000121 from "Related" to "Exact"
* Added synonym "glycerol-3-phosphate phosphatase activity" to GO:0000121
* Added general dbxref EC:3.1.3.21 to synonym glycerol-3-phosphate phosphatase activity of GO:0000121
* Changed synonym scope of GO:0000121 from "Related" to "Exact"
* Deleted synonym "1-acyldihydroxyacetone-phosphate reductase" from GO:0000140
* Added synonym "1-acyldihydroxyacetone-phosphate reductase activity" to GO:0000140
* Changed synonym scope of GO:0000140 from "Related" to "Exact"
* Added synonym "1-palmitoylglycerol-3-phosphate:NADP+ oxidoreductase activity" to GO:0000140
* Added general dbxref EC:1.1.1.101 to synonym 1-palmitoylglycerol-3-phosphate:NADP+ oxidoreductase activity of GO:0000140
* Changed synonym scope of GO:0000140 from "Related" to "Exact"
* Added synonym "acyldihydroxyacetone phosphate reductase activity" to GO:0000140
* Added general dbxref EC:1.1.1.101 to synonym acyldihydroxyacetone phosphate reductase activity of GO:0000140
* Changed synonym scope of GO:0000140 from "Related" to "Exact"
* Added synonym "palmitoyl dihydroxyacetone phosphate reductase activity" to GO:0000140
* Added general dbxref EC:1.1.1.101 to synonym palmitoyl dihydroxyacetone phosphate reductase activity of GO:0000140
* Changed synonym scope of GO:0000140 from "Related" to "Exact"
* Added synonym "palmitoyl-dihydroxyacetone-phosphate reductase activity" to GO:0000140
* Added general dbxref EC:1.1.1.101 to synonym palmitoyl-dihydroxyacetone-phosphate reductase activity of GO:0000140
* Changed synonym scope of GO:0000140 from "Related" to "Exact"
* Added synonym "NAD+ phosphohydrolase activity" to GO:0000210
* Added general dbxref EC:3.6.1.22 to synonym NAD+ phosphohydrolase activity of GO:0000210
* Changed synonym scope of GO:0000210 from "Related" to "Exact"
* Added synonym "nicotinamide adenine dinucleotide pyrophosphatase activity" to GO:0000210
* Added general dbxref EC:3.6.1.22 to synonym nicotinamide adenine dinucleotide pyrophosphatase activity of GO:0000210
* Changed synonym scope of GO:0000210 from "Related" to "Exact"
* Added synonym "jack-bean glycopeptidase" to GO:0000224
* Added general dbxref EC:3.5.1.52 to synonym jack-bean glycopeptidase of GO:0000224
* Changed synonym scope of GO:0000224 from "Related" to "Narrow"
* Added synonym "N-linked-glycopeptide-(N-acetyl-beta-D-glucosaminyl)-L-asparagine amidohydrolase activity" to GO:0000224
* Added general dbxref EC:3.5.1.52 to synonym N-linked-glycopeptide-(N-acetyl-beta-D-glucosaminyl)-L-asparagine amidohydrolase activity of GO:0000224
* Changed synonym scope of GO:0000224 from "Related" to "Exact"
* Added synonym "PNGase A" to GO:0000224
* Added general dbxref EC:3.5.1.52 to synonym PNGase A of GO:0000224
* Added synonym "PNGase F" to GO:0000224
* Added general dbxref EC:3.5.1.52 to synonym PNGase F of GO:0000224
* Added synonym "6-(N-acetyl-alpha-D-glucosaminyl)-1-phosphatidyl-1D-myo-inositol acetylhydrolase activity" to GO:0000225
* Added general dbxref EC:3.5.1.89 to synonym 6-(N-acetyl-alpha-D-glucosaminyl)-1-phosphatidyl-1D-myo-inositol acetylhydrolase activity of GO:0000225
* Changed synonym scope of GO:0000225 from "Related" to "Exact"
* Added synonym "phosphoethanolamine methyltransferase activity" to GO:0000234
* Added general dbxref EC:2.1.1.103 to synonym phosphoethanolamine methyltransferase activity of GO:0000234
* Changed synonym scope of GO:0000234 from "Related" to "Exact"
* Added synonym "S-adenosyl-L-methionine:ethanolamine-phosphate N-methyltransferase activity" to GO:0000234
* Added general dbxref EC:2.1.1.103 to synonym S-adenosyl-L-methionine:ethanolamine-phosphate N-methyltransferase activity of GO:0000234
* Changed synonym scope of GO:0000234 from "Related" to "Exact"
* Added synonym "delta24(241)-sterol reductase activity" to GO:0000246
* Added general dbxref EC:1.3.1.71 to synonym delta24(241)-sterol reductase activity of GO:0000246
* Changed synonym scope of GO:0000246 from "Related" to "Exact"
* Added synonym "ergosterol:NADP+ delta24(241)-oxidoreductase activity" to GO:0000246
* Added general dbxref EC:1.3.1.71 to synonym ergosterol:NADP+ delta24(241)-oxidoreductase activity of GO:0000246
* Changed synonym scope of GO:0000246 from "Related" to "Exact"
* Added synonym "sterol delta24(28)-methylene reductase activity" to GO:0000246
* Added general dbxref EC:1.3.1.71 to synonym sterol delta24(28)-methylene reductase activity of GO:0000246
* Changed synonym scope of GO:0000246 from "Related" to "Exact"
* Added synonym "sterol delta24(28)-reductase activity" to GO:0000246
* Added general dbxref EC:1.3.1.71 to synonym sterol delta24(28)-reductase activity of GO:0000246
* Changed synonym scope of GO:0000246 from "Related" to "Exact"
* Deleted synonym "delta-8-delta-7 sterol isomerase" from GO:0000247
* Added synonym "delta-8-delta-7 sterol isomerase activity" to GO:0000247
* Changed synonym scope of GO:0000247 from "Related" to "Exact"
* Deleted synonym "sterol-C5-desaturase" from GO:0000248
* Added synonym "sterol-C5-desaturase activity" to GO:0000248
* Changed synonym scope of GO:0000248 from "Related" to "Exact"
* Deleted synonym "2,3-epoxysqualene-lanosterol cyclase" from GO:0000250
* Deleted synonym "oxidosqualene-lanosterol cyclase" from GO:0000250
* Added synonym "(S)-2,3-epoxysqualene mutase (cyclizing, lanosterol-forming)" to GO:0000250
* Added general dbxref EC:5.4.99.7 to synonym (S)-2,3-epoxysqualene mutase (cyclizing, lanosterol-forming) of GO:0000250
* Changed synonym scope of GO:0000250 from "Related" to "Exact"
* Added synonym "2,3-epoxysqualene lanosterol cyclase activity" to GO:0000250
* Added general dbxref EC:5.4.99.7 to synonym 2,3-epoxysqualene lanosterol cyclase activity of GO:0000250
* Changed synonym scope of GO:0000250 from "Related" to "Exact"
* Added synonym "2,3-epoxysqualene-lanosterol cyclase activity" to GO:0000250
* Changed synonym scope of GO:0000250 from "Related" to "Exact"
* Added synonym "2,3-oxidosqualene cyclase activity" to GO:0000250
* Added general dbxref EC:5.4.99.7 to synonym 2,3-oxidosqualene cyclase activity of GO:0000250
* Changed synonym scope of GO:0000250 from "Related" to "Exact"
* Added synonym "2,3-oxidosqualene sterol cyclase activity" to GO:0000250
* Added general dbxref EC:5.4.99.7 to synonym 2,3-oxidosqualene sterol cyclase activity of GO:0000250
* Changed synonym scope of GO:0000250 from "Related" to "Exact"
* Added synonym "2,3-oxidosqualene-lanosterol cyclase activity" to GO:0000250
* Added general dbxref EC:5.4.99.7 to synonym 2,3-oxidosqualene-lanosterol cyclase activity of GO:0000250
* Changed synonym scope of GO:0000250 from "Related" to "Exact"
* Added synonym "lanosterol 2,3-oxidosqualene cyclase activity" to GO:0000250
* Added general dbxref EC:5.4.99.7 to synonym lanosterol 2,3-oxidosqualene cyclase activity of GO:0000250
* Changed synonym scope of GO:0000250 from "Related" to "Exact"
* Added synonym "oxidosqualene-lanosterol cyclase activity" to GO:0000250
* Changed synonym scope of GO:0000250 from "Related" to "Exact"
* Added synonym "squalene 2,3-epoxide:lanosterol cyclase activity" to GO:0000250
* Added general dbxref EC:5.4.99.7 to synonym squalene 2,3-epoxide:lanosterol cyclase activity of GO:0000250
* Changed synonym scope of GO:0000250 from "Related" to "Exact"
* Added synonym "squalene epoxidase-cyclase activity" to GO:0000250
* Added general dbxref EC:5.4.99.7 to synonym squalene epoxidase-cyclase activity of GO:0000250
* Changed synonym scope of GO:0000250 from "Related" to "Exact"
* Deleted synonym "3beta-hydroxy-4beta-methylcholestenoate dehydrogenase" from GO:0000252
* Deleted synonym "sterol 4alpha-carboxylic decarboxylase" from GO:0000252
* Added synonym "3beta-hydroxy-4beta-methylcholestenoate dehydrogenase activity" to GO:0000252
* Changed synonym scope of GO:0000252 from "Related" to "Exact"
* Added synonym "sterol 4alpha-carboxylic decarboxylase activity" to GO:0000252
* Changed synonym scope of GO:0000252 from "Related" to "Exact"
* Added synonym "4,4-dimethyl-5alpha-cholest-7-en-3beta-ol,hydrogen-donor:oxygen oxidoreductase (hydroxylating)" to GO:0000254
* Added general dbxref EC:1.14.13.72 to synonym 4,4-dimethyl-5alpha-cholest-7-en-3beta-ol,hydrogen-donor:oxygen oxidoreductase (hydroxylating) of GO:0000254
* Changed synonym scope of GO:0000254 from "Related" to "Exact"
* Added synonym "4,4-dimethyl-5alpha-cholest-7-en-3beta-ol,NAD(P)H:oxygen oxidoreductase (hydroxylating)" to GO:0000254
* Added general dbxref EC:1.14.13.72 to synonym 4,4-dimethyl-5alpha-cholest-7-en-3beta-ol,NAD(P)H:oxygen oxidoreductase (hydroxylating) of GO:0000254
* Changed synonym scope of GO:0000254 from "Related" to "Exact"
* Added synonym "acetonitrilase activity" to GO:0000257
* Added general dbxref EC:3.5.5.1 to synonym acetonitrilase activity of GO:0000257
* Changed synonym scope of GO:0000257 from "Related" to "Exact"
* Added synonym "benzonitrilase activity" to GO:0000257
* Added general dbxref EC:3.5.5.1 to synonym benzonitrilase activity of GO:0000257
* Changed synonym scope of GO:0000257 from "Related" to "Exact"
* Added synonym "nitrile aminohydrolase activity" to GO:0000257
* Added general dbxref EC:3.5.5.1 to synonym nitrile aminohydrolase activity of GO:0000257
* Changed synonym scope of GO:0000257 from "Related" to "Exact"
* Added synonym "cytochrome c-lysine N-methyltransferase activity" to GO:0000277
* Added general dbxref EC:2.1.1.59 to synonym cytochrome c-lysine N-methyltransferase activity of GO:0000277
* Changed synonym scope of GO:0000277 from "Related" to "Exact"
* Added synonym "S-adenosyl-L-methionine:cytochrome c-L-lysine 6-N-methyltransferase activity" to GO:0000277
* Added general dbxref EC:2.1.1.59 to synonym S-adenosyl-L-methionine:cytochrome c-L-lysine 6-N-methyltransferase activity of GO:0000277
* Changed synonym scope of GO:0000277 from "Related" to "Exact"
* Added synonym "S-adenosyl-L-methionine:cytochrome c-L-lysine N6-methyltransferase activity" to GO:0000277
* Added general dbxref EC:2.1.1.59 to synonym S-adenosyl-L-methionine:cytochrome c-L-lysine N6-methyltransferase activity of GO:0000277
* Changed synonym scope of GO:0000277 from "Related" to "Exact"
* Added synonym "ATP:1-phosphatidyl-1D-myo-inositol-3-phosphate 5-phosphotransferase activity" to GO:0000285
* Added general dbxref EC:2.7.1.150 to synonym ATP:1-phosphatidyl-1D-myo-inositol-3-phosphate 5-phosphotransferase activity of GO:0000285
* Changed synonym scope of GO:0000285 from "Related" to "Exact"
* Added synonym "phosphatidylinositol 3-phosphate 5-kinase activity" to GO:0000285
* Added general dbxref EC:2.7.1.150 to synonym phosphatidylinositol 3-phosphate 5-kinase activity of GO:0000285
* Changed synonym scope of GO:0000285 from "Related" to "Exact"
* Added synonym "AlaDH" to GO:0000286
* Added general dbxref EC:1.4.1.1 to synonym AlaDH of GO:0000286
* Added synonym "alanine oxidoreductase activity" to GO:0000286
* Added general dbxref EC:1.4.1.1 to synonym alanine oxidoreductase activity of GO:0000286
* Changed synonym scope of GO:0000286 from "Related" to "Exact"
* Added synonym "alpha-alanine dehydrogenase activity" to GO:0000286
* Added general dbxref EC:1.4.1.1 to synonym alpha-alanine dehydrogenase activity of GO:0000286
* Changed synonym scope of GO:0000286 from "Related" to "Exact"
* Added synonym "L-alanine dehydrogenase activity" to GO:0000286
* Added general dbxref EC:1.4.1.1 to synonym L-alanine dehydrogenase activity of GO:0000286
* Changed synonym scope of GO:0000286 from "Related" to "Exact"
* Added synonym "L-alanine:NAD+ oxidoreductase (deaminating)" to GO:0000286
* Added general dbxref EC:1.4.1.1 to synonym L-alanine:NAD+ oxidoreductase (deaminating) of GO:0000286
* Changed synonym scope of GO:0000286 from "Related" to "Exact"
* Added synonym "NAD-dependent alanine dehydrogenase activity" to GO:0000286
* Added general dbxref EC:1.4.1.1 to synonym NAD-dependent alanine dehydrogenase activity of GO:0000286
* Changed synonym scope of GO:0000286 from "Related" to "Exact"
* Added synonym "NAD-linked alanine dehydrogenase activity" to GO:0000286
* Added general dbxref EC:1.4.1.1 to synonym NAD-linked alanine dehydrogenase activity of GO:0000286
* Changed synonym scope of GO:0000286 from "Related" to "Exact"
* Added synonym "NADH-dependent alanine dehydrogenase activity" to GO:0000286
* Added general dbxref EC:1.4.1.1 to synonym NADH-dependent alanine dehydrogenase activity of GO:0000286
* Changed synonym scope of GO:0000286 from "Related" to "Exact"
* Added synonym "Fe(II):NAD+ oxidoreductase activity" to GO:0000293
* Added general dbxref EC:1.16.1.7 to synonym Fe(II):NAD+ oxidoreductase activity of GO:0000293
* Changed synonym scope of GO:0000293 from "Related" to "Exact"
* Added synonym "NADH2:Fe3+ oxidoreductase activity" to GO:0000293
* Added general dbxref EC:1.16.1.7 to synonym NADH2:Fe3+ oxidoreductase activity of GO:0000293
* Changed synonym scope of GO:0000293 from "Related" to "Exact"
* Added synonym "NADH:Fe3+ oxidoreductase activity" to GO:0000293
* Added general dbxref EC:1.16.1.7 to synonym NADH:Fe3+ oxidoreductase activity of GO:0000293
* Changed synonym scope of GO:0000293 from "Related" to "Exact"
* Added synonym "NADH:Fe3+-EDTA reductase activity" to GO:0000293
* Added general dbxref EC:1.16.1.7 to synonym NADH:Fe3+-EDTA reductase activity of GO:0000293
* Changed synonym scope of GO:0000293 from "Related" to "Exact"
* Added synonym "polymetaphosphatase activity" to GO:0000298
* Added general dbxref EC:3.6.1.10 to synonym polymetaphosphatase activity of GO:0000298
* Changed synonym scope of GO:0000298 from "Related" to "Exact"
* Added synonym "polyphosphate polyphosphohydrolase activity" to GO:0000298
* Added general dbxref EC:3.6.1.10 to synonym polyphosphate polyphosphohydrolase activity of GO:0000298
* Changed synonym scope of GO:0000298 from "Related" to "Exact"
* Added synonym "ATP:NMN adenylyltransferase activity" to GO:0000309
* Added general dbxref EC:2.7.7.1 to synonym ATP:NMN adenylyltransferase activity of GO:0000309
* Changed synonym scope of GO:0000309 from "Related" to "Exact"
* Added synonym "NAD+ diphosphorylase activity" to GO:0000309
* Added general dbxref EC:2.7.7.1 to synonym NAD+ diphosphorylase activity of GO:0000309
* Changed synonym scope of GO:0000309 from "Related" to "Exact"
* Added synonym "NAD+ pyrophosphorylase activity" to GO:0000309
* Added general dbxref EC:2.7.7.1 to synonym NAD+ pyrophosphorylase activity of GO:0000309
* Changed synonym scope of GO:0000309 from "Related" to "Exact"
* Added synonym "5-phospho-alpha-D-ribose-1-diphosphate:xanthine phospho-D-ribosyltransferase activity" to GO:0000310
* Added general dbxref EC:2.4.2.22 to synonym 5-phospho-alpha-D-ribose-1-diphosphate:xanthine phospho-D-ribosyltransferase activity of GO:0000310
* Changed synonym scope of GO:0000310 from "Related" to "Exact"
* Added synonym "XMP:diphosphate 5-phospho-alpha-D-ribosyltransferase activity" to GO:0000310
* Added general dbxref EC:2.4.2.22 to synonym XMP:diphosphate 5-phospho-alpha-D-ribosyltransferase activity of GO:0000310
* Changed synonym scope of GO:0000310 from "Related" to "Exact"
* Deleted synonym "methionine sulfoxide reductase" from GO:0000317
* Added synonym "methionine sulfoxide reductase activity" to GO:0000317
* Changed synonym scope of GO:0000317 from "Related" to "Exact"
* Deleted synonym "(protein) methionine-R-sulfoxide reductase" from GO:0000318
* Added synonym "(protein) methionine-R-sulfoxide reductase activity" to GO:0000318
* Changed synonym scope of GO:0000318 from "Related" to "Exact"
* Added synonym "3-hydroxyanthranilate oxygenase activity" to GO:0000334
* Added general dbxref EC:1.13.11.6 to synonym 3-hydroxyanthranilate oxygenase activity of GO:0000334
* Changed synonym scope of GO:0000334 from "Related" to "Exact"
* Added synonym "3-hydroxyanthranilate:oxygen 3,4-oxidoreductase (decyclizing)" to GO:0000334
* Added general dbxref EC:1.13.11.6 to synonym 3-hydroxyanthranilate:oxygen 3,4-oxidoreductase (decyclizing) of GO:0000334
* Changed synonym scope of GO:0000334 from "Related" to "Exact"
* Added synonym "3-hydroxyanthranilic acid oxygenase activity" to GO:0000334
* Added general dbxref EC:1.13.11.6 to synonym 3-hydroxyanthranilic acid oxygenase activity of GO:0000334
* Changed synonym scope of GO:0000334 from "Related" to "Exact"
* Added synonym "3-hydroxyanthranilic oxygenase activity" to GO:0000334
* Added general dbxref EC:1.13.11.6 to synonym 3-hydroxyanthranilic oxygenase activity of GO:0000334
* Changed synonym scope of GO:0000334 from "Related" to "Exact"
* Added synonym "3HAO" to GO:0000334
* Added general dbxref EC:1.13.11.6 to synonym 3HAO of GO:0000334
* Deleted GO:0000414 --OBO_REL:is_a--> GO:0051568
* Copied GO:0000414 to GO:0010452 with type part_of
* Added synonym "methyltransferase II" to GO:0000773
* Added general dbxref EC:2.1.1.71 to synonym methyltransferase II of GO:0000773
* Added synonym "phosphatidyl-N-methylethanolamine methyltransferase activity" to GO:0000773
* Added general dbxref EC:2.1.1.71 to synonym phosphatidyl-N-methylethanolamine methyltransferase activity of GO:0000773
* Changed synonym scope of GO:0000773 from "Related" to "Exact"
* Added synonym "phosphatidyl-N-monomethylethanolamine methyltransferase activity" to GO:0000773
* Added general dbxref EC:2.1.1.71 to synonym phosphatidyl-N-monomethylethanolamine methyltransferase activity of GO:0000773
* Changed synonym scope of GO:0000773 from "Related" to "Exact"
* Added synonym "phosphatidylethanolamine methyltransferase I" to GO:0000773
* Added general dbxref EC:2.1.1.71 to synonym phosphatidylethanolamine methyltransferase I of GO:0000773
* Added synonym "phosphatidylmonomethylethanolamine methyltransferase activity" to GO:0000773
* Added general dbxref EC:2.1.1.71 to synonym phosphatidylmonomethylethanolamine methyltransferase activity of GO:0000773
* Changed synonym scope of GO:0000773 from "Related" to "Exact"
* Added synonym "phospholipid methyltransferase activity" to GO:0000773
* Added general dbxref EC:2.1.1.71 to synonym phospholipid methyltransferase activity of GO:0000773
* Changed synonym scope of GO:0000773 from "Related" to "Exact"
* Added synonym "S-adenosyl-L-methionine:phosphatidyl-N-methylethanolamine N-methyltransferase activity" to GO:0000773
* Added general dbxref EC:2.1.1.71 to synonym S-adenosyl-L-methionine:phosphatidyl-N-methylethanolamine N-methyltransferase activity of GO:0000773
* Changed synonym scope of GO:0000773 from "Related" to "Exact"
* Deleted synonym "DGPP phosphatase" from GO:0000810
* Deleted synonym "DGPP phosphohydrolase" from GO:0000810
* Added synonym "DGPP phosphatase activity" to GO:0000810
* Changed synonym scope of GO:0000810 from "Related" to "Exact"
* Added synonym "DGPP phosphohydrolase activity" to GO:0000810
* Changed synonym scope of GO:0000810 from "Related" to "Exact"
* Deleted synonym "sulfonate/alpha-ketoglutarate dioxygenase" from GO:0000907
* Added synonym "sulfonate/alpha-ketoglutarate dioxygenase activity" to GO:0000907
* Changed synonym scope of GO:0000907 from "Related" to "Exact"
* Added synonym "taurine, 2-oxoglutarate:O2 oxidoreductase (sulfite-forming)" to GO:0000908
* Added general dbxref EC:1.14.11.17 to synonym taurine, 2-oxoglutarate:O2 oxidoreductase (sulfite-forming) of GO:0000908
* Changed synonym scope of GO:0000908 from "Related" to "Exact"
* Added synonym "citvac" to GO:0001509
* Added general dbxref EC:3.4.22.34 to synonym citvac of GO:0001509
* Added synonym "proteinase B" to GO:0001509
* Added general dbxref EC:3.4.22.34 to synonym proteinase B of GO:0001509
* Added synonym "PRSC1 gene product (Homo sapiens)" to GO:0001509
* Added general dbxref EC:3.4.22.34 to synonym PRSC1 gene product (Homo sapiens) of GO:0001509
* Added synonym "1-(beta-D-ribofuranosyl)-1,4-dihydronicotinamide:quinone oxidoreductase activity" to GO:0001512
* Added general dbxref EC:1.10.99.2 to synonym 1-(beta-D-ribofuranosyl)-1,4-dihydronicotinamide:quinone oxidoreductase activity of GO:0001512
* Changed synonym scope of GO:0001512 from "Related" to "Exact"
* Added synonym "NAD(P)H:quinone oxidoreductase-2" to GO:0001512
* Added general dbxref EC:1.10.99.2 to synonym NAD(P)H:quinone oxidoreductase-2 of GO:0001512
* Added synonym "NAD(P)H:quinone oxidoreductase2" to GO:0001512
* Added general dbxref EC:1.10.99.2 to synonym NAD(P)H:quinone oxidoreductase2 of GO:0001512
* Added synonym "NQO2" to GO:0001512
* Added general dbxref EC:1.10.99.2 to synonym NQO2 of GO:0001512
* Added synonym "CMP-N-acetylneuraminate:glycano-1,3-(N-acetyl-alpha-D-galactosaminyl)-glycoprotein alpha-2,6-N-acetylneuraminyltransferase activity" to GO:0001665
* Added general dbxref EC:2.4.99.3 to synonym CMP-N-acetylneuraminate:glycano-1,3-(N-acetyl-alpha-D-galactosaminyl)-glycoprotein alpha-2,6-N-acetylneuraminyltransferase activity of GO:0001665
* Changed synonym scope of GO:0001665 from "Related" to "Exact"
* Deleted synonym "sialate 9(4)-O-acetylesterase" from GO:0001681
* Added synonym "N-acetylneuraminate acetyltransferase activity" to GO:0001681
* Added general dbxref EC:3.1.1.53 to synonym N-acetylneuraminate acetyltransferase activity of GO:0001681
* Changed synonym scope of GO:0001681 from "Related" to "Exact"
* Added synonym "N-acyl-O-acetylneuraminate O-acetylhydrolase activity" to GO:0001681
* Added general dbxref EC:3.1.1.53 to synonym N-acyl-O-acetylneuraminate O-acetylhydrolase activity of GO:0001681
* Changed synonym scope of GO:0001681 from "Related" to "Exact"
* Added synonym "sialate 9(4)-O-acetylesterase activity" to GO:0001681
* Changed synonym scope of GO:0001681 from "Related" to "Exact"
* Added synonym "L-amino-acid:oxygen oxidoreductase (deaminating)" to GO:0001716
* Added general dbxref EC:1.4.3.2 to synonym L-amino-acid:oxygen oxidoreductase (deaminating) of GO:0001716
* Changed synonym scope of GO:0001716 from "Related" to "Exact"
* Added synonym "ATP:ceramide 1-phosphotransferase activity" to GO:0001729
* Added general dbxref EC:2.7.1.138 to synonym ATP:ceramide 1-phosphotransferase activity of GO:0001729
* Changed synonym scope of GO:0001729 from "Related" to "Exact"
* Deleted synonym "(2-5')oligo(A) synthetase" from GO:0001730
* Deleted synonym "2-5A synthetase" from GO:0001730
* Deleted synonym "oligo-2',5'-adenylate synthetase" from GO:0001730
* Added synonym "(2-5')oligo(A) synthetase activity" to GO:0001730
* Changed synonym scope of GO:0001730 from "Related" to "Exact"
* Added synonym "2-5A synthetase activity" to GO:0001730
* Changed synonym scope of GO:0001730 from "Related" to "Exact"
* Added synonym "oligo-2',5'-adenylate synthetase activity" to GO:0001730
* Changed synonym scope of GO:0001730 from "Related" to "Exact"
* Added synonym "3'-phosphoadenosine-5'-phosphosulfate-cerebroside sulfotransferase activity" to GO:0001733
* Added general dbxref EC:2.8.2.11 to synonym 3'-phosphoadenosine-5'-phosphosulfate-cerebroside sulfotransferase activity of GO:0001733
* Changed synonym scope of GO:0001733 from "Related" to "Exact"
* Added synonym "3'-phosphoadenylyl-sulfate:galactosylceramide 3'-sulfotransferase activity" to GO:0001733
* Added general dbxref EC:2.8.2.11 to synonym 3'-phosphoadenylyl-sulfate:galactosylceramide 3'-sulfotransferase activity of GO:0001733
* Changed synonym scope of GO:0001733 from "Related" to "Exact"
* Added synonym "galactocerebroside sulfotransferase activity" to GO:0001733
* Added general dbxref EC:2.8.2.11 to synonym galactocerebroside sulfotransferase activity of GO:0001733
* Changed synonym scope of GO:0001733 from "Related" to "Exact"
* Added synonym "galactolipid sulfotransferase activity" to GO:0001733
* Added general dbxref EC:2.8.2.11 to synonym galactolipid sulfotransferase activity of GO:0001733
* Changed synonym scope of GO:0001733 from "Related" to "Exact"
* Added synonym "glycolipid sulfotransferase activity" to GO:0001733
* Added general dbxref EC:2.8.2.11 to synonym glycolipid sulfotransferase activity of GO:0001733
* Changed synonym scope of GO:0001733 from "Related" to "Exact"
* Added synonym "glycosphingolipid sulfotransferase activity" to GO:0001733
* Added general dbxref EC:2.8.2.11 to synonym glycosphingolipid sulfotransferase activity of GO:0001733
* Changed synonym scope of GO:0001733 from "Related" to "Exact"
* Added synonym "GSase" to GO:0001733
* Added general dbxref EC:2.8.2.11 to synonym GSase of GO:0001733
* Changed synonym scope of GO:0001733 from "Related" to "Exact"
* Added synonym "S-prenyl-L-cysteine:oxygen oxidoreductase activity" to GO:0001735
* Added general dbxref EC:1.8.3.5 to synonym S-prenyl-L-cysteine:oxygen oxidoreductase activity of GO:0001735
* Changed synonym scope of GO:0001735 from "Related" to "Exact"
* Added synonym "cytosolic retinal dehydrogenase activity" to GO:0001758
* Added general dbxref EC:1.2.1.36 to synonym cytosolic retinal dehydrogenase activity of GO:0001758
* Changed synonym scope of GO:0001758 from "Related" to "Exact"
* Added synonym "retinal:NAD+ oxidoreductase activity" to GO:0001758
* Added general dbxref EC:1.2.1.36 to synonym retinal:NAD+ oxidoreductase activity of GO:0001758
* Changed synonym scope of GO:0001758 from "Related" to "Exact"
* Added synonym "2-amino-3-(3-oxoprop-1-en-1-yl)but-2-enedioate carboxy-lyase (2-aminomuconate-semialdehyde-forming)" to GO:0001760
* Added general dbxref EC:4.1.1.45 to synonym 2-amino-3-(3-oxoprop-1-en-1-yl)but-2-enedioate carboxy-lyase (2-aminomuconate-semialdehyde-forming) of GO:0001760
* Changed synonym scope of GO:0001760 from "Related" to "Exact"
* Added synonym "2-amino-3-(3-oxoprop-1-en-1-yl)but-2-enedioate carboxy-lyase activity" to GO:0001760
* Added general dbxref EC:4.1.1.45 to synonym 2-amino-3-(3-oxoprop-1-en-1-yl)but-2-enedioate carboxy-lyase activity of GO:0001760
* Changed synonym scope of GO:0001760 from "Related" to "Exact"
* Added synonym "2-amino-3-(3-oxoprop-2-enyl)but-2-enedioate carboxy-lyase activity" to GO:0001760
* Added general dbxref EC:4.1.1.45 to synonym 2-amino-3-(3-oxoprop-2-enyl)but-2-enedioate carboxy-lyase activity of GO:0001760
* Changed synonym scope of GO:0001760 from "Related" to "Exact"
* Added synonym "alpha-amino-beta-carboxymuconate-epsilon-semialdehade decarboxylase activity" to GO:0001760
* Added general dbxref EC:4.1.1.45 to synonym alpha-amino-beta-carboxymuconate-epsilon-semialdehade decarboxylase activity of GO:0001760
* Changed synonym scope of GO:0001760 from "Related" to "Exact"
* Added synonym "alpha-amino-beta-carboxymuconate-epsilon-semialdehyde beta-decarboxylase activity" to GO:0001760
* Added general dbxref EC:4.1.1.45 to synonym alpha-amino-beta-carboxymuconate-epsilon-semialdehyde beta-decarboxylase activity of GO:0001760
* Changed synonym scope of GO:0001760 from "Related" to "Exact"
* Added synonym "picolinic acid carboxylase activity" to GO:0001760
* Added general dbxref EC:4.1.1.45 to synonym picolinic acid carboxylase activity of GO:0001760
* Changed synonym scope of GO:0001760 from "Related" to "Exact"
* Added synonym "alpha1,4-N-acetylglucosaminyltransferase activity" to GO:0001888
* Added general dbxref EC:2.4.1.223 to synonym alpha1,4-N-acetylglucosaminyltransferase activity of GO:0001888
* Changed synonym scope of GO:0001888 from "Related" to "Exact"
* Added synonym "UDP-N-acetyl-D-glucosamine:beta-D-glucuronosyl-(1right3)-beta-D-galactosyl-(1right3)-beta-D-galactosyl-(1right4)-beta-D-xylosyl-proteoglycan 4IV-alpha-N-acetyl-D-glucosaminyltransferase activity" to GO:0001888
* Added general dbxref EC:2.4.1.223 to synonym UDP-N-acetyl-D-glucosamine:beta-D-glucuronosyl-(1right3)-beta-D-galactosyl-(1right3)-beta-D-galactosyl-(1right4)-beta-D-xylosyl-proteoglycan 4IV-alpha-N-acetyl-D-glucosaminyltransferase activity of GO:0001888
* Changed synonym scope of GO:0001888 from "Related" to "Exact"
* Added synonym "protein disulfide-isomerase" to GO:0003756
* Added general dbxref EC:5.3.4.1 to synonym protein disulfide-isomerase of GO:0003756
* Changed synonym scope of GO:0003756 from "Related" to "Broad"
* Added synonym "globulin G" to GO:0003796
* Added general dbxref EC:3.2.1.17 to synonym globulin G of GO:0003796
* Added synonym "globulin G1" to GO:0003796
* Added general dbxref EC:3.2.1.17 to synonym globulin G1 of GO:0003796
* Added synonym "L-7001" to GO:0003796
* Added general dbxref EC:3.2.1.17 to synonym L-7001 of GO:0003796
* Added synonym "lysozyme g" to GO:0003796
* Added general dbxref EC:3.2.1.17 to synonym lysozyme g of GO:0003796
* Added synonym "peptidoglycan N-acetylmuramoylhydrolase activity" to GO:0003796
* Added general dbxref EC:3.2.1.17 to synonym peptidoglycan N-acetylmuramoylhydrolase activity of GO:0003796
* Changed synonym scope of GO:0003796 from "Related" to "Exact"
* Added synonym "PR1-lysozyme" to GO:0003796
* Added general dbxref EC:3.2.1.17 to synonym PR1-lysozyme of GO:0003796
* Added synonym "activated blood coagulation factor VII" to GO:0003802
* Added general dbxref EC:3.4.21.21 to synonym activated blood coagulation factor VII of GO:0003802
* Added synonym "blood-coagulation factor VIIa" to GO:0003802
* Added general dbxref EC:3.4.21.21 to synonym blood-coagulation factor VIIa of GO:0003802
* Added synonym "activated blood coagulation factor XI" to GO:0003803
* Added general dbxref EC:3.4.21.22 to synonym activated blood coagulation factor XI of GO:0003803
* Added synonym "activated blood-coagulation factor IX" to GO:0003803
* Added general dbxref EC:3.4.21.22 to synonym activated blood-coagulation factor IX of GO:0003803
* Added synonym "activated christmas factor" to GO:0003803
* Added general dbxref EC:3.4.21.22 to synonym activated christmas factor of GO:0003803
* Added synonym "autoprothrombin II" to GO:0003803
* Added general dbxref EC:3.4.21.22 to synonym autoprothrombin II of GO:0003803
* Added synonym "blood platelet cofactor II" to GO:0003803
* Added general dbxref EC:3.4.21.22 to synonym blood platelet cofactor II of GO:0003803
* Added synonym "blood-coagulation factor IXa" to GO:0003803
* Added general dbxref EC:3.4.21.22 to synonym blood-coagulation factor IXa of GO:0003803
* Added synonym "activated blood-coagulation factor X" to GO:0003804
* Added general dbxref EC:3.4.21.6 to synonym activated blood-coagulation factor X of GO:0003804
* Added synonym "activated factor X" to GO:0003804
* Added general dbxref EC:3.4.21.6 to synonym activated factor X of GO:0003804
* Added synonym "activated Stuart-Prower factor" to GO:0003804
* Added general dbxref EC:3.4.21.6 to synonym activated Stuart-Prower factor of GO:0003804
* Added synonym "autoprothrombin C" to GO:0003804
* Added general dbxref EC:3.4.21.6 to synonym autoprothrombin C of GO:0003804
* Added synonym "factor Xa" to GO:0003804
* Added general dbxref EC:3.4.21.6 to synonym factor Xa of GO:0003804
* Added synonym "plasma thromboplastin" to GO:0003804
* Added general dbxref EC:3.4.21.6 to synonym plasma thromboplastin of GO:0003804
* Added synonym "Stuart factor" to GO:0003804
* Added general dbxref EC:3.4.21.6 to synonym Stuart factor of GO:0003804
* Added synonym "thromboplastin" to GO:0003804
* Added general dbxref EC:3.4.21.6 to synonym thromboplastin of GO:0003804
* Added synonym "activated blood-coagulation factor XI" to GO:0003805
* Added general dbxref EC:3.4.21.27 to synonym activated blood-coagulation factor XI of GO:0003805
* Added synonym "activated plasma thromboplastin antecedent" to GO:0003805
* Added general dbxref EC:3.4.21.27 to synonym activated plasma thromboplastin antecedent of GO:0003805
* Added synonym "blood-coagulation factor XIa" to GO:0003805
* Added general dbxref EC:3.4.21.27 to synonym blood-coagulation factor XIa of GO:0003805
* Added synonym "activated beta blood-coagulation factor XII" to GO:0003806
* Added general dbxref EC:3.4.21.38 to synonym activated beta blood-coagulation factor XII of GO:0003806
* Added synonym "blood-coagulation factor XIIabeta" to GO:0003806
* Added general dbxref EC:3.4.21.38 to synonym blood-coagulation factor XIIabeta of GO:0003806
* Added synonym "blood-coagulation factor XIIf" to GO:0003806
* Added general dbxref EC:3.4.21.38 to synonym blood-coagulation factor XIIf of GO:0003806
* Added synonym "hageman factor (activated)" to GO:0003806
* Added general dbxref EC:3.4.21.38 to synonym hageman factor (activated) of GO:0003806
* Added synonym "hageman factor beta-fragment" to GO:0003806
* Added general dbxref EC:3.4.21.38 to synonym hageman factor beta-fragment of GO:0003806
* Added synonym "hageman factor fragment HFf" to GO:0003806
* Added general dbxref EC:3.4.21.38 to synonym hageman factor fragment HFf of GO:0003806
* Added synonym "kallikreinogen activator" to GO:0003806
* Added general dbxref EC:3.4.21.38 to synonym kallikreinogen activator of GO:0003806
* Added synonym "prealbumin activator" to GO:0003806
* Added general dbxref EC:3.4.21.38 to synonym prealbumin activator of GO:0003806
* Added synonym "prekallikrein activator" to GO:0003806
* Added general dbxref EC:3.4.21.38 to synonym prekallikrein activator of GO:0003806
* Added synonym "bradykininogenase" to GO:0003807
* Added general dbxref EC:3.4.21.34 to synonym bradykininogenase of GO:0003807
* Changed synonym scope of GO:0003807 from "Related" to "Broad"
* Added synonym "callicrein" to GO:0003807
* Added general dbxref EC:3.4.21.34 to synonym callicrein of GO:0003807
* Added synonym "depot-padutin" to GO:0003807
* Added general dbxref EC:3.4.21.34 to synonym depot-padutin of GO:0003807
* Added synonym "dilminal D" to GO:0003807
* Added general dbxref EC:3.4.21.34 to synonym dilminal D of GO:0003807
* Added synonym "glumorin" to GO:0003807
* Added general dbxref EC:3.4.21.34 to synonym glumorin of GO:0003807
* Added synonym "kallidinogenase" to GO:0003807
* Added general dbxref EC:3.4.21.34 to synonym kallidinogenase of GO:0003807
* Changed synonym scope of GO:0003807 from "Related" to "Broad"
* Added synonym "kallikrein" to GO:0003807
* Added general dbxref EC:3.4.21.34 to synonym kallikrein of GO:0003807
* Added synonym "kallikrein I" to GO:0003807
* Added general dbxref EC:3.4.21.34 to synonym kallikrein I of GO:0003807
* Added synonym "kallikrein II" to GO:0003807
* Added general dbxref EC:3.4.21.34 to synonym kallikrein II of GO:0003807
* Added synonym "kininogenase" to GO:0003807
* Added general dbxref EC:3.4.21.34 to synonym kininogenase of GO:0003807
* Changed synonym scope of GO:0003807 from "Related" to "Broad"
* Added synonym "onokrein P" to GO:0003807
* Added general dbxref EC:3.4.21.34 to synonym onokrein P of GO:0003807
* Added synonym "padreatin" to GO:0003807
* Added general dbxref EC:3.4.21.34 to synonym padreatin of GO:0003807
* Added synonym "padutin" to GO:0003807
* Added general dbxref EC:3.4.21.34 to synonym padutin of GO:0003807
* Added synonym "panceatic kallikrein" to GO:0003807
* Added general dbxref EC:3.4.21.34 to synonym panceatic kallikrein of GO:0003807
* Added synonym "urinary kallikrein" to GO:0003807
* Added general dbxref EC:3.4.21.34 to synonym urinary kallikrein of GO:0003807
* Added synonym "urokallikrein" to GO:0003807
* Added general dbxref EC:3.4.21.34 to synonym urokallikrein of GO:0003807
* Added synonym "activated protein C" to GO:0003808
* Added general dbxref EC:3.4.21.69 to synonym activated protein C of GO:0003808
* Added synonym "autoprothrombin II-A" to GO:0003808
* Added general dbxref EC:3.4.21.69 to synonym autoprothrombin II-A of GO:0003808
* Added synonym "blood-coagulation factor XIVa" to GO:0003808
* Added general dbxref EC:3.4.21.69 to synonym blood-coagulation factor XIVa of GO:0003808
* Added synonym "GSAPC" to GO:0003808
* Added general dbxref EC:3.4.21.69 to synonym GSAPC of GO:0003808
* Added synonym "protein Ca" to GO:0003808
* Added general dbxref EC:3.4.21.69 to synonym protein Ca of GO:0003808
* Added synonym "activated blood-coagulation factor II" to GO:0003809
* Added general dbxref EC:3.4.21.5 to synonym activated blood-coagulation factor II of GO:0003809
* Added synonym "beta-thrombin" to GO:0003809
* Added general dbxref EC:3.4.21.5 to synonym beta-thrombin of GO:0003809
* Added synonym "blood-coagulation factor IIa" to GO:0003809
* Added general dbxref EC:3.4.21.5 to synonym blood-coagulation factor IIa of GO:0003809
* Added synonym "E thrombin" to GO:0003809
* Added general dbxref EC:3.4.21.5 to synonym E thrombin of GO:0003809
* Added synonym "factor IIa" to GO:0003809
* Added general dbxref EC:3.4.21.5 to synonym factor IIa of GO:0003809
* Added synonym "gamma-thrombin" to GO:0003809
* Added general dbxref EC:3.4.21.5 to synonym gamma-thrombin of GO:0003809
* Added synonym "thrombase activity" to GO:0003809
* Added general dbxref EC:3.4.21.5 to synonym thrombase activity of GO:0003809
* Changed synonym scope of GO:0003809 from "Related" to "Exact"
* Added synonym "thrombin-C" to GO:0003809
* Added general dbxref EC:3.4.21.5 to synonym thrombin-C of GO:0003809
* Added synonym "thrombofort" to GO:0003809
* Added general dbxref EC:3.4.21.5 to synonym thrombofort of GO:0003809
* Added synonym "topical" to GO:0003809
* Added general dbxref EC:3.4.21.5 to synonym topical of GO:0003809
* Added synonym "tropostasin" to GO:0003809
* Added general dbxref EC:3.4.21.5 to synonym tropostasin of GO:0003809
* Added synonym "factor XIIIa" to GO:0003810
* Added general dbxref EC:2.3.2.13 to synonym factor XIIIa of GO:0003810
* Added synonym "fibrin stabilizing factor" to GO:0003810
* Added general dbxref EC:2.3.2.13 to synonym fibrin stabilizing factor of GO:0003810
* Added synonym "protein-glutamine:amine gamma-glutamyltransferase" to GO:0003810
* Added general dbxref EC:2.3.2.13 to synonym protein-glutamine:amine gamma-glutamyltransferase of GO:0003810
* Changed synonym scope of GO:0003810 from "Related" to "Exact"
* Added synonym "R-glutaminyl-peptide:amine gamma-glutamyl transferase activity" to GO:0003810
* Added general dbxref EC:2.3.2.13 to synonym R-glutaminyl-peptide:amine gamma-glutamyl transferase activity of GO:0003810
* Changed synonym scope of GO:0003810 from "Related" to "Exact"
* Added synonym "tissue transglutaminase" to GO:0003810
* Added general dbxref EC:2.3.2.13 to synonym tissue transglutaminase of GO:0003810
* Changed synonym scope of GO:0003810 from "Related" to "Narrow"
* Added synonym "(C3b)n,Bb" to GO:0003812
* Added general dbxref EC:3.4.21.47 to synonym (C3b)n,Bb of GO:0003812
* Added synonym "(CVF)-dependent glycine-rich-beta-glucoprotein" to GO:0003812
* Added general dbxref EC:3.4.21.47 to synonym (CVF)-dependent glycine-rich-beta-glucoprotein of GO:0003812
* Added synonym "alternative complement pathway C3(C5) convertase activity" to GO:0003812
* Added general dbxref EC:3.4.21.47 to synonym alternative complement pathway C3(C5) convertase activity of GO:0003812
* Changed synonym scope of GO:0003812 from "Related" to "Exact"
* Added synonym "C3b,Bb,CVF,Bb,C5 convertase activity" to GO:0003812
* Added general dbxref EC:3.4.21.47 to synonym C3b,Bb,CVF,Bb,C5 convertase activity of GO:0003812
* Changed synonym scope of GO:0003812 from "Related" to "Exact"
* Added synonym "cobra venom factor-dependent C3 convertase" to GO:0003812
* Added general dbxref EC:3.4.21.47 to synonym cobra venom factor-dependent C3 convertase of GO:0003812
* Changed synonym scope of GO:0003812 from "Related" to "Narrow"
* Added synonym "complement C 3(C 5) convertase (amplification)" to GO:0003812
* Added general dbxref EC:3.4.21.47 to synonym complement C 3(C 5) convertase (amplification) of GO:0003812
* Changed synonym scope of GO:0003812 from "Related" to "Exact"
* Added synonym "CVF,Bb" to GO:0003812
* Added general dbxref EC:3.4.21.47 to synonym CVF,Bb of GO:0003812
* Added synonym "glycine-rich beta-glycoprotein" to GO:0003812
* Added general dbxref EC:3.4.21.47 to synonym glycine-rich beta-glycoprotein of GO:0003812
* Added synonym "heat-labile factor" to GO:0003812
* Added general dbxref EC:3.4.21.47 to synonym heat-labile factor of GO:0003812
* Added synonym "C42" to GO:0003813
* Added general dbxref EC:3.4.21.43 to synonym C42 of GO:0003813
* Added synonym "C423" to GO:0003813
* Added general dbxref EC:3.4.21.43 to synonym C423 of GO:0003813
* Added synonym "C4b,2a" to GO:0003813
* Added general dbxref EC:3.4.21.43 to synonym C4b,2a of GO:0003813
* Added synonym "C4b,2a,3b" to GO:0003813
* Added general dbxref EC:3.4.21.43 to synonym C4b,2a,3b of GO:0003813
* Added synonym "complement C3 convertase activity" to GO:0003813
* Added general dbxref EC:3.4.21.43 to synonym complement C3 convertase activity of GO:0003813
* Changed synonym scope of GO:0003813 from "Related" to "Exact"
* Added synonym "complement C42" to GO:0003813
* Added general dbxref EC:3.4.21.43 to synonym complement C42 of GO:0003813
* Added synonym "activated complement C1r" to GO:0003815
* Added general dbxref EC:3.4.21.41 to synonym activated complement C1r of GO:0003815
* Added synonym "C1r esterase activity" to GO:0003815
* Added general dbxref EC:3.4.21.41 to synonym C1r esterase activity of GO:0003815
* Changed synonym scope of GO:0003815 from "Related" to "Exact"
* Added synonym "complement subcomponent C1r" to GO:0003815
* Added general dbxref EC:3.4.21.41 to synonym complement subcomponent C1r of GO:0003815
* Added synonym "activated complement C1s" to GO:0003816
* Added general dbxref EC:3.4.21.42 to synonym activated complement C1s of GO:0003816
* Added synonym "C1 esterase activity" to GO:0003816
* Added general dbxref EC:3.4.21.42 to synonym C1 esterase activity of GO:0003816
* Changed synonym scope of GO:0003816 from "Related" to "Exact"
* Added synonym "complement C1s" to GO:0003816
* Added general dbxref EC:3.4.21.42 to synonym complement C1s of GO:0003816
* Added synonym "complement subcomponent C1s" to GO:0003816
* Added general dbxref EC:3.4.21.42 to synonym complement subcomponent C1s of GO:0003816
* Added synonym "factor D" to GO:0003817
* Added general dbxref EC:3.4.21.46 to synonym factor D of GO:0003817
* Added synonym "factor D (complement)" to GO:0003817
* Added general dbxref EC:3.4.21.46 to synonym factor D (complement) of GO:0003817
* Added synonym "properdin factor D esterase activity" to GO:0003817
* Added general dbxref EC:3.4.21.46 to synonym properdin factor D esterase activity of GO:0003817
* Changed synonym scope of GO:0003817 from "Related" to "Exact"
* Added synonym "C3bINA" to GO:0003818
* Added general dbxref EC:3.4.21.45 to synonym C3bINA of GO:0003818
* Added synonym "complement C3b inactivator" to GO:0003818
* Added general dbxref EC:3.4.21.45 to synonym complement C3b inactivator of GO:0003818
* Added synonym "complement C3b/C4b inactivator" to GO:0003818
* Added general dbxref EC:3.4.21.45 to synonym complement C3b/C4b inactivator of GO:0003818
* Added synonym "complement C4b inactivator" to GO:0003818
* Added general dbxref EC:3.4.21.45 to synonym complement C4b inactivator of GO:0003818
* Added synonym "complement C4bi" to GO:0003818
* Added general dbxref EC:3.4.21.45 to synonym complement C4bi of GO:0003818
* Added synonym "conglutinogen-activating factor C" to GO:0003818
* Added general dbxref EC:3.4.21.45 to synonym conglutinogen-activating factor C of GO:0003818
* Added synonym "factor I" to GO:0003818
* Added general dbxref EC:3.4.21.45 to synonym factor I of GO:0003818
* Deleted synonym "UDP-glucose:D-glucose-6-phosphate 1-alpha-D-glucosyltransferase" from GO:0003825
* Added synonym "alpha,alpha-trehalose phosphate synthase (UDP-forming)" to GO:0003825
* Added general dbxref EC:2.4.1.15 to synonym alpha,alpha-trehalose phosphate synthase (UDP-forming) of GO:0003825
* Changed synonym scope of GO:0003825 from "Related" to "Exact"
* Added synonym "phosphotrehalose-uridine diphosphate transglucosylase activity" to GO:0003825
* Added general dbxref EC:2.4.1.15 to synonym phosphotrehalose-uridine diphosphate transglucosylase activity of GO:0003825
* Changed synonym scope of GO:0003825 from "Related" to "Exact"
* Added synonym "trehalose phosphate-uridine diphosphate glucosyltransferase activity" to GO:0003825
* Added general dbxref EC:2.4.1.15 to synonym trehalose phosphate-uridine diphosphate glucosyltransferase activity of GO:0003825
* Changed synonym scope of GO:0003825 from "Related" to "Exact"
* Added synonym "trehalose-P synthetase activity" to GO:0003825
* Added general dbxref EC:2.4.1.15 to synonym trehalose-P synthetase activity of GO:0003825
* Changed synonym scope of GO:0003825 from "Related" to "Exact"
* Added synonym "UDP-glucose:D-glucose-6-phosphate 1-alpha-D-glucosyltransferase activity" to GO:0003825
* Changed synonym scope of GO:0003825 from "Related" to "Exact"
* Added synonym "UDPglucose-glucose-phosphate glucosyltransferase activity" to GO:0003825
* Added general dbxref EC:2.4.1.15 to synonym UDPglucose-glucose-phosphate glucosyltransferase activity of GO:0003825
* Changed synonym scope of GO:0003825 from "Related" to "Exact"
* Added synonym "UDPglucose:D-glucose-6-phosphate 1-alpha-D-glucosyltransferase activity" to GO:0003825
* Added general dbxref EC:2.4.1.15 to synonym UDPglucose:D-glucose-6-phosphate 1-alpha-D-glucosyltransferase activity of GO:0003825
* Changed synonym scope of GO:0003825 from "Related" to "Exact"
* Added synonym "uridine diphosphoglucose phosphate glucosyltransferase activity" to GO:0003825
* Added general dbxref EC:2.4.1.15 to synonym uridine diphosphoglucose phosphate glucosyltransferase activity of GO:0003825
* Changed synonym scope of GO:0003825 from "Related" to "Exact"
* Added synonym "alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase activity" to GO:0003827
* Added general dbxref EC:2.4.1.101 to synonym alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase activity of GO:0003827
* Changed synonym scope of GO:0003827 from "Related" to "Exact"
* Added synonym "GnTI" to GO:0003827
* Added general dbxref EC:2.4.1.101 to synonym GnTI of GO:0003827
* Added synonym "UDP-N-acetyl-D-glucosamine:3-(alpha-D-mannosyl)-beta-D-mannosyl-glycoprotein 2-beta-N-acetyl-D-glucosaminyltransferase activity" to GO:0003827
* Added general dbxref EC:2.4.1.101 to synonym UDP-N-acetyl-D-glucosamine:3-(alpha-D-mannosyl)-beta-D-mannosyl-glycoprotein 2-beta-N-acetyl-D-glucosaminyltransferase activity of GO:0003827
* Changed synonym scope of GO:0003827 from "Related" to "Exact"
* Added synonym "CMP-N-acetylneuraminate:alpha-N-acetylneuraminyl-2,3-beta-D-galactoside alpha-2,8-N-acetylneuraminyltransferase activity" to GO:0003828
* Added general dbxref EC:2.4.99.8 to synonym CMP-N-acetylneuraminate:alpha-N-acetylneuraminyl-2,3-beta-D-galactoside alpha-2,8-N-acetylneuraminyltransferase activity of GO:0003828
* Changed synonym scope of GO:0003828 from "Related" to "Exact"
* Added synonym "CMP-NeuAc:LM1(alpha2-8) sialyltranferase activity" to GO:0003828
* Added general dbxref EC:2.4.99.8 to synonym CMP-NeuAc:LM1(alpha2-8) sialyltranferase activity of GO:0003828
* Changed synonym scope of GO:0003828 from "Related" to "Exact"
* Added synonym "cytidine monophosphoacetylneuraminate-ganglioside GM3" to GO:0003828
* Added general dbxref EC:2.4.99.8 to synonym cytidine monophosphoacetylneuraminate-ganglioside GM3 of GO:0003828
* Added synonym "ganglioside GD3 synthase activity" to GO:0003828
* Added general dbxref EC:2.4.99.8 to synonym ganglioside GD3 synthase activity of GO:0003828
* Changed synonym scope of GO:0003828 from "Related" to "Exact"
* Added synonym "ganglioside GD3 synthetase sialyltransferase activity" to GO:0003828
* Added general dbxref EC:2.4.99.8 to synonym ganglioside GD3 synthetase sialyltransferase activity of GO:0003828
* Changed synonym scope of GO:0003828 from "Related" to "Exact"
* Added synonym "GD3 synthase activity" to GO:0003828
* Added general dbxref EC:2.4.99.8 to synonym GD3 synthase activity of GO:0003828
* Changed synonym scope of GO:0003828 from "Related" to "Exact"
* Added synonym "SAT-2" to GO:0003828
* Added general dbxref EC:2.4.99.8 to synonym SAT-2 of GO:0003828
* Added synonym "beta6-N-acetylglucosaminyltransferase activity" to GO:0003829
* Added general dbxref EC:2.4.1.102 to synonym beta6-N-acetylglucosaminyltransferase activity of GO:0003829
* Changed synonym scope of GO:0003829 from "Related" to "Exact"
* Added synonym "core 2 acetylglucosaminyltransferase activity" to GO:0003829
* Added general dbxref EC:2.4.1.102 to synonym core 2 acetylglucosaminyltransferase activity of GO:0003829
* Changed synonym scope of GO:0003829 from "Related" to "Exact"
* Added synonym "core 6-beta-GlcNAc-transferase A" to GO:0003829
* Added general dbxref EC:2.4.1.102 to synonym core 6-beta-GlcNAc-transferase A of GO:0003829
* Added synonym "UDP-N-acetyl-D-glucosamine:O-glycosyl-glycoprotein (N-acetyl-D-glucosamine to N-acetyl-D-galactosamine of beta-D-galactosyl-1,3-N-acetyl-D-galactosaminyl-R) beta-1,6-N-acetyl-D-glucosaminyltransferase activity" to GO:0003829
* Added general dbxref EC:2.4.1.102 to synonym UDP-N-acetyl-D-glucosamine:O-glycosyl-glycoprotein (N-acetyl-D-glucosamine to N-acetyl-D-galactosamine of beta-D-galactosyl-1,3-N-acetyl-D-galactosaminyl-R) beta-1,6-N-acetyl-D-glucosaminyltransferase activity of GO:0003829
* Changed synonym scope of GO:0003829 from "Related" to "Exact"
* Added synonym "uridine diphosphoacetylglucosamine-mucin beta-(1right6)-acetylglucosaminyltransferase activity" to GO:0003829
* Added general dbxref EC:2.4.1.102 to synonym uridine diphosphoacetylglucosamine-mucin beta-(1right6)-acetylglucosaminyltransferase activity of GO:0003829
* Changed synonym scope of GO:0003829 from "Related" to "Exact"
* Deleted synonym "Beta-1,4-mannosyl-glycoprotein beta-1,4-N-acetylglucosaminyltransferase activity" from GO:0003830
* Added synonym "beta-1,4-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase activity" to GO:0003830
* Added general dbxref EC:2.4.1.144 to synonym beta-1,4-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase activity of GO:0003830
* Changed synonym scope of GO:0003830 from "Related" to "Exact"
* Added synonym "beta-1,4-mannosyl-glycoprotein beta-1,4-N-acetylglucosaminyltransferase activity" to GO:0003830
* Added general dbxref EC:2.4.1.144 to synonym beta-1,4-mannosyl-glycoprotein beta-1,4-N-acetylglucosaminyltransferase activity of GO:0003830
* Changed synonym scope of GO:0003830 from "Related" to "Exact"
* Added synonym "UDP-N-acetyl-D-glucosamine:beta-D-mannosyl-glycoprotein 4-beta-N-acetyl-D-glucosaminyltransferase activity" to GO:0003830
* Added general dbxref EC:2.4.1.144 to synonym UDP-N-acetyl-D-glucosamine:beta-D-mannosyl-glycoprotein 4-beta-N-acetyl-D-glucosaminyltransferase activity of GO:0003830
* Changed synonym scope of GO:0003830 from "Related" to "Exact"
* Added synonym "uridine diphosphoacetylglucosamine-glycopeptide beta4-acetylglucosaminyltransferase III" to GO:0003830
* Added general dbxref EC:2.4.1.144 to synonym uridine diphosphoacetylglucosamine-glycopeptide beta4-acetylglucosaminyltransferase III of GO:0003830
* Added synonym "beta-N-acetyl-beta1-4-galactosyltransferase activity" to GO:0003831
* Added general dbxref EC:2.4.1.38 to synonym beta-N-acetyl-beta1-4-galactosyltransferase activity of GO:0003831
* Changed synonym scope of GO:0003831 from "Related" to "Exact"
* Added synonym "glycoprotein 4-beta-galactosyl-transferase activity" to GO:0003831
* Added general dbxref EC:2.4.1.38 to synonym glycoprotein 4-beta-galactosyl-transferase activity of GO:0003831
* Changed synonym scope of GO:0003831 from "Related" to "Exact"
* Added synonym "glycoprotein beta-galactosyltransferase activity" to GO:0003831
* Added general dbxref EC:2.4.1.38 to synonym glycoprotein beta-galactosyltransferase activity of GO:0003831
* Changed synonym scope of GO:0003831 from "Related" to "Exact"
* Added synonym "thyroid glycoprotein beta-galactosyltransferase" to GO:0003831
* Added general dbxref EC:2.4.1.38 to synonym thyroid glycoprotein beta-galactosyltransferase of GO:0003831
* Changed synonym scope of GO:0003831 from "Related" to "Narrow"
* Added synonym "UDP-galactose:N-acetyl-beta-D-glucosaminylglycopeptide beta-1,4-galactosyltransferase activity" to GO:0003831
* Added general dbxref EC:2.4.1.38 to synonym UDP-galactose:N-acetyl-beta-D-glucosaminylglycopeptide beta-1,4-galactosyltransferase activity of GO:0003831
* Changed synonym scope of GO:0003831 from "Related" to "Exact"
* Added synonym "UDPgalactose-glycoprotein galactosyltransferase activity" to GO:0003831
* Added general dbxref EC:2.4.1.38 to synonym UDPgalactose-glycoprotein galactosyltransferase activity of GO:0003831
* Changed synonym scope of GO:0003831 from "Related" to "Exact"
* Added synonym "UDPgalactose:N-acetyl-beta-D-glucosaminylglycopeptide beta-1,4-galactosyltransferase activity" to GO:0003831
* Added general dbxref EC:2.4.1.38 to synonym UDPgalactose:N-acetyl-beta-D-glucosaminylglycopeptide beta-1,4-galactosyltransferase activity of GO:0003831
* Changed synonym scope of GO:0003831 from "Related" to "Exact"
* Added synonym "uridine diphosphogalactose-glycoprotein galactosyltransferase activity" to GO:0003831
* Added general dbxref EC:2.4.1.38 to synonym uridine diphosphogalactose-glycoprotein galactosyltransferase activity of GO:0003831
* Changed synonym scope of GO:0003831 from "Related" to "Exact"
* Deleted synonym "NBAD hydrolase" from GO:0003832
* Added synonym "NBAD hydrolase activity" to GO:0003832
* Changed synonym scope of GO:0003832 from "Related" to "Exact"
* Added synonym "beta-carotene:oxygen 15,15'-oxidoreductase (bond-cleaving)" to GO:0003834
* Added general dbxref EC:1.14.99.36 to synonym beta-carotene:oxygen 15,15'-oxidoreductase (bond-cleaving) of GO:0003834
* Changed synonym scope of GO:0003834 from "Related" to "Exact"
* Added synonym "CMP-N-acetylneuraminate:beta-D-galactosyl-1,4-N-acetyl-beta-D-glucosamine alpha-2,6-N-acetylneuraminyltransferase activity" to GO:0003835
* Added general dbxref EC:2.4.99.1 to synonym CMP-N-acetylneuraminate:beta-D-galactosyl-1,4-N-acetyl-beta-D-glucosamine alpha-2,6-N-acetylneuraminyltransferase activity of GO:0003835
* Changed synonym scope of GO:0003835 from "Related" to "Exact"
* Added synonym "CMP-N-acetylneuraminate:beta-D-galactoside alpha-2,3-N-acetylneuraminyl-transferase activity" to GO:0003836
* Added general dbxref EC:2.4.99.4 to synonym CMP-N-acetylneuraminate:beta-D-galactoside alpha-2,3-N-acetylneuraminyl-transferase activity of GO:0003836
* Changed synonym scope of GO:0003836 from "Related" to "Exact"
* Added synonym "N-carbamoyl-beta-alanine amidohydrolase activity" to GO:0003837
* Added general dbxref EC:3.5.1.6 to synonym N-carbamoyl-beta-alanine amidohydrolase activity of GO:0003837
* Changed synonym scope of GO:0003837 from "Related" to "Exact"
* Added synonym "delta24-methyltransferase activity" to GO:0003838
* Added general dbxref EC:2.1.1.41 to synonym delta24-methyltransferase activity of GO:0003838
* Changed synonym scope of GO:0003838 from "Related" to "Exact"
* Added synonym "delta24-sterol methyltransferase activity" to GO:0003838
* Added general dbxref EC:2.1.1.41 to synonym delta24-sterol methyltransferase activity of GO:0003838
* Changed synonym scope of GO:0003838 from "Related" to "Exact"
* Added synonym "S-adenosyl-4-methionine:sterol delta24-methyltransferase activity" to GO:0003838
* Added general dbxref EC:2.1.1.41 to synonym S-adenosyl-4-methionine:sterol delta24-methyltransferase activity of GO:0003838
* Changed synonym scope of GO:0003838 from "Related" to "Exact"
* Added synonym "S-adenosyl-L-methionine:Delta24(23)-sterol methyltransferase activity" to GO:0003838
* Added general dbxref EC:2.1.1.41 to synonym S-adenosyl-L-methionine:Delta24(23)-sterol methyltransferase activity of GO:0003838
* Changed synonym scope of GO:0003838 from "Related" to "Exact"
* Added synonym "S-adenosyl-L-methionine:zymosterol 24-C-methyltransferase activity" to GO:0003838
* Added general dbxref EC:2.1.1.41 to synonym S-adenosyl-L-methionine:zymosterol 24-C-methyltransferase activity of GO:0003838
* Changed synonym scope of GO:0003838 from "Related" to "Exact"
* Added synonym "(5-L-glutamyl)-L-amino-acid 5-glutamyltransferase (cyclizing)" to GO:0003839
* Added general dbxref EC:2.3.2.4 to synonym (5-L-glutamyl)-L-amino-acid 5-glutamyltransferase (cyclizing) of GO:0003839
* Changed synonym scope of GO:0003839 from "Related" to "Exact"
* Added synonym "gamma-glutamyl-amino acid cyclotransferase activity" to GO:0003839
* Added general dbxref EC:2.3.2.4 to synonym gamma-glutamyl-amino acid cyclotransferase activity of GO:0003839
* Changed synonym scope of GO:0003839 from "Related" to "Exact"
* Added synonym "gamma-L-glutamylcyclotransferase activity" to GO:0003839
* Added general dbxref EC:2.3.2.4 to synonym gamma-L-glutamylcyclotransferase activity of GO:0003839
* Changed synonym scope of GO:0003839 from "Related" to "Exact"
* Added synonym "L-glutamic cyclase activity" to GO:0003839
* Added general dbxref EC:2.3.2.4 to synonym L-glutamic cyclase activity of GO:0003839
* Changed synonym scope of GO:0003839 from "Related" to "Exact"
* Added synonym "(5-L-glutamyl)-peptide:amino-acid 5-glutamyltransferase activity" to GO:0003840
* Added general dbxref EC:2.3.2.2 to synonym (5-L-glutamyl)-peptide:amino-acid 5-glutamyltransferase activity of GO:0003840
* Changed synonym scope of GO:0003840 from "Related" to "Exact"
* Added synonym "alpha-glutamyl transpeptidase activity" to GO:0003840
* Added general dbxref EC:2.3.2.2 to synonym alpha-glutamyl transpeptidase activity of GO:0003840
* Changed synonym scope of GO:0003840 from "Related" to "Exact"
* Added synonym "gamma-glutamyl peptidyltransferase activity" to GO:0003840
* Added general dbxref EC:2.3.2.2 to synonym gamma-glutamyl peptidyltransferase activity of GO:0003840
* Changed synonym scope of GO:0003840 from "Related" to "Exact"
* Added synonym "gamma-GPT" to GO:0003840
* Added general dbxref EC:2.3.2.2 to synonym gamma-GPT of GO:0003840
* Added synonym "gamma-GT" to GO:0003840
* Added general dbxref EC:2.3.2.2 to synonym gamma-GT of GO:0003840
* Added synonym "gamma-GTP" to GO:0003840
* Added general dbxref EC:2.3.2.2 to synonym gamma-GTP of GO:0003840
* Added synonym "L-gamma-glutamyl transpeptidase activity" to GO:0003840
* Added general dbxref EC:2.3.2.2 to synonym L-gamma-glutamyl transpeptidase activity of GO:0003840
* Changed synonym scope of GO:0003840 from "Related" to "Exact"
* Added synonym "L-gamma-glutamyltransferase activity" to GO:0003840
* Added general dbxref EC:2.3.2.2 to synonym L-gamma-glutamyltransferase activity of GO:0003840
* Changed synonym scope of GO:0003840 from "Related" to "Exact"
* Added synonym "L-glutamyltransferase activity" to GO:0003840
* Added general dbxref EC:2.3.2.2 to synonym L-glutamyltransferase activity of GO:0003840
* Changed synonym scope of GO:0003840 from "Related" to "Exact"
* Added synonym "1-acyl-sn-glycero-3-phosphate acyltransferase activity" to GO:0003841
* Added general dbxref EC:2.3.1.51 to synonym 1-acyl-sn-glycero-3-phosphate acyltransferase activity of GO:0003841
* Changed synonym scope of GO:0003841 from "Related" to "Exact"
* Added synonym "1-acyl-sn-glycerol 3-phosphate acyltransferase activity" to GO:0003841
* Added general dbxref EC:2.3.1.51 to synonym 1-acyl-sn-glycerol 3-phosphate acyltransferase activity of GO:0003841
* Changed synonym scope of GO:0003841 from "Related" to "Exact"
* Added synonym "1-acylglycero-3-phosphate acyltransferase activity" to GO:0003841
* Added general dbxref EC:2.3.1.51 to synonym 1-acylglycero-3-phosphate acyltransferase activity of GO:0003841
* Changed synonym scope of GO:0003841 from "Related" to "Exact"
* Added synonym "1-acylglycerolphosphate acyltransferase activity" to GO:0003841
* Added general dbxref EC:2.3.1.51 to synonym 1-acylglycerolphosphate acyltransferase activity of GO:0003841
* Changed synonym scope of GO:0003841 from "Related" to "Exact"
* Added synonym "1-acylglycerophosphate acyltransferase activity" to GO:0003841
* Added general dbxref EC:2.3.1.51 to synonym 1-acylglycerophosphate acyltransferase activity of GO:0003841
* Changed synonym scope of GO:0003841 from "Related" to "Exact"
* Added synonym "acyl-CoA:1-acyl-sn-glycerol-3-phosphate 2-O-acyltransferase activity" to GO:0003841
* Added general dbxref EC:2.3.1.51 to synonym acyl-CoA:1-acyl-sn-glycerol-3-phosphate 2-O-acyltransferase activity of GO:0003841
* Changed synonym scope of GO:0003841 from "Related" to "Exact"
* Added synonym "lysophosphatidic acid-acyltransferase activity" to GO:0003841
* Added general dbxref EC:2.3.1.51 to synonym lysophosphatidic acid-acyltransferase activity of GO:0003841
* Changed synonym scope of GO:0003841 from "Related" to "Exact"
* Added synonym "1-pyrroline dehydrogenase" to GO:0003842
* Added general dbxref EC:1.5.1.12 to synonym 1-pyrroline dehydrogenase of GO:0003842
* Changed synonym scope of GO:0003842 from "Related" to "Broad"
* Added synonym "1-pyrroline-5-carboxylate:NAD+ oxidoreductase activity" to GO:0003842
* Added general dbxref EC:1.5.1.12 to synonym 1-pyrroline-5-carboxylate:NAD+ oxidoreductase activity of GO:0003842
* Changed synonym scope of GO:0003842 from "Related" to "Exact"
* Added synonym "delta1-pyrroline-5-carboxylate dehydrogenase activity" to GO:0003842
* Added general dbxref EC:1.5.1.12 to synonym delta1-pyrroline-5-carboxylate dehydrogenase activity of GO:0003842
* Changed synonym scope of GO:0003842 from "Related" to "Exact"
* Added synonym "L-pyrroline-5-carboxylate-NAD+ oxidoreductase activity" to GO:0003842
* Added general dbxref EC:1.5.1.12 to synonym L-pyrroline-5-carboxylate-NAD+ oxidoreductase activity of GO:0003842
* Changed synonym scope of GO:0003842 from "Related" to "Exact"
* Added synonym "pyrroline-5-carboxylate dehydrogenase activity" to GO:0003842
* Added general dbxref EC:1.5.1.12 to synonym pyrroline-5-carboxylate dehydrogenase activity of GO:0003842
* Changed synonym scope of GO:0003842 from "Related" to "Exact"
* Added synonym "pyrroline-5-carboxylic acid dehydrogenase activity" to GO:0003842
* Added general dbxref EC:1.5.1.12 to synonym pyrroline-5-carboxylic acid dehydrogenase activity of GO:0003842
* Changed synonym scope of GO:0003842 from "Related" to "Exact"
* Deleted synonym "1,4-alpha-D-glucan:1,4-alpha-D-glucan 6-alpha-D-(1,4-alpha-D-glucano)-transferase" from GO:0003844
* Deleted synonym "1,4-glucan-6-(1,4-glucano)-transferase" from GO:0003844
* Added synonym "1,4-alpha-D-glucan:1,4-alpha-D-glucan 6-alpha-D-(1,4-alpha-D-glucano)-transferase activity" to GO:0003844
* Changed synonym scope of GO:0003844 from "Related" to "Exact"
* Added synonym "1,4-glucan-6-(1,4-glucano)-transferase activity" to GO:0003844
* Changed synonym scope of GO:0003844 from "Related" to "Exact"
* Added synonym "alpha-1,4-glucan:alpha-1,4-glucan-6-glycosyltransferase activity" to GO:0003844
* Added general dbxref EC:2.4.1.18 to synonym alpha-1,4-glucan:alpha-1,4-glucan-6-glycosyltransferase activity of GO:0003844
* Changed synonym scope of GO:0003844 from "Related" to "Exact"
* Added synonym "alpha-glucan-branching glycosyltransferase activity" to GO:0003844
* Added general dbxref EC:2.4.1.18 to synonym alpha-glucan-branching glycosyltransferase activity of GO:0003844
* Changed synonym scope of GO:0003844 from "Related" to "Exact"
* Added synonym "amylo-(1,4right1,6)-transglycosylase activity" to GO:0003844
* Added general dbxref EC:2.4.1.18 to synonym amylo-(1,4right1,6)-transglycosylase activity of GO:0003844
* Changed synonym scope of GO:0003844 from "Related" to "Exact"
* Added synonym "amylose isomerase activity" to GO:0003844
* Added general dbxref EC:2.4.1.18 to synonym amylose isomerase activity of GO:0003844
* Changed synonym scope of GO:0003844 from "Related" to "Exact"
* Added synonym "branching glycosyltransferase activity" to GO:0003844
* Added general dbxref EC:2.4.1.18 to synonym branching glycosyltransferase activity of GO:0003844
* Changed synonym scope of GO:0003844 from "Related" to "Exact"
* Added synonym "enzymatic branching factor" to GO:0003844
* Added general dbxref EC:2.4.1.18 to synonym enzymatic branching factor of GO:0003844
* Added synonym "enzyme Q" to GO:0003844
* Added general dbxref EC:2.4.1.18 to synonym enzyme Q of GO:0003844
* Added synonym "glucosan transglycosylase activity" to GO:0003844
* Added general dbxref EC:2.4.1.18 to synonym glucosan transglycosylase activity of GO:0003844
* Changed synonym scope of GO:0003844 from "Related" to "Exact"
* Added synonym "plant branching enzyme" to GO:0003844
* Added general dbxref EC:2.4.1.18 to synonym plant branching enzyme of GO:0003844
* Added synonym "Q-enzyme" to GO:0003844
* Added general dbxref EC:2.4.1.18 to synonym Q-enzyme of GO:0003844
* Added synonym "starch branching enzyme" to GO:0003844
* Added general dbxref EC:2.4.1.18 to synonym starch branching enzyme of GO:0003844
* Added synonym "acyl coenzyme A-monoglyceride acyltransferase activity" to GO:0003846
* Added general dbxref EC:2.3.1.22 to synonym acyl coenzyme A-monoglyceride acyltransferase activity of GO:0003846
* Changed synonym scope of GO:0003846 from "Related" to "Exact"
* Added synonym "acyl-CoA:2-acylglycerol O-acyltransferase activity" to GO:0003846
* Added general dbxref EC:2.3.1.22 to synonym acyl-CoA:2-acylglycerol O-acyltransferase activity of GO:0003846
* Changed synonym scope of GO:0003846 from "Related" to "Exact"
* Added synonym "monoacylglycerol acyltransferase activity" to GO:0003846
* Added general dbxref EC:2.3.1.22 to synonym monoacylglycerol acyltransferase activity of GO:0003846
* Changed synonym scope of GO:0003846 from "Related" to "Exact"
* Added synonym "1-alkyl-2-acetyl-sn-glycero-3-phosphocholine acetohydrolase activity" to GO:0003847
* Added general dbxref EC:3.1.1.47 to synonym 1-alkyl-2-acetyl-sn-glycero-3-phosphocholine acetohydrolase activity of GO:0003847
* Changed synonym scope of GO:0003847 from "Related" to "Exact"
* Added synonym "1-alkyl-2-acetyl-sn-glycero-3-phosphocholine acetylhydrolase activity" to GO:0003847
* Added general dbxref EC:3.1.1.47 to synonym 1-alkyl-2-acetyl-sn-glycero-3-phosphocholine acetylhydrolase activity of GO:0003847
* Changed synonym scope of GO:0003847 from "Related" to "Exact"
* Added synonym "alkylacetyl-GPC:acetylhydrolase activity" to GO:0003847
* Added general dbxref EC:3.1.1.47 to synonym alkylacetyl-GPC:acetylhydrolase activity of GO:0003847
* Changed synonym scope of GO:0003847 from "Related" to "Exact"
* Added synonym "LDL-associated phospholipase A2" to GO:0003847
* Added general dbxref EC:3.1.1.47 to synonym LDL-associated phospholipase A2 of GO:0003847
* Added synonym "LDL-PLA2" to GO:0003847
* Added general dbxref EC:3.1.1.47 to synonym LDL-PLA2 of GO:0003847
* Added synonym "7,8-dihydroxymethylpterin-pyrophosphokinase activity" to GO:0003848
* Added general dbxref EC:2.7.6.3 to synonym 7,8-dihydroxymethylpterin-pyrophosphokinase activity of GO:0003848
* Changed synonym scope of GO:0003848 from "Related" to "Exact"
* Added synonym "ATP:2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine 6'-diphosphotransferase activity" to GO:0003848
* Added general dbxref EC:2.7.6.3 to synonym ATP:2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine 6'-diphosphotransferase activity of GO:0003848
* Changed synonym scope of GO:0003848 from "Related" to "Exact"
* Added synonym "H2-pteridine-CH2OH pyrophosphokinase activity" to GO:0003848
* Added general dbxref EC:2.7.6.3 to synonym H2-pteridine-CH2OH pyrophosphokinase activity of GO:0003848
* Changed synonym scope of GO:0003848 from "Related" to "Exact"
* Added synonym "HPPK" to GO:0003848
* Added general dbxref EC:2.7.6.3 to synonym HPPK of GO:0003848
* Added synonym "hydroxymethyldihydropteridine pyrophosphokinase activity" to GO:0003848
* Added general dbxref EC:2.7.6.3 to synonym hydroxymethyldihydropteridine pyrophosphokinase activity of GO:0003848
* Changed synonym scope of GO:0003848 from "Related" to "Exact"
* Added synonym "7-phospho-2-dehydro-3-deoxy-D-arabino-heptonate" to GO:0003849
* Added general dbxref EC:2.5.1.54 to synonym 7-phospho-2-dehydro-3-deoxy-D-arabino-heptonate of GO:0003849
* Added synonym "phosphoenolpyruvate:D-erythrose-4-phosphate C-(1-carboxyvinyl)transferase (phosphate-hydrolysing, 2-carboxy-2-oxoethyl-forming)" to GO:0003849
* Added general dbxref EC:2.5.1.54 to synonym phosphoenolpyruvate:D-erythrose-4-phosphate C-(1-carboxyvinyl)transferase (phosphate-hydrolysing, 2-carboxy-2-oxoethyl-forming) of GO:0003849
* Changed synonym scope of GO:0003849 from "Related" to "Exact"
* Added synonym "2-deoxy-D-glucose-6-phosphate phosphohydrolase activity" to GO:0003850
* Added general dbxref EC:3.1.3.68 to synonym 2-deoxy-D-glucose-6-phosphate phosphohydrolase activity of GO:0003850
* Changed synonym scope of GO:0003850 from "Related" to "Exact"
* Added synonym "UDP-galactose:2-(2-hydroxyacyl)sphingosine 1-beta-D-galactosyl-transferase activity" to GO:0003851
* Added general dbxref EC:2.4.1.45 to synonym UDP-galactose:2-(2-hydroxyacyl)sphingosine 1-beta-D-galactosyl-transferase activity of GO:0003851
* Changed synonym scope of GO:0003851 from "Related" to "Exact"
* Added synonym "UDPgalactose-2-hydroxyacylsphingosine galactosyltransferase activity" to GO:0003851
* Added general dbxref EC:2.4.1.45 to synonym UDPgalactose-2-hydroxyacylsphingosine galactosyltransferase activity of GO:0003851
* Changed synonym scope of GO:0003851 from "Related" to "Exact"
* Added synonym "UDPgalactose:2-(2-hydroxyacyl)sphingosine 1-beta-D-galactosyl-transferase activity" to GO:0003851
* Added general dbxref EC:2.4.1.45 to synonym UDPgalactose:2-(2-hydroxyacyl)sphingosine 1-beta-D-galactosyl-transferase activity of GO:0003851
* Changed synonym scope of GO:0003851 from "Related" to "Exact"
* Added synonym "UDPgalactose:2-2-hydroxyacylsphingosine galactosyltransferase activity" to GO:0003851
* Added general dbxref EC:2.4.1.45 to synonym UDPgalactose:2-2-hydroxyacylsphingosine galactosyltransferase activity of GO:0003851
* Changed synonym scope of GO:0003851 from "Related" to "Exact"
* Added synonym "UDPgalactose:ceramide galactosyltransferase activity" to GO:0003851
* Added general dbxref EC:2.4.1.45 to synonym UDPgalactose:ceramide galactosyltransferase activity of GO:0003851
* Changed synonym scope of GO:0003851 from "Related" to "Exact"
* Added synonym "uridine diphosphogalactose-2-hydroxyacylsphingosine galactosyltransferase activity" to GO:0003851
* Added general dbxref EC:2.4.1.45 to synonym uridine diphosphogalactose-2-hydroxyacylsphingosine galactosyltransferase activity of GO:0003851
* Changed synonym scope of GO:0003851 from "Related" to "Exact"
* Added synonym "acetyl-CoA:3-methyl-2-oxobutanoate C-acetyltransferase (thioester-hydrolysing, carboxymethyl-forming)" to GO:0003852
* Added general dbxref EC:2.3.3.13 to synonym acetyl-CoA:3-methyl-2-oxobutanoate C-acetyltransferase (thioester-hydrolysing, carboxymethyl-forming) of GO:0003852
* Changed synonym scope of GO:0003852 from "Related" to "Exact"
* Added synonym "2-methyl branched chain acyl-CoA dehydrogenase activity" to GO:0003853
* Added general dbxref EC:1.3.99.12 to synonym 2-methyl branched chain acyl-CoA dehydrogenase activity of GO:0003853
* Changed synonym scope of GO:0003853 from "Related" to "Exact"
* Added synonym "2-methylbutanoyl-CoA:(acceptor) oxidoreductase activity" to GO:0003853
* Added general dbxref EC:1.3.99.12 to synonym 2-methylbutanoyl-CoA:(acceptor) oxidoreductase activity of GO:0003853
* Changed synonym scope of GO:0003853 from "Related" to "Exact"
* Added synonym "2-methylbutanoyl-CoA:acceptor oxidoreductase activity" to GO:0003853
* Added general dbxref EC:1.3.99.12 to synonym 2-methylbutanoyl-CoA:acceptor oxidoreductase activity of GO:0003853
* Changed synonym scope of GO:0003853 from "Related" to "Exact"
* Added synonym "3beta-HSDH" to GO:0003854
* Added general dbxref EC:1.1.1.145 to synonym 3beta-HSDH of GO:0003854
* Added synonym "3beta-hydroxy steroid dehydrogenase/isomerase activity" to GO:0003854
* Added general dbxref EC:1.1.1.145 to synonym 3beta-hydroxy steroid dehydrogenase/isomerase activity of GO:0003854
* Changed synonym scope of GO:0003854 from "Related" to "Exact"
* Added synonym "3beta-hydroxy-5-ene steroid dehydrogenase activity" to GO:0003854
* Added general dbxref EC:1.1.1.145 to synonym 3beta-hydroxy-5-ene steroid dehydrogenase activity of GO:0003854
* Changed synonym scope of GO:0003854 from "Related" to "Exact"
* Added synonym "3beta-hydroxy-5-ene-steroid dehydrogenase activity" to GO:0003854
* Added general dbxref EC:1.1.1.145 to synonym 3beta-hydroxy-5-ene-steroid dehydrogenase activity of GO:0003854
* Changed synonym scope of GO:0003854 from "Related" to "Exact"
* Added synonym "3beta-hydroxy-5-ene-steroid oxidoreductase activity" to GO:0003854
* Added general dbxref EC:1.1.1.145 to synonym 3beta-hydroxy-5-ene-steroid oxidoreductase activity of GO:0003854
* Changed synonym scope of GO:0003854 from "Related" to "Exact"
* Added synonym "3beta-hydroxy-delta5-C27-steroid dehydrogenase/isomerase activity" to GO:0003854
* Added general dbxref EC:1.1.1.145 to synonym 3beta-hydroxy-delta5-C27-steroid dehydrogenase/isomerase activity of GO:0003854
* Changed synonym scope of GO:0003854 from "Related" to "Exact"
* Added synonym "3beta-hydroxy-delta5-C27-steroid oxidoreductase" to GO:0003854
* Added general dbxref EC:1.1.1.145 to synonym 3beta-hydroxy-delta5-C27-steroid oxidoreductase of GO:0003854
* Changed synonym scope of GO:0003854 from "Related" to "Broad"
* Added synonym "3beta-hydroxy-delta5-steroid dehydrogenase activity" to GO:0003854
* Added general dbxref EC:1.1.1.145 to synonym 3beta-hydroxy-delta5-steroid dehydrogenase activity of GO:0003854
* Changed synonym scope of GO:0003854 from "Related" to "Exact"
* Added synonym "3beta-hydroxy-delta5-steroid:NAD+ 3-oxidoreductase activity" to GO:0003854
* Added general dbxref EC:1.1.1.145 to synonym 3beta-hydroxy-delta5-steroid:NAD+ 3-oxidoreductase activity of GO:0003854
* Changed synonym scope of GO:0003854 from "Related" to "Exact"
* Added synonym "5-ene-3-beta-hydroxysteroid dehydrogenase activity" to GO:0003854
* Added general dbxref EC:1.1.1.145 to synonym 5-ene-3-beta-hydroxysteroid dehydrogenase activity of GO:0003854
* Changed synonym scope of GO:0003854 from "Related" to "Exact"
* Added synonym "delta5-3beta-hydroxysteroid dehydrogenase activity" to GO:0003854
* Added general dbxref EC:1.1.1.145 to synonym delta5-3beta-hydroxysteroid dehydrogenase activity of GO:0003854
* Changed synonym scope of GO:0003854 from "Related" to "Exact"
* Added synonym "steroid-delta5-3beta-ol dehydrogenase activity" to GO:0003854
* Added general dbxref EC:1.1.1.145 to synonym steroid-delta5-3beta-ol dehydrogenase activity of GO:0003854
* Changed synonym scope of GO:0003854 from "Related" to "Exact"
* Added synonym "3-dehydroquinase activity" to GO:0003855
* Added general dbxref EC:4.2.1.10 to synonym 3-dehydroquinase activity of GO:0003855
* Changed synonym scope of GO:0003855 from "Related" to "Exact"
* Added synonym "3-dehydroquinate hydro-lyase (3-dehydroshikimate-forming)" to GO:0003855
* Added general dbxref EC:4.2.1.10 to synonym 3-dehydroquinate hydro-lyase (3-dehydroshikimate-forming) of GO:0003855
* Changed synonym scope of GO:0003855 from "Related" to "Exact"
* Added synonym "3-dehydroquinate hydro-lyase activity" to GO:0003855
* Added general dbxref EC:4.2.1.10 to synonym 3-dehydroquinate hydro-lyase activity of GO:0003855
* Changed synonym scope of GO:0003855 from "Related" to "Exact"
* Added synonym "3-dehydroquinate hydrolase activity" to GO:0003855
* Added general dbxref EC:4.2.1.10 to synonym 3-dehydroquinate hydrolase activity of GO:0003855
* Changed synonym scope of GO:0003855 from "Related" to "Exact"
* Added synonym "5-dehydroquinase activity" to GO:0003855
* Added general dbxref EC:4.2.1.10 to synonym 5-dehydroquinase activity of GO:0003855
* Changed synonym scope of GO:0003855 from "Related" to "Exact"
* Added synonym "5-dehydroquinate dehydratase activity" to GO:0003855
* Added general dbxref EC:4.2.1.10 to synonym 5-dehydroquinate dehydratase activity of GO:0003855
* Changed synonym scope of GO:0003855 from "Related" to "Exact"
* Added synonym "5-dehydroquinate hydro-lyase activity" to GO:0003855
* Added general dbxref EC:4.2.1.10 to synonym 5-dehydroquinate hydro-lyase activity of GO:0003855
* Changed synonym scope of GO:0003855 from "Related" to "Exact"
* Added synonym "dehydroquinase activity" to GO:0003855
* Added general dbxref EC:4.2.1.10 to synonym dehydroquinase activity of GO:0003855
* Changed synonym scope of GO:0003855 from "Related" to "Exact"
* Added synonym "dehydroquinate dehydratase activity" to GO:0003855
* Added general dbxref EC:4.2.1.10 to synonym dehydroquinate dehydratase activity of GO:0003855
* Changed synonym scope of GO:0003855 from "Related" to "Exact"
* Added synonym "DHQase" to GO:0003855
* Added general dbxref EC:4.2.1.10 to synonym DHQase of GO:0003855
* Changed synonym scope of GO:0003855 from "Related" to "Exact"
* Added synonym "3-deoxy-arabino-heptulonate-7-phosphate phosphate-lyase (cyclizing)" to GO:0003856
* Added general dbxref EC:4.2.3.4 to synonym 3-deoxy-arabino-heptulonate-7-phosphate phosphate-lyase (cyclizing) of GO:0003856
* Changed synonym scope of GO:0003856 from "Related" to "Exact"
* Added synonym "3-deoxy-arabino-heptulonate-7-phosphate phosphate-lyase (cyclizing; 3-dehydroquinate-forming)" to GO:0003856
* Added general dbxref EC:4.2.3.4 to synonym 3-deoxy-arabino-heptulonate-7-phosphate phosphate-lyase (cyclizing; 3-dehydroquinate-forming) of GO:0003856
* Changed synonym scope of GO:0003856 from "Related" to "Exact"
* Added synonym "3-deoxy-arabino-heptulosonate-7-phosphate phosphate-lyase (cyclizing)" to GO:0003856
* Added general dbxref EC:4.2.3.4 to synonym 3-deoxy-arabino-heptulosonate-7-phosphate phosphate-lyase (cyclizing) of GO:0003856
* Changed synonym scope of GO:0003856 from "Related" to "Exact"
* Added synonym "beta-hydroxyacyl-coenzyme A synthetase activity" to GO:0003857
* Added general dbxref EC:1.1.1.35 to synonym beta-hydroxyacyl-coenzyme A synthetase activity of GO:0003857
* Changed synonym scope of GO:0003857 from "Related" to "Exact"
* Added synonym "beta-hydroxyacylcoenzyme A dehydrogenase activity" to GO:0003857
* Added general dbxref EC:1.1.1.35 to synonym beta-hydroxyacylcoenzyme A dehydrogenase activity of GO:0003857
* Changed synonym scope of GO:0003857 from "Related" to "Exact"
* Added synonym "beta-hydroxybutyrylcoenzyme A dehydrogenase activity" to GO:0003857
* Added general dbxref EC:1.1.1.35 to synonym beta-hydroxybutyrylcoenzyme A dehydrogenase activity of GO:0003857
* Changed synonym scope of GO:0003857 from "Related" to "Exact"
* Added synonym "beta-ketoacyl-CoA reductase" to GO:0003857
* Added general dbxref EC:1.1.1.35 to synonym beta-ketoacyl-CoA reductase of GO:0003857
* Changed synonym scope of GO:0003857 from "Related" to "Broad"
* Added synonym "L-3-hydroxyacyl CoA dehydrogenase activity" to GO:0003857
* Added general dbxref EC:1.1.1.35 to synonym L-3-hydroxyacyl CoA dehydrogenase activity of GO:0003857
* Changed synonym scope of GO:0003857 from "Related" to "Exact"
* Added synonym "L-3-hydroxyacyl coenzyme A dehydrogenase activity" to GO:0003857
* Added general dbxref EC:1.1.1.35 to synonym L-3-hydroxyacyl coenzyme A dehydrogenase activity of GO:0003857
* Changed synonym scope of GO:0003857 from "Related" to "Exact"
* Added synonym "(3R)-3-hydroxybutanoyl-CoA hydro-lyase (crotonoyl-CoA-forming)" to GO:0003859
* Added general dbxref EC:4.2.1.55 to synonym (3R)-3-hydroxybutanoyl-CoA hydro-lyase (crotonoyl-CoA-forming) of GO:0003859
* Changed synonym scope of GO:0003859 from "Related" to "Exact"
* Added synonym "(3R)-3-hydroxybutanoyl-CoA hydro-lyase activity" to GO:0003859
* Added general dbxref EC:4.2.1.55 to synonym (3R)-3-hydroxybutanoyl-CoA hydro-lyase activity of GO:0003859
* Changed synonym scope of GO:0003859 from "Related" to "Exact"
* Added synonym "D-3-hydroxybutyryl coenzyme A dehydratase activity" to GO:0003859
* Added general dbxref EC:4.2.1.55 to synonym D-3-hydroxybutyryl coenzyme A dehydratase activity of GO:0003859
* Changed synonym scope of GO:0003859 from "Related" to "Exact"
* Added synonym "D-3-hydroxybutyryl-CoA dehydratase activity" to GO:0003859
* Added general dbxref EC:4.2.1.55 to synonym D-3-hydroxybutyryl-CoA dehydratase activity of GO:0003859
* Changed synonym scope of GO:0003859 from "Related" to "Exact"
* Added synonym "enoyl coenzyme A hydrase (D)" to GO:0003859
* Added general dbxref EC:4.2.1.55 to synonym enoyl coenzyme A hydrase (D) of GO:0003859
* Changed synonym scope of GO:0003859 from "Related" to "Broad"
* Added synonym "3-hydroxy-2-methylpropanoyl-CoA hydrolase activity" to GO:0003860
* Added general dbxref EC:3.1.2.4 to synonym 3-hydroxy-2-methylpropanoyl-CoA hydrolase activity of GO:0003860
* Changed synonym scope of GO:0003860 from "Related" to "Exact"
* Added synonym "3-hydroxy-isobutyryl CoA hydrolase activity" to GO:0003860
* Added general dbxref EC:3.1.2.4 to synonym 3-hydroxy-isobutyryl CoA hydrolase activity of GO:0003860
* Changed synonym scope of GO:0003860 from "Related" to "Exact"
* Added synonym "HIB CoA deacylase activity" to GO:0003860
* Added general dbxref EC:3.1.2.4 to synonym HIB CoA deacylase activity of GO:0003860
* Changed synonym scope of GO:0003860 from "Related" to "Exact"
* Added synonym "(2R,3S)-3-isopropylmalate hydro-lyase (2-isopropylmaleate-forming)" to GO:0003861
* Added general dbxref EC:4.2.1.33 to synonym (2R,3S)-3-isopropylmalate hydro-lyase (2-isopropylmaleate-forming) of GO:0003861
* Changed synonym scope of GO:0003861 from "Related" to "Exact"
* Added synonym "alpha-isopropylmalate isomerase activity" to GO:0003861
* Added general dbxref EC:4.2.1.33 to synonym alpha-isopropylmalate isomerase activity of GO:0003861
* Changed synonym scope of GO:0003861 from "Related" to "Exact"
* Added synonym "beta-isopropylmalate dehydratase activity" to GO:0003861
* Added general dbxref EC:4.2.1.33 to synonym beta-isopropylmalate dehydratase activity of GO:0003861
* Changed synonym scope of GO:0003861 from "Related" to "Exact"
* Added synonym "(2R,3S)-3-isopropylmalate:NAD+ oxidoreductase activity" to GO:0003862
* Added general dbxref EC:1.1.1.85 to synonym (2R,3S)-3-isopropylmalate:NAD+ oxidoreductase activity of GO:0003862
* Changed synonym scope of GO:0003862 from "Related" to "Exact"
* Added synonym "3-carboxy-2-hydroxy-4-methylpentanoate:NAD+ oxidoreductase activity" to GO:0003862
* Added general dbxref EC:1.1.1.85 to synonym 3-carboxy-2-hydroxy-4-methylpentanoate:NAD+ oxidoreductase activity of GO:0003862
* Changed synonym scope of GO:0003862 from "Related" to "Exact"
* Added synonym "beta-isopropylmalic enzyme" to GO:0003862
* Added general dbxref EC:1.1.1.85 to synonym beta-isopropylmalic enzyme of GO:0003862
* Added synonym "IPMDH" to GO:0003862
* Added general dbxref EC:1.1.1.85 to synonym IPMDH of GO:0003862
* Added synonym "threo-Ds-3-isopropylmalate dehydrogenase activity" to GO:0003862
* Added general dbxref EC:1.1.1.85 to synonym threo-Ds-3-isopropylmalate dehydrogenase activity of GO:0003862
* Changed synonym scope of GO:0003862 from "Related" to "Exact"
* Added synonym "5,10-methylene tetrahydrofolate:alpha-ketoisovalerate hydroxymethyltransferase activity" to GO:0003864
* Added general dbxref EC:2.1.2.11 to synonym 5,10-methylene tetrahydrofolate:alpha-ketoisovalerate hydroxymethyltransferase activity of GO:0003864
* Changed synonym scope of GO:0003864 from "Related" to "Exact"
* Added synonym "5,10-methylenetetrahydrofolate:3-methyl-2-oxobutanoate hydroxymethyltransferase activity" to GO:0003864
* Added general dbxref EC:2.1.2.11 to synonym 5,10-methylenetetrahydrofolate:3-methyl-2-oxobutanoate hydroxymethyltransferase activity of GO:0003864
* Changed synonym scope of GO:0003864 from "Related" to "Exact"
* Added synonym "oxopantoate hydroxymethyltransferase activity" to GO:0003864
* Added general dbxref EC:2.1.2.11 to synonym oxopantoate hydroxymethyltransferase activity of GO:0003864
* Changed synonym scope of GO:0003864 from "Related" to "Exact"
* Added synonym "3-keto-delta4-steroid-5alpha-reductase activity" to GO:0003865
* Added general dbxref EC:1.3.99.5 to synonym 3-keto-delta4-steroid-5alpha-reductase activity of GO:0003865
* Changed synonym scope of GO:0003865 from "Related" to "Exact"
* Added synonym "3-oxo-5alpha-steroid 4-dehydrogenase activity" to GO:0003865
* Added general dbxref EC:1.3.99.5 to synonym 3-oxo-5alpha-steroid 4-dehydrogenase activity of GO:0003865
* Changed synonym scope of GO:0003865 from "Related" to "Exact"
* Added synonym "3-oxo-5alpha-steroid delta4-dehydrogenase activity" to GO:0003865
* Added general dbxref EC:1.3.99.5 to synonym 3-oxo-5alpha-steroid delta4-dehydrogenase activity of GO:0003865
* Changed synonym scope of GO:0003865 from "Related" to "Exact"
* Added synonym "3-oxo-5alpha-steroid:(acceptor) delta4-oxidoreductase activity" to GO:0003865
* Added general dbxref EC:1.3.99.5 to synonym 3-oxo-5alpha-steroid:(acceptor) delta4-oxidoreductase activity of GO:0003865
* Changed synonym scope of GO:0003865 from "Related" to "Exact"
* Added synonym "3-oxo-5alpha-steroid:acceptor delta4-oxidoreductase activity" to GO:0003865
* Added general dbxref EC:1.3.99.5 to synonym 3-oxo-5alpha-steroid:acceptor delta4-oxidoreductase activity of GO:0003865
* Changed synonym scope of GO:0003865 from "Related" to "Exact"
* Added synonym "3-oxosteroid delta4-dehydrogenase" to GO:0003865
* Added general dbxref EC:1.3.99.5 to synonym 3-oxosteroid delta4-dehydrogenase of GO:0003865
* Changed synonym scope of GO:0003865 from "Related" to "Broad"
* Added synonym "4-ene-3-ketosteroid-5alpha-oxidoreductase activity" to GO:0003865
* Added general dbxref EC:1.3.99.5 to synonym 4-ene-3-ketosteroid-5alpha-oxidoreductase activity of GO:0003865
* Changed synonym scope of GO:0003865 from "Related" to "Exact"
* Added synonym "5alpha-reductase" to GO:0003865
* Added general dbxref EC:1.3.99.5 to synonym 5alpha-reductase of GO:0003865
* Changed synonym scope of GO:0003865 from "Related" to "Broad"
* Added synonym "delta4-3-keto steroid 5alpha-reductase activity" to GO:0003865
* Added general dbxref EC:1.3.99.5 to synonym delta4-3-keto steroid 5alpha-reductase activity of GO:0003865
* Changed synonym scope of GO:0003865 from "Related" to "Exact"
* Added synonym "delta4-3-ketosteroid5alpha-oxidoreductase activity" to GO:0003865
* Added general dbxref EC:1.3.99.5 to synonym delta4-3-ketosteroid5alpha-oxidoreductase activity of GO:0003865
* Changed synonym scope of GO:0003865 from "Related" to "Exact"
* Added synonym "delta4-3-oxo steroid reductase activity" to GO:0003865
* Added general dbxref EC:1.3.99.5 to synonym delta4-3-oxo steroid reductase activity of GO:0003865
* Changed synonym scope of GO:0003865 from "Related" to "Exact"
* Added synonym "delta4-3-oxosteroid-5alpha-reductase" to GO:0003865
* Added general dbxref EC:1.3.99.5 to synonym delta4-3-oxosteroid-5alpha-reductase of GO:0003865
* Changed synonym scope of GO:0003865 from "Related" to "Broad"
* Added synonym "delta4-5alpha-dehydrogenase activity" to GO:0003865
* Added general dbxref EC:1.3.99.5 to synonym delta4-5alpha-dehydrogenase activity of GO:0003865
* Changed synonym scope of GO:0003865 from "Related" to "Exact"
* Added synonym "steroid 5alpha-reductase" to GO:0003865
* Added general dbxref EC:1.3.99.5 to synonym steroid 5alpha-reductase of GO:0003865
* Changed synonym scope of GO:0003865 from "Related" to "Broad"
* Added synonym "steroid delta4-5alpha-reductase activity" to GO:0003865
* Added general dbxref EC:1.3.99.5 to synonym steroid delta4-5alpha-reductase activity of GO:0003865
* Changed synonym scope of GO:0003865 from "Related" to "Exact"
* Added synonym "testosterone 5alpha-reductase" to GO:0003865
* Added general dbxref EC:1.3.99.5 to synonym testosterone 5alpha-reductase of GO:0003865
* Changed synonym scope of GO:0003865 from "Related" to "Broad"
* Added synonym "phosphoenolpyruvate:3-phosphoshikimate 5-O-(1-carboxyvinyl)-transferase activity" to GO:0003866
* Added general dbxref EC:2.5.1.19 to synonym phosphoenolpyruvate:3-phosphoshikimate 5-O-(1-carboxyvinyl)-transferase activity of GO:0003866
* Changed synonym scope of GO:0003866 from "Related" to "Exact"
* Added synonym "4-aminobutanoate:2-oxoglutarate aminotransferase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym 4-aminobutanoate:2-oxoglutarate aminotransferase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "4-aminobutyrate-2-ketoglutarate aminotransferase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym 4-aminobutyrate-2-ketoglutarate aminotransferase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "4-aminobutyrate-2-oxoglutarate aminotransferase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym 4-aminobutyrate-2-oxoglutarate aminotransferase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "4-aminobutyrate-2-oxoglutarate transaminase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym 4-aminobutyrate-2-oxoglutarate transaminase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "4-aminobutyric acid 2-ketoglutaric acid aminotransferase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym 4-aminobutyric acid 2-ketoglutaric acid aminotransferase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "4-aminobutyric acid aminotransferase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym 4-aminobutyric acid aminotransferase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "aminobutyrate aminotransferase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym aminobutyrate aminotransferase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "aminobutyrate transaminase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym aminobutyrate transaminase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "beta-alanine aminotransferase" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym beta-alanine aminotransferase of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Broad"
* Added synonym "beta-alanine-oxoglutarate transaminase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym beta-alanine-oxoglutarate transaminase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "GABA aminotransferase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym GABA aminotransferase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "GABA transferase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym GABA transferase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "GABA-2-oxoglutarate aminotransferase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym GABA-2-oxoglutarate aminotransferase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "GABA-2-oxoglutarate transaminase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym GABA-2-oxoglutarate transaminase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "GABA-alpha-ketoglutarate aminotransferase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym GABA-alpha-ketoglutarate aminotransferase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "GABA-alpha-ketoglutarate transaminase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym GABA-alpha-ketoglutarate transaminase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "GABA-alpha-ketoglutaric acid transaminase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym GABA-alpha-ketoglutaric acid transaminase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "GABA-alpha-oxoglutarate aminotransferase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym GABA-alpha-oxoglutarate aminotransferase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "GABA-oxoglutarate aminotransferase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym GABA-oxoglutarate aminotransferase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "GABA-oxoglutarate transaminase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym GABA-oxoglutarate transaminase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "gamma-aminobutyrate aminotransaminase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym gamma-aminobutyrate aminotransaminase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "gamma-aminobutyrate transaminase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym gamma-aminobutyrate transaminase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "gamma-aminobutyrate-alpha-ketoglutarate aminotransferase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym gamma-aminobutyrate-alpha-ketoglutarate aminotransferase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "gamma-aminobutyrate-alpha-ketoglutarate transaminase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym gamma-aminobutyrate-alpha-ketoglutarate transaminase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "gamma-aminobutyrate:alpha-oxoglutarate aminotransferase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym gamma-aminobutyrate:alpha-oxoglutarate aminotransferase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "gamma-aminobutyric acid aminotransferase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym gamma-aminobutyric acid aminotransferase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "gamma-aminobutyric acid pyruvate transaminase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym gamma-aminobutyric acid pyruvate transaminase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "gamma-aminobutyric acid-2-oxoglutarate transaminase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym gamma-aminobutyric acid-2-oxoglutarate transaminase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "gamma-aminobutyric acid-alpha-ketoglutarate transaminase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym gamma-aminobutyric acid-alpha-ketoglutarate transaminase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "gamma-aminobutyric acid-alpha-ketoglutaric acid aminotransferase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym gamma-aminobutyric acid-alpha-ketoglutaric acid aminotransferase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "gamma-aminobutyric transaminase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym gamma-aminobutyric transaminase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "glutamate-succinic semialdehyde transaminase activity" to GO:0003867
* Added general dbxref EC:2.6.1.19 to synonym glutamate-succinic semialdehyde transaminase activity of GO:0003867
* Changed synonym scope of GO:0003867 from "Related" to "Exact"
* Added synonym "4-hydroxyphenylpyruvate:oxygen oxidoreductase (hydroxylating, decarboxylating)" to GO:0003868
* Added general dbxref EC:1.13.11.27 to synonym 4-hydroxyphenylpyruvate:oxygen oxidoreductase (hydroxylating, decarboxylating) of GO:0003868
* Changed synonym scope of GO:0003868 from "Related" to "Exact"
* Added synonym "4-hydroxyphenylpyruvic acid dioxygenase activity" to GO:0003868
* Added general dbxref EC:1.13.11.27 to synonym 4-hydroxyphenylpyruvic acid dioxygenase activity of GO:0003868
* Changed synonym scope of GO:0003868 from "Related" to "Exact"
* Added synonym "p-hydroxyphenylpyruvate hydroxylase activity" to GO:0003868
* Added general dbxref EC:1.13.11.27 to synonym p-hydroxyphenylpyruvate hydroxylase activity of GO:0003868
* Changed synonym scope of GO:0003868 from "Related" to "Exact"
* Added synonym "p-hydroxyphenylpyruvic acid hydroxylase activity" to GO:0003868
* Added general dbxref EC:1.13.11.27 to synonym p-hydroxyphenylpyruvic acid hydroxylase activity of GO:0003868
* Changed synonym scope of GO:0003868 from "Related" to "Exact"
* Added synonym "p-hydroxyphenylpyruvic hydroxylase activity" to GO:0003868
* Added general dbxref EC:1.13.11.27 to synonym p-hydroxyphenylpyruvic hydroxylase activity of GO:0003868
* Changed synonym scope of GO:0003868 from "Related" to "Exact"
* Added synonym "p-hydroxyphenylpyruvic oxidase activity" to GO:0003868
* Added general dbxref EC:1.13.11.27 to synonym p-hydroxyphenylpyruvic oxidase activity of GO:0003868
* Changed synonym scope of GO:0003868 from "Related" to "Exact"
* Added synonym "4-nitrophenylphosphate phosphohydrolase activity" to GO:0003869
* Added general dbxref EC:3.1.3.41 to synonym 4-nitrophenylphosphate phosphohydrolase activity of GO:0003869
* Changed synonym scope of GO:0003869 from "Related" to "Exact"
* Added synonym "ecto-p-nitrophenyl phosphatase activity" to GO:0003869
* Added general dbxref EC:3.1.3.41 to synonym ecto-p-nitrophenyl phosphatase activity of GO:0003869
* Changed synonym scope of GO:0003869 from "Related" to "Exact"
* Added synonym "K-pNPPase activity" to GO:0003869
* Added general dbxref EC:3.1.3.41 to synonym K-pNPPase activity of GO:0003869
* Changed synonym scope of GO:0003869 from "Related" to "Exact"
* Added synonym "nitrophenyl phosphatase activity" to GO:0003869
* Added general dbxref EC:3.1.3.41 to synonym nitrophenyl phosphatase activity of GO:0003869
* Changed synonym scope of GO:0003869 from "Related" to "Exact"
* Added synonym "NPPase activity" to GO:0003869
* Added general dbxref EC:3.1.3.41 to synonym NPPase activity of GO:0003869
* Changed synonym scope of GO:0003869 from "Related" to "Exact"
* Added synonym "p-nitrophenylphosphatase activity" to GO:0003869
* Added general dbxref EC:3.1.3.41 to synonym p-nitrophenylphosphatase activity of GO:0003869
* Changed synonym scope of GO:0003869 from "Related" to "Exact"
* Added synonym "p-nitrophenylphosphate phosphohydrolase activity" to GO:0003869
* Added general dbxref EC:3.1.3.41 to synonym p-nitrophenylphosphate phosphohydrolase activity of GO:0003869
* Changed synonym scope of GO:0003869 from "Related" to "Exact"
* Added synonym "para-nitrophenyl phosphatase activity" to GO:0003869
* Added general dbxref EC:3.1.3.41 to synonym para-nitrophenyl phosphatase activity of GO:0003869
* Changed synonym scope of GO:0003869 from "Related" to "Exact"
* Added synonym "PNPPase activity" to GO:0003869
* Added general dbxref EC:3.1.3.41 to synonym PNPPase activity of GO:0003869
* Changed synonym scope of GO:0003869 from "Related" to "Exact"
* Added synonym "5-aminolevulinate synthetase activity" to GO:0003870
* Added general dbxref EC:2.3.1.37 to synonym 5-aminolevulinate synthetase activity of GO:0003870
* Changed synonym scope of GO:0003870 from "Related" to "Exact"
* Added synonym "5-aminolevulinic acid synthetase activity" to GO:0003870
* Added general dbxref EC:2.3.1.37 to synonym 5-aminolevulinic acid synthetase activity of GO:0003870
* Changed synonym scope of GO:0003870 from "Related" to "Exact"
* Added synonym "ALA synthase activity" to GO:0003870
* Added general dbxref EC:2.3.1.37 to synonym ALA synthase activity of GO:0003870
* Changed synonym scope of GO:0003870 from "Related" to "Exact"
* Added synonym "ALA synthetase activity" to GO:0003870
* Added general dbxref EC:2.3.1.37 to synonym ALA synthetase activity of GO:0003870
* Changed synonym scope of GO:0003870 from "Related" to "Exact"
* Added synonym "alpha-aminolevulinic acid synthase activity" to GO:0003870
* Added general dbxref EC:2.3.1.37 to synonym alpha-aminolevulinic acid synthase activity of GO:0003870
* Changed synonym scope of GO:0003870 from "Related" to "Exact"
* Added synonym "aminolevulinate synthase activity" to GO:0003870
* Added general dbxref EC:2.3.1.37 to synonym aminolevulinate synthase activity of GO:0003870
* Changed synonym scope of GO:0003870 from "Related" to "Exact"
* Added synonym "aminolevulinate synthetase activity" to GO:0003870
* Added general dbxref EC:2.3.1.37 to synonym aminolevulinate synthetase activity of GO:0003870
* Changed synonym scope of GO:0003870 from "Related" to "Exact"
* Added synonym "aminolevulinic acid synthase activity" to GO:0003870
* Added general dbxref EC:2.3.1.37 to synonym aminolevulinic acid synthase activity of GO:0003870
* Changed synonym scope of GO:0003870 from "Related" to "Exact"
* Added synonym "aminolevulinic acid synthetase activity" to GO:0003870
* Added general dbxref EC:2.3.1.37 to synonym aminolevulinic acid synthetase activity of GO:0003870
* Changed synonym scope of GO:0003870 from "Related" to "Exact"
* Added synonym "aminolevulinic synthetase activity" to GO:0003870
* Added general dbxref EC:2.3.1.37 to synonym aminolevulinic synthetase activity of GO:0003870
* Changed synonym scope of GO:0003870 from "Related" to "Exact"
* Added synonym "delta-aminolevulinate synthetase activity" to GO:0003870
* Added general dbxref EC:2.3.1.37 to synonym delta-aminolevulinate synthetase activity of GO:0003870
* Changed synonym scope of GO:0003870 from "Related" to "Exact"
* Added synonym "delta-aminolevulinic acid synthase activity" to GO:0003870
* Added general dbxref EC:2.3.1.37 to synonym delta-aminolevulinic acid synthase activity of GO:0003870
* Changed synonym scope of GO:0003870 from "Related" to "Exact"
* Added synonym "delta-aminolevulinic acid synthetase activity" to GO:0003870
* Added general dbxref EC:2.3.1.37 to synonym delta-aminolevulinic acid synthetase activity of GO:0003870
* Changed synonym scope of GO:0003870 from "Related" to "Exact"
* Added synonym "delta-aminolevulinic synthetase activity" to GO:0003870
* Added general dbxref EC:2.3.1.37 to synonym delta-aminolevulinic synthetase activity of GO:0003870
* Changed synonym scope of GO:0003870 from "Related" to "Exact"
* Added synonym "succinyl-CoA:glycine C-succinyltransferase (decarboxylating)" to GO:0003870
* Added general dbxref EC:2.3.1.37 to synonym succinyl-CoA:glycine C-succinyltransferase (decarboxylating) of GO:0003870
* Changed synonym scope of GO:0003870 from "Related" to "Exact"
* Added synonym "5-methyltetrahydropteroyltri-L-glutamate:L-homocysteine S-methyltransferase activity" to GO:0003871
* Added general dbxref EC:2.1.1.14 to synonym 5-methyltetrahydropteroyltri-L-glutamate:L-homocysteine S-methyltransferase activity of GO:0003871
* Changed synonym scope of GO:0003871 from "Related" to "Exact"
* Added synonym "MetE" to GO:0003871
* Added general dbxref EC:2.1.1.14 to synonym MetE of GO:0003871
* Added synonym "methyltransferase, tetrahydropteroylglutamate-homocysteine transmethylase activity" to GO:0003871
* Added general dbxref EC:2.1.1.14 to synonym methyltransferase, tetrahydropteroylglutamate-homocysteine transmethylase activity of GO:0003871
* Changed synonym scope of GO:0003871 from "Related" to "Exact"
* Added synonym "tetrahydropteroyltriglutamate methyltransferase activity" to GO:0003871
* Added general dbxref EC:2.1.1.14 to synonym tetrahydropteroyltriglutamate methyltransferase activity of GO:0003871
* Changed synonym scope of GO:0003871 from "Related" to "Exact"
* Added synonym "6-phosphofructose 1-kinase activity" to GO:0003872
* Added general dbxref EC:2.7.1.11 to synonym 6-phosphofructose 1-kinase activity of GO:0003872
* Changed synonym scope of GO:0003872 from "Related" to "Exact"
* Added synonym "ATP-dependent phosphofructokinase activity" to GO:0003872
* Added general dbxref EC:2.7.1.11 to synonym ATP-dependent phosphofructokinase activity of GO:0003872
* Changed synonym scope of GO:0003872 from "Related" to "Exact"
* Added synonym "ATP:D-fructose-6-phosphate 1-phosphotransferase activity" to GO:0003872
* Added general dbxref EC:2.7.1.11 to synonym ATP:D-fructose-6-phosphate 1-phosphotransferase activity of GO:0003872
* Changed synonym scope of GO:0003872 from "Related" to "Exact"
* Added synonym "D-fructose-6-phosphate 1-phosphotransferase activity" to GO:0003872
* Added general dbxref EC:2.7.1.11 to synonym D-fructose-6-phosphate 1-phosphotransferase activity of GO:0003872
* Changed synonym scope of GO:0003872 from "Related" to "Exact"
* Added synonym "fructose 6-phosphate kinase activity" to GO:0003872
* Added general dbxref EC:2.7.1.11 to synonym fructose 6-phosphate kinase activity of GO:0003872
* Changed synonym scope of GO:0003872 from "Related" to "Exact"
* Added synonym "fructose 6-phosphokinase activity" to GO:0003872
* Added general dbxref EC:2.7.1.11 to synonym fructose 6-phosphokinase activity of GO:0003872
* Changed synonym scope of GO:0003872 from "Related" to "Exact"
* Added synonym "nucleotide triphosphate-dependent phosphofructokinase activity" to GO:0003872
* Added general dbxref EC:2.7.1.11 to synonym nucleotide triphosphate-dependent phosphofructokinase activity of GO:0003872
* Changed synonym scope of GO:0003872 from "Related" to "Exact"
* Added synonym "PFK" to GO:0003872
* Added general dbxref EC:2.7.1.11 to synonym PFK of GO:0003872
* Added synonym "phospho-1,6-fructokinase activity" to GO:0003872
* Added general dbxref EC:2.7.1.11 to synonym phospho-1,6-fructokinase activity of GO:0003872
* Changed synonym scope of GO:0003872 from "Related" to "Exact"
* Added synonym "phosphofructokinase (phosphorylating)" to GO:0003872
* Added general dbxref EC:2.7.1.11 to synonym phosphofructokinase (phosphorylating) of GO:0003872
* Changed synonym scope of GO:0003872 from "Related" to "Exact"
* Added synonym "6-phosphofructo-2-kinase (phosphorylating)" to GO:0003873
* Added general dbxref EC:2.7.1.105 to synonym 6-phosphofructo-2-kinase (phosphorylating) of GO:0003873
* Changed synonym scope of GO:0003873 from "Related" to "Exact"
* Added synonym "6-phosphofructose 2-kinase activity" to GO:0003873
* Added general dbxref EC:2.7.1.105 to synonym 6-phosphofructose 2-kinase activity of GO:0003873
* Changed synonym scope of GO:0003873 from "Related" to "Exact"
* Added synonym "ATP:beta-D-fructose-6-phosphate 2-phosphotransferase activity" to GO:0003873
* Added general dbxref EC:2.7.1.105 to synonym ATP:beta-D-fructose-6-phosphate 2-phosphotransferase activity of GO:0003873
* Changed synonym scope of GO:0003873 from "Related" to "Exact"
* Added synonym "ATP:D-fructose-6-phosphate 2-phosphotransferase activity" to GO:0003873
* Added general dbxref EC:2.7.1.105 to synonym ATP:D-fructose-6-phosphate 2-phosphotransferase activity of GO:0003873
* Changed synonym scope of GO:0003873 from "Related" to "Exact"
* Added synonym "fructose 6-phosphate 2-kinase activity" to GO:0003873
* Added general dbxref EC:2.7.1.105 to synonym fructose 6-phosphate 2-kinase activity of GO:0003873
* Changed synonym scope of GO:0003873 from "Related" to "Exact"
* Added synonym "2-amino-4-oxo-6-[(1S,2R)-1,2-dihydroxy-3-triphosphooxypropyl]-7,8-dihydroxypteridine triphosphate lyase activity" to GO:0003874
* Added general dbxref EC:4.2.3.12 to synonym 2-amino-4-oxo-6-[(1S,2R)-1,2-dihydroxy-3-triphosphooxypropyl]-7,8-dihydroxypteridine triphosphate lyase activity of GO:0003874
* Changed synonym scope of GO:0003874 from "Related" to "Exact"
* Added synonym "2-amino-4-oxo-6-[(1S,2R)-1,2-dihydroxy-3-triphosphooxypropyl]-7,8-dihydroxypteridine triphosphate-lyase (6-pyruvoyl-5,6,7,8-tetrahydropterin-forming)" to GO:0003874
* Added general dbxref EC:4.2.3.12 to synonym 2-amino-4-oxo-6-[(1S,2R)-1,2-dihydroxy-3-triphosphooxypropyl]-7,8-dihydroxypteridine triphosphate-lyase (6-pyruvoyl-5,6,7,8-tetrahydropterin-forming) of GO:0003874
* Changed synonym scope of GO:0003874 from "Related" to "Exact"
* Added synonym "nomega-(ADP-D-ribosyl)-L-arginine ADP-ribosylhydrolase activity" to GO:0003875
* Added general dbxref EC:3.2.2.19 to synonym nomega-(ADP-D-ribosyl)-L-arginine ADP-ribosylhydrolase activity of GO:0003875
* Changed synonym scope of GO:0003875 from "Related" to "Exact"
* Added synonym "omega-protein-N-(ADP-D-ribosyl)-L-arginine ADP-ribosylhydrolase activity" to GO:0003875
* Added general dbxref EC:3.2.2.19 to synonym omega-protein-N-(ADP-D-ribosyl)-L-arginine ADP-ribosylhydrolase activity of GO:0003875
* Changed synonym scope of GO:0003875 from "Related" to "Exact"
* Added synonym "protein ADP-ribosylarginine hydrolase activity" to GO:0003875
* Added general dbxref EC:3.2.2.19 to synonym protein ADP-ribosylarginine hydrolase activity of GO:0003875
* Changed synonym scope of GO:0003875 from "Related" to "Exact"
* Added synonym "protein-nomega-(ADP-D-ribosyl)-L-arginine ADP-ribosylhydrolase activity" to GO:0003875
* Added general dbxref EC:3.2.2.19 to synonym protein-nomega-(ADP-D-ribosyl)-L-arginine ADP-ribosylhydrolase activity of GO:0003875
* Changed synonym scope of GO:0003875 from "Related" to "Exact"
* Added synonym "5-adenylate deaminase activity" to GO:0003876
* Added general dbxref EC:3.5.4.6 to synonym 5-adenylate deaminase activity of GO:0003876
* Changed synonym scope of GO:0003876 from "Related" to "Exact"
* Added synonym "5-adenylic acid deaminase activity" to GO:0003876
* Added general dbxref EC:3.5.4.6 to synonym 5-adenylic acid deaminase activity of GO:0003876
* Changed synonym scope of GO:0003876 from "Related" to "Exact"
* Added synonym "adenosine 5-monophosphate deaminase activity" to GO:0003876
* Added general dbxref EC:3.5.4.6 to synonym adenosine 5-monophosphate deaminase activity of GO:0003876
* Changed synonym scope of GO:0003876 from "Related" to "Exact"
* Added synonym "adenosine 5-phosphate aminohydrolase activity" to GO:0003876
* Added general dbxref EC:3.5.4.6 to synonym adenosine 5-phosphate aminohydrolase activity of GO:0003876
* Changed synonym scope of GO:0003876 from "Related" to "Exact"
* Added synonym "adenosine monophosphate deaminase activity" to GO:0003876
* Added general dbxref EC:3.5.4.6 to synonym adenosine monophosphate deaminase activity of GO:0003876
* Changed synonym scope of GO:0003876 from "Related" to "Exact"
* Added synonym "adenyl deaminase activity" to GO:0003876
* Added general dbxref EC:3.5.4.6 to synonym adenyl deaminase activity of GO:0003876
* Changed synonym scope of GO:0003876 from "Related" to "Exact"
* Added synonym "adenylate aminohydrolase activity" to GO:0003876
* Added general dbxref EC:3.5.4.6 to synonym adenylate aminohydrolase activity of GO:0003876
* Changed synonym scope of GO:0003876 from "Related" to "Exact"
* Added synonym "adenylate desaminase activity" to GO:0003876
* Added general dbxref EC:3.5.4.6 to synonym adenylate desaminase activity of GO:0003876
* Changed synonym scope of GO:0003876 from "Related" to "Exact"
* Added synonym "adenylic deaminase activity" to GO:0003876
* Added general dbxref EC:3.5.4.6 to synonym adenylic deaminase activity of GO:0003876
* Changed synonym scope of GO:0003876 from "Related" to "Exact"
* Deleted synonym "ADP:ATP adenylyltransferase" from GO:0003877
* Added synonym "adenine triphosphate adenylyltransferase activity" to GO:0003877
* Added general dbxref EC:2.7.7.53 to synonym adenine triphosphate adenylyltransferase activity of GO:0003877
* Changed synonym scope of GO:0003877 from "Related" to "Exact"
* Added synonym "ADP:ATP adenylyltransferase activity" to GO:0003877
* Changed synonym scope of GO:0003877 from "Related" to "Exact"
* Added synonym "diadenosine 5',5'''-P1,P4-tetraphosphate alphabeta-phosphorylase (ADP-forming)" to GO:0003877
* Added general dbxref EC:2.7.7.53 to synonym diadenosine 5',5'''-P1,P4-tetraphosphate alphabeta-phosphorylase (ADP-forming) of GO:0003877
* Changed synonym scope of GO:0003877 from "Related" to "Exact"
* Added synonym "diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase activity" to GO:0003877
* Added general dbxref EC:2.7.7.53 to synonym diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase activity of GO:0003877
* Changed synonym scope of GO:0003877 from "Related" to "Exact"
* Added synonym "diadenosinetetraphosphate alphabeta-phosphorylase activity" to GO:0003877
* Added general dbxref EC:2.7.7.53 to synonym diadenosinetetraphosphate alphabeta-phosphorylase activity of GO:0003877
* Changed synonym scope of GO:0003877 from "Related" to "Exact"
* Added synonym "dinucleoside oligophosphate alphabeta-phosphorylase activity" to GO:0003877
* Added general dbxref EC:2.7.7.53 to synonym dinucleoside oligophosphate alphabeta-phosphorylase activity of GO:0003877
* Changed synonym scope of GO:0003877 from "Related" to "Exact"
* Added synonym "acetyl-CoA:oxaloacetate acetyltransferase (isomerizing; ADP-phosphorylating)" to GO:0003878
* Added general dbxref EC:2.3.3.8 to synonym acetyl-CoA:oxaloacetate acetyltransferase (isomerizing; ADP-phosphorylating) of GO:0003878
* Changed synonym scope of GO:0003878 from "Related" to "Exact"
* Added synonym "acetyl-CoA:oxaloacetate C-acetyltransferase [(pro-S)-carboxymethyl-forming, ADP-phosphorylating]" to GO:0003878
* Added general dbxref EC:2.3.3.8 to synonym acetyl-CoA:oxaloacetate C-acetyltransferase [(pro-S)-carboxymethyl-forming, ADP-phosphorylating] of GO:0003878
* Added synonym "ATP citrate (pro-S)-lyase activity" to GO:0003878
* Added general dbxref EC:2.3.3.8 to synonym ATP citrate (pro-S)-lyase activity of GO:0003878
* Changed synonym scope of GO:0003878 from "Related" to "Exact"
* Added synonym "ATP:citrate oxaloacetate-lyase [(pro-S)-CH2COO-rightacetyl-CoA] (ATP-dephosphorylating)" to GO:0003878
* Added general dbxref EC:2.3.3.8 to synonym ATP:citrate oxaloacetate-lyase [(pro-S)-CH2COO-rightacetyl-CoA] (ATP-dephosphorylating) of GO:0003878
* Added synonym "1-(5-phospho-D-ribosyl)-ATP:diphosphate phospho-alpha-D-ribosyl-transferase activity" to GO:0003879
* Added general dbxref EC:2.4.2.17 to synonym 1-(5-phospho-D-ribosyl)-ATP:diphosphate phospho-alpha-D-ribosyl-transferase activity of GO:0003879
* Changed synonym scope of GO:0003879 from "Related" to "Exact"
* Added synonym "adenosine triphosphate phosphoribosyltransferase activity" to GO:0003879
* Added general dbxref EC:2.4.2.17 to synonym adenosine triphosphate phosphoribosyltransferase activity of GO:0003879
* Changed synonym scope of GO:0003879 from "Related" to "Exact"
* Added synonym "phosphoribosyl ATP synthetase activity" to GO:0003879
* Added general dbxref EC:2.4.2.17 to synonym phosphoribosyl ATP synthetase activity of GO:0003879
* Changed synonym scope of GO:0003879 from "Related" to "Exact"
* Added synonym "phosphoribosyl ATP:pyrophosphate phosphoribosyltransferase activity" to GO:0003879
* Added general dbxref EC:2.4.2.17 to synonym phosphoribosyl ATP:pyrophosphate phosphoribosyltransferase activity of GO:0003879
* Changed synonym scope of GO:0003879 from "Related" to "Exact"
* Added synonym "phosphoribosyl-ATP:pyrophosphate-phosphoribosyl phosphotransferase activity" to GO:0003879
* Added general dbxref EC:2.4.2.17 to synonym phosphoribosyl-ATP:pyrophosphate-phosphoribosyl phosphotransferase activity of GO:0003879
* Changed synonym scope of GO:0003879 from "Related" to "Exact"
* Added synonym "phosphoribosyladenosine triphosphate pyrophosphorylase activity" to GO:0003879
* Added general dbxref EC:2.4.2.17 to synonym phosphoribosyladenosine triphosphate pyrophosphorylase activity of GO:0003879
* Changed synonym scope of GO:0003879 from "Related" to "Exact"
* Added synonym "phosphoribosyladenosine triphosphate synthetase activity" to GO:0003879
* Added general dbxref EC:2.4.2.17 to synonym phosphoribosyladenosine triphosphate synthetase activity of GO:0003879
* Changed synonym scope of GO:0003879 from "Related" to "Exact"
* Added synonym "phosphoribosyladenosine triphosphate:pyrophosphate phosphoribosyltransferase activity" to GO:0003879
* Added general dbxref EC:2.4.2.17 to synonym phosphoribosyladenosine triphosphate:pyrophosphate phosphoribosyltransferase activity of GO:0003879
* Changed synonym scope of GO:0003879 from "Related" to "Exact"
* Added synonym "CDP diglyceride-inositol phosphatidyltransferase activity" to GO:0003881
* Added general dbxref EC:2.7.8.11 to synonym CDP diglyceride-inositol phosphatidyltransferase activity of GO:0003881
* Changed synonym scope of GO:0003881 from "Related" to "Exact"
* Added synonym "CDP-DG:inositol transferase activity" to GO:0003881
* Added general dbxref EC:2.7.8.11 to synonym CDP-DG:inositol transferase activity of GO:0003881
* Changed synonym scope of GO:0003881 from "Related" to "Exact"
* Added synonym "CDP-diacylglycerol:myo-inositol 3-phosphatidyltransferase activity" to GO:0003881
* Added general dbxref EC:2.7.8.11 to synonym CDP-diacylglycerol:myo-inositol 3-phosphatidyltransferase activity of GO:0003881
* Changed synonym scope of GO:0003881 from "Related" to "Exact"
* Added synonym "CDP-diacylglycerol:myo-inositol-3-phosphatidyltransferase activity" to GO:0003881
* Added general dbxref EC:2.7.8.11 to synonym CDP-diacylglycerol:myo-inositol-3-phosphatidyltransferase activity of GO:0003881
* Changed synonym scope of GO:0003881 from "Related" to "Exact"
* Added synonym "CDP-diglyceride-inositol transferase activity" to GO:0003881
* Added general dbxref EC:2.7.8.11 to synonym CDP-diglyceride-inositol transferase activity of GO:0003881
* Changed synonym scope of GO:0003881 from "Related" to "Exact"
* Added synonym "CDP-diglyceride:inositol transferase activity" to GO:0003881
* Added general dbxref EC:2.7.8.11 to synonym CDP-diglyceride:inositol transferase activity of GO:0003881
* Changed synonym scope of GO:0003881 from "Related" to "Exact"
* Added synonym "CDPdiacylglycerol-inositol 3-phosphatidyltransferase activity" to GO:0003881
* Added general dbxref EC:2.7.8.11 to synonym CDPdiacylglycerol-inositol 3-phosphatidyltransferase activity of GO:0003881
* Changed synonym scope of GO:0003881 from "Related" to "Exact"
* Added synonym "cytidine 5'-diphospho-1,2-diacyl-sn-glycerol:myo-inositol 3-phosphatidyltransferase activity" to GO:0003881
* Added general dbxref EC:2.7.8.11 to synonym cytidine 5'-diphospho-1,2-diacyl-sn-glycerol:myo-inositol 3-phosphatidyltransferase activity of GO:0003881
* Changed synonym scope of GO:0003881 from "Related" to "Exact"
* Added synonym "cytidine diphosphodiglyceride-inositol phosphatidyltransferase activity" to GO:0003881
* Added general dbxref EC:2.7.8.11 to synonym cytidine diphosphodiglyceride-inositol phosphatidyltransferase activity of GO:0003881
* Changed synonym scope of GO:0003881 from "Related" to "Exact"
* Added synonym "cytidine diphosphoglyceride-inositol phosphatidyltransferase activity" to GO:0003881
* Added general dbxref EC:2.7.8.11 to synonym cytidine diphosphoglyceride-inositol phosphatidyltransferase activity of GO:0003881
* Changed synonym scope of GO:0003881 from "Related" to "Exact"
* Added synonym "cytidine diphosphoglyceride-inositol transferase activity" to GO:0003881
* Added general dbxref EC:2.7.8.11 to synonym cytidine diphosphoglyceride-inositol transferase activity of GO:0003881
* Changed synonym scope of GO:0003881 from "Related" to "Exact"
* Added synonym "CDP-diacylglycerol-L-serine O-phosphatidyltransferase activity" to GO:0003882
* Added general dbxref EC:2.7.8.8 to synonym CDP-diacylglycerol-L-serine O-phosphatidyltransferase activity of GO:0003882
* Changed synonym scope of GO:0003882 from "Related" to "Exact"
* Added synonym "CDP-diacylglycerol:L-serine 3-O-phosphatidyltransferase activity" to GO:0003882
* Added general dbxref EC:2.7.8.8 to synonym CDP-diacylglycerol:L-serine 3-O-phosphatidyltransferase activity of GO:0003882
* Changed synonym scope of GO:0003882 from "Related" to "Exact"
* Added synonym "CDP-diglyceride-L-serine phosphatidyltransferase activity" to GO:0003882
* Added general dbxref EC:2.7.8.8 to synonym CDP-diglyceride-L-serine phosphatidyltransferase activity of GO:0003882
* Changed synonym scope of GO:0003882 from "Related" to "Exact"
* Added synonym "CDP-diglyceride:serine phosphatidyltransferase activity" to GO:0003882
* Added general dbxref EC:2.7.8.8 to synonym CDP-diglyceride:serine phosphatidyltransferase activity of GO:0003882
* Changed synonym scope of GO:0003882 from "Related" to "Exact"
* Added synonym "CDPdiacylglycerol-serine O-phosphatidyltransferase activity" to GO:0003882
* Added general dbxref EC:2.7.8.8 to synonym CDPdiacylglycerol-serine O-phosphatidyltransferase activity of GO:0003882
* Changed synonym scope of GO:0003882 from "Related" to "Exact"
* Added synonym "CDPdiglyceride-serine O-phosphatidyltransferase activity" to GO:0003882
* Added general dbxref EC:2.7.8.8 to synonym CDPdiglyceride-serine O-phosphatidyltransferase activity of GO:0003882
* Changed synonym scope of GO:0003882 from "Related" to "Exact"
* Added synonym "cytidine 5'-diphospho-1,2-diacyl-sn-glycerol (CDPdiglyceride):L-serine O-phosphatidyltransferase activity" to GO:0003882
* Added general dbxref EC:2.7.8.8 to synonym cytidine 5'-diphospho-1,2-diacyl-sn-glycerol (CDPdiglyceride):L-serine O-phosphatidyltransferase activity of GO:0003882
* Changed synonym scope of GO:0003882 from "Related" to "Exact"
* Added synonym "cytidine 5'-diphospho-1,2-diacyl-sn-glycerol:L-serine O-phosphatidyltransferase activity" to GO:0003882
* Added general dbxref EC:2.7.8.8 to synonym cytidine 5'-diphospho-1,2-diacyl-sn-glycerol:L-serine O-phosphatidyltransferase activity of GO:0003882
* Changed synonym scope of GO:0003882 from "Related" to "Exact"
* Added synonym "cytidine diphosphoglyceride-serine O-phosphatidyltransferase activity" to GO:0003882
* Added general dbxref EC:2.7.8.8 to synonym cytidine diphosphoglyceride-serine O-phosphatidyltransferase activity of GO:0003882
* Changed synonym scope of GO:0003882 from "Related" to "Exact"
* Added synonym "phosphatidylserine synthetase activity" to GO:0003882
* Added general dbxref EC:2.7.8.8 to synonym phosphatidylserine synthetase activity of GO:0003882
* Changed synonym scope of GO:0003882 from "Related" to "Exact"
* Added synonym "PS synthase activity" to GO:0003882
* Added general dbxref EC:2.7.8.8 to synonym PS synthase activity of GO:0003882
* Changed synonym scope of GO:0003882 from "Related" to "Exact"
* Added synonym "cytidine 5'-triphosphate synthetase activity" to GO:0003883
* Added general dbxref EC:6.3.4.2 to synonym cytidine 5'-triphosphate synthetase activity of GO:0003883
* Changed synonym scope of GO:0003883 from "Related" to "Exact"
* Added synonym "cytidine triphosphate synthetase activity" to GO:0003883
* Added general dbxref EC:6.3.4.2 to synonym cytidine triphosphate synthetase activity of GO:0003883
* Changed synonym scope of GO:0003883 from "Related" to "Exact"
* Added synonym "uridine triphosphate aminase activity" to GO:0003883
* Added general dbxref EC:6.3.4.2 to synonym uridine triphosphate aminase activity of GO:0003883
* Changed synonym scope of GO:0003883 from "Related" to "Exact"
* Added synonym "UTP:ammonia ligase (ADP-forming)" to GO:0003883
* Added general dbxref EC:6.3.4.2 to synonym UTP:ammonia ligase (ADP-forming) of GO:0003883
* Changed synonym scope of GO:0003883 from "Related" to "Exact"
* Added synonym "D-amino-acid:oxygen oxidoreductase (deaminating)" to GO:0003884
* Added general dbxref EC:1.4.3.3 to synonym D-amino-acid:oxygen oxidoreductase (deaminating) of GO:0003884
* Changed synonym scope of GO:0003884 from "Related" to "Exact"
* Added synonym "L-amino acid:O2 oxidoreductase activity" to GO:0003884
* Added general dbxref EC:1.4.3.3 to synonym L-amino acid:O2 oxidoreductase activity of GO:0003884
* Changed synonym scope of GO:0003884 from "Related" to "Exact"
* Added synonym "new yellow enzyme" to GO:0003884
* Added general dbxref EC:1.4.3.3 to synonym new yellow enzyme of GO:0003884
* Added synonym "D-arabinono-1,4-lactone:oxygen oxidoreductase activity" to GO:0003885
* Added general dbxref EC:1.1.3.37 to synonym D-arabinono-1,4-lactone:oxygen oxidoreductase activity of GO:0003885
* Changed synonym scope of GO:0003885 from "Related" to "Exact"
* Added synonym "deoxyribocyclobutadipyrimidine pyrimidine-lyase activity" to GO:0003904
* Added general dbxref EC:4.1.99.3 to synonym deoxyribocyclobutadipyrimidine pyrimidine-lyase activity of GO:0003904
* Changed synonym scope of GO:0003904 from "Related" to "Exact"
* Added synonym "deoxyribonucleate pyrimidine dimer lyase (photosensitive)" to GO:0003904
* Added general dbxref EC:4.1.99.3 to synonym deoxyribonucleate pyrimidine dimer lyase (photosensitive) of GO:0003904
* Changed synonym scope of GO:0003904 from "Related" to "Exact"
* Added synonym "deoxyribonucleic cyclobutane dipyrimidine photolyase activity" to GO:0003904
* Added general dbxref EC:4.1.99.3 to synonym deoxyribonucleic cyclobutane dipyrimidine photolyase activity of GO:0003904
* Changed synonym scope of GO:0003904 from "Related" to "Exact"
* Added synonym "deoxyribonucleic photolyase activity" to GO:0003904
* Added general dbxref EC:4.1.99.3 to synonym deoxyribonucleic photolyase activity of GO:0003904
* Changed synonym scope of GO:0003904 from "Related" to "Exact"
* Added synonym "dipyrimidine photolyase (photosensitive)" to GO:0003904
* Added general dbxref EC:4.1.99.3 to synonym dipyrimidine photolyase (photosensitive) of GO:0003904
* Changed synonym scope of GO:0003904 from "Related" to "Exact"
* Added synonym "DNA cyclobutane dipyrimidine photolyase activity" to GO:0003904
* Added general dbxref EC:4.1.99.3 to synonym DNA cyclobutane dipyrimidine photolyase activity of GO:0003904
* Changed synonym scope of GO:0003904 from "Related" to "Exact"
* Added synonym "DNA-photoreactivating enzyme" to GO:0003904
* Added general dbxref EC:4.1.99.3 to synonym DNA-photoreactivating enzyme of GO:0003904
* Added synonym "photolyase activity" to GO:0003904
* Added general dbxref EC:4.1.99.3 to synonym photolyase activity of GO:0003904
* Changed synonym scope of GO:0003904 from "Related" to "Exact"
* Added synonym "phr A photolyase activity" to GO:0003904
* Added general dbxref EC:4.1.99.3 to synonym phr A photolyase activity of GO:0003904
* Changed synonym scope of GO:0003904 from "Related" to "Exact"
* Added synonym "PhrB photolyase activity" to GO:0003904
* Added general dbxref EC:4.1.99.3 to synonym PhrB photolyase activity of GO:0003904
* Changed synonym scope of GO:0003904 from "Related" to "Exact"
* Added synonym "PRE" to GO:0003904
* Added general dbxref EC:4.1.99.3 to synonym PRE of GO:0003904
* Added synonym "3-methyladenine DNA glycosylase II" to GO:0003905
* Added general dbxref EC:3.2.2.21 to synonym 3-methyladenine DNA glycosylase II of GO:0003905
* Added synonym "AlkA" to GO:0003905
* Added general dbxref EC:3.2.2.21 to synonym AlkA of GO:0003905
* Added synonym "alkylated-DNA glycohydrolase (releasing methyladenine and methylguanine)" to GO:0003905
* Added general dbxref EC:3.2.2.21 to synonym alkylated-DNA glycohydrolase (releasing methyladenine and methylguanine) of GO:0003905
* Changed synonym scope of GO:0003905 from "Related" to "Broad"
* Added synonym "deoxyribonucleate 3-methyladenine glycosidase II" to GO:0003905
* Added general dbxref EC:3.2.2.21 to synonym deoxyribonucleate 3-methyladenine glycosidase II of GO:0003905
* Added synonym "DNA-3-methyladenine glycosylase II" to GO:0003905
* Added general dbxref EC:3.2.2.21 to synonym DNA-3-methyladenine glycosylase II of GO:0003905
* Added synonym "AP site-DNA 5'-phosphomonoester-lyase activity" to GO:0003906
* Added general dbxref EC:4.2.99.18 to synonym AP site-DNA 5'-phosphomonoester-lyase activity of GO:0003906
* Changed synonym scope of GO:0003906 from "Related" to "Exact"
* Added synonym "DNA-(apurinic or apyrimidinic site) 5'-phosphomonoester-lyase activity" to GO:0003906
* Added general dbxref EC:4.2.99.18 to synonym DNA-(apurinic or apyrimidinic site) 5'-phosphomonoester-lyase activity of GO:0003906
* Changed synonym scope of GO:0003906 from "Related" to "Exact"
* Added synonym "E. coli endonuclease III" to GO:0003906
* Added general dbxref EC:4.2.99.18 to synonym E. coli endonuclease III of GO:0003906
* Added synonym "micrococcus luteus UV endonuclease" to GO:0003906
* Added general dbxref EC:4.2.99.18 to synonym micrococcus luteus UV endonuclease of GO:0003906
* Changed synonym scope of GO:0003906 from "Related" to "Narrow"
* Added synonym "phage-T4 UV endonuclease" to GO:0003906
* Added general dbxref EC:4.2.99.18 to synonym phage-T4 UV endonuclease of GO:0003906
* Changed synonym scope of GO:0003906 from "Related" to "Broad"
* Added synonym "X-ray endonuclease III" to GO:0003906
* Added general dbxref EC:4.2.99.18 to synonym X-ray endonuclease III of GO:0003906
* Deleted synonym "DNA-6-O-methylguanine:[protein]-L-cysteine S-methyltransferase" from GO:0003908
* Added synonym "DNA-6-O-methylguanine:[protein]-L-cysteine S-methyltransferase activity" to GO:0003908
* Changed synonym scope of GO:0003908 from "Related" to "Exact"
* Added synonym "DNA-6-O-methylguanine:protein-L-cysteine S-methyltransferase activity" to GO:0003908
* Added general dbxref EC:2.1.1.63 to synonym DNA-6-O-methylguanine:protein-L-cysteine S-methyltransferase activity of GO:0003908
* Changed synonym scope of GO:0003908 from "Related" to "Exact"
* Added synonym "methylated-DNA-protein-cysteine S-methyltransferase activity" to GO:0003908
* Added general dbxref EC:2.1.1.63 to synonym methylated-DNA-protein-cysteine S-methyltransferase activity of GO:0003908
* Changed synonym scope of GO:0003908 from "Related" to "Exact"
* Added synonym "deoxyribonucleate ligase" to GO:0003910
* Added general dbxref EC:6.5.1.1 to synonym deoxyribonucleate ligase of GO:0003910
* Changed synonym scope of GO:0003910 from "Related" to "Broad"
* Added synonym "deoxyribonucleic acid joinase" to GO:0003910
* Added general dbxref EC:6.5.1.1 to synonym deoxyribonucleic acid joinase of GO:0003910
* Changed synonym scope of GO:0003910 from "Related" to "Broad"
* Added synonym "deoxyribonucleic acid ligase" to GO:0003910
* Added general dbxref EC:6.5.1.1 to synonym deoxyribonucleic acid ligase of GO:0003910
* Changed synonym scope of GO:0003910 from "Related" to "Broad"
* Added synonym "deoxyribonucleic acid repair enzyme" to GO:0003910
* Added general dbxref EC:6.5.1.1 to synonym deoxyribonucleic acid repair enzyme of GO:0003910
* Added synonym "deoxyribonucleic acid-joining enzyme" to GO:0003910
* Added general dbxref EC:6.5.1.1 to synonym deoxyribonucleic acid-joining enzyme of GO:0003910
* Added synonym "deoxyribonucleic joinase" to GO:0003910
* Added general dbxref EC:6.5.1.1 to synonym deoxyribonucleic joinase of GO:0003910
* Changed synonym scope of GO:0003910 from "Related" to "Broad"
* Added synonym "deoxyribonucleic ligase" to GO:0003910
* Added general dbxref EC:6.5.1.1 to synonym deoxyribonucleic ligase of GO:0003910
* Changed synonym scope of GO:0003910 from "Related" to "Broad"
* Added synonym "deoxyribonucleic repair enzyme" to GO:0003910
* Added general dbxref EC:6.5.1.1 to synonym deoxyribonucleic repair enzyme of GO:0003910
* Added synonym "deoxyribonucleic-joining enzyme" to GO:0003910
* Added general dbxref EC:6.5.1.1 to synonym deoxyribonucleic-joining enzyme of GO:0003910
* Added synonym "DNA-joining enzyme" to GO:0003910
* Added general dbxref EC:6.5.1.1 to synonym DNA-joining enzyme of GO:0003910
* Added synonym "poly(deoxyribonucleotide):poly(deoxyribonucleotide) ligase (AMP-forming)" to GO:0003910
* Added general dbxref EC:6.5.1.1 to synonym poly(deoxyribonucleotide):poly(deoxyribonucleotide) ligase (AMP-forming) of GO:0003910
* Changed synonym scope of GO:0003910 from "Related" to "Exact"
* Added synonym "polynucleotide ligase" to GO:0003910
* Added general dbxref EC:6.5.1.1 to synonym polynucleotide ligase of GO:0003910
* Changed synonym scope of GO:0003910 from "Related" to "Broad"
* Added synonym "deoxyribonucleate ligase" to GO:0003911
* Added general dbxref EC:6.5.1.2 to synonym deoxyribonucleate ligase of GO:0003911
* Changed synonym scope of GO:0003911 from "Related" to "Broad"
* Added synonym "deoxyribonucleic acid joinase" to GO:0003911
* Added general dbxref EC:6.5.1.2 to synonym deoxyribonucleic acid joinase of GO:0003911
* Changed synonym scope of GO:0003911 from "Related" to "Broad"
* Added synonym "deoxyribonucleic acid ligase" to GO:0003911
* Added general dbxref EC:6.5.1.2 to synonym deoxyribonucleic acid ligase of GO:0003911
* Changed synonym scope of GO:0003911 from "Related" to "Broad"
* Added synonym "deoxyribonucleic joinase" to GO:0003911
* Added general dbxref EC:6.5.1.2 to synonym deoxyribonucleic joinase of GO:0003911
* Changed synonym scope of GO:0003911 from "Related" to "Broad"
* Added synonym "deoxyribonucleic ligase" to GO:0003911
* Added general dbxref EC:6.5.1.2 to synonym deoxyribonucleic ligase of GO:0003911
* Changed synonym scope of GO:0003911 from "Related" to "Broad"
* Added synonym "deoxyribonucleic repair enzyme" to GO:0003911
* Added general dbxref EC:6.5.1.2 to synonym deoxyribonucleic repair enzyme of GO:0003911
* Added synonym "deoxyribonucleic-joining enzyme" to GO:0003911
* Added general dbxref EC:6.5.1.2 to synonym deoxyribonucleic-joining enzyme of GO:0003911
* Added synonym "DNA ligase (NAD)" to GO:0003911
* Added general dbxref EC:6.5.1.2 to synonym DNA ligase (NAD) of GO:0003911
* Changed synonym scope of GO:0003911 from "Related" to "Exact"
* Added synonym "DNA-joining enzyme" to GO:0003911
* Added general dbxref EC:6.5.1.2 to synonym DNA-joining enzyme of GO:0003911
* Added synonym "poly(deoxyribonucleotide):poly(deoxyribonucleotide) ligase (AMP-forming, NMN-forming)" to GO:0003911
* Added general dbxref EC:6.5.1.2 to synonym poly(deoxyribonucleotide):poly(deoxyribonucleotide) ligase (AMP-forming, NMN-forming) of GO:0003911
* Changed synonym scope of GO:0003911 from "Related" to "Exact"
* Added synonym "polydeoxyribonucleotide synthase (NAD)" to GO:0003911
* Added general dbxref EC:6.5.1.2 to synonym polydeoxyribonucleotide synthase (NAD) of GO:0003911
* Changed synonym scope of GO:0003911 from "Related" to "Exact"
* Added synonym "polynucleotide ligase" to GO:0003911
* Added general dbxref EC:6.5.1.2 to synonym polynucleotide ligase of GO:0003911
* Changed synonym scope of GO:0003911 from "Related" to "Broad"
* Added synonym "polynucleotide ligase (NAD)" to GO:0003911
* Added general dbxref EC:6.5.1.2 to synonym polynucleotide ligase (NAD) of GO:0003911
* Changed synonym scope of GO:0003911 from "Related" to "Exact"
* Added synonym "polynucleotide ligase (nicotinamide adenine dinucleotide)" to GO:0003911
* Added general dbxref EC:6.5.1.2 to synonym polynucleotide ligase (nicotinamide adenine dinucleotide) of GO:0003911
* Changed synonym scope of GO:0003911 from "Related" to "Exact"
* Added synonym "polynucleotide synthetase (nicotinamide adenine dinucleotide)" to GO:0003911
* Added general dbxref EC:6.5.1.2 to synonym polynucleotide synthetase (nicotinamide adenine dinucleotide) of GO:0003911
* Changed synonym scope of GO:0003911 from "Related" to "Exact"
* Added synonym "polynucleotide synthetase activity" to GO:0003911
* Added general dbxref EC:6.5.1.2 to synonym polynucleotide synthetase activity of GO:0003911
* Changed synonym scope of GO:0003911 from "Related" to "Exact"
* Added synonym "addase activity" to GO:0003912
* Added general dbxref EC:2.7.7.31 to synonym addase activity of GO:0003912
* Changed synonym scope of GO:0003912 from "Related" to "Exact"
* Added synonym "deoxynucleotidyl terminal transferase activity" to GO:0003912
* Added general dbxref EC:2.7.7.31 to synonym deoxynucleotidyl terminal transferase activity of GO:0003912
* Changed synonym scope of GO:0003912 from "Related" to "Exact"
* Added synonym "deoxyribonucleic acid nucleotidyltransferase activity" to GO:0003912
* Added general dbxref EC:2.7.7.31 to synonym deoxyribonucleic acid nucleotidyltransferase activity of GO:0003912
* Changed synonym scope of GO:0003912 from "Related" to "Exact"
* Added synonym "deoxyribonucleic nucleotidyltransferase activity" to GO:0003912
* Added general dbxref EC:2.7.7.31 to synonym deoxyribonucleic nucleotidyltransferase activity of GO:0003912
* Changed synonym scope of GO:0003912 from "Related" to "Exact"
* Added synonym "nucleoside-triphosphate:DNA deoxynucleotidylexotransferase activity" to GO:0003912
* Added general dbxref EC:2.7.7.31 to synonym nucleoside-triphosphate:DNA deoxynucleotidylexotransferase activity of GO:0003912
* Changed synonym scope of GO:0003912 from "Related" to "Exact"
* Added synonym "TdT" to GO:0003912
* Added general dbxref EC:2.7.7.31 to synonym TdT of GO:0003912
* Added synonym "terminal deoxynucleotide transferase activity" to GO:0003912
* Added general dbxref EC:2.7.7.31 to synonym terminal deoxynucleotide transferase activity of GO:0003912
* Changed synonym scope of GO:0003912 from "Related" to "Exact"
* Added synonym "deoxyribonucleate topoisomerase" to GO:0003917
* Added general dbxref EC:5.99.1.2 to synonym deoxyribonucleate topoisomerase of GO:0003917
* Changed synonym scope of GO:0003917 from "Related" to "Broad"
* Added synonym "topoisomerase" to GO:0003917
* Added general dbxref EC:5.99.1.2 to synonym topoisomerase of GO:0003917
* Changed synonym scope of GO:0003917 from "Related" to "Broad"
* Added synonym "deoxyribonucleate topoisomerase" to GO:0003918
* Added general dbxref EC:5.99.1.3 to synonym deoxyribonucleate topoisomerase of GO:0003918
* Changed synonym scope of GO:0003918 from "Related" to "Broad"
* Added synonym "deoxyribonucleic topoisomerase activity" to GO:0003918
* Added general dbxref EC:5.99.1.3 to synonym deoxyribonucleic topoisomerase activity of GO:0003918
* Changed synonym scope of GO:0003918 from "Related" to "Exact"
* Added synonym "DNA topoisomerase (ATP-hydrolysing)" to GO:0003918
* Added general dbxref EC:5.99.1.3 to synonym DNA topoisomerase (ATP-hydrolysing) of GO:0003918
* Changed synonym scope of GO:0003918 from "Related" to "Broad"
* Added synonym "DNA topoisomerase II" to GO:0003918
* Added general dbxref EC:5.99.1.3 to synonym DNA topoisomerase II of GO:0003918
* Added synonym "DNA-gyrase activity" to GO:0003918
* Added general dbxref EC:5.99.1.3 to synonym DNA-gyrase activity of GO:0003918
* Changed synonym scope of GO:0003918 from "Related" to "Exact"
* Added synonym "topoisomerase" to GO:0003918
* Added general dbxref EC:5.99.1.3 to synonym topoisomerase of GO:0003918
* Changed synonym scope of GO:0003918 from "Related" to "Broad"
* Added synonym "adenosine triphosphate-riboflavin mononucleotide transadenylase activity" to GO:0003919
* Added general dbxref EC:2.7.7.2 to synonym adenosine triphosphate-riboflavin mononucleotide transadenylase activity of GO:0003919
* Changed synonym scope of GO:0003919 from "Related" to "Exact"
* Added synonym "adenosine triphosphate-riboflavine mononucleotide transadenylase activity" to GO:0003919
* Added general dbxref EC:2.7.7.2 to synonym adenosine triphosphate-riboflavine mononucleotide transadenylase activity of GO:0003919
* Changed synonym scope of GO:0003919 from "Related" to "Exact"
* Added synonym "riboflavin adenine dinucleotide pyrophosphorylase activity" to GO:0003919
* Added general dbxref EC:2.7.7.2 to synonym riboflavin adenine dinucleotide pyrophosphorylase activity of GO:0003919
* Changed synonym scope of GO:0003919 from "Related" to "Exact"
* Added synonym "riboflavin mononucleotide adenylyltransferase activity" to GO:0003919
* Added general dbxref EC:2.7.7.2 to synonym riboflavin mononucleotide adenylyltransferase activity of GO:0003919
* Changed synonym scope of GO:0003919 from "Related" to "Exact"
* Added synonym "riboflavine adenine dinucleotide adenylyltransferase activity" to GO:0003919
* Added general dbxref EC:2.7.7.2 to synonym riboflavine adenine dinucleotide adenylyltransferase activity of GO:0003919
* Changed synonym scope of GO:0003919 from "Related" to "Exact"
* Added synonym "inosine-5'-phosphate:NADP+ oxidoreductase (aminating)" to GO:0003920
* Added general dbxref EC:1.7.1.7 to synonym inosine-5'-phosphate:NADP+ oxidoreductase (aminating) of GO:0003920
* Changed synonym scope of GO:0003920 from "Related" to "Exact"
* Added synonym "NADPH2:guanosine-5'-phosphate oxidoreductase (deaminating)" to GO:0003920
* Added general dbxref EC:1.7.1.7 to synonym NADPH2:guanosine-5'-phosphate oxidoreductase (deaminating) of GO:0003920
* Changed synonym scope of GO:0003920 from "Related" to "Exact"
* Added synonym "guanylate synthetase activity" to GO:0003921
* Added general dbxref EC:6.3.4.1 to synonym guanylate synthetase activity of GO:0003921
* Changed synonym scope of GO:0003921 from "Related" to "Exact"
* Added synonym "xanthosine 5'-monophosphate aminase activity" to GO:0003921
* Added general dbxref EC:6.3.4.1 to synonym xanthosine 5'-monophosphate aminase activity of GO:0003921
* Changed synonym scope of GO:0003921 from "Related" to "Exact"
* Added synonym "xanthosine-5'-phosphate-ammonia ligase activity" to GO:0003921
* Added general dbxref EC:6.3.4.1 to synonym xanthosine-5'-phosphate-ammonia ligase activity of GO:0003921
* Changed synonym scope of GO:0003921 from "Related" to "Exact"
* Added synonym "xanthosine-5'-phosphate:ammonia ligase (AMP-forming)" to GO:0003921
* Added general dbxref EC:6.3.4.1 to synonym xanthosine-5'-phosphate:ammonia ligase (AMP-forming) of GO:0003921
* Changed synonym scope of GO:0003921 from "Related" to "Exact"
* Added synonym "GMP synthase (glutamine-hydrolysing)" to GO:0003922
* Added general dbxref EC:6.3.5.2 to synonym GMP synthase (glutamine-hydrolysing) of GO:0003922
* Changed synonym scope of GO:0003922 from "Related" to "Exact"
* Added synonym "GMP synthetase (glutamine-hydrolysing)" to GO:0003922
* Added general dbxref EC:6.3.5.2 to synonym GMP synthetase (glutamine-hydrolysing) of GO:0003922
* Changed synonym scope of GO:0003922 from "Related" to "Exact"
* Added synonym "guanosine 5'-monophosphate synthetase activity" to GO:0003922
* Added general dbxref EC:6.3.5.2 to synonym guanosine 5'-monophosphate synthetase activity of GO:0003922
* Changed synonym scope of GO:0003922 from "Related" to "Exact"
* Added synonym "guanosine monophosphate synthetase (glutamine-hydrolyzing)" to GO:0003922
* Added general dbxref EC:6.3.5.2 to synonym guanosine monophosphate synthetase (glutamine-hydrolyzing) of GO:0003922
* Changed synonym scope of GO:0003922 from "Related" to "Exact"
* Added synonym "guanylate synthetase (glutamine-hydrolyzing)" to GO:0003922
* Added general dbxref EC:6.3.5.2 to synonym guanylate synthetase (glutamine-hydrolyzing) of GO:0003922
* Changed synonym scope of GO:0003922 from "Related" to "Exact"
* Added synonym "xanthosine 5'-phosphate amidotransferase activity" to GO:0003922
* Added general dbxref EC:6.3.5.2 to synonym xanthosine 5'-phosphate amidotransferase activity of GO:0003922
* Changed synonym scope of GO:0003922 from "Related" to "Exact"
* Added synonym "xanthosine-5'-phosphate:L-glutamine amido-ligase (AMP-forming)" to GO:0003922
* Added general dbxref EC:6.3.5.2 to synonym xanthosine-5'-phosphate:L-glutamine amido-ligase (AMP-forming) of GO:0003922
* Changed synonym scope of GO:0003922 from "Related" to "Exact"
* Added synonym "dihydroneopterin triphosphate synthase activity" to GO:0003934
* Added general dbxref EC:3.5.4.16 to synonym dihydroneopterin triphosphate synthase activity of GO:0003934
* Changed synonym scope of GO:0003934 from "Related" to "Exact"
* Added synonym "GTP 7,8-8,9-dihydrolase activity" to GO:0003934
* Added general dbxref EC:3.5.4.16 to synonym GTP 7,8-8,9-dihydrolase activity of GO:0003934
* Changed synonym scope of GO:0003934 from "Related" to "Exact"
* Added synonym "GTP 8-formylhydrolase activity" to GO:0003934
* Added general dbxref EC:3.5.4.16 to synonym GTP 8-formylhydrolase activity of GO:0003934
* Changed synonym scope of GO:0003934 from "Related" to "Exact"
* Added synonym "guanosine triphosphate 8-deformylase activity" to GO:0003934
* Added general dbxref EC:3.5.4.16 to synonym guanosine triphosphate 8-deformylase activity of GO:0003934
* Changed synonym scope of GO:0003934 from "Related" to "Exact"
* Added synonym "guanosine triphosphate cyclohydrolase activity" to GO:0003934
* Added general dbxref EC:3.5.4.16 to synonym guanosine triphosphate cyclohydrolase activity of GO:0003934
* Changed synonym scope of GO:0003934 from "Related" to "Exact"
* Added synonym "GTP 7,8-8,9-dihydrolase (diphosphate-forming)" to GO:0003935
* Added general dbxref EC:3.5.4.25 to synonym GTP 7,8-8,9-dihydrolase (diphosphate-forming) of GO:0003935
* Changed synonym scope of GO:0003935 from "Related" to "Exact"
* Added synonym "GTP-8-formylhydrolase activity" to GO:0003935
* Added general dbxref EC:3.5.4.25 to synonym GTP-8-formylhydrolase activity of GO:0003935
* Changed synonym scope of GO:0003935 from "Related" to "Exact"
* Added synonym "guanosine triphosphate cyclohydrolase II" to GO:0003935
* Added general dbxref EC:3.5.4.25 to synonym guanosine triphosphate cyclohydrolase II of GO:0003935
* Deleted synonym "proton-transporting two-sector ATPase" from GO:0003936
* Added synonym "proton-transporting two-sector ATPase activity" to GO:0003936
* Changed synonym scope of GO:0003936 from "Related" to "Exact"
* Added synonym "IMP 1,2-hydrolase (decyclizing)" to GO:0003937
* Added general dbxref EC:3.5.4.10 to synonym IMP 1,2-hydrolase (decyclizing) of GO:0003937
* Changed synonym scope of GO:0003937 from "Related" to "Exact"
* Added synonym "inosinate cyclohydrolase activity" to GO:0003937
* Added general dbxref EC:3.5.4.10 to synonym inosinate cyclohydrolase activity of GO:0003937
* Changed synonym scope of GO:0003937 from "Related" to "Exact"
* Added synonym "IMP:NAD+ oxidoreductase activity" to GO:0003938
* Added general dbxref EC:1.1.1.205 to synonym IMP:NAD+ oxidoreductase activity of GO:0003938
* Changed synonym scope of GO:0003938 from "Related" to "Exact"
* Added synonym "inosine monophosphate dehydrogenase activity" to GO:0003938
* Added general dbxref EC:1.1.1.205 to synonym inosine monophosphate dehydrogenase activity of GO:0003938
* Changed synonym scope of GO:0003938 from "Related" to "Exact"
* Added synonym "inosine-5'-phosphate dehydrogenase activity" to GO:0003938
* Added general dbxref EC:1.1.1.205 to synonym inosine-5'-phosphate dehydrogenase activity of GO:0003938
* Changed synonym scope of GO:0003938 from "Related" to "Exact"
* Added synonym "alpha-L-iduronidase activity" to GO:0003940
* Added general dbxref EC:3.2.1.76 to synonym alpha-L-iduronidase activity of GO:0003940
* Changed synonym scope of GO:0003940 from "Related" to "Exact"
* Added synonym "glycosaminoglycan alpha-L-iduronohydrolase activity" to GO:0003940
* Added general dbxref EC:3.2.1.76 to synonym glycosaminoglycan alpha-L-iduronohydrolase activity of GO:0003940
* Changed synonym scope of GO:0003940 from "Related" to "Exact"
* Changed synonym scope of GO:0003942 from "Exact" to "Broad"
* Added synonym "N-acetyl-L-glutamate gamma-semialdehyde:NADP oxidoreductase (phosphorylating)" to GO:0003942
* Added general dbxref EC:1.2.1.38 to synonym N-acetyl-L-glutamate gamma-semialdehyde:NADP oxidoreductase (phosphorylating) of GO:0003942
* Changed synonym scope of GO:0003942 from "Related" to "Exact"
* Added synonym "N-acetyl-L-glutamate-5-semialdehyde:NADP+ 5-oxidoreductase (phosphorylating)" to GO:0003942
* Added general dbxref EC:1.2.1.38 to synonym N-acetyl-L-glutamate-5-semialdehyde:NADP+ 5-oxidoreductase (phosphorylating) of GO:0003942
* Changed synonym scope of GO:0003942 from "Related" to "Exact"
* Added synonym "N-acetylglutamate 5-semialdehyde dehydrogenase activity" to GO:0003942
* Added general dbxref EC:1.2.1.38 to synonym N-acetylglutamate 5-semialdehyde dehydrogenase activity of GO:0003942
* Changed synonym scope of GO:0003942 from "Related" to "Exact"
* Added synonym "N-acetylglutamic gamma-semialdehyde dehydrogenase activity" to GO:0003942
* Added general dbxref EC:1.2.1.38 to synonym N-acetylglutamic gamma-semialdehyde dehydrogenase activity of GO:0003942
* Changed synonym scope of GO:0003942 from "Related" to "Exact"
* Added synonym "reductase, acetyl-gamma-glutamyl phosphate" to GO:0003942
* Added general dbxref EC:1.2.1.38 to synonym reductase, acetyl-gamma-glutamyl phosphate of GO:0003942
* Changed synonym scope of GO:0003942 from "Related" to "Exact"
* Added synonym "acetylgalactosamine 4-sulfatase activity" to GO:0003943
* Added general dbxref EC:3.1.6.12 to synonym acetylgalactosamine 4-sulfatase activity of GO:0003943
* Changed synonym scope of GO:0003943 from "Related" to "Exact"
* Added synonym "chondroitinsulfatase" to GO:0003943
* Added general dbxref EC:3.1.6.12 to synonym chondroitinsulfatase of GO:0003943
* Changed synonym scope of GO:0003943 from "Related" to "Broad"
* Added synonym "N-acetyl-D-galactosamine-4-sulfate 4-sulfohydrolase activity" to GO:0003943
* Added general dbxref EC:3.1.6.12 to synonym N-acetyl-D-galactosamine-4-sulfate 4-sulfohydrolase activity of GO:0003943
* Changed synonym scope of GO:0003943 from "Related" to "Exact"
* Added synonym "N-acetylgalactosamine 4-sulfate sulfohydrolase activity" to GO:0003943
* Added general dbxref EC:3.1.6.12 to synonym N-acetylgalactosamine 4-sulfate sulfohydrolase activity of GO:0003943
* Changed synonym scope of GO:0003943 from "Related" to "Exact"
* Added synonym "2-acetamido-2-deoxy-alpha-D-glucose 1-phosphodiester acetamidodeoxyglucohydrolase activity" to GO:0003944
* Added general dbxref EC:3.1.4.45 to synonym 2-acetamido-2-deoxy-alpha-D-glucose 1-phosphodiester acetamidodeoxyglucohydrolase activity of GO:0003944
* Changed synonym scope of GO:0003944 from "Related" to "Exact"
* Added synonym "alpha-N-acetyl-D-glucosamine-1-phosphodiester N-acetylglucosaminidase activity" to GO:0003944
* Added general dbxref EC:3.1.4.45 to synonym alpha-N-acetyl-D-glucosamine-1-phosphodiester N-acetylglucosaminidase activity of GO:0003944
* Changed synonym scope of GO:0003944 from "Related" to "Exact"
* Added synonym "glycoprotein-N-acetyl-D-glucosaminyl-phospho-D-mannose N-acetyl-D-glucosaminylphosphohydrolase activity" to GO:0003944
* Added general dbxref EC:3.1.4.45 to synonym glycoprotein-N-acetyl-D-glucosaminyl-phospho-D-mannose N-acetyl-D-glucosaminylphosphohydrolase activity of GO:0003944
* Changed synonym scope of GO:0003944 from "Related" to "Exact"
* Added synonym "phosphodiester glycosidase activity" to GO:0003944
* Added general dbxref EC:3.1.4.45 to synonym phosphodiester glycosidase activity of GO:0003944
* Changed synonym scope of GO:0003944 from "Related" to "Exact"
* Deleted synonym "UDP-galactose:N-acetyl-D-glucosamine 4-beta-D-galactosyltransferase" from GO:0003945
* Added synonym "beta-1,4-galactosyltransferase activity" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym beta-1,4-galactosyltransferase activity of GO:0003945
* Changed synonym scope of GO:0003945 from "Related" to "Exact"
* Added synonym "beta-N-acetylglucosaminide beta1-4-galactosyltransferase activity" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym beta-N-acetylglucosaminide beta1-4-galactosyltransferase activity of GO:0003945
* Changed synonym scope of GO:0003945 from "Related" to "Exact"
* Added synonym "beta1-4-galactosyltransferase activity" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym beta1-4-galactosyltransferase activity of GO:0003945
* Changed synonym scope of GO:0003945 from "Related" to "Exact"
* Added synonym "beta1-4GalT" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym beta1-4GalT of GO:0003945
* Added synonym "Gal-T" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym Gal-T of GO:0003945
* Added synonym "lactosamine synthase activity" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym lactosamine synthase activity of GO:0003945
* Changed synonym scope of GO:0003945 from "Related" to "Exact"
* Added synonym "lactosamine synthetase activity" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym lactosamine synthetase activity of GO:0003945
* Changed synonym scope of GO:0003945 from "Related" to "Exact"
* Added synonym "lactose synthetase A protein" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym lactose synthetase A protein of GO:0003945
* Added synonym "N-acetylglucosamine (beta1,4)galactosyltransferase activity" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym N-acetylglucosamine (beta1,4)galactosyltransferase activity of GO:0003945
* Changed synonym scope of GO:0003945 from "Related" to "Exact"
* Added synonym "N-acetyllactosamine synthetase activity" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym N-acetyllactosamine synthetase activity of GO:0003945
* Changed synonym scope of GO:0003945 from "Related" to "Exact"
* Added synonym "UDP-beta-1,4-galactosyltransferase activity" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym UDP-beta-1,4-galactosyltransferase activity of GO:0003945
* Changed synonym scope of GO:0003945 from "Related" to "Exact"
* Added synonym "UDP-Gal:N-acetylglucosamine beta1-4-galactosyltransferase activity" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym UDP-Gal:N-acetylglucosamine beta1-4-galactosyltransferase activity of GO:0003945
* Changed synonym scope of GO:0003945 from "Related" to "Exact"
* Added synonym "UDP-galactose N-acetylglucosamine beta-4-galactosyltransferase activity" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym UDP-galactose N-acetylglucosamine beta-4-galactosyltransferase activity of GO:0003945
* Changed synonym scope of GO:0003945 from "Related" to "Exact"
* Added synonym "UDP-galactose-acetylglucosamine galactosyltransferase activity" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym UDP-galactose-acetylglucosamine galactosyltransferase activity of GO:0003945
* Changed synonym scope of GO:0003945 from "Related" to "Exact"
* Added synonym "UDP-galactose-N-acetylglucosamine beta-1,4-galactosyltransferase activity" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym UDP-galactose-N-acetylglucosamine beta-1,4-galactosyltransferase activity of GO:0003945
* Changed synonym scope of GO:0003945 from "Related" to "Exact"
* Added synonym "UDP-galactose-N-acetylglucosamine galactosyltransferase activity" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym UDP-galactose-N-acetylglucosamine galactosyltransferase activity of GO:0003945
* Changed synonym scope of GO:0003945 from "Related" to "Exact"
* Added synonym "UDP-galactose:N-acetyl-D-glucosamine 4-beta-D-galactosyltransferase activity" to GO:0003945
* Changed synonym scope of GO:0003945 from "Related" to "Exact"
* Added synonym "UDP-galactose:N-acetylglucosaminide beta1-4-galactosyltransferase activity" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym UDP-galactose:N-acetylglucosaminide beta1-4-galactosyltransferase activity of GO:0003945
* Changed synonym scope of GO:0003945 from "Related" to "Exact"
* Added synonym "UDPgalactose-N-acetylglucosamine beta-D-galactosyltransferase activity" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym UDPgalactose-N-acetylglucosamine beta-D-galactosyltransferase activity of GO:0003945
* Changed synonym scope of GO:0003945 from "Related" to "Exact"
* Added synonym "UDPgalactose:N-acetyl-D-glucosamine 4-beta-D-galactosyltransferase activity" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym UDPgalactose:N-acetyl-D-glucosamine 4-beta-D-galactosyltransferase activity of GO:0003945
* Changed synonym scope of GO:0003945 from "Related" to "Exact"
* Added synonym "UDPgalactose:N-acetylglucosaminyl(beta1-4)galactosyltransferase activity" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym UDPgalactose:N-acetylglucosaminyl(beta1-4)galactosyltransferase activity of GO:0003945
* Changed synonym scope of GO:0003945 from "Related" to "Exact"
* Added synonym "uridine diphosphogalactose-acetylglucosamine galactosyltransferase activity" to GO:0003945
* Added general dbxref EC:2.4.1.90 to synonym uridine diphosphogalactose-acetylglucosamine galactosyltransferase activity of GO:0003945
* Changed synonym scope of GO:0003945 from "Related" to "Exact"
* Added synonym "UDP-N-acetyl-D-galactosamine:(N-acetylneuraminyl)-D-galactosyl-D-glucosylceramide N-acetyl-D-galactosaminyltransferase activity" to GO:0003947
* Added general dbxref EC:2.4.1.92 to synonym UDP-N-acetyl-D-galactosamine:(N-acetylneuraminyl)-D-galactosyl-D-glucosylceramide N-acetyl-D-galactosaminyltransferase activity of GO:0003947
* Changed synonym scope of GO:0003947 from "Related" to "Exact"
* Added synonym "UDP-N-acetyl-D-galactosamine:1-O-[O-(N-acetyl-alpha-neuraminosyl)-(2right3)-O-beta-D-galactopyranosyl-(1right4)-beta-D-glucopyranosyl]-ceramide 1,4-beta-N-acetyl-D-galactosaminyltransferase activity" to GO:0003947
* Added general dbxref EC:2.4.1.92 to synonym UDP-N-acetyl-D-galactosamine:1-O-[O-(N-acetyl-alpha-neuraminosyl)-(2right3)-O-beta-D-galactopyranosyl-(1right4)-beta-D-glucopyranosyl]-ceramide 1,4-beta-N-acetyl-D-galactosaminyltransferase activity of GO:0003947
* Changed synonym scope of GO:0003947 from "Related" to "Exact"
* Added synonym "4-N-(beta-N-acetyl-D-glucosaminyl)-L-asparagine amidohydrolase activity" to GO:0003948
* Added general dbxref EC:3.5.1.26 to synonym 4-N-(beta-N-acetyl-D-glucosaminyl)-L-asparagine amidohydrolase activity of GO:0003948
* Changed synonym scope of GO:0003948 from "Related" to "Exact"
* Added synonym "N4-(beta-N-acetyl-D-glucosaminyl)-L-asparagine amidohydrolase activity" to GO:0003948
* Added general dbxref EC:3.5.1.26 to synonym N4-(beta-N-acetyl-D-glucosaminyl)-L-asparagine amidohydrolase activity of GO:0003948
* Changed synonym scope of GO:0003948 from "Related" to "Exact"
* Added synonym "1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide aldose-ketose-isomerase activity" to GO:0003949
* Added general dbxref EC:5.3.1.16 to synonym 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide aldose-ketose-isomerase activity of GO:0003949
* Changed synonym scope of GO:0003949 from "Related" to "Exact"
* Added synonym "1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide ketol-isomerase activity" to GO:0003949
* Added general dbxref EC:5.3.1.16 to synonym 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide ketol-isomerase activity of GO:0003949
* Changed synonym scope of GO:0003949 from "Related" to "Exact"
* Added synonym "N-(phosphoribosylformimino) aminophosphoribosylimidazolecarboxamide isomerase activity" to GO:0003949
* Added general dbxref EC:5.3.1.16 to synonym N-(phosphoribosylformimino) aminophosphoribosylimidazolecarboxamide isomerase activity of GO:0003949
* Changed synonym scope of GO:0003949 from "Related" to "Exact"
* Added synonym "phosphoribosylformiminoaminophosphoribosylimidazolecarboxamide isomerase activity" to GO:0003949
* Added general dbxref EC:5.3.1.16 to synonym phosphoribosylformiminoaminophosphoribosylimidazolecarboxamide isomerase activity of GO:0003949
* Changed synonym scope of GO:0003949 from "Related" to "Exact"
* Added synonym "NAD+:poly(adenine-diphosphate-D-ribosyl)-acceptor ADP-D-ribosyl-transferase activity" to GO:0003950
* Added general dbxref EC:2.4.2.30 to synonym NAD+:poly(adenine-diphosphate-D-ribosyl)-acceptor ADP-D-ribosyl-transferase activity of GO:0003950
* Changed synonym scope of GO:0003950 from "Related" to "Exact"
* Added synonym "poly(ADP-ribose) synthase activity" to GO:0003950
* Added general dbxref EC:2.4.2.30 to synonym poly(ADP-ribose) synthase activity of GO:0003950
* Changed synonym scope of GO:0003950 from "Related" to "Exact"
* Added synonym "ATP:NAD+ 2'-phosphotransferase activity" to GO:0003951
* Added general dbxref EC:2.7.1.23 to synonym ATP:NAD+ 2'-phosphotransferase activity of GO:0003951
* Changed synonym scope of GO:0003951 from "Related" to "Exact"
* Added synonym "NADK" to GO:0003951
* Added general dbxref EC:2.7.1.23 to synonym NADK of GO:0003951
* Added synonym "nicotinamide adenine dinucleotide kinase (phosphorylating)" to GO:0003951
* Added general dbxref EC:2.7.1.23 to synonym nicotinamide adenine dinucleotide kinase (phosphorylating) of GO:0003951
* Changed synonym scope of GO:0003951 from "Related" to "Exact"
* Added synonym "nicotinamide adenine dinucleotide kinase activity" to GO:0003951
* Added general dbxref EC:2.7.1.23 to synonym nicotinamide adenine dinucleotide kinase activity of GO:0003951
* Changed synonym scope of GO:0003951 from "Related" to "Exact"
* Added synonym "deamido-NAD+:L-glutamine amido-ligase (AMP-forming)" to GO:0003952
* Added general dbxref EC:6.3.5.1 to synonym deamido-NAD+:L-glutamine amido-ligase (AMP-forming) of GO:0003952
* Changed synonym scope of GO:0003952 from "Related" to "Exact"
* Added synonym "desamidonicotinamide adenine dinucleotide amidotransferase activity" to GO:0003952
* Added general dbxref EC:6.3.5.1 to synonym desamidonicotinamide adenine dinucleotide amidotransferase activity of GO:0003952
* Changed synonym scope of GO:0003952 from "Related" to "Exact"
* Added synonym "DPN synthetase activity" to GO:0003952
* Added general dbxref EC:6.3.5.1 to synonym DPN synthetase activity of GO:0003952
* Changed synonym scope of GO:0003952 from "Related" to "Exact"
* Added synonym "NAD synthetase (glutamine-hydrolysing)" to GO:0003952
* Added general dbxref EC:6.3.5.1 to synonym NAD synthetase (glutamine-hydrolysing) of GO:0003952
* Changed synonym scope of GO:0003952 from "Related" to "Exact"
* Added synonym "NAD+ synthase (glutamine-hydrolysing)" to GO:0003952
* Added general dbxref EC:6.3.5.1 to synonym NAD+ synthase (glutamine-hydrolysing) of GO:0003952
* Changed synonym scope of GO:0003952 from "Related" to "Exact"
* Added synonym "NAD+ synthetase (glutamine-hydrolyzing)" to GO:0003952
* Added general dbxref EC:6.3.5.1 to synonym NAD+ synthetase (glutamine-hydrolyzing) of GO:0003952
* Changed synonym scope of GO:0003952 from "Related" to "Exact"
* Added synonym "NAD hydrolase activity" to GO:0003953
* Added general dbxref EC:3.2.2.5 to synonym NAD hydrolase activity of GO:0003953
* Changed synonym scope of GO:0003953 from "Related" to "Exact"
* Added synonym "NAD+ glycohydrolase activity" to GO:0003953
* Added general dbxref EC:3.2.2.5 to synonym NAD+ glycohydrolase activity of GO:0003953
* Changed synonym scope of GO:0003953 from "Related" to "Exact"
* Added synonym "diphosphopyridine diaphorase activity" to GO:0003954
* Added general dbxref EC:1.6.99.3 to synonym diphosphopyridine diaphorase activity of GO:0003954
* Changed synonym scope of GO:0003954 from "Related" to "Exact"
* Added synonym "NADH2 dehydrogenase activity" to GO:0003954
* Added general dbxref EC:1.6.99.3 to synonym NADH2 dehydrogenase activity of GO:0003954
* Changed synonym scope of GO:0003954 from "Related" to "Exact"
* Added synonym "NADH:(acceptor) oxidoreductase activity" to GO:0003954
* Added general dbxref EC:1.6.99.3 to synonym NADH:(acceptor) oxidoreductase activity of GO:0003954
* Changed synonym scope of GO:0003954 from "Related" to "Exact"
* Added synonym "NADH:acceptor oxidoreductase activity" to GO:0003954
* Added general dbxref EC:1.6.99.3 to synonym NADH:acceptor oxidoreductase activity of GO:0003954
* Changed synonym scope of GO:0003954 from "Related" to "Exact"
* Added synonym "NAD(P)H2 dehydrogenase (quinone)" to GO:0003955
* Added general dbxref EC:1.6.5.2 to synonym NAD(P)H2 dehydrogenase (quinone) of GO:0003955
* Changed synonym scope of GO:0003955 from "Related" to "Exact"
* Added synonym "NAD(P)H:quinone oxidoreductase activity" to GO:0003955
* Added general dbxref EC:1.6.5.2 to synonym NAD(P)H:quinone oxidoreductase activity of GO:0003955
* Changed synonym scope of GO:0003955 from "Related" to "Exact"
* Added synonym "naphthoquinone reductase activity" to GO:0003955
* Added general dbxref EC:1.6.5.2 to synonym naphthoquinone reductase activity of GO:0003955
* Changed synonym scope of GO:0003955 from "Related" to "Exact"
* Added synonym "NQO1" to GO:0003955
* Added general dbxref EC:1.6.5.2 to synonym NQO1 of GO:0003955
* Added synonym "QR1" to GO:0003955
* Added general dbxref EC:1.6.5.2 to synonym QR1 of GO:0003955
* Deleted synonym "protein-arginine ADP-ribosyltransferase" from GO:0003956
* Added synonym "NAD(P)+:L-arginine ADP-D-ribosyltransferase activity" to GO:0003956
* Added general dbxref EC:2.4.2.31 to synonym NAD(P)+:L-arginine ADP-D-ribosyltransferase activity of GO:0003956
* Changed synonym scope of GO:0003956 from "Related" to "Exact"
* Added synonym "NAD(P)+:protein-L-arginine ADP-D-ribosyltransferase activity" to GO:0003956
* Added general dbxref EC:2.4.2.31 to synonym NAD(P)+:protein-L-arginine ADP-D-ribosyltransferase activity of GO:0003956
* Changed synonym scope of GO:0003956 from "Related" to "Exact"
* Added synonym "NAD+:L-arginine ADP-D-ribosyltransferase activity" to GO:0003956
* Added general dbxref EC:2.4.2.31 to synonym NAD+:L-arginine ADP-D-ribosyltransferase activity of GO:0003956
* Changed synonym scope of GO:0003956 from "Related" to "Exact"
* Added synonym "protein-arginine ADP-ribosyltransferase activity" to GO:0003956
* Changed synonym scope of GO:0003956 from "Related" to "Exact"
* Added synonym "H+-thase" to GO:0003957
* Added general dbxref EC:1.6.1.1 to synonym H+-thase of GO:0003957
* Changed synonym scope of GO:0003957 from "Related" to "Broad"
* Added synonym "NAD transhydrogenase" to GO:0003957
* Added general dbxref EC:1.6.1.1 to synonym NAD transhydrogenase of GO:0003957
* Changed synonym scope of GO:0003957 from "Related" to "Broad"
* Added synonym "NADH transhydrogenase" to GO:0003957
* Added general dbxref EC:1.6.1.1 to synonym NADH transhydrogenase of GO:0003957
* Changed synonym scope of GO:0003957 from "Related" to "Broad"
* Added synonym "NADH-NADP-transhydrogenase" to GO:0003957
* Added general dbxref EC:1.6.1.1 to synonym NADH-NADP-transhydrogenase of GO:0003957
* Changed synonym scope of GO:0003957 from "Related" to "Broad"
* Added synonym "NADPH-NAD oxidoreductase" to GO:0003957
* Added general dbxref EC:1.6.1.1 to synonym NADPH-NAD oxidoreductase of GO:0003957
* Changed synonym scope of GO:0003957 from "Related" to "Broad"
* Added synonym "NADPH-NAD transhydrogenase" to GO:0003957
* Added general dbxref EC:1.6.1.1 to synonym NADPH-NAD transhydrogenase of GO:0003957
* Changed synonym scope of GO:0003957 from "Related" to "Broad"
* Added synonym "NADPH:NAD+ oxidoreductase (B-specific)" to GO:0003957
* Added general dbxref EC:1.6.1.1 to synonym NADPH:NAD+ oxidoreductase (B-specific) of GO:0003957
* Changed synonym scope of GO:0003957 from "Related" to "Exact"
* Added synonym "NADPH:NAD+ transhydrogenase" to GO:0003957
* Added general dbxref EC:1.6.1.1 to synonym NADPH:NAD+ transhydrogenase of GO:0003957
* Changed synonym scope of GO:0003957 from "Related" to "Broad"
* Added synonym "nicotinamide adenine dinucleotide (phosphate) transhydrogenase" to GO:0003957
* Added general dbxref EC:1.6.1.1 to synonym nicotinamide adenine dinucleotide (phosphate) transhydrogenase of GO:0003957
* Changed synonym scope of GO:0003957 from "Related" to "Broad"
* Added synonym "non-energy-linked transhydrogenase activity" to GO:0003957
* Added general dbxref EC:1.6.1.1 to synonym non-energy-linked transhydrogenase activity of GO:0003957
* Changed synonym scope of GO:0003957 from "Related" to "Exact"
* Added synonym "pyridine nucleotide transferase" to GO:0003957
* Added general dbxref EC:1.6.1.1 to synonym pyridine nucleotide transferase of GO:0003957
* Changed synonym scope of GO:0003957 from "Related" to "Broad"
* Deleted synonym "NADPH:cytochrome c reductase" from GO:0003958
* Deleted synonym "NADPH:cytochrome P450 reductase" from GO:0003958
* Added synonym "cytochrome P-450 reductase activity" to GO:0003958
* Added general dbxref EC:1.6.2.4 to synonym cytochrome P-450 reductase activity of GO:0003958
* Changed synonym scope of GO:0003958 from "Related" to "Exact"
* Added synonym "NADPH-cytochrome P-450 oxidoreductase activity" to GO:0003958
* Added general dbxref EC:1.6.2.4 to synonym NADPH-cytochrome P-450 oxidoreductase activity of GO:0003958
* Changed synonym scope of GO:0003958 from "Related" to "Exact"
* Added synonym "NADPH-cytochrome p-450 reductase activity" to GO:0003958
* Added general dbxref EC:1.6.2.4 to synonym NADPH-cytochrome p-450 reductase activity of GO:0003958
* Changed synonym scope of GO:0003958 from "Related" to "Exact"
* Added synonym "NADPH:cytochrome c reductase activity" to GO:0003958
* Changed synonym scope of GO:0003958 from "Related" to "Exact"
* Added synonym "NADPH:cytochrome P450 reductase activity" to GO:0003958
* Changed synonym scope of GO:0003958 from "Related" to "Exact"
* Added synonym "NADPH:hemoprotein oxidoreductase activity" to GO:0003958
* Added general dbxref EC:1.6.2.4 to synonym NADPH:hemoprotein oxidoreductase activity of GO:0003958
* Changed synonym scope of GO:0003958 from "Related" to "Exact"
* Added synonym "NADPH:P-450 reductase activity" to GO:0003958
* Added general dbxref EC:1.6.2.4 to synonym NADPH:P-450 reductase activity of GO:0003958
* Changed synonym scope of GO:0003958 from "Related" to "Exact"
* Added synonym "POR" to GO:0003958
* Added general dbxref EC:1.6.2.4 to synonym POR of GO:0003958
* Added synonym "TPNH2 cytochrome c reductase activity" to GO:0003958
* Added general dbxref EC:1.6.2.4 to synonym TPNH2 cytochrome c reductase activity of GO:0003958
* Changed synonym scope of GO:0003958 from "Related" to "Exact"
* Added synonym "dihydronicotinamide adenine dinucleotide phosphate dehydrogenase activity" to GO:0003959
* Added general dbxref EC:1.6.99.1 to synonym dihydronicotinamide adenine dinucleotide phosphate dehydrogenase activity of GO:0003959
* Changed synonym scope of GO:0003959 from "Related" to "Exact"
* Added synonym "NADPH-dehydrogenase activity" to GO:0003959
* Added general dbxref EC:1.6.99.1 to synonym NADPH-dehydrogenase activity of GO:0003959
* Changed synonym scope of GO:0003959 from "Related" to "Exact"
* Added synonym "NADPH2 diaphorase activity" to GO:0003959
* Added general dbxref EC:1.6.99.1 to synonym NADPH2 diaphorase activity of GO:0003959
* Changed synonym scope of GO:0003959 from "Related" to "Exact"
* Added synonym "NADPH2-dehydrogenase activity" to GO:0003959
* Added general dbxref EC:1.6.99.1 to synonym NADPH2-dehydrogenase activity of GO:0003959
* Changed synonym scope of GO:0003959 from "Related" to "Exact"
* Added synonym "NADPH:(acceptor) oxidoreductase activity" to GO:0003959
* Added general dbxref EC:1.6.99.1 to synonym NADPH:(acceptor) oxidoreductase activity of GO:0003959
* Changed synonym scope of GO:0003959 from "Related" to "Exact"
* Added synonym "NADPH:acceptor oxidoreductase activity" to GO:0003959
* Added general dbxref EC:1.6.99.1 to synonym NADPH:acceptor oxidoreductase activity of GO:0003959
* Changed synonym scope of GO:0003959 from "Related" to "Exact"
* Added synonym "old yellow enzyme" to GO:0003959
* Added general dbxref EC:1.6.99.1 to synonym old yellow enzyme of GO:0003959
* Added synonym "OYE" to GO:0003959
* Added general dbxref EC:1.6.99.1 to synonym OYE of GO:0003959
* Added synonym "reduced nicotinamide adenine dinucleotide phosphate dehydrogenase activity" to GO:0003959
* Added general dbxref EC:1.6.99.1 to synonym reduced nicotinamide adenine dinucleotide phosphate dehydrogenase activity of GO:0003959
* Changed synonym scope of GO:0003959 from "Related" to "Exact"
* Added synonym "TPNH dehydrogenase activity" to GO:0003959
* Added general dbxref EC:1.6.99.1 to synonym TPNH dehydrogenase activity of GO:0003959
* Changed synonym scope of GO:0003959 from "Related" to "Exact"
* Added synonym "TPNH-diaphorase activity" to GO:0003959
* Added general dbxref EC:1.6.99.1 to synonym TPNH-diaphorase activity of GO:0003959
* Changed synonym scope of GO:0003959 from "Related" to "Exact"
* Added synonym "triphosphopyridine diaphorase activity" to GO:0003959
* Added general dbxref EC:1.6.99.1 to synonym triphosphopyridine diaphorase activity of GO:0003959
* Changed synonym scope of GO:0003959 from "Related" to "Exact"
* Added synonym "triphosphopyridine nucleotide diaphorase activity" to GO:0003959
* Added general dbxref EC:1.6.99.1 to synonym triphosphopyridine nucleotide diaphorase activity of GO:0003959
* Changed synonym scope of GO:0003959 from "Related" to "Exact"
* Added synonym "NADPH:quinone oxidoreductase activity" to GO:0003960
* Added general dbxref EC:1.6.5.5 to synonym NADPH:quinone oxidoreductase activity of GO:0003960
* Changed synonym scope of GO:0003960 from "Related" to "Exact"
* Added synonym "O-acetyl-L-homoserine:methanethiol 3-amino-3-carboxypropyltransferase activity" to GO:0003961
* Added general dbxref EC:2.5.1.49 to synonym O-acetyl-L-homoserine:methanethiol 3-amino-3-carboxypropyltransferase activity of GO:0003961
* Changed synonym scope of GO:0003961 from "Related" to "Exact"
* Deleted synonym "cystathionine g-synthase" from GO:0003962
* Added synonym "cystathionine g-synthase activity" to GO:0003962
* Changed synonym scope of GO:0003962 from "Related" to "Exact"
* Added synonym "O4-succinyl-L-homoserine:L-cysteine S-(3-amino-3-carboxypropyl)transferase activity" to GO:0003962
* Added general dbxref EC:2.5.1.48 to synonym O4-succinyl-L-homoserine:L-cysteine S-(3-amino-3-carboxypropyl)transferase activity of GO:0003962
* Changed synonym scope of GO:0003962 from "Related" to "Exact"
* Added synonym "RNA-3'-phosphate:RNA ligase (cyclizing, AMP-forming)" to GO:0003963
* Added general dbxref EC:6.5.1.4 to synonym RNA-3'-phosphate:RNA ligase (cyclizing, AMP-forming) of GO:0003963
* Changed synonym scope of GO:0003963 from "Related" to "Exact"
* Added synonym "3D polymerase activity" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym 3D polymerase activity of GO:0003968
* Changed synonym scope of GO:0003968 from "Related" to "Exact"
* Added synonym "nucleoside-triphosphate:RNA nucleotidyltransferase (RNA-directed)" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym nucleoside-triphosphate:RNA nucleotidyltransferase (RNA-directed) of GO:0003968
* Changed synonym scope of GO:0003968 from "Related" to "Exact"
* Added synonym "PB1 proteins" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym PB1 proteins of GO:0003968
* Added synonym "PB2 proteins" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym PB2 proteins of GO:0003968
* Added synonym "phage f2 replicase" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym phage f2 replicase of GO:0003968
* Changed synonym scope of GO:0003968 from "Related" to "Narrow"
* Added synonym "polymerase L" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym polymerase L of GO:0003968
* Added synonym "Q-beta replicase activity" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym Q-beta replicase activity of GO:0003968
* Changed synonym scope of GO:0003968 from "Related" to "Exact"
* Added synonym "RDRP" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym RDRP of GO:0003968
* Added synonym "ribonucleic acid replicase activity" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym ribonucleic acid replicase activity of GO:0003968
* Changed synonym scope of GO:0003968 from "Related" to "Exact"
* Added synonym "ribonucleic acid-dependent ribonucleate nucleotidyltransferase activity" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym ribonucleic acid-dependent ribonucleate nucleotidyltransferase activity of GO:0003968
* Changed synonym scope of GO:0003968 from "Related" to "Exact"
* Added synonym "ribonucleic acid-dependent ribonucleic acid polymerase activity" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym ribonucleic acid-dependent ribonucleic acid polymerase activity of GO:0003968
* Changed synonym scope of GO:0003968 from "Related" to "Exact"
* Added synonym "ribonucleic replicase activity" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym ribonucleic replicase activity of GO:0003968
* Changed synonym scope of GO:0003968 from "Related" to "Exact"
* Added synonym "ribonucleic synthetase activity" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym ribonucleic synthetase activity of GO:0003968
* Changed synonym scope of GO:0003968 from "Related" to "Exact"
* Added synonym "RNA replicase activity" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym RNA replicase activity of GO:0003968
* Changed synonym scope of GO:0003968 from "Related" to "Exact"
* Added synonym "RNA synthetase activity" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym RNA synthetase activity of GO:0003968
* Changed synonym scope of GO:0003968 from "Related" to "Exact"
* Added synonym "RNA transcriptase" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym RNA transcriptase of GO:0003968
* Changed synonym scope of GO:0003968 from "Related" to "Broad"
* Added synonym "RNA-dependent ribonucleate nucleotidyltransferase activity" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym RNA-dependent ribonucleate nucleotidyltransferase activity of GO:0003968
* Changed synonym scope of GO:0003968 from "Related" to "Exact"
* Added synonym "RNA-dependent RNA polymerase activity" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym RNA-dependent RNA polymerase activity of GO:0003968
* Changed synonym scope of GO:0003968 from "Related" to "Exact"
* Added synonym "RNA-dependent RNA replicase activity" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym RNA-dependent RNA replicase activity of GO:0003968
* Changed synonym scope of GO:0003968 from "Related" to "Exact"
* Added synonym "transcriptase" to GO:0003968
* Added general dbxref EC:2.7.7.48 to synonym transcriptase of GO:0003968
* Changed synonym scope of GO:0003968 from "Related" to "Broad"
* Added synonym "poly(ribonucleotide):poly(ribonucleotide) ligase (AMP-forming)" to GO:0003972
* Added general dbxref EC:6.5.1.3 to synonym poly(ribonucleotide):poly(ribonucleotide) ligase (AMP-forming) of GO:0003972
* Changed synonym scope of GO:0003972 from "Related" to "Exact"
* Added synonym "polyribonucleotide ligase activity" to GO:0003972
* Added general dbxref EC:6.5.1.3 to synonym polyribonucleotide ligase activity of GO:0003972
* Changed synonym scope of GO:0003972 from "Related" to "Exact"
* Added synonym "UDP acetylglucosamine epimerase activity" to GO:0003974
* Added general dbxref EC:5.1.3.7 to synonym UDP acetylglucosamine epimerase activity of GO:0003974
* Changed synonym scope of GO:0003974 from "Related" to "Exact"
* Added synonym "UDP-N-acetyl-D-glucosamine 4-epimerase activity" to GO:0003974
* Added general dbxref EC:5.1.3.7 to synonym UDP-N-acetyl-D-glucosamine 4-epimerase activity of GO:0003974
* Changed synonym scope of GO:0003974 from "Related" to "Exact"
* Added synonym "uridine 5'-diphospho-N-acetylglucosamine-4-epimerase activity" to GO:0003974
* Added general dbxref EC:5.1.3.7 to synonym uridine 5'-diphospho-N-acetylglucosamine-4-epimerase activity of GO:0003974
* Changed synonym scope of GO:0003974 from "Related" to "Exact"
* Added synonym "uridine diphosphate N-acetylglucosamine-4-epimerase activity" to GO:0003974
* Added general dbxref EC:5.1.3.7 to synonym uridine diphosphate N-acetylglucosamine-4-epimerase activity of GO:0003974
* Changed synonym scope of GO:0003974 from "Related" to "Exact"
* Added synonym "chitobiosylpyrophosphoryldolichol synthase activity" to GO:0003975
* Added general dbxref EC:2.7.8.15 to synonym chitobiosylpyrophosphoryldolichol synthase activity of GO:0003975
* Changed synonym scope of GO:0003975 from "Related" to "Exact"
* Added synonym "dolichol phosphate N-acetylglucosamine-1-phosphotransferase activity" to GO:0003975
* Added general dbxref EC:2.7.8.15 to synonym dolichol phosphate N-acetylglucosamine-1-phosphotransferase activity of GO:0003975
* Changed synonym scope of GO:0003975 from "Related" to "Exact"
* Added synonym "UDP-acetylglucosamine-dolichol phosphate acetylglucosamine phosphotransferase activity" to GO:0003975
* Added general dbxref EC:2.7.8.15 to synonym UDP-acetylglucosamine-dolichol phosphate acetylglucosamine phosphotransferase activity of GO:0003975
* Changed synonym scope of GO:0003975 from "Related" to "Exact"
* Added synonym "UDP-acetylglucosamine-dolichol phosphate acetylglucosamine-1-phosphotransferase activity" to GO:0003975
* Added general dbxref EC:2.7.8.15 to synonym UDP-acetylglucosamine-dolichol phosphate acetylglucosamine-1-phosphotransferase activity of GO:0003975
* Changed synonym scope of GO:0003975 from "Related" to "Exact"
* Added synonym "UDP-D-N-acetylglucosamine N-acetylglucosamine 1-phosphate transferase activity" to GO:0003975
* Added general dbxref EC:2.7.8.15 to synonym UDP-D-N-acetylglucosamine N-acetylglucosamine 1-phosphate transferase activity of GO:0003975
* Changed synonym scope of GO:0003975 from "Related" to "Exact"
* Added synonym "UDP-GlcNAc:dolichyl-phosphate GlcNAc-1-phosphate transferase activity" to GO:0003975
* Added general dbxref EC:2.7.8.15 to synonym UDP-GlcNAc:dolichyl-phosphate GlcNAc-1-phosphate transferase activity of GO:0003975
* Changed synonym scope of GO:0003975 from "Related" to "Exact"
* Added synonym "UDP-N-acetyl-D-glucosamine:dolichol phosphate N-acetyl-D-glucosamine-1-phosphate transferase activity" to GO:0003975
* Added general dbxref EC:2.7.8.15 to synonym UDP-N-acetyl-D-glucosamine:dolichol phosphate N-acetyl-D-glucosamine-1-phosphate transferase activity of GO:0003975
* Changed synonym scope of GO:0003975 from "Related" to "Exact"
* Added synonym "UDP-N-acetyl-D-glucosamine:dolichyl-phosphate N-acetyl-D-glucosaminephosphotransferase activity" to GO:0003975
* Added general dbxref EC:2.7.8.15 to synonym UDP-N-acetyl-D-glucosamine:dolichyl-phosphate N-acetyl-D-glucosaminephosphotransferase activity of GO:0003975
* Changed synonym scope of GO:0003975 from "Related" to "Exact"
* Added synonym "uridine diphosphoacetylglucosamine-dolichyl phosphate acetylglucosamine-1-phosphotransferase activity" to GO:0003975
* Added general dbxref EC:2.7.8.15 to synonym uridine diphosphoacetylglucosamine-dolichyl phosphate acetylglucosamine-1-phosphotransferase activity of GO:0003975
* Changed synonym scope of GO:0003975 from "Related" to "Exact"
* Added synonym "lysosomal enzyme precursor acetylglucosamine-1-phosphotransferase activity" to GO:0003976
* Added general dbxref EC:2.7.8.17 to synonym lysosomal enzyme precursor acetylglucosamine-1-phosphotransferase activity of GO:0003976
* Changed synonym scope of GO:0003976 from "Related" to "Exact"
* Added synonym "N-acetylglucosaminyl phosphotransferase activity" to GO:0003976
* Added general dbxref EC:2.7.8.17 to synonym N-acetylglucosaminyl phosphotransferase activity of GO:0003976
* Changed synonym scope of GO:0003976 from "Related" to "Exact"
* Added synonym "UDP-GlcNAc:glycoprotein N-acetylglucosamine-1-phosphotransferase activity" to GO:0003976
* Added general dbxref EC:2.7.8.17 to synonym UDP-GlcNAc:glycoprotein N-acetylglucosamine-1-phosphotransferase activity of GO:0003976
* Changed synonym scope of GO:0003976 from "Related" to "Exact"
* Added synonym "UDP-N-acetyl-D-glucosamine:lysosomal-enzyme N-acetylglucosaminephosphotransferase activity" to GO:0003976
* Added general dbxref EC:2.7.8.17 to synonym UDP-N-acetyl-D-glucosamine:lysosomal-enzyme N-acetylglucosaminephosphotransferase activity of GO:0003976
* Changed synonym scope of GO:0003976 from "Related" to "Exact"
* Added synonym "UDP-N-acetylglucosamine:glycoprotein N-acetylglucosamine-1-phosphotransferase activity" to GO:0003976
* Added general dbxref EC:2.7.8.17 to synonym UDP-N-acetylglucosamine:glycoprotein N-acetylglucosamine-1-phosphotransferase activity of GO:0003976
* Changed synonym scope of GO:0003976 from "Related" to "Exact"
* Added synonym "UDP-N-acetylglucosamine:glycoprotein N-acetylglucosaminyl-1-phosphotransferase activity" to GO:0003976
* Added general dbxref EC:2.7.8.17 to synonym UDP-N-acetylglucosamine:glycoprotein N-acetylglucosaminyl-1-phosphotransferase activity of GO:0003976
* Changed synonym scope of GO:0003976 from "Related" to "Exact"
* Added synonym "UDP-N-acetylglucosamine:lysosomal enzyme N-acetylglucosamine-1-phosphotransferase activity" to GO:0003976
* Added general dbxref EC:2.7.8.17 to synonym UDP-N-acetylglucosamine:lysosomal enzyme N-acetylglucosamine-1-phosphotransferase activity of GO:0003976
* Changed synonym scope of GO:0003976 from "Related" to "Exact"
* Added synonym "acetylglucosamine 1-phosphate uridylyltransferase" to GO:0003977
* Added general dbxref EC:2.7.7.23 to synonym acetylglucosamine 1-phosphate uridylyltransferase of GO:0003977
* Changed synonym scope of GO:0003977 from "Related" to "Broad"
* Added synonym "GlmU uridylyltransferase activity" to GO:0003977
* Added general dbxref EC:2.7.7.23 to synonym GlmU uridylyltransferase activity of GO:0003977
* Changed synonym scope of GO:0003977 from "Related" to "Exact"
* Added synonym "UDP-acetylglucosamine pyrophosphorylase activity" to GO:0003977
* Added general dbxref EC:2.7.7.23 to synonym UDP-acetylglucosamine pyrophosphorylase activity of GO:0003977
* Changed synonym scope of GO:0003977 from "Related" to "Exact"
* Added synonym "UDP-GlcNAc pyrophosphorylase activity" to GO:0003977
* Added general dbxref EC:2.7.7.23 to synonym UDP-GlcNAc pyrophosphorylase activity of GO:0003977
* Changed synonym scope of GO:0003977 from "Related" to "Exact"
* Added synonym "uridine diphosphate-N-acetylglucosamine pyrophosphorylase activity" to GO:0003977
* Added general dbxref EC:2.7.7.23 to synonym uridine diphosphate-N-acetylglucosamine pyrophosphorylase activity of GO:0003977
* Changed synonym scope of GO:0003977 from "Related" to "Exact"
* Added synonym "uridine diphosphoacetylglucosamine phosphorylase activity" to GO:0003977
* Added general dbxref EC:2.7.7.23 to synonym uridine diphosphoacetylglucosamine phosphorylase activity of GO:0003977
* Changed synonym scope of GO:0003977 from "Related" to "Exact"
* Added synonym "uridine diphosphoacetylglucosamine pyrophosphorylase activity" to GO:0003977
* Added general dbxref EC:2.7.7.23 to synonym uridine diphosphoacetylglucosamine pyrophosphorylase activity of GO:0003977
* Changed synonym scope of GO:0003977 from "Related" to "Exact"
* Added synonym "UTP:2-acetamido-2-deoxy-alpha-D-glucose-1-phosphate uridylyltransferase activity" to GO:0003977
* Added general dbxref EC:2.7.7.23 to synonym UTP:2-acetamido-2-deoxy-alpha-D-glucose-1-phosphate uridylyltransferase activity of GO:0003977
* Changed synonym scope of GO:0003977 from "Related" to "Exact"
* Added synonym "UTP:N-acetyl-alpha-D-glucosamine-1-phosphate uridylyltransferase activity" to GO:0003977
* Added general dbxref EC:2.7.7.23 to synonym UTP:N-acetyl-alpha-D-glucosamine-1-phosphate uridylyltransferase activity of GO:0003977
* Changed synonym scope of GO:0003977 from "Related" to "Exact"
* Added synonym "4-epimerase activity" to GO:0003978
* Added general dbxref EC:5.1.3.2 to synonym 4-epimerase activity of GO:0003978
* Changed synonym scope of GO:0003978 from "Related" to "Exact"
* Added synonym "UDP-D-galactose 4-epimerase activity" to GO:0003978
* Added general dbxref EC:5.1.3.2 to synonym UDP-D-galactose 4-epimerase activity of GO:0003978
* Changed synonym scope of GO:0003978 from "Related" to "Exact"
* Added synonym "UDP-glucose epimerase activity" to GO:0003978
* Added general dbxref EC:5.1.3.2 to synonym UDP-glucose epimerase activity of GO:0003978
* Changed synonym scope of GO:0003978 from "Related" to "Exact"
* Added synonym "UDPG-4-epimerase activity" to GO:0003978
* Added general dbxref EC:5.1.3.2 to synonym UDPG-4-epimerase activity of GO:0003978
* Changed synonym scope of GO:0003978 from "Related" to "Exact"
* Added synonym "UDPgalactose 4-epimerase activity" to GO:0003978
* Added general dbxref EC:5.1.3.2 to synonym UDPgalactose 4-epimerase activity of GO:0003978
* Changed synonym scope of GO:0003978 from "Related" to "Exact"
* Added synonym "UDPglucose 4-epimerase activity" to GO:0003978
* Added general dbxref EC:5.1.3.2 to synonym UDPglucose 4-epimerase activity of GO:0003978
* Changed synonym scope of GO:0003978 from "Related" to "Exact"
* Added synonym "uridine diphosphate glucose 4-epimerase activity" to GO:0003978
* Added general dbxref EC:5.1.3.2 to synonym uridine diphosphate glucose 4-epimerase activity of GO:0003978
* Changed synonym scope of GO:0003978 from "Related" to "Exact"
* Added synonym "uridine diphosphoglucose 4-epimerase activity" to GO:0003978
* Added general dbxref EC:5.1.3.2 to synonym uridine diphosphoglucose 4-epimerase activity of GO:0003978
* Changed synonym scope of GO:0003978 from "Related" to "Exact"
* Added synonym "uridine diphosphoglucose epimerase activity" to GO:0003978
* Added general dbxref EC:5.1.3.2 to synonym uridine diphosphoglucose epimerase activity of GO:0003978
* Changed synonym scope of GO:0003978 from "Related" to "Exact"
* Added synonym "UDP glucose pyrophosphorylase activity" to GO:0003983
* Added general dbxref EC:2.7.7.9 to synonym UDP glucose pyrophosphorylase activity of GO:0003983
* Changed synonym scope of GO:0003983 from "Related" to "Exact"
* Added synonym "UDPG phosphorylase activity" to GO:0003983
* Added general dbxref EC:2.7.7.9 to synonym UDPG phosphorylase activity of GO:0003983
* Changed synonym scope of GO:0003983 from "Related" to "Exact"
* Added synonym "UDPG pyrophosphorylase activity" to GO:0003983
* Added general dbxref EC:2.7.7.9 to synonym UDPG pyrophosphorylase activity of GO:0003983
* Changed synonym scope of GO:0003983 from "Related" to "Exact"
* Added synonym "uridine 5'-diphosphoglucose pyrophosphorylase activity" to GO:0003983
* Added general dbxref EC:2.7.7.9 to synonym uridine 5'-diphosphoglucose pyrophosphorylase activity of GO:0003983
* Changed synonym scope of GO:0003983 from "Related" to "Exact"
* Added synonym "uridine diphosphate-D-glucose pyrophosphorylase activity" to GO:0003983
* Added general dbxref EC:2.7.7.9 to synonym uridine diphosphate-D-glucose pyrophosphorylase activity of GO:0003983
* Changed synonym scope of GO:0003983 from "Related" to "Exact"
* Added synonym "uridine diphosphoglucose pyrophosphorylase activity" to GO:0003983
* Added general dbxref EC:2.7.7.9 to synonym uridine diphosphoglucose pyrophosphorylase activity of GO:0003983
* Changed synonym scope of GO:0003983 from "Related" to "Exact"
* Added synonym "uridine-diphosphate glucose pyrophosphorylase activity" to GO:0003983
* Added general dbxref EC:2.7.7.9 to synonym uridine-diphosphate glucose pyrophosphorylase activity of GO:0003983
* Changed synonym scope of GO:0003983 from "Related" to "Exact"
* Added synonym "UTP-glucose-1-phosphate uridylyltransferase activity" to GO:0003983
* Added general dbxref EC:2.7.7.9 to synonym UTP-glucose-1-phosphate uridylyltransferase activity of GO:0003983
* Changed synonym scope of GO:0003983 from "Related" to "Exact"
* Added synonym "UTP:alpha-D-glucose-1-phosphate uridylyltransferase activity" to GO:0003983
* Added general dbxref EC:2.7.7.9 to synonym UTP:alpha-D-glucose-1-phosphate uridylyltransferase activity of GO:0003983
* Changed synonym scope of GO:0003983 from "Related" to "Exact"
* Added synonym "pyruvate:pyruvate acetaldehydetransferase (decarboxylating)" to GO:0003984
* Added general dbxref EC:2.2.1.6 to synonym pyruvate:pyruvate acetaldehydetransferase (decarboxylating) of GO:0003984
* Changed synonym scope of GO:0003984 from "Related" to "Exact"
* Added synonym "2-methylacetoacetyl-CoA thiolase" to GO:0003985
* Added general dbxref EC:2.3.1.9 to synonym 2-methylacetoacetyl-CoA thiolase of GO:0003985
* Changed synonym scope of GO:0003985 from "Related" to "Broad"
* Added synonym "3-oxothiolase activity" to GO:0003985
* Added general dbxref EC:2.3.1.9 to synonym 3-oxothiolase activity of GO:0003985
* Changed synonym scope of GO:0003985 from "Related" to "Exact"
* Added synonym "acetyl coenzyme A thiolase activity" to GO:0003985
* Added general dbxref EC:2.3.1.9 to synonym acetyl coenzyme A thiolase activity of GO:0003985
* Changed synonym scope of GO:0003985 from "Related" to "Exact"
* Added synonym "acetyl-CoA acetyltransferase activity" to GO:0003985
* Added general dbxref EC:2.3.1.9 to synonym acetyl-CoA acetyltransferase activity of GO:0003985
* Changed synonym scope of GO:0003985 from "Related" to "Exact"
* Added synonym "acetyl-CoA:acetyl-CoA C-acetyltransferase activity" to GO:0003985
* Added general dbxref EC:2.3.1.9 to synonym acetyl-CoA:acetyl-CoA C-acetyltransferase activity of GO:0003985
* Changed synonym scope of GO:0003985 from "Related" to "Exact"
* Added synonym "acetyl-CoA:N-acetyltransferase activity" to GO:0003985
* Added general dbxref EC:2.3.1.9 to synonym acetyl-CoA:N-acetyltransferase activity of GO:0003985
* Changed synonym scope of GO:0003985 from "Related" to "Exact"
* Added synonym "beta-acetoacetyl coenzyme A thiolase activity" to GO:0003985
* Added general dbxref EC:2.3.1.9 to synonym beta-acetoacetyl coenzyme A thiolase activity of GO:0003985
* Changed synonym scope of GO:0003985 from "Related" to "Exact"
* Added synonym "thiolase II" to GO:0003985
* Added general dbxref EC:2.3.1.9 to synonym thiolase II of GO:0003985
* Added synonym "acetyl coenzyme A acylase activity" to GO:0003986
* Added general dbxref EC:3.1.2.1 to synonym acetyl coenzyme A acylase activity of GO:0003986
* Changed synonym scope of GO:0003986 from "Related" to "Exact"
* Added synonym "acetyl coenzyme A deacylase activity" to GO:0003986
* Added general dbxref EC:3.1.2.1 to synonym acetyl coenzyme A deacylase activity of GO:0003986
* Changed synonym scope of GO:0003986 from "Related" to "Exact"
* Added synonym "acetyl coenzyme A hydrolase activity" to GO:0003986
* Added general dbxref EC:3.1.2.1 to synonym acetyl coenzyme A hydrolase activity of GO:0003986
* Changed synonym scope of GO:0003986 from "Related" to "Exact"
* Added synonym "acetyl-CoA thiol esterase activity" to GO:0003986
* Added general dbxref EC:3.1.2.1 to synonym acetyl-CoA thiol esterase activity of GO:0003986
* Changed synonym scope of GO:0003986 from "Related" to "Exact"
* Added synonym "acetate:CoA ligase (AMP-forming)" to GO:0003987
* Added general dbxref EC:6.2.1.1 to synonym acetate:CoA ligase (AMP-forming) of GO:0003987
* Changed synonym scope of GO:0003987 from "Related" to "Exact"
* Added synonym "acetic thiokinase activity" to GO:0003987
* Added general dbxref EC:6.2.1.1 to synonym acetic thiokinase activity of GO:0003987
* Changed synonym scope of GO:0003987 from "Related" to "Exact"
* Added synonym "acetyl activating enzyme" to GO:0003987
* Added general dbxref EC:6.2.1.1 to synonym acetyl activating enzyme of GO:0003987
* Added synonym "acetyl CoA ligase activity" to GO:0003987
* Added general dbxref EC:6.2.1.1 to synonym acetyl CoA ligase activity of GO:0003987
* Changed synonym scope of GO:0003987 from "Related" to "Exact"
* Added synonym "acetyl CoA synthase activity" to GO:0003987
* Added general dbxref EC:6.2.1.1 to synonym acetyl CoA synthase activity of GO:0003987
* Changed synonym scope of GO:0003987 from "Related" to "Exact"
* Added synonym "acetyl coenzyme A synthetase activity" to GO:0003987
* Added general dbxref EC:6.2.1.1 to synonym acetyl coenzyme A synthetase activity of GO:0003987
* Changed synonym scope of GO:0003987 from "Related" to "Exact"
* Added synonym "acetyl-coenzyme A synthase activity" to GO:0003987
* Added general dbxref EC:6.2.1.1 to synonym acetyl-coenzyme A synthase activity of GO:0003987
* Changed synonym scope of GO:0003987 from "Related" to "Exact"
* Added synonym "ACS" to GO:0003987
* Added general dbxref EC:6.2.1.1 to synonym ACS of GO:0003987
* Added synonym "short chain fatty acyl-CoA synthetase activity" to GO:0003987
* Added general dbxref EC:6.2.1.1 to synonym short chain fatty acyl-CoA synthetase activity of GO:0003987
* Changed synonym scope of GO:0003987 from "Related" to "Exact"
* Added synonym "short-chain acyl-coenzyme A synthetase activity" to GO:0003987
* Added general dbxref EC:6.2.1.1 to synonym short-chain acyl-coenzyme A synthetase activity of GO:0003987
* Changed synonym scope of GO:0003987 from "Related" to "Exact"
* Deleted synonym "2-keto-acyl thiolase" from GO:0003988
* Added synonym "2-keto-acyl thiolase activity" to GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "2-methylacetoacetyl-CoA thiolase" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym 2-methylacetoacetyl-CoA thiolase of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Broad"
* Added synonym "3-ketoacyl CoA thiolase activity" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym 3-ketoacyl CoA thiolase activity of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "3-ketoacyl coenzyme A thiolase activity" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym 3-ketoacyl coenzyme A thiolase activity of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "3-ketoacyl thiolase activity" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym 3-ketoacyl thiolase activity of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "3-ketothiolase activity" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym 3-ketothiolase activity of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "3-oxoacyl-CoA thiolase activity" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym 3-oxoacyl-CoA thiolase activity of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "3-oxoacyl-coenzyme A thiolase activity" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym 3-oxoacyl-coenzyme A thiolase activity of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "6-oxoacyl-CoA thiolase activity" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym 6-oxoacyl-CoA thiolase activity of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "acetoacetyl-CoA beta-ketothiolase activity" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym acetoacetyl-CoA beta-ketothiolase activity of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "acetyl-CoA acyltransferase activity" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym acetyl-CoA acyltransferase activity of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "acyl-CoA:acetyl-CoA C-acyltransferase activity" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym acyl-CoA:acetyl-CoA C-acyltransferase activity of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "beta-ketoacyl coenzyme A thiolase activity" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym beta-ketoacyl coenzyme A thiolase activity of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "beta-ketoacyl-CoA thiolase activity" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym beta-ketoacyl-CoA thiolase activity of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "beta-ketoadipyl coenzyme A thiolase activity" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym beta-ketoadipyl coenzyme A thiolase activity of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "beta-ketoadipyl-CoA thiolase activity" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym beta-ketoadipyl-CoA thiolase activity of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "KAT" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym KAT of GO:0003988
* Added synonym "ketoacyl-CoA acyltransferase activity" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym ketoacyl-CoA acyltransferase activity of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "ketoacyl-coenzyme A thiolase activity" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym ketoacyl-coenzyme A thiolase activity of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "long-chain 3-oxoacyl-CoA thiolase activity" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym long-chain 3-oxoacyl-CoA thiolase activity of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "oxoacyl-coenzyme A thiolase activity" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym oxoacyl-coenzyme A thiolase activity of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "pro-3-ketoacyl-CoA thiolase activity" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym pro-3-ketoacyl-CoA thiolase activity of GO:0003988
* Changed synonym scope of GO:0003988 from "Related" to "Exact"
* Added synonym "thiolase I" to GO:0003988
* Added general dbxref EC:2.3.1.16 to synonym thiolase I of GO:0003988
* Added synonym "acetyl coenzyme A carboxylase activity" to GO:0003989
* Added general dbxref EC:6.4.1.2 to synonym acetyl coenzyme A carboxylase activity of GO:0003989
* Changed synonym scope of GO:0003989 from "Related" to "Exact"
* Added synonym "acetyl-CoA:carbon-dioxide ligase (ADP-forming)" to GO:0003989
* Added general dbxref EC:6.4.1.2 to synonym acetyl-CoA:carbon-dioxide ligase (ADP-forming) of GO:0003989
* Changed synonym scope of GO:0003989 from "Related" to "Exact"
* Added synonym "AcCholE" to GO:0003990
* Added general dbxref EC:3.1.1.7 to synonym AcCholE of GO:0003990
* Added synonym "acetyl.beta-methylcholinesterase activity" to GO:0003990
* Added general dbxref EC:3.1.1.7 to synonym acetyl.beta-methylcholinesterase activity of GO:0003990
* Changed synonym scope of GO:0003990 from "Related" to "Exact"
* Added synonym "acetylcholine acetylhydrolase activity" to GO:0003990
* Added general dbxref EC:3.1.1.7 to synonym acetylcholine acetylhydrolase activity of GO:0003990
* Changed synonym scope of GO:0003990 from "Related" to "Exact"
* Added synonym "acetylcholine hydrolase activity" to GO:0003990
* Added general dbxref EC:3.1.1.7 to synonym acetylcholine hydrolase activity of GO:0003990
* Changed synonym scope of GO:0003990 from "Related" to "Exact"
* Added synonym "acetylthiocholinesterase activity" to GO:0003990
* Added general dbxref EC:3.1.1.7 to synonym acetylthiocholinesterase activity of GO:0003990
* Changed synonym scope of GO:0003990 from "Related" to "Exact"
* Added synonym "acetylglutamate phosphokinase activity" to GO:0003991
* Added general dbxref EC:2.7.2.8 to synonym acetylglutamate phosphokinase activity of GO:0003991
* Changed synonym scope of GO:0003991 from "Related" to "Exact"
* Added synonym "ATP:N-acetyl-L-glutamate 5-phosphotransferase activity" to GO:0003991
* Added general dbxref EC:2.7.2.8 to synonym ATP:N-acetyl-L-glutamate 5-phosphotransferase activity of GO:0003991
* Changed synonym scope of GO:0003991 from "Related" to "Exact"
* Added synonym "N-acetylglutamate 5-phosphotransferase activity" to GO:0003991
* Added general dbxref EC:2.7.2.8 to synonym N-acetylglutamate 5-phosphotransferase activity of GO:0003991
* Changed synonym scope of GO:0003991 from "Related" to "Exact"
* Added synonym "N-acetylglutamate kinase activity" to GO:0003991
* Added general dbxref EC:2.7.2.8 to synonym N-acetylglutamate kinase activity of GO:0003991
* Changed synonym scope of GO:0003991 from "Related" to "Exact"
* Added synonym "N-acetylglutamate phosphokinase activity" to GO:0003991
* Added general dbxref EC:2.7.2.8 to synonym N-acetylglutamate phosphokinase activity of GO:0003991
* Changed synonym scope of GO:0003991 from "Related" to "Exact"
* Added synonym "N-acetylglutamic 5-phosphotransferase activity" to GO:0003991
* Added general dbxref EC:2.7.2.8 to synonym N-acetylglutamic 5-phosphotransferase activity of GO:0003991
* Changed synonym scope of GO:0003991 from "Related" to "Exact"
* Added synonym "2-N-acetyl-L-ornithine:2-oxoglutarate 5-aminotransferase activity" to GO:0003992
* Added general dbxref EC:2.6.1.11 to synonym 2-N-acetyl-L-ornithine:2-oxoglutarate 5-aminotransferase activity of GO:0003992
* Changed synonym scope of GO:0003992 from "Related" to "Exact"
* Added synonym "N2-acetyl-L-ornithine:2-oxoglutarate 5-aminotransferase activity" to GO:0003992
* Added general dbxref EC:2.6.1.11 to synonym N2-acetyl-L-ornithine:2-oxoglutarate 5-aminotransferase activity of GO:0003992
* Changed synonym scope of GO:0003992 from "Related" to "Exact"
* Added synonym "N2-acetyl-L-ornithine:2-oxoglutarate aminotransferase activity" to GO:0003992
* Added general dbxref EC:2.6.1.11 to synonym N2-acetyl-L-ornithine:2-oxoglutarate aminotransferase activity of GO:0003992
* Changed synonym scope of GO:0003992 from "Related" to "Exact"
* Added synonym "N2-acetylornithine 5-transaminase activity" to GO:0003992
* Added general dbxref EC:2.6.1.11 to synonym N2-acetylornithine 5-transaminase activity of GO:0003992
* Changed synonym scope of GO:0003992 from "Related" to "Exact"
* Added synonym "acid monophosphatase activity" to GO:0003993
* Added general dbxref EC:3.1.3.2 to synonym acid monophosphatase activity of GO:0003993
* Changed synonym scope of GO:0003993 from "Related" to "Exact"
* Added synonym "acid nucleoside diphosphate phosphatase activity" to GO:0003993
* Added general dbxref EC:3.1.3.2 to synonym acid nucleoside diphosphate phosphatase activity of GO:0003993
* Changed synonym scope of GO:0003993 from "Related" to "Exact"
* Added synonym "acid phosphohydrolase activity" to GO:0003993
* Added general dbxref EC:3.1.3.2 to synonym acid phosphohydrolase activity of GO:0003993
* Changed synonym scope of GO:0003993 from "Related" to "Exact"
* Added synonym "acid phosphomonoester hydrolase activity" to GO:0003993
* Added general dbxref EC:3.1.3.2 to synonym acid phosphomonoester hydrolase activity of GO:0003993
* Changed synonym scope of GO:0003993 from "Related" to "Exact"
* Added synonym "orthophosphoric-monoester phosphohydrolase (acid optimum)" to GO:0003993
* Added general dbxref EC:3.1.3.2 to synonym orthophosphoric-monoester phosphohydrolase (acid optimum) of GO:0003993
* Changed synonym scope of GO:0003993 from "Related" to "Exact"
* Added synonym "phosphate-monoester phosphohydrolase (acid optimum)" to GO:0003993
* Added general dbxref EC:3.1.3.2 to synonym phosphate-monoester phosphohydrolase (acid optimum) of GO:0003993
* Changed synonym scope of GO:0003993 from "Related" to "Exact"
* Added synonym "uteroferrin" to GO:0003993
* Added general dbxref EC:3.1.3.2 to synonym uteroferrin of GO:0003993
* Added synonym "citrate(isocitrate) hydro-lyase (cis-aconitate-forming)" to GO:0003994
* Added general dbxref EC:4.2.1.3 to synonym citrate(isocitrate) hydro-lyase (cis-aconitate-forming) of GO:0003994
* Changed synonym scope of GO:0003994 from "Related" to "Exact"
* Added synonym "acyl CoA dehydrogenase activity" to GO:0003995
* Added general dbxref EC:1.3.99.3 to synonym acyl CoA dehydrogenase activity of GO:0003995
* Changed synonym scope of GO:0003995 from "Related" to "Exact"
* Added synonym "acyl coenzyme A dehydrogenase activity" to GO:0003995
* Added general dbxref EC:1.3.99.3 to synonym acyl coenzyme A dehydrogenase activity of GO:0003995
* Changed synonym scope of GO:0003995 from "Related" to "Exact"
* Added synonym "acyl-CoA:(acceptor) 2,3-oxidoreductase activity" to GO:0003995
* Added general dbxref EC:1.3.99.3 to synonym acyl-CoA:(acceptor) 2,3-oxidoreductase activity of GO:0003995
* Changed synonym scope of GO:0003995 from "Related" to "Exact"
* Added synonym "acyl-CoA:acceptor 2,3-oxidoreductase activity" to GO:0003995
* Added general dbxref EC:1.3.99.3 to synonym acyl-CoA:acceptor 2,3-oxidoreductase activity of GO:0003995
* Changed synonym scope of GO:0003995 from "Related" to "Exact"
* Added synonym "fatty acyl coenzyme A dehydrogenase activity" to GO:0003995
* Added general dbxref EC:1.3.99.3 to synonym fatty acyl coenzyme A dehydrogenase activity of GO:0003995
* Changed synonym scope of GO:0003995 from "Related" to "Exact"
* Added synonym "fatty-acyl-CoA dehydrogenase activity" to GO:0003995
* Added general dbxref EC:1.3.99.3 to synonym fatty-acyl-CoA dehydrogenase activity of GO:0003995
* Changed synonym scope of GO:0003995 from "Related" to "Exact"
* Added synonym "general acyl CoA dehydrogenase activity" to GO:0003995
* Added general dbxref EC:1.3.99.3 to synonym general acyl CoA dehydrogenase activity of GO:0003995
* Changed synonym scope of GO:0003995 from "Related" to "Exact"
* Added synonym "long-chain acyl coenzyme A dehydrogenase activity" to GO:0003995
* Added general dbxref EC:1.3.99.3 to synonym long-chain acyl coenzyme A dehydrogenase activity of GO:0003995
* Changed synonym scope of GO:0003995 from "Related" to "Exact"
* Added synonym "long-chain acyl-CoA dehydrogenase activity" to GO:0003995
* Added general dbxref EC:1.3.99.3 to synonym long-chain acyl-CoA dehydrogenase activity of GO:0003995
* Changed synonym scope of GO:0003995 from "Related" to "Exact"
* Added synonym "medium-chain acyl-coenzyme A dehydrogenase activity" to GO:0003995
* Added general dbxref EC:1.3.99.3 to synonym medium-chain acyl-coenzyme A dehydrogenase activity of GO:0003995
* Changed synonym scope of GO:0003995 from "Related" to "Exact"
* Added synonym "acyl coenzyme A oxidase activity" to GO:0003997
* Added general dbxref EC:1.3.3.6 to synonym acyl coenzyme A oxidase activity of GO:0003997
* Changed synonym scope of GO:0003997 from "Related" to "Exact"
* Added synonym "acyl-CoA:oxygen 2-oxidoreductase activity" to GO:0003997
* Added general dbxref EC:1.3.3.6 to synonym acyl-CoA:oxygen 2-oxidoreductase activity of GO:0003997
* Changed synonym scope of GO:0003997 from "Related" to "Exact"
* Added synonym "fatty acyl-CoA oxidase activity" to GO:0003997
* Added general dbxref EC:1.3.3.6 to synonym fatty acyl-CoA oxidase activity of GO:0003997
* Changed synonym scope of GO:0003997 from "Related" to "Exact"
* Added synonym "fatty acyl-coenzyme A oxidase activity" to GO:0003997
* Added general dbxref EC:1.3.3.6 to synonym fatty acyl-coenzyme A oxidase activity of GO:0003997
* Changed synonym scope of GO:0003997 from "Related" to "Exact"
* Added synonym "1,3-diphosphoglycerate phosphatase activity" to GO:0003998
* Added general dbxref EC:3.6.1.7 to synonym 1,3-diphosphoglycerate phosphatase activity of GO:0003998
* Changed synonym scope of GO:0003998 from "Related" to "Exact"
* Added synonym "acetic phosphatase activity" to GO:0003998
* Added general dbxref EC:3.6.1.7 to synonym acetic phosphatase activity of GO:0003998
* Changed synonym scope of GO:0003998 from "Related" to "Exact"
* Added synonym "acetylphosphatase activity" to GO:0003998
* Added general dbxref EC:3.6.1.7 to synonym acetylphosphatase activity of GO:0003998
* Changed synonym scope of GO:0003998 from "Related" to "Exact"
* Added synonym "GP 1-3" to GO:0003998
* Added general dbxref EC:3.6.1.7 to synonym GP 1-3 of GO:0003998
* Added synonym "Ho 1-3" to GO:0003998
* Added general dbxref EC:3.6.1.7 to synonym Ho 1-3 of GO:0003998
* Added synonym "adenine phosphoribosylpyrophosphate transferase activity" to GO:0003999
* Added general dbxref EC:2.4.2.7 to synonym adenine phosphoribosylpyrophosphate transferase activity of GO:0003999
* Changed synonym scope of GO:0003999 from "Related" to "Exact"
* Added synonym "adenosine phosphoribosyltransferase activity" to GO:0003999
* Added general dbxref EC:2.4.2.7 to synonym adenosine phosphoribosyltransferase activity of GO:0003999
* Changed synonym scope of GO:0003999 from "Related" to "Exact"
* Added synonym "adenylate pyrophosphorylase activity" to GO:0003999
* Added general dbxref EC:2.4.2.7 to synonym adenylate pyrophosphorylase activity of GO:0003999
* Changed synonym scope of GO:0003999 from "Related" to "Exact"
* Added synonym "adenylic pyrophosphorylase activity" to GO:0003999
* Added general dbxref EC:2.4.2.7 to synonym adenylic pyrophosphorylase activity of GO:0003999
* Changed synonym scope of GO:0003999 from "Related" to "Exact"
* Added synonym "AMP-pyrophosphate phosphoribosyltransferase activity" to GO:0003999
* Added general dbxref EC:2.4.2.7 to synonym AMP-pyrophosphate phosphoribosyltransferase activity of GO:0003999
* Changed synonym scope of GO:0003999 from "Related" to "Exact"
* Added synonym "AMP:diphosphate phospho-D-ribosyltransferase activity" to GO:0003999
* Added general dbxref EC:2.4.2.7 to synonym AMP:diphosphate phospho-D-ribosyltransferase activity of GO:0003999
* Changed synonym scope of GO:0003999 from "Related" to "Exact"
* Deleted synonym "adenosine 5-phosphotransferase" from GO:0004001
* Added synonym "adenosine 5-phosphotransferase activity" to GO:0004001
* Changed synonym scope of GO:0004001 from "Related" to "Exact"
* Added synonym "adenosine kinase (phosphorylating)" to GO:0004001
* Added general dbxref EC:2.7.1.20 to synonym adenosine kinase (phosphorylating) of GO:0004001
* Changed synonym scope of GO:0004001 from "Related" to "Exact"
* Added synonym "ATP:adenosine 5'-phosphotransferase activity" to GO:0004001
* Added general dbxref EC:2.7.1.20 to synonym ATP:adenosine 5'-phosphotransferase activity of GO:0004001
* Changed synonym scope of GO:0004001 from "Related" to "Exact"
* Added synonym "ATP phosphohydrolase (Cu2+-exporting)" to GO:0004008
* Added general dbxref EC:3.6.3.4 to synonym ATP phosphohydrolase (Cu2+-exporting) of GO:0004008
* Changed synonym scope of GO:0004008 from "Related" to "Exact"
* Added synonym "Cu2+-exporting ATPase activity" to GO:0004008
* Added general dbxref EC:3.6.3.4 to synonym Cu2+-exporting ATPase activity of GO:0004008
* Changed synonym scope of GO:0004008 from "Related" to "Exact"
* Added synonym "cu2+-exporting ATPase activity" to GO:0004008
* Added general dbxref EC:3.6.3.4 to synonym cu2+-exporting ATPase activity of GO:0004008
* Changed synonym scope of GO:0004008 from "Related" to "Exact"
* Added synonym "ATP phosphohydrolase (phospholipid-flipping)" to GO:0004012
* Added general dbxref EC:3.6.3.1 to synonym ATP phosphohydrolase (phospholipid-flipping) of GO:0004012
* Changed synonym scope of GO:0004012 from "Related" to "Exact"
* Added synonym "Mg2+-ATPase activity" to GO:0004012
* Added general dbxref EC:3.6.3.1 to synonym Mg2+-ATPase activity of GO:0004012
* Changed synonym scope of GO:0004012 from "Related" to "Exact"
* Added synonym "S-adenosyl-L-homocysteine hydrolase activity" to GO:0004013
* Added general dbxref EC:3.3.1.1 to synonym S-adenosyl-L-homocysteine hydrolase activity of GO:0004013
* Changed synonym scope of GO:0004013 from "Related" to "Exact"
* Added synonym "S-adenosyl-L-methionine carboxy-lyase [(5-deoxy-5-adenosyl)(3-aminopropyl)-methylsulfonium-salt-forming]" to GO:0004014
* Added general dbxref EC:4.1.1.50 to synonym S-adenosyl-L-methionine carboxy-lyase [(5-deoxy-5-adenosyl)(3-aminopropyl)-methylsulfonium-salt-forming] of GO:0004014
* Added synonym "S-adenosylmethionine decarboxylase activity" to GO:0004014
* Added general dbxref EC:4.1.1.50 to synonym S-adenosylmethionine decarboxylase activity of GO:0004014
* Changed synonym scope of GO:0004014 from "Related" to "Exact"
* Added synonym "7,8-diaminonanoate transaminase activity" to GO:0004015
* Added general dbxref EC:2.6.1.62 to synonym 7,8-diaminonanoate transaminase activity of GO:0004015
* Changed synonym scope of GO:0004015 from "Related" to "Exact"
* Added synonym "7,8-diaminononanoate transaminase activity" to GO:0004015
* Added general dbxref EC:2.6.1.62 to synonym 7,8-diaminononanoate transaminase activity of GO:0004015
* Changed synonym scope of GO:0004015 from "Related" to "Exact"
* Added synonym "7,8-diaminopelargonic acid aminotransferase activity" to GO:0004015
* Added general dbxref EC:2.6.1.62 to synonym 7,8-diaminopelargonic acid aminotransferase activity of GO:0004015
* Changed synonym scope of GO:0004015 from "Related" to "Exact"
* Added synonym "7-keto-8-aminopelargonic acid" to GO:0004015
* Added general dbxref EC:2.6.1.62 to synonym 7-keto-8-aminopelargonic acid of GO:0004015
* Added synonym "7-keto-8-aminopelargonic acid aminotransferase activity" to GO:0004015
* Added general dbxref EC:2.6.1.62 to synonym 7-keto-8-aminopelargonic acid aminotransferase activity of GO:0004015
* Changed synonym scope of GO:0004015 from "Related" to "Exact"
* Added synonym "DAPA transaminase activity" to GO:0004015
* Added general dbxref EC:2.6.1.62 to synonym DAPA transaminase activity of GO:0004015
* Changed synonym scope of GO:0004015 from "Related" to "Exact"
* Added synonym "diaminopelargonate synthase activity" to GO:0004015
* Added general dbxref EC:2.6.1.62 to synonym diaminopelargonate synthase activity of GO:0004015
* Changed synonym scope of GO:0004015 from "Related" to "Exact"
* Added synonym "S-adenosyl-L-methionine:8-amino-7-oxononanoate aminotransferase activity" to GO:0004015
* Added general dbxref EC:2.6.1.62 to synonym S-adenosyl-L-methionine:8-amino-7-oxononanoate aminotransferase activity of GO:0004015
* Changed synonym scope of GO:0004015 from "Related" to "Exact"
* Added synonym "5'-AMP-kinase activity" to GO:0004017
* Added general dbxref EC:2.7.4.3 to synonym 5'-AMP-kinase activity of GO:0004017
* Changed synonym scope of GO:0004017 from "Related" to "Exact"
* Added synonym "ATP:AMP phosphotransferase activity" to GO:0004017
* Added general dbxref EC:2.7.4.3 to synonym ATP:AMP phosphotransferase activity of GO:0004017
* Changed synonym scope of GO:0004017 from "Related" to "Exact"
* Added synonym "6-N-(1,2-dicarboxyethyl)AMP AMP-lyase activity" to GO:0004018
* Added general dbxref EC:4.3.2.2 to synonym 6-N-(1,2-dicarboxyethyl)AMP AMP-lyase activity of GO:0004018
* Changed synonym scope of GO:0004018 from "Related" to "Exact"
* Added synonym "N6-(1,2-dicarboxyethyl)AMP AMP-lyase activity" to GO:0004018
* Added general dbxref EC:4.3.2.2 to synonym N6-(1,2-dicarboxyethyl)AMP AMP-lyase activity of GO:0004018
* Changed synonym scope of GO:0004018 from "Related" to "Exact"
* Added synonym "IMP:L-aspartate ligase (GDP-forming)" to GO:0004019
* Added general dbxref EC:6.3.4.4 to synonym IMP:L-aspartate ligase (GDP-forming) of GO:0004019
* Changed synonym scope of GO:0004019 from "Related" to "Exact"
* Added synonym "succino-AMP synthetase activity" to GO:0004019
* Added general dbxref EC:6.3.4.4 to synonym succino-AMP synthetase activity of GO:0004019
* Changed synonym scope of GO:0004019 from "Related" to "Exact"
* Deleted synonym "adenosine-5'-phosphosulfate 3'-phosphotransferase" from GO:0004020
* Deleted synonym "adenosine-5'-phosphosulphate 3'-phosphotransferase" from GO:0004020
* Added synonym "5'-phosphoadenosine sulfate kinase activity" to GO:0004020
* Added general dbxref EC:2.7.1.25 to synonym 5'-phosphoadenosine sulfate kinase activity of GO:0004020
* Changed synonym scope of GO:0004020 from "Related" to "Exact"
* Added synonym "adenosine phosphosulfate kinase activity" to GO:0004020
* Added general dbxref EC:2.7.1.25 to synonym adenosine phosphosulfate kinase activity of GO:0004020
* Changed synonym scope of GO:0004020 from "Related" to "Exact"
* Added synonym "adenosine phosphosulfokinase activity" to GO:0004020
* Added general dbxref EC:2.7.1.25 to synonym adenosine phosphosulfokinase activity of GO:0004020
* Changed synonym scope of GO:0004020 from "Related" to "Exact"
* Added synonym "adenosine-5'-phosphosulfate 3'-phosphotransferase activity" to GO:0004020
* Changed synonym scope of GO:0004020 from "Related" to "Exact"
* Added synonym "adenosine-5'-phosphosulfate-3'-phosphokinase activity" to GO:0004020
* Added general dbxref EC:2.7.1.25 to synonym adenosine-5'-phosphosulfate-3'-phosphokinase activity of GO:0004020
* Changed synonym scope of GO:0004020 from "Related" to "Exact"
* Added synonym "adenosine-5'-phosphosulphate 3'-phosphotransferase activity" to GO:0004020
* Changed synonym scope of GO:0004020 from "Related" to "Exact"
* Added synonym "adenylylsulfate kinase (phosphorylating)" to GO:0004020
* Added general dbxref EC:2.7.1.25 to synonym adenylylsulfate kinase (phosphorylating) of GO:0004020
* Changed synonym scope of GO:0004020 from "Related" to "Exact"
* Added synonym "ATP:adenylyl-sulfate 3'-phosphotransferase activity" to GO:0004020
* Added general dbxref EC:2.7.1.25 to synonym ATP:adenylyl-sulfate 3'-phosphotransferase activity of GO:0004020
* Changed synonym scope of GO:0004020 from "Related" to "Exact"
* Added synonym "alanine-alpha-ketoglutarate aminotransferase activity" to GO:0004021
* Added general dbxref EC:2.6.1.2 to synonym alanine-alpha-ketoglutarate aminotransferase activity of GO:0004021
* Changed synonym scope of GO:0004021 from "Related" to "Exact"
* Added synonym "alanine-pyruvate aminotransferase activity" to GO:0004021
* Added general dbxref EC:2.6.1.2 to synonym alanine-pyruvate aminotransferase activity of GO:0004021
* Changed synonym scope of GO:0004021 from "Related" to "Exact"
* Added synonym "ALT" to GO:0004021
* Added general dbxref EC:2.6.1.2 to synonym ALT of GO:0004021
* Added synonym "beta-alanine aminotransferase" to GO:0004021
* Added general dbxref EC:2.6.1.2 to synonym beta-alanine aminotransferase of GO:0004021
* Changed synonym scope of GO:0004021 from "Related" to "Broad"
* Added synonym "glutamic acid-pyruvic acid transaminase activity" to GO:0004021
* Added general dbxref EC:2.6.1.2 to synonym glutamic acid-pyruvic acid transaminase activity of GO:0004021
* Changed synonym scope of GO:0004021 from "Related" to "Exact"
* Added synonym "glutamic-pyruvic aminotransferase activity" to GO:0004021
* Added general dbxref EC:2.6.1.2 to synonym glutamic-pyruvic aminotransferase activity of GO:0004021
* Changed synonym scope of GO:0004021 from "Related" to "Exact"
* Added synonym "GPT" to GO:0004021
* Added general dbxref EC:2.6.1.2 to synonym GPT of GO:0004021
* Added synonym "L-alanine aminotransferase activity" to GO:0004021
* Added general dbxref EC:2.6.1.2 to synonym L-alanine aminotransferase activity of GO:0004021
* Changed synonym scope of GO:0004021 from "Related" to "Exact"
* Added synonym "L-alanine transaminase activity" to GO:0004021
* Added general dbxref EC:2.6.1.2 to synonym L-alanine transaminase activity of GO:0004021
* Changed synonym scope of GO:0004021 from "Related" to "Exact"
* Added synonym "L-alanine-alpha-ketoglutarate aminotransferase activity" to GO:0004021
* Added general dbxref EC:2.6.1.2 to synonym L-alanine-alpha-ketoglutarate aminotransferase activity of GO:0004021
* Changed synonym scope of GO:0004021 from "Related" to "Exact"
* Added synonym "L-alanine:2-oxoglutarate aminotransferase activity" to GO:0004021
* Added general dbxref EC:2.6.1.2 to synonym L-alanine:2-oxoglutarate aminotransferase activity of GO:0004021
* Changed synonym scope of GO:0004021 from "Related" to "Exact"
* Added synonym "pyruvate transaminase activity" to GO:0004021
* Added general dbxref EC:2.6.1.2 to synonym pyruvate transaminase activity of GO:0004021
* Changed synonym scope of GO:0004021 from "Related" to "Exact"
* Added synonym "pyruvate-alanine aminotransferase activity" to GO:0004021
* Added general dbxref EC:2.6.1.2 to synonym pyruvate-alanine aminotransferase activity of GO:0004021
* Changed synonym scope of GO:0004021 from "Related" to "Exact"
* Added synonym "pyruvate-glutamate transaminase activity" to GO:0004021
* Added general dbxref EC:2.6.1.2 to synonym pyruvate-glutamate transaminase activity of GO:0004021
* Changed synonym scope of GO:0004021 from "Related" to "Exact"
* Added synonym "acetyl-CoA:alcohol O-acetyltransferase activity" to GO:0004026
* Added general dbxref EC:2.3.1.84 to synonym acetyl-CoA:alcohol O-acetyltransferase activity of GO:0004026
* Changed synonym scope of GO:0004026 from "Related" to "Exact"
* Added synonym "alcohol acetyltransferase activity" to GO:0004026
* Added general dbxref EC:2.3.1.84 to synonym alcohol acetyltransferase activity of GO:0004026
* Changed synonym scope of GO:0004026 from "Related" to "Exact"
* Added synonym "3'-phosphoadenylyl-sulfate:alcohol sulfotransferase activity" to GO:0004027
* Added general dbxref EC:2.8.2.2 to synonym 3'-phosphoadenylyl-sulfate:alcohol sulfotransferase activity of GO:0004027
* Changed synonym scope of GO:0004027 from "Related" to "Exact"
* Added synonym "3-hydroxysteroid sulfotransferase activity" to GO:0004027
* Added general dbxref EC:2.8.2.2 to synonym 3-hydroxysteroid sulfotransferase activity of GO:0004027
* Changed synonym scope of GO:0004027 from "Related" to "Exact"
* Added synonym "3beta-hydroxy steroid sulfotransferase activity" to GO:0004027
* Added general dbxref EC:2.8.2.2 to synonym 3beta-hydroxy steroid sulfotransferase activity of GO:0004027
* Changed synonym scope of GO:0004027 from "Related" to "Exact"
* Added synonym "3beta-hydroxysteroid sulfotransferase activity" to GO:0004027
* Added general dbxref EC:2.8.2.2 to synonym 3beta-hydroxysteroid sulfotransferase activity of GO:0004027
* Changed synonym scope of GO:0004027 from "Related" to "Exact"
* Added synonym "5alpha-androstenol sulfotransferase activity" to GO:0004027
* Added general dbxref EC:2.8.2.2 to synonym 5alpha-androstenol sulfotransferase activity of GO:0004027
* Changed synonym scope of GO:0004027 from "Related" to "Exact"
* Added synonym "alcohol/hydroxysteroid sulfotransferase activity" to GO:0004027
* Added general dbxref EC:2.8.2.2 to synonym alcohol/hydroxysteroid sulfotransferase activity of GO:0004027
* Changed synonym scope of GO:0004027 from "Related" to "Exact"
* Added synonym "dehydroepiandrosterone sulfotransferase activity" to GO:0004027
* Added general dbxref EC:2.8.2.2 to synonym dehydroepiandrosterone sulfotransferase activity of GO:0004027
* Changed synonym scope of GO:0004027 from "Related" to "Exact"
* Added synonym "delta5-3beta-hydroxysteroid sulfokinase activity" to GO:0004027
* Added general dbxref EC:2.8.2.2 to synonym delta5-3beta-hydroxysteroid sulfokinase activity of GO:0004027
* Changed synonym scope of GO:0004027 from "Related" to "Exact"
* Added synonym "estrogen sulfokinase activity" to GO:0004027
* Added general dbxref EC:2.8.2.2 to synonym estrogen sulfokinase activity of GO:0004027
* Changed synonym scope of GO:0004027 from "Related" to "Exact"
* Added synonym "estrogen sulfotransferase" to GO:0004027
* Added general dbxref EC:2.8.2.2 to synonym estrogen sulfotransferase of GO:0004027
* Changed synonym scope of GO:0004027 from "Related" to "Broad"
* Added synonym "HST" to GO:0004027
* Added general dbxref EC:2.8.2.2 to synonym HST of GO:0004027
* Added synonym "steroid alcohol sulfotransferase" to GO:0004027
* Added general dbxref EC:2.8.2.2 to synonym steroid alcohol sulfotransferase of GO:0004027
* Changed synonym scope of GO:0004027 from "Related" to "Broad"
* Added synonym "steroid sulfokinase activity" to GO:0004027
* Added general dbxref EC:2.8.2.2 to synonym steroid sulfokinase activity of GO:0004027
* Changed synonym scope of GO:0004027 from "Related" to "Exact"
* Added synonym "sterol sulfokinase activity" to GO:0004027
* Added general dbxref EC:2.8.2.2 to synonym sterol sulfokinase activity of GO:0004027
* Changed synonym scope of GO:0004027 from "Related" to "Exact"
* Added synonym "sterol sulfotransferase activity" to GO:0004027
* Added general dbxref EC:2.8.2.2 to synonym sterol sulfotransferase activity of GO:0004027
* Changed synonym scope of GO:0004027 from "Related" to "Exact"
* Added synonym "aldehyde dehydrogenase (NAD+)" to GO:0004029
* Added general dbxref EC:1.2.1.3 to synonym aldehyde dehydrogenase (NAD+) of GO:0004029
* Changed synonym scope of GO:0004029 from "Related" to "Exact"
* Added synonym "aldehyde:NAD+ oxidoreductase activity" to GO:0004029
* Added general dbxref EC:1.2.1.3 to synonym aldehyde:NAD+ oxidoreductase activity of GO:0004029
* Changed synonym scope of GO:0004029 from "Related" to "Exact"
* Added synonym "CoA-independent aldehyde dehydrogenase activity" to GO:0004029
* Added general dbxref EC:1.2.1.3 to synonym CoA-independent aldehyde dehydrogenase activity of GO:0004029
* Changed synonym scope of GO:0004029 from "Related" to "Exact"
* Added synonym "m-methylbenzaldehyde dehydrogenase activity" to GO:0004029
* Added general dbxref EC:1.2.1.3 to synonym m-methylbenzaldehyde dehydrogenase activity of GO:0004029
* Changed synonym scope of GO:0004029 from "Related" to "Exact"
* Added synonym "NAD-aldehyde dehydrogenase activity" to GO:0004029
* Added general dbxref EC:1.2.1.3 to synonym NAD-aldehyde dehydrogenase activity of GO:0004029
* Changed synonym scope of GO:0004029 from "Related" to "Exact"
* Added synonym "NAD-dependent 4-hydroxynonenal dehydrogenase activity" to GO:0004029
* Added general dbxref EC:1.2.1.3 to synonym NAD-dependent 4-hydroxynonenal dehydrogenase activity of GO:0004029
* Changed synonym scope of GO:0004029 from "Related" to "Exact"
* Added synonym "NAD-dependent aldehyde dehydrogenase activity" to GO:0004029
* Added general dbxref EC:1.2.1.3 to synonym NAD-dependent aldehyde dehydrogenase activity of GO:0004029
* Changed synonym scope of GO:0004029 from "Related" to "Exact"
* Added synonym "NAD-linked aldehyde dehydrogenase activity" to GO:0004029
* Added general dbxref EC:1.2.1.3 to synonym NAD-linked aldehyde dehydrogenase activity of GO:0004029
* Changed synonym scope of GO:0004029 from "Related" to "Exact"
* Added synonym "propionaldehyde dehydrogenase activity" to GO:0004029
* Added general dbxref EC:1.2.1.3 to synonym propionaldehyde dehydrogenase activity of GO:0004029
* Changed synonym scope of GO:0004029 from "Related" to "Exact"
* Added synonym "aldehyde:NAD(P)+ oxidoreductase activity" to GO:0004030
* Added general dbxref EC:1.2.1.5 to synonym aldehyde:NAD(P)+ oxidoreductase activity of GO:0004030
* Changed synonym scope of GO:0004030 from "Related" to "Exact"
* Added synonym "ALDH" to GO:0004030
* Added general dbxref EC:1.2.1.5 to synonym ALDH of GO:0004030
* Added synonym "aldehyde:oxygen oxidoreductase activity" to GO:0004031
* Added general dbxref EC:1.2.3.1 to synonym aldehyde:oxygen oxidoreductase activity of GO:0004031
* Changed synonym scope of GO:0004031 from "Related" to "Exact"
* Added synonym "alkaline phenyl phosphatase activity" to GO:0004035
* Added general dbxref EC:3.1.3.1 to synonym alkaline phenyl phosphatase activity of GO:0004035
* Changed synonym scope of GO:0004035 from "Related" to "Exact"
* Added synonym "alkaline phosphohydrolase activity" to GO:0004035
* Added general dbxref EC:3.1.3.1 to synonym alkaline phosphohydrolase activity of GO:0004035
* Changed synonym scope of GO:0004035 from "Related" to "Exact"
* Added synonym "orthophosphoric-monoester phosphohydrolase (alkaline optimum)" to GO:0004035
* Added general dbxref EC:3.1.3.1 to synonym orthophosphoric-monoester phosphohydrolase (alkaline optimum) of GO:0004035
* Changed synonym scope of GO:0004035 from "Related" to "Exact"
* Added synonym "phosphate-monoester phosphohydrolase (alkaline optimum)" to GO:0004035
* Added general dbxref EC:3.1.3.1 to synonym phosphate-monoester phosphohydrolase (alkaline optimum) of GO:0004035
* Changed synonym scope of GO:0004035 from "Related" to "Exact"
* Added synonym "allantoate amidinohydrolase activity" to GO:0004037
* Added general dbxref EC:3.5.3.4 to synonym allantoate amidinohydrolase activity of GO:0004037
* Changed synonym scope of GO:0004037 from "Related" to "Exact"
* Added synonym "(S)-allantoin amidohydrolase activity" to GO:0004038
* Added general dbxref EC:3.5.2.5 to synonym (S)-allantoin amidohydrolase activity of GO:0004038
* Changed synonym scope of GO:0004038 from "Related" to "Exact"
* Added synonym "allophanate lyase activity" to GO:0004039
* Added general dbxref EC:3.5.1.54 to synonym allophanate lyase activity of GO:0004039
* Changed synonym scope of GO:0004039 from "Related" to "Exact"
* Added synonym "urea-1-carboxylate amidohydrolase activity" to GO:0004039
* Added general dbxref EC:3.5.1.54 to synonym urea-1-carboxylate amidohydrolase activity of GO:0004039
* Changed synonym scope of GO:0004039 from "Related" to "Exact"
* Deleted synonym "acetamidase" from GO:0004040
* Added synonym "acetamidase activity" to GO:0004040
* Changed synonym scope of GO:0004040 from "Related" to "Exact"
* Added synonym "acylamide amidohydrolase activity" to GO:0004040
* Added general dbxref EC:3.5.1.4 to synonym acylamide amidohydrolase activity of GO:0004040
* Changed synonym scope of GO:0004040 from "Related" to "Exact"
* Added synonym "amidohydrolase activity" to GO:0004040
* Added general dbxref EC:3.5.1.4 to synonym amidohydrolase activity of GO:0004040
* Changed synonym scope of GO:0004040 from "Related" to "Exact"
* Added synonym "fatty acylamidase activity" to GO:0004040
* Added general dbxref EC:3.5.1.4 to synonym fatty acylamidase activity of GO:0004040
* Changed synonym scope of GO:0004040 from "Related" to "Exact"
* Added synonym "N-acetylaminohydrolase activity" to GO:0004040
* Added general dbxref EC:3.5.1.4 to synonym N-acetylaminohydrolase activity of GO:0004040
* Changed synonym scope of GO:0004040 from "Related" to "Exact"
* Added synonym "acetyl-CoA:L-glutamate N-acetyltransferase activity" to GO:0004042
* Added general dbxref EC:2.3.1.1 to synonym acetyl-CoA:L-glutamate N-acetyltransferase activity of GO:0004042
* Changed synonym scope of GO:0004042 from "Related" to "Exact"
* Added synonym "acetylglutamate acetylglutamate synthetase activity" to GO:0004042
* Added general dbxref EC:2.3.1.1 to synonym acetylglutamate acetylglutamate synthetase activity of GO:0004042
* Changed synonym scope of GO:0004042 from "Related" to "Exact"
* Added synonym "AGAS" to GO:0004042
* Added general dbxref EC:2.3.1.1 to synonym AGAS of GO:0004042
* Added synonym "amino acid acetyltransferase activity" to GO:0004042
* Added general dbxref EC:2.3.1.1 to synonym amino acid acetyltransferase activity of GO:0004042
* Changed synonym scope of GO:0004042 from "Related" to "Exact"
* Added synonym "5'-phosphoribosylpyrophosphate amidotransferase activity" to GO:0004044
* Added general dbxref EC:2.4.2.14 to synonym 5'-phosphoribosylpyrophosphate amidotransferase activity of GO:0004044
* Changed synonym scope of GO:0004044 from "Related" to "Exact"
* Added synonym "5-phosphoribosyl-1-pyrophosphate amidotransferase activity" to GO:0004044
* Added general dbxref EC:2.4.2.14 to synonym 5-phosphoribosyl-1-pyrophosphate amidotransferase activity of GO:0004044
* Changed synonym scope of GO:0004044 from "Related" to "Exact"
* Added synonym "5-phosphoribosylamine:diphosphate phospho-alpha-D-ribosyltransferase (glutamate-amidating)" to GO:0004044
* Added general dbxref EC:2.4.2.14 to synonym 5-phosphoribosylamine:diphosphate phospho-alpha-D-ribosyltransferase (glutamate-amidating) of GO:0004044
* Changed synonym scope of GO:0004044 from "Related" to "Exact"
* Added synonym "5-phosphororibosyl-1-pyrophosphate amidotransferase activity" to GO:0004044
* Added general dbxref EC:2.4.2.14 to synonym 5-phosphororibosyl-1-pyrophosphate amidotransferase activity of GO:0004044
* Changed synonym scope of GO:0004044 from "Related" to "Exact"
* Added synonym "alpha-5-phosphoribosyl-1-pyrophosphate amidotransferase activity" to GO:0004044
* Added general dbxref EC:2.4.2.14 to synonym alpha-5-phosphoribosyl-1-pyrophosphate amidotransferase activity of GO:0004044
* Changed synonym scope of GO:0004044 from "Related" to "Exact"
* Added synonym "glutamine 5-phosphoribosylpyrophosphate amidotransferase activity" to GO:0004044
* Added general dbxref EC:2.4.2.14 to synonym glutamine 5-phosphoribosylpyrophosphate amidotransferase activity of GO:0004044
* Changed synonym scope of GO:0004044 from "Related" to "Exact"
* Added synonym "glutamine phosphoribosyldiphosphate amidotransferase activity" to GO:0004044
* Added general dbxref EC:2.4.2.14 to synonym glutamine phosphoribosyldiphosphate amidotransferase activity of GO:0004044
* Changed synonym scope of GO:0004044 from "Related" to "Exact"
* Added synonym "glutamine ribosylpyrophosphate 5-phosphate amidotransferase activity" to GO:0004044
* Added general dbxref EC:2.4.2.14 to synonym glutamine ribosylpyrophosphate 5-phosphate amidotransferase activity of GO:0004044
* Changed synonym scope of GO:0004044 from "Related" to "Exact"
* Added synonym "phosphoribose pyrophosphate amidotransferase activity" to GO:0004044
* Added general dbxref EC:2.4.2.14 to synonym phosphoribose pyrophosphate amidotransferase activity of GO:0004044
* Changed synonym scope of GO:0004044 from "Related" to "Exact"
* Added synonym "phosphoribosyl pyrophosphate amidotransferase activity" to GO:0004044
* Added general dbxref EC:2.4.2.14 to synonym phosphoribosyl pyrophosphate amidotransferase activity of GO:0004044
* Changed synonym scope of GO:0004044 from "Related" to "Exact"
* Added synonym "phosphoribosylpyrophosphate glutamyl amidotransferase activity" to GO:0004044
* Added general dbxref EC:2.4.2.14 to synonym phosphoribosylpyrophosphate glutamyl amidotransferase activity of GO:0004044
* Changed synonym scope of GO:0004044 from "Related" to "Exact"
* Added synonym "aminoacyl-transfer ribonucleate hydrolase activity" to GO:0004045
* Added general dbxref EC:3.1.1.29 to synonym aminoacyl-transfer ribonucleate hydrolase activity of GO:0004045
* Changed synonym scope of GO:0004045 from "Related" to "Exact"
* Added synonym "aminoacyl-tRNA aminoacylhydrolase activity" to GO:0004045
* Added general dbxref EC:3.1.1.29 to synonym aminoacyl-tRNA aminoacylhydrolase activity of GO:0004045
* Changed synonym scope of GO:0004045 from "Related" to "Exact"
* Added synonym "N-substituted aminoacyl transfer RNA hydrolase activity" to GO:0004045
* Added general dbxref EC:3.1.1.29 to synonym N-substituted aminoacyl transfer RNA hydrolase activity of GO:0004045
* Changed synonym scope of GO:0004045 from "Related" to "Exact"
* Added synonym "alpha-N-acylaminoacid hydrolase activity" to GO:0004046
* Added general dbxref EC:3.5.1.14 to synonym alpha-N-acylaminoacid hydrolase activity of GO:0004046
* Changed synonym scope of GO:0004046 from "Related" to "Exact"
* Added synonym "amido acid deacylase activity" to GO:0004046
* Added general dbxref EC:3.5.1.14 to synonym amido acid deacylase activity of GO:0004046
* Changed synonym scope of GO:0004046 from "Related" to "Exact"
* Added synonym "hippurase activity" to GO:0004046
* Added general dbxref EC:3.5.1.14 to synonym hippurase activity of GO:0004046
* Changed synonym scope of GO:0004046 from "Related" to "Exact"
* Added synonym "L-amino-acid acylase activity" to GO:0004046
* Added general dbxref EC:3.5.1.14 to synonym L-amino-acid acylase activity of GO:0004046
* Changed synonym scope of GO:0004046 from "Related" to "Exact"
* Added synonym "L-aminoacylase activity" to GO:0004046
* Added general dbxref EC:3.5.1.14 to synonym L-aminoacylase activity of GO:0004046
* Changed synonym scope of GO:0004046 from "Related" to "Exact"
* Added synonym "long acyl amidoacylase activity" to GO:0004046
* Added general dbxref EC:3.5.1.14 to synonym long acyl amidoacylase activity of GO:0004046
* Changed synonym scope of GO:0004046 from "Related" to "Exact"
* Added synonym "N-acyl-L-amino-acid amidohydrolase activity" to GO:0004046
* Added general dbxref EC:3.5.1.14 to synonym N-acyl-L-amino-acid amidohydrolase activity of GO:0004046
* Changed synonym scope of GO:0004046 from "Related" to "Exact"
* Added synonym "short acyl amidoacylase activity" to GO:0004046
* Added general dbxref EC:3.5.1.14 to synonym short acyl amidoacylase activity of GO:0004046
* Changed synonym scope of GO:0004046 from "Related" to "Exact"
* Added synonym "anthranilate 5-phosphoribosylpyrophosphate phosphoribosyltransferase activity" to GO:0004048
* Added general dbxref EC:2.4.2.18 to synonym anthranilate 5-phosphoribosylpyrophosphate phosphoribosyltransferase activity of GO:0004048
* Changed synonym scope of GO:0004048 from "Related" to "Exact"
* Added synonym "anthranilate phosphoribosylpyrophosphate phosphoribosyltransferase activity" to GO:0004048
* Added general dbxref EC:2.4.2.18 to synonym anthranilate phosphoribosylpyrophosphate phosphoribosyltransferase activity of GO:0004048
* Changed synonym scope of GO:0004048 from "Related" to "Exact"
* Added synonym "anthranilate-PP-ribose-P phosphoribosyltransferase activity" to GO:0004048
* Added general dbxref EC:2.4.2.18 to synonym anthranilate-PP-ribose-P phosphoribosyltransferase activity of GO:0004048
* Changed synonym scope of GO:0004048 from "Related" to "Exact"
* Added synonym "N-(5-phospho-D-ribosyl)-anthranilate:diphosphate phospho-alpha-D-ribosyltransferase activity" to GO:0004048
* Added general dbxref EC:2.4.2.18 to synonym N-(5-phospho-D-ribosyl)-anthranilate:diphosphate phospho-alpha-D-ribosyltransferase activity of GO:0004048
* Changed synonym scope of GO:0004048 from "Related" to "Exact"
* Added synonym "phosphoribosylanthranilate pyrophosphorylase activity" to GO:0004048
* Added general dbxref EC:2.4.2.18 to synonym phosphoribosylanthranilate pyrophosphorylase activity of GO:0004048
* Changed synonym scope of GO:0004048 from "Related" to "Exact"
* Added synonym "phosphoribosylanthranilate transferase activity" to GO:0004048
* Added general dbxref EC:2.4.2.18 to synonym phosphoribosylanthranilate transferase activity of GO:0004048
* Changed synonym scope of GO:0004048 from "Related" to "Exact"
* Added synonym "PRT" to GO:0004048
* Added general dbxref EC:2.4.2.18 to synonym PRT of GO:0004048
* Added synonym "5Delta-lipoxygenase activity" to GO:0004051
* Added general dbxref EC:1.13.11.34 to synonym 5Delta-lipoxygenase activity of GO:0004051
* Changed synonym scope of GO:0004051 from "Related" to "Exact"
* Added synonym "arachidonate:oxygen 5-oxidoreductase activity" to GO:0004051
* Added general dbxref EC:1.13.11.34 to synonym arachidonate:oxygen 5-oxidoreductase activity of GO:0004051
* Changed synonym scope of GO:0004051 from "Related" to "Exact"
* Added synonym "delta5-lipoxygenase activity" to GO:0004051
* Added general dbxref EC:1.13.11.34 to synonym delta5-lipoxygenase activity of GO:0004051
* Changed synonym scope of GO:0004051 from "Related" to "Exact"
* Added synonym "leukotriene A4 synthase" to GO:0004051
* Added general dbxref EC:1.13.11.34 to synonym leukotriene A4 synthase of GO:0004051
* Changed synonym scope of GO:0004051 from "Related" to "Broad"
* Added synonym "leukotriene-A4 synthase activity" to GO:0004051
* Added general dbxref EC:1.13.11.34 to synonym leukotriene-A4 synthase activity of GO:0004051
* Changed synonym scope of GO:0004051 from "Related" to "Exact"
* Added synonym "12Delta-lipoxygenase activity" to GO:0004052
* Added general dbxref EC:1.13.11.31 to synonym 12Delta-lipoxygenase activity of GO:0004052
* Changed synonym scope of GO:0004052 from "Related" to "Exact"
* Added synonym "12S-lipoxygenase activity" to GO:0004052
* Added general dbxref EC:1.13.11.31 to synonym 12S-lipoxygenase activity of GO:0004052
* Changed synonym scope of GO:0004052 from "Related" to "Exact"
* Added synonym "arachidonate:oxygen 12-oxidoreductase activity" to GO:0004052
* Added general dbxref EC:1.13.11.31 to synonym arachidonate:oxygen 12-oxidoreductase activity of GO:0004052
* Changed synonym scope of GO:0004052 from "Related" to "Exact"
* Added synonym "C-12 lipoxygenase activity" to GO:0004052
* Added general dbxref EC:1.13.11.31 to synonym C-12 lipoxygenase activity of GO:0004052
* Changed synonym scope of GO:0004052 from "Related" to "Exact"
* Added synonym "delta12-lipoxygenase activity" to GO:0004052
* Added general dbxref EC:1.13.11.31 to synonym delta12-lipoxygenase activity of GO:0004052
* Changed synonym scope of GO:0004052 from "Related" to "Exact"
* Added synonym "leukotriene A4 synthase" to GO:0004052
* Added general dbxref EC:1.13.11.31 to synonym leukotriene A4 synthase of GO:0004052
* Changed synonym scope of GO:0004052 from "Related" to "Broad"
* Added synonym "LTA4 synthase activity" to GO:0004052
* Added general dbxref EC:1.13.11.31 to synonym LTA4 synthase activity of GO:0004052
* Changed synonym scope of GO:0004052 from "Related" to "Exact"
* Added synonym "arginine transamidinase activity" to GO:0004053
* Added general dbxref EC:3.5.3.1 to synonym arginine transamidinase activity of GO:0004053
* Changed synonym scope of GO:0004053 from "Related" to "Exact"
* Added synonym "L-arginase activity" to GO:0004053
* Added general dbxref EC:3.5.3.1 to synonym L-arginase activity of GO:0004053
* Changed synonym scope of GO:0004053 from "Related" to "Exact"
* Added synonym "L-arginine amidinohydrolase activity" to GO:0004053
* Added general dbxref EC:3.5.3.1 to synonym L-arginine amidinohydrolase activity of GO:0004053
* Changed synonym scope of GO:0004053 from "Related" to "Exact"
* Added synonym "adenosine 5'-triphosphate-arginine phosphotransferase activity" to GO:0004054
* Added general dbxref EC:2.7.3.3 to synonym adenosine 5'-triphosphate-arginine phosphotransferase activity of GO:0004054
* Changed synonym scope of GO:0004054 from "Related" to "Exact"
* Added synonym "adenosine 5'-triphosphate:L-arginine" to GO:0004054
* Added general dbxref EC:2.7.3.3 to synonym adenosine 5'-triphosphate:L-arginine of GO:0004054
* Added synonym "arginine phosphokinase activity" to GO:0004054
* Added general dbxref EC:2.7.3.3 to synonym arginine phosphokinase activity of GO:0004054
* Changed synonym scope of GO:0004054 from "Related" to "Exact"
* Added synonym "ATP:L-arginine N-phosphotransferase activity" to GO:0004054
* Added general dbxref EC:2.7.3.3 to synonym ATP:L-arginine N-phosphotransferase activity of GO:0004054
* Changed synonym scope of GO:0004054 from "Related" to "Exact"
* Added synonym "argininosuccinic acid synthetase activity" to GO:0004055
* Added general dbxref EC:6.3.4.5 to synonym argininosuccinic acid synthetase activity of GO:0004055
* Changed synonym scope of GO:0004055 from "Related" to "Exact"
* Added synonym "arginosuccinate synthetase activity" to GO:0004055
* Added general dbxref EC:6.3.4.5 to synonym arginosuccinate synthetase activity of GO:0004055
* Changed synonym scope of GO:0004055 from "Related" to "Exact"
* Added synonym "L-citrulline:L-aspartate ligase (AMP-forming)" to GO:0004055
* Added general dbxref EC:6.3.4.5 to synonym L-citrulline:L-aspartate ligase (AMP-forming) of GO:0004055
* Changed synonym scope of GO:0004055 from "Related" to "Exact"
* Added synonym "2-(Nomega-L-arginino)succinate arginine-lyase (fumarate-forming)" to GO:0004056
* Added general dbxref EC:4.3.2.1 to synonym 2-(Nomega-L-arginino)succinate arginine-lyase (fumarate-forming) of GO:0004056
* Changed synonym scope of GO:0004056 from "Related" to "Exact"
* Added synonym "2-(omega-N-L-arginino)succinate arginine-lyase (fumarate-forming)" to GO:0004056
* Added general dbxref EC:4.3.2.1 to synonym 2-(omega-N-L-arginino)succinate arginine-lyase (fumarate-forming) of GO:0004056
* Changed synonym scope of GO:0004056 from "Related" to "Exact"
* Added synonym "arginine-succinate lyase activity" to GO:0004056
* Added general dbxref EC:4.3.2.1 to synonym arginine-succinate lyase activity of GO:0004056
* Changed synonym scope of GO:0004056 from "Related" to "Exact"
* Added synonym "argininosuccinic acid lyase activity" to GO:0004056
* Added general dbxref EC:4.3.2.1 to synonym argininosuccinic acid lyase activity of GO:0004056
* Changed synonym scope of GO:0004056 from "Related" to "Exact"
* Deleted synonym "arginyl-tRNA-protein transferase" from GO:0004057
* Added synonym "arginine transferase activity" to GO:0004057
* Added general dbxref EC:2.3.2.8 to synonym arginine transferase activity of GO:0004057
* Changed synonym scope of GO:0004057 from "Related" to "Exact"
* Added synonym "arginyl-transfer ribonucleate-protein aminoacyltransferase activity" to GO:0004057
* Added general dbxref EC:2.3.2.8 to synonym arginyl-transfer ribonucleate-protein aminoacyltransferase activity of GO:0004057
* Changed synonym scope of GO:0004057 from "Related" to "Exact"
* Added synonym "arginyl-transfer ribonucleate-protein transferase activity" to GO:0004057
* Added general dbxref EC:2.3.2.8 to synonym arginyl-transfer ribonucleate-protein transferase activity of GO:0004057
* Changed synonym scope of GO:0004057 from "Related" to "Exact"
* Added synonym "arginyl-tRNA protein transferase activity" to GO:0004057
* Added general dbxref EC:2.3.2.8 to synonym arginyl-tRNA protein transferase activity of GO:0004057
* Changed synonym scope of GO:0004057 from "Related" to "Exact"
* Added synonym "arginyl-tRNA-protein transferase activity" to GO:0004057
* Changed synonym scope of GO:0004057 from "Related" to "Exact"
* Added synonym "L-arginyl-tRNA:protein arginyltransferase activity" to GO:0004057
* Added general dbxref EC:2.3.2.8 to synonym L-arginyl-tRNA:protein arginyltransferase activity of GO:0004057
* Changed synonym scope of GO:0004057 from "Related" to "Exact"
* Added synonym "aromatic-L-amino-acid carboxy-lyase (tryptamine-forming)" to GO:0004058
* Added general dbxref EC:4.1.1.28 to synonym aromatic-L-amino-acid carboxy-lyase (tryptamine-forming) of GO:0004058
* Changed synonym scope of GO:0004058 from "Related" to "Exact"
* Added synonym "acetyl-CoA:2-arylethylamine N-acetyltransferase activity" to GO:0004059
* Added general dbxref EC:2.3.1.87 to synonym acetyl-CoA:2-arylethylamine N-acetyltransferase activity of GO:0004059
* Changed synonym scope of GO:0004059 from "Related" to "Exact"
* Added synonym "2-naphthylamine N-acetyltransferase activity" to GO:0004060
* Added general dbxref EC:2.3.1.5 to synonym 2-naphthylamine N-acetyltransferase activity of GO:0004060
* Changed synonym scope of GO:0004060 from "Related" to "Exact"
* Added synonym "4-aminobiphenyl N-acetyltransferase activity" to GO:0004060
* Added general dbxref EC:2.3.1.5 to synonym 4-aminobiphenyl N-acetyltransferase activity of GO:0004060
* Changed synonym scope of GO:0004060 from "Related" to "Exact"
* Added synonym "acetyl CoA-arylamine N-acetyltransferase activity" to GO:0004060
* Added general dbxref EC:2.3.1.5 to synonym acetyl CoA-arylamine N-acetyltransferase activity of GO:0004060
* Changed synonym scope of GO:0004060 from "Related" to "Exact"
* Added synonym "acetyl-CoA:arylamine N-acetyltransferase activity" to GO:0004060
* Added general dbxref EC:2.3.1.5 to synonym acetyl-CoA:arylamine N-acetyltransferase activity of GO:0004060
* Changed synonym scope of GO:0004060 from "Related" to "Exact"
* Added synonym "arylamine acetyltransferase activity" to GO:0004060
* Added general dbxref EC:2.3.1.5 to synonym arylamine acetyltransferase activity of GO:0004060
* Changed synonym scope of GO:0004060 from "Related" to "Exact"
* Added synonym "beta-naphthylamine N-acetyltransferase activity" to GO:0004060
* Added general dbxref EC:2.3.1.5 to synonym beta-naphthylamine N-acetyltransferase activity of GO:0004060
* Changed synonym scope of GO:0004060 from "Related" to "Exact"
* Added synonym "indoleamine N-acetyltransferase activity" to GO:0004060
* Added general dbxref EC:2.3.1.5 to synonym indoleamine N-acetyltransferase activity of GO:0004060
* Changed synonym scope of GO:0004060 from "Related" to "Exact"
* Added synonym "p-aminosalicylate N-acetyltransferase activity" to GO:0004060
* Added general dbxref EC:2.3.1.5 to synonym p-aminosalicylate N-acetyltransferase activity of GO:0004060
* Changed synonym scope of GO:0004060 from "Related" to "Exact"
* Added synonym "aryl-formylamine amidohydrolase activity" to GO:0004061
* Added general dbxref EC:3.5.1.9 to synonym aryl-formylamine amidohydrolase activity of GO:0004061
* Changed synonym scope of GO:0004061 from "Related" to "Exact"
* Added synonym "formamidase I" to GO:0004061
* Added general dbxref EC:3.5.1.9 to synonym formamidase I of GO:0004061
* Added synonym "formamidase II" to GO:0004061
* Added general dbxref EC:3.5.1.9 to synonym formamidase II of GO:0004061
* Added synonym "formylkynurenine formamidase activity" to GO:0004061
* Added general dbxref EC:3.5.1.9 to synonym formylkynurenine formamidase activity of GO:0004061
* Changed synonym scope of GO:0004061 from "Related" to "Exact"
* Added synonym "1-naphthol phenol sulfotransferase activity" to GO:0004062
* Added general dbxref EC:2.8.2.1 to synonym 1-naphthol phenol sulfotransferase activity of GO:0004062
* Changed synonym scope of GO:0004062 from "Related" to "Exact"
* Added synonym "2-naphtholsulfotransferase activity" to GO:0004062
* Added general dbxref EC:2.8.2.1 to synonym 2-naphtholsulfotransferase activity of GO:0004062
* Changed synonym scope of GO:0004062 from "Related" to "Exact"
* Added synonym "3'-phosphoadenylyl-sulfate:phenol sulfotransferase activity" to GO:0004062
* Added general dbxref EC:2.8.2.1 to synonym 3'-phosphoadenylyl-sulfate:phenol sulfotransferase activity of GO:0004062
* Changed synonym scope of GO:0004062 from "Related" to "Exact"
* Added synonym "4-nitrocatechol sulfokinase activity" to GO:0004062
* Added general dbxref EC:2.8.2.1 to synonym 4-nitrocatechol sulfokinase activity of GO:0004062
* Changed synonym scope of GO:0004062 from "Related" to "Exact"
* Added synonym "arylsulfotransferase" to GO:0004062
* Added general dbxref EC:2.8.2.1 to synonym arylsulfotransferase of GO:0004062
* Changed synonym scope of GO:0004062 from "Related" to "Broad"
* Added synonym "dopamine sulfotransferase activity" to GO:0004062
* Added general dbxref EC:2.8.2.1 to synonym dopamine sulfotransferase activity of GO:0004062
* Changed synonym scope of GO:0004062 from "Related" to "Exact"
* Added synonym "p-nitrophenol sulfotransferase activity" to GO:0004062
* Added general dbxref EC:2.8.2.1 to synonym p-nitrophenol sulfotransferase activity of GO:0004062
* Changed synonym scope of GO:0004062 from "Related" to "Exact"
* Added synonym "phenol sulfokinase activity" to GO:0004062
* Added general dbxref EC:2.8.2.1 to synonym phenol sulfokinase activity of GO:0004062
* Changed synonym scope of GO:0004062 from "Related" to "Exact"
* Added synonym "PST" to GO:0004062
* Added general dbxref EC:2.8.2.1 to synonym PST of GO:0004062
* Added synonym "ritodrine sulfotransferase activity" to GO:0004062
* Added general dbxref EC:2.8.2.1 to synonym ritodrine sulfotransferase activity of GO:0004062
* Changed synonym scope of GO:0004062 from "Related" to "Exact"
* Added synonym "aryltriphosphate dialkylphosphohydrolase activity" to GO:0004063
* Added general dbxref EC:3.1.8.1 to synonym aryltriphosphate dialkylphosphohydrolase activity of GO:0004063
* Changed synonym scope of GO:0004063 from "Related" to "Exact"
* Added synonym "esterase B1" to GO:0004063
* Added general dbxref EC:3.1.8.1 to synonym esterase B1 of GO:0004063
* Added synonym "esterase E4" to GO:0004063
* Added general dbxref EC:3.1.8.1 to synonym esterase E4 of GO:0004063
* Added synonym "OPH" to GO:0004063
* Added general dbxref EC:3.1.8.1 to synonym OPH of GO:0004063
* Added synonym "organophosphate esterase activity" to GO:0004063
* Added general dbxref EC:3.1.8.1 to synonym organophosphate esterase activity of GO:0004063
* Changed synonym scope of GO:0004063 from "Related" to "Exact"
* Added synonym "organophosphate hydrolase activity" to GO:0004063
* Added general dbxref EC:3.1.8.1 to synonym organophosphate hydrolase activity of GO:0004063
* Changed synonym scope of GO:0004063 from "Related" to "Exact"
* Added synonym "organophosphorus acid anhydrase activity" to GO:0004063
* Added general dbxref EC:3.1.8.1 to synonym organophosphorus acid anhydrase activity of GO:0004063
* Changed synonym scope of GO:0004063 from "Related" to "Exact"
* Added synonym "organophosphorus hydrolase activity" to GO:0004063
* Added general dbxref EC:3.1.8.1 to synonym organophosphorus hydrolase activity of GO:0004063
* Changed synonym scope of GO:0004063 from "Related" to "Exact"
* Added synonym "paraoxon esterase activity" to GO:0004063
* Added general dbxref EC:3.1.8.1 to synonym paraoxon esterase activity of GO:0004063
* Changed synonym scope of GO:0004063 from "Related" to "Exact"
* Added synonym "pirimiphos-methyloxon esterase activity" to GO:0004063
* Added general dbxref EC:3.1.8.1 to synonym pirimiphos-methyloxon esterase activity of GO:0004063
* Changed synonym scope of GO:0004063 from "Related" to "Exact"
* Added synonym "aromatic esterase" to GO:0004064
* Added general dbxref EC:3.1.1.2 to synonym aromatic esterase of GO:0004064
* Changed synonym scope of GO:0004064 from "Related" to "Narrow"
* Added synonym "aryl-ester hydrolase" to GO:0004064
* Added general dbxref EC:3.1.1.2 to synonym aryl-ester hydrolase of GO:0004064
* Changed synonym scope of GO:0004064 from "Related" to "Narrow"
* Added synonym "4-methylumbelliferyl sulfatase activity" to GO:0004065
* Added general dbxref EC:3.1.6.1 to synonym 4-methylumbelliferyl sulfatase activity of GO:0004065
* Changed synonym scope of GO:0004065 from "Related" to "Exact"
* Added synonym "aryl-sulfate sulfohydrolase activity" to GO:0004065
* Added general dbxref EC:3.1.6.1 to synonym aryl-sulfate sulfohydrolase activity of GO:0004065
* Changed synonym scope of GO:0004065 from "Related" to "Exact"
* Added synonym "aryl-sulphate sulphohydrolase activity" to GO:0004065
* Added general dbxref EC:3.1.6.1 to synonym aryl-sulphate sulphohydrolase activity of GO:0004065
* Changed synonym scope of GO:0004065 from "Related" to "Exact"
* Added synonym "arylsulfohydrolase activity" to GO:0004065
* Added general dbxref EC:3.1.6.1 to synonym arylsulfohydrolase activity of GO:0004065
* Changed synonym scope of GO:0004065 from "Related" to "Exact"
* Added synonym "estrogen sulfatase activity" to GO:0004065
* Added general dbxref EC:3.1.6.1 to synonym estrogen sulfatase activity of GO:0004065
* Changed synonym scope of GO:0004065 from "Related" to "Exact"
* Added synonym "nitrocatechol sulfatase activity" to GO:0004065
* Added general dbxref EC:3.1.6.1 to synonym nitrocatechol sulfatase activity of GO:0004065
* Changed synonym scope of GO:0004065 from "Related" to "Exact"
* Added synonym "p-nitrophenyl sulfatase activity" to GO:0004065
* Added general dbxref EC:3.1.6.1 to synonym p-nitrophenyl sulfatase activity of GO:0004065
* Changed synonym scope of GO:0004065 from "Related" to "Exact"
* Added synonym "phenolsulfatase activity" to GO:0004065
* Added general dbxref EC:3.1.6.1 to synonym phenolsulfatase activity of GO:0004065
* Changed synonym scope of GO:0004065 from "Related" to "Exact"
* Added synonym "phenylsulfatase activity" to GO:0004065
* Added general dbxref EC:3.1.6.1 to synonym phenylsulfatase activity of GO:0004065
* Changed synonym scope of GO:0004065 from "Related" to "Exact"
* Added synonym "AS" to GO:0004066
* Added general dbxref EC:6.3.5.4 to synonym AS of GO:0004066
* Added synonym "asparagine synthase (glutamine-hydrolysing)" to GO:0004066
* Added general dbxref EC:6.3.5.4 to synonym asparagine synthase (glutamine-hydrolysing) of GO:0004066
* Changed synonym scope of GO:0004066 from "Related" to "Exact"
* Added synonym "asparagine synthetase (glutamine-hydrolysing)" to GO:0004066
* Added general dbxref EC:6.3.5.4 to synonym asparagine synthetase (glutamine-hydrolysing) of GO:0004066
* Changed synonym scope of GO:0004066 from "Related" to "Exact"
* Added synonym "L-aspartate:L-glutamine amido-ligase (AMP-forming)" to GO:0004066
* Added general dbxref EC:6.3.5.4 to synonym L-aspartate:L-glutamine amido-ligase (AMP-forming) of GO:0004066
* Changed synonym scope of GO:0004066 from "Related" to "Exact"
* Added synonym "alpha-asparaginase activity" to GO:0004067
* Added general dbxref EC:3.5.1.1 to synonym alpha-asparaginase activity of GO:0004067
* Changed synonym scope of GO:0004067 from "Related" to "Exact"
* Added synonym "asparaginase II" to GO:0004067
* Added general dbxref EC:3.5.1.1 to synonym asparaginase II of GO:0004067
* Added synonym "colaspase activity" to GO:0004067
* Added general dbxref EC:3.5.1.1 to synonym colaspase activity of GO:0004067
* Changed synonym scope of GO:0004067 from "Related" to "Exact"
* Added synonym "crasnitin" to GO:0004067
* Added general dbxref EC:3.5.1.1 to synonym crasnitin of GO:0004067
* Added synonym "elspar" to GO:0004067
* Added general dbxref EC:3.5.1.1 to synonym elspar of GO:0004067
* Added synonym "leunase activity" to GO:0004067
* Added general dbxref EC:3.5.1.1 to synonym leunase activity of GO:0004067
* Changed synonym scope of GO:0004067 from "Related" to "Exact"
* Added synonym "aspartic alpha-decarboxylase" to GO:0004068
* Added general dbxref EC:4.1.1.11 to synonym aspartic alpha-decarboxylase of GO:0004068
* Changed synonym scope of GO:0004068 from "Related" to "Broad"
* Added synonym "L-aspartate 1-carboxy-lyase (beta-alanine-forming)" to GO:0004068
* Added general dbxref EC:4.1.1.11 to synonym L-aspartate 1-carboxy-lyase (beta-alanine-forming) of GO:0004068
* Changed synonym scope of GO:0004068 from "Related" to "Exact"
* Added synonym "L-aspartate alpha-decarboxylase activity" to GO:0004068
* Added general dbxref EC:4.1.1.11 to synonym L-aspartate alpha-decarboxylase activity of GO:0004068
* Changed synonym scope of GO:0004068 from "Related" to "Exact"
* Added synonym "2-oxoglutarate-glutamate aminotransferase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym 2-oxoglutarate-glutamate aminotransferase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "AAT" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym AAT of GO:0004069
* Added synonym "aspartate alpha-ketoglutarate transaminase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym aspartate alpha-ketoglutarate transaminase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "aspartate-2-oxoglutarate transaminase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym aspartate-2-oxoglutarate transaminase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "aspartate:2-oxoglutarate aminotransferase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym aspartate:2-oxoglutarate aminotransferase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "aspartic acid aminotransferase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym aspartic acid aminotransferase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "aspartic aminotransferase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym aspartic aminotransferase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "aspartyl aminotransferase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym aspartyl aminotransferase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "AspT" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym AspT of GO:0004069
* Added synonym "glutamate oxaloacetate transaminase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym glutamate oxaloacetate transaminase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "glutamate-oxalacetate aminotransferase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym glutamate-oxalacetate aminotransferase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "glutamate-oxalate transaminase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym glutamate-oxalate transaminase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "glutamic oxalic transaminase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym glutamic oxalic transaminase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "glutamic-aspartic aminotransferase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym glutamic-aspartic aminotransferase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "glutamic-oxalacetic transaminase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym glutamic-oxalacetic transaminase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "GOT (enzyme)" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym GOT (enzyme) of GO:0004069
* Added synonym "L-aspartate transaminase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym L-aspartate transaminase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "L-aspartate-2-ketoglutarate aminotransferase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym L-aspartate-2-ketoglutarate aminotransferase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "L-aspartate-2-oxoglutarate aminotransferase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym L-aspartate-2-oxoglutarate aminotransferase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "L-aspartate-2-oxoglutarate-transaminase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym L-aspartate-2-oxoglutarate-transaminase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "L-aspartate-alpha-ketoglutarate transaminase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym L-aspartate-alpha-ketoglutarate transaminase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "L-aspartate:2-oxoglutarate aminotransferase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym L-aspartate:2-oxoglutarate aminotransferase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "L-aspartic aminotransferase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym L-aspartic aminotransferase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "oxaloacetate transferase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym oxaloacetate transferase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "oxaloacetate-aspartate aminotransferase activity" to GO:0004069
* Added general dbxref EC:2.6.1.1 to synonym oxaloacetate-aspartate aminotransferase activity of GO:0004069
* Changed synonym scope of GO:0004069 from "Related" to "Exact"
* Added synonym "aspartate carbamyltransferase activity" to GO:0004070
* Added general dbxref EC:2.1.3.2 to synonym aspartate carbamyltransferase activity of GO:0004070
* Changed synonym scope of GO:0004070 from "Related" to "Exact"
* Added synonym "aspartate transcarbamoylase activity" to GO:0004070
* Added general dbxref EC:2.1.3.2 to synonym aspartate transcarbamoylase activity of GO:0004070
* Changed synonym scope of GO:0004070 from "Related" to "Exact"
* Added synonym "aspartic acid transcarbamoylase activity" to GO:0004070
* Added general dbxref EC:2.1.3.2 to synonym aspartic acid transcarbamoylase activity of GO:0004070
* Changed synonym scope of GO:0004070 from "Related" to "Exact"
* Added synonym "aspartic carbamyltransferase activity" to GO:0004070
* Added general dbxref EC:2.1.3.2 to synonym aspartic carbamyltransferase activity of GO:0004070
* Changed synonym scope of GO:0004070 from "Related" to "Exact"
* Added synonym "aspartic transcarbamylase activity" to GO:0004070
* Added general dbxref EC:2.1.3.2 to synonym aspartic transcarbamylase activity of GO:0004070
* Changed synonym scope of GO:0004070 from "Related" to "Exact"
* Added synonym "carbamoyl-phosphate:L-aspartate carbamoyltransferase activity" to GO:0004070
* Added general dbxref EC:2.1.3.2 to synonym carbamoyl-phosphate:L-aspartate carbamoyltransferase activity of GO:0004070
* Changed synonym scope of GO:0004070 from "Related" to "Exact"
* Added synonym "carbamoylaspartotranskinase activity" to GO:0004070
* Added general dbxref EC:2.1.3.2 to synonym carbamoylaspartotranskinase activity of GO:0004070
* Changed synonym scope of GO:0004070 from "Related" to "Exact"
* Added synonym "L-aspartate transcarbamoylase activity" to GO:0004070
* Added general dbxref EC:2.1.3.2 to synonym L-aspartate transcarbamoylase activity of GO:0004070
* Changed synonym scope of GO:0004070 from "Related" to "Exact"
* Added synonym "L-aspartate transcarbamylase activity" to GO:0004070
* Added general dbxref EC:2.1.3.2 to synonym L-aspartate transcarbamylase activity of GO:0004070
* Changed synonym scope of GO:0004070 from "Related" to "Exact"
* Added synonym "L-asparagine synthetase activity" to GO:0004071
* Added general dbxref EC:6.3.1.1 to synonym L-asparagine synthetase activity of GO:0004071
* Changed synonym scope of GO:0004071 from "Related" to "Exact"
* Added synonym "L-aspartate:ammonia ligase (AMP-forming)" to GO:0004071
* Added general dbxref EC:6.3.1.1 to synonym L-aspartate:ammonia ligase (AMP-forming) of GO:0004071
* Changed synonym scope of GO:0004071 from "Related" to "Exact"
* Added synonym "aspartic kinase activity" to GO:0004072
* Added general dbxref EC:2.7.2.4 to synonym aspartic kinase activity of GO:0004072
* Changed synonym scope of GO:0004072 from "Related" to "Exact"
* Added synonym "ATP:L-aspartate 4-phosphotransferase activity" to GO:0004072
* Added general dbxref EC:2.7.2.4 to synonym ATP:L-aspartate 4-phosphotransferase activity of GO:0004072
* Changed synonym scope of GO:0004072 from "Related" to "Exact"
* Added synonym "beta-aspartokinase activity" to GO:0004072
* Added general dbxref EC:2.7.2.4 to synonym beta-aspartokinase activity of GO:0004072
* Changed synonym scope of GO:0004072 from "Related" to "Exact"
* Added synonym "aspartate semialdehyde dehydrogenase activity" to GO:0004073
* Added general dbxref EC:1.2.1.11 to synonym aspartate semialdehyde dehydrogenase activity of GO:0004073
* Changed synonym scope of GO:0004073 from "Related" to "Exact"
* Added synonym "aspartic beta-semialdehyde dehydrogenase activity" to GO:0004073
* Added general dbxref EC:1.2.1.11 to synonym aspartic beta-semialdehyde dehydrogenase activity of GO:0004073
* Changed synonym scope of GO:0004073 from "Related" to "Exact"
* Added synonym "L-aspartate-4-semialdehyde:NADP+ oxidoreductase (phosphorylating)" to GO:0004073
* Added general dbxref EC:1.2.1.11 to synonym L-aspartate-4-semialdehyde:NADP+ oxidoreductase (phosphorylating) of GO:0004073
* Changed synonym scope of GO:0004073 from "Related" to "Exact"
* Added synonym "L-aspartate-beta-semialdehyde:NADP oxidoreductase (phosporylating)" to GO:0004073
* Added general dbxref EC:1.2.1.11 to synonym L-aspartate-beta-semialdehyde:NADP oxidoreductase (phosporylating) of GO:0004073
* Changed synonym scope of GO:0004073 from "Related" to "Exact"
* Added synonym "bilirubin:NAD(P)+ oxidoreductase activity" to GO:0004074
* Added general dbxref EC:1.3.1.24 to synonym bilirubin:NAD(P)+ oxidoreductase activity of GO:0004074
* Changed synonym scope of GO:0004074 from "Related" to "Exact"
* Added synonym "dethiobiotin:sulfur sulfurtransferase activity" to GO:0004076
* Added general dbxref EC:2.8.1.6 to synonym dethiobiotin:sulfur sulfurtransferase activity of GO:0004076
* Changed synonym scope of GO:0004076 from "Related" to "Exact"
* Added synonym "acetyl CoA holocarboxylase synthetase activity" to GO:0004077
* Added general dbxref EC:6.3.4.15 to synonym acetyl CoA holocarboxylase synthetase activity of GO:0004077
* Changed synonym scope of GO:0004077 from "Related" to "Exact"
* Added synonym "acetyl coenzyme A holocarboxylase synthetase activity" to GO:0004077
* Added general dbxref EC:6.3.4.15 to synonym acetyl coenzyme A holocarboxylase synthetase activity of GO:0004077
* Changed synonym scope of GO:0004077 from "Related" to "Exact"
* Added synonym "biotin holoenzyme synthetase activity" to GO:0004077
* Added general dbxref EC:6.3.4.15 to synonym biotin holoenzyme synthetase activity of GO:0004077
* Changed synonym scope of GO:0004077 from "Related" to "Exact"
* Added synonym "biotin-acetyl coenzyme A carboxylase synthetase activity" to GO:0004077
* Added general dbxref EC:6.3.4.15 to synonym biotin-acetyl coenzyme A carboxylase synthetase activity of GO:0004077
* Changed synonym scope of GO:0004077 from "Related" to "Exact"
* Added synonym "biotin-acetyl-CoA carboxylase synthetase" to GO:0004077
* Added general dbxref EC:6.3.4.15 to synonym biotin-acetyl-CoA carboxylase synthetase of GO:0004077
* Changed synonym scope of GO:0004077 from "Related" to "Broad"
* Added synonym "biotin-acetyl-CoA-carboxylase ligase activity" to GO:0004077
* Added general dbxref EC:6.3.4.15 to synonym biotin-acetyl-CoA-carboxylase ligase activity of GO:0004077
* Changed synonym scope of GO:0004077 from "Related" to "Exact"
* Added synonym "biotin:apo-acetyl-CoA:carbon-dioxide ligase (ADP-forming) ligase (AMP-forming)" to GO:0004077
* Added general dbxref EC:6.3.4.15 to synonym biotin:apo-acetyl-CoA:carbon-dioxide ligase (ADP-forming) ligase (AMP-forming) of GO:0004077
* Changed synonym scope of GO:0004077 from "Related" to "Exact"
* Added synonym "biotin:apocarboxylase ligase activity" to GO:0004077
* Added general dbxref EC:6.3.4.15 to synonym biotin:apocarboxylase ligase activity of GO:0004077
* Changed synonym scope of GO:0004077 from "Related" to "Exact"
* Added synonym "HCS" to GO:0004077
* Added general dbxref EC:6.3.4.15 to synonym HCS of GO:0004077
* Added synonym "beta-methylcrotonyl coenzyme A holocarboxylase synthetase activity" to GO:0004078
* Added general dbxref EC:6.3.4.11 to synonym beta-methylcrotonyl coenzyme A holocarboxylase synthetase activity of GO:0004078
* Changed synonym scope of GO:0004078 from "Related" to "Exact"
* Added synonym "biotin-beta-methylcrotonyl coenzyme A carboxylase synthetase activity" to GO:0004078
* Added general dbxref EC:6.3.4.11 to synonym biotin-beta-methylcrotonyl coenzyme A carboxylase synthetase activity of GO:0004078
* Changed synonym scope of GO:0004078 from "Related" to "Exact"
* Added synonym "biotin-methylcrotonoyl-CoA-carboxylase ligase activity" to GO:0004078
* Added general dbxref EC:6.3.4.11 to synonym biotin-methylcrotonoyl-CoA-carboxylase ligase activity of GO:0004078
* Changed synonym scope of GO:0004078 from "Related" to "Exact"
* Added synonym "biotin-methylcrotonoyl-CoA-carboxylase synthetase" to GO:0004078
* Added general dbxref EC:6.3.4.11 to synonym biotin-methylcrotonoyl-CoA-carboxylase synthetase of GO:0004078
* Changed synonym scope of GO:0004078 from "Related" to "Broad"
* Added synonym "biotin:apo-3-methylcrotonoyl-CoA:carbon-dioxide ligase (ADP-forming) ligase (AMP-forming)" to GO:0004078
* Added general dbxref EC:6.3.4.11 to synonym biotin:apo-3-methylcrotonoyl-CoA:carbon-dioxide ligase (ADP-forming) ligase (AMP-forming) of GO:0004078
* Changed synonym scope of GO:0004078 from "Related" to "Exact"
* Added synonym "holocarboxylase-synthetase activity" to GO:0004078
* Added general dbxref EC:6.3.4.11 to synonym holocarboxylase-synthetase activity of GO:0004078
* Changed synonym scope of GO:0004078 from "Related" to "Exact"
* Added synonym "biotin-methylmalonyl coenzyme A carboxyltransferase synthetase activity" to GO:0004079
* Added general dbxref EC:6.3.4.9 to synonym biotin-methylmalonyl coenzyme A carboxyltransferase synthetase activity of GO:0004079
* Changed synonym scope of GO:0004079 from "Related" to "Exact"
* Added synonym "biotin-methylmalonyl-CoA-carboxyltransferase ligase activity" to GO:0004079
* Added general dbxref EC:6.3.4.9 to synonym biotin-methylmalonyl-CoA-carboxyltransferase ligase activity of GO:0004079
* Changed synonym scope of GO:0004079 from "Related" to "Exact"
* Added synonym "biotin-methylmalonyl-CoA-carboxyltransferase synthetase" to GO:0004079
* Added general dbxref EC:6.3.4.9 to synonym biotin-methylmalonyl-CoA-carboxyltransferase synthetase of GO:0004079
* Changed synonym scope of GO:0004079 from "Related" to "Broad"
* Added synonym "biotin-methylmalonyl-CoA-carboxytransferase ligase activity" to GO:0004079
* Added general dbxref EC:6.3.4.9 to synonym biotin-methylmalonyl-CoA-carboxytransferase ligase activity of GO:0004079
* Changed synonym scope of GO:0004079 from "Related" to "Exact"
* Added synonym "biotin-methylmalonyl-CoA-carboxytransferase synthetase activity" to GO:0004079
* Added general dbxref EC:6.3.4.9 to synonym biotin-methylmalonyl-CoA-carboxytransferase synthetase activity of GO:0004079
* Changed synonym scope of GO:0004079 from "Related" to "Exact"
* Added synonym "biotin:apomethylmalonyl-CoA:pyruvate carboxyltransferase ligase (AMP-forming)" to GO:0004079
* Added general dbxref EC:6.3.4.9 to synonym biotin:apomethylmalonyl-CoA:pyruvate carboxyltransferase ligase (AMP-forming) of GO:0004079
* Changed synonym scope of GO:0004079 from "Related" to "Exact"
* Added synonym "biotin:apomethylmalonyl-CoA:pyruvate carboxytransferase ligase (AMP-forming)" to GO:0004079
* Added general dbxref EC:6.3.4.9 to synonym biotin:apomethylmalonyl-CoA:pyruvate carboxytransferase ligase (AMP-forming) of GO:0004079
* Changed synonym scope of GO:0004079 from "Related" to "Exact"
* Added synonym "methylmalonyl coenzyme A holotranscarboxylase synthetase activity" to GO:0004079
* Added general dbxref EC:6.3.4.9 to synonym methylmalonyl coenzyme A holotranscarboxylase synthetase activity of GO:0004079
* Changed synonym scope of GO:0004079 from "Related" to "Exact"
* Added synonym "biotin-propionyl coenzyme A carboxylase synthetase activity" to GO:0004080
* Added general dbxref EC:6.3.4.10 to synonym biotin-propionyl coenzyme A carboxylase synthetase activity of GO:0004080
* Changed synonym scope of GO:0004080 from "Related" to "Exact"
* Added synonym "biotin-propionyl-CoA-carboxylase (ATP-hydrolysing) ligase activity" to GO:0004080
* Added general dbxref EC:6.3.4.10 to synonym biotin-propionyl-CoA-carboxylase (ATP-hydrolysing) ligase activity of GO:0004080
* Changed synonym scope of GO:0004080 from "Related" to "Exact"
* Added synonym "biotin-propionyl-CoA-carboxylase (ATP-hydrolysing) synthetase activity" to GO:0004080
* Added general dbxref EC:6.3.4.10 to synonym biotin-propionyl-CoA-carboxylase (ATP-hydrolysing) synthetase activity of GO:0004080
* Changed synonym scope of GO:0004080 from "Related" to "Exact"
* Added synonym "biotin:apo-propanoyl-CoA:carbon-dioxide ligase (ADP-forming) ligase (AMP-forming)" to GO:0004080
* Added general dbxref EC:6.3.4.10 to synonym biotin:apo-propanoyl-CoA:carbon-dioxide ligase (ADP-forming) ligase (AMP-forming) of GO:0004080
* Changed synonym scope of GO:0004080 from "Related" to "Exact"
* Added synonym "propionyl coenzyme A holocarboxylase synthetase activity" to GO:0004080
* Added general dbxref EC:6.3.4.10 to synonym propionyl coenzyme A holocarboxylase synthetase activity of GO:0004080
* Changed synonym scope of GO:0004080 from "Related" to "Exact"
* Added synonym "1-P,4-P-bis(5'-nucleosyl)-tetraphosphate nucleotidohydrolase activity" to GO:0004081
* Added general dbxref EC:3.6.1.17 to synonym 1-P,4-P-bis(5'-nucleosyl)-tetraphosphate nucleotidohydrolase activity of GO:0004081
* Changed synonym scope of GO:0004081 from "Related" to "Exact"
* Added synonym "diadenosine 5',5'''-P1,P4-tetraphosphate asymmetrical hydrolase activity" to GO:0004081
* Added general dbxref EC:3.6.1.17 to synonym diadenosine 5',5'''-P1,P4-tetraphosphate asymmetrical hydrolase activity of GO:0004081
* Changed synonym scope of GO:0004081 from "Related" to "Exact"
* Added synonym "diadenosine P1,P4-tetraphosphatase activity" to GO:0004081
* Added general dbxref EC:3.6.1.17 to synonym diadenosine P1,P4-tetraphosphatase activity of GO:0004081
* Changed synonym scope of GO:0004081 from "Related" to "Exact"
* Added synonym "dinucleoside tetraphosphatase activity" to GO:0004081
* Added general dbxref EC:3.6.1.17 to synonym dinucleoside tetraphosphatase activity of GO:0004081
* Changed synonym scope of GO:0004081 from "Related" to "Exact"
* Added synonym "P1,P4-bis(5'-nucleosyl)-tetraphosphate nucleotidohydrolase activity" to GO:0004081
* Added general dbxref EC:3.6.1.17 to synonym P1,P4-bis(5'-nucleosyl)-tetraphosphate nucleotidohydrolase activity of GO:0004081
* Changed synonym scope of GO:0004081 from "Related" to "Exact"
* Added synonym "2,3-diphosphoglycerate synthase activity" to GO:0004082
* Added general dbxref EC:5.4.2.4 to synonym 2,3-diphosphoglycerate synthase activity of GO:0004082
* Changed synonym scope of GO:0004082 from "Related" to "Exact"
* Added synonym "2,3-diphosphoglyceromutase activity" to GO:0004082
* Added general dbxref EC:5.4.2.4 to synonym 2,3-diphosphoglyceromutase activity of GO:0004082
* Changed synonym scope of GO:0004082 from "Related" to "Exact"
* Added synonym "3-phospho-D-glycerate 1,2-phosphomutase activity" to GO:0004082
* Added general dbxref EC:5.4.2.4 to synonym 3-phospho-D-glycerate 1,2-phosphomutase activity of GO:0004082
* Changed synonym scope of GO:0004082 from "Related" to "Exact"
* Added synonym "biphosphoglycerate synthase activity" to GO:0004082
* Added general dbxref EC:5.4.2.4 to synonym biphosphoglycerate synthase activity of GO:0004082
* Changed synonym scope of GO:0004082 from "Related" to "Exact"
* Added synonym "bisphosphoglyceromutase" to GO:0004082
* Added general dbxref EC:5.4.2.4 to synonym bisphosphoglyceromutase of GO:0004082
* Changed synonym scope of GO:0004082 from "Related" to "Broad"
* Added synonym "diphosphoglyceric mutase activity" to GO:0004082
* Added general dbxref EC:5.4.2.4 to synonym diphosphoglyceric mutase activity of GO:0004082
* Changed synonym scope of GO:0004082 from "Related" to "Exact"
* Added synonym "DPGM" to GO:0004082
* Added general dbxref EC:5.4.2.4 to synonym DPGM of GO:0004082
* Added synonym "2,3-bisphospho-D-glycerate 2-phosphohydrolase activity" to GO:0004083
* Added general dbxref EC:3.1.3.13 to synonym 2,3-bisphospho-D-glycerate 2-phosphohydrolase activity of GO:0004083
* Changed synonym scope of GO:0004083 from "Related" to "Exact"
* Added synonym "2,3-bisphosphoglycerate phosphatase activity" to GO:0004083
* Added general dbxref EC:3.1.3.13 to synonym 2,3-bisphosphoglycerate phosphatase activity of GO:0004083
* Changed synonym scope of GO:0004083 from "Related" to "Exact"
* Added synonym "2,3-diphosphoglycerate phosphatase activity" to GO:0004083
* Added general dbxref EC:3.1.3.13 to synonym 2,3-diphosphoglycerate phosphatase activity of GO:0004083
* Changed synonym scope of GO:0004083 from "Related" to "Exact"
* Added synonym "2,3-diphosphoglyceric acid phosphatase activity" to GO:0004083
* Added general dbxref EC:3.1.3.13 to synonym 2,3-diphosphoglyceric acid phosphatase activity of GO:0004083
* Changed synonym scope of GO:0004083 from "Related" to "Exact"
* Added synonym "diphosphoglycerate phosphatase activity" to GO:0004083
* Added general dbxref EC:3.1.3.13 to synonym diphosphoglycerate phosphatase activity of GO:0004083
* Changed synonym scope of GO:0004083 from "Related" to "Exact"
* Added synonym "glycerate-2,3-diphosphate phosphatase activity" to GO:0004083
* Added general dbxref EC:3.1.3.13 to synonym glycerate-2,3-diphosphate phosphatase activity of GO:0004083
* Changed synonym scope of GO:0004083 from "Related" to "Exact"
* Added synonym "branched-chain amino acid-glutamate transaminase activity" to GO:0004084
* Added general dbxref EC:2.6.1.42 to synonym branched-chain amino acid-glutamate transaminase activity of GO:0004084
* Changed synonym scope of GO:0004084 from "Related" to "Exact"
* Added synonym "branched-chain aminotransferase activity" to GO:0004084
* Added general dbxref EC:2.6.1.42 to synonym branched-chain aminotransferase activity of GO:0004084
* Changed synonym scope of GO:0004084 from "Related" to "Exact"
* Added synonym "branched-chain-amino-acid:2-oxoglutarate aminotransferase activity" to GO:0004084
* Added general dbxref EC:2.6.1.42 to synonym branched-chain-amino-acid:2-oxoglutarate aminotransferase activity of GO:0004084
* Changed synonym scope of GO:0004084 from "Related" to "Exact"
* Added synonym "glutamate-branched-chain amino acid transaminase activity" to GO:0004084
* Added general dbxref EC:2.6.1.42 to synonym glutamate-branched-chain amino acid transaminase activity of GO:0004084
* Changed synonym scope of GO:0004084 from "Related" to "Exact"
* Added synonym "L-branched chain amino acid aminotransferase activity" to GO:0004084
* Added general dbxref EC:2.6.1.42 to synonym L-branched chain amino acid aminotransferase activity of GO:0004084
* Changed synonym scope of GO:0004084 from "Related" to "Exact"
* Added synonym "3-hydroxyacyl CoA reductase activity" to GO:0004085
* Added general dbxref EC:1.3.99.2 to synonym 3-hydroxyacyl CoA reductase activity of GO:0004085
* Changed synonym scope of GO:0004085 from "Related" to "Exact"
* Added synonym "butanoyl-CoA:(acceptor) 2,3-oxidoreductase activity" to GO:0004085
* Added general dbxref EC:1.3.99.2 to synonym butanoyl-CoA:(acceptor) 2,3-oxidoreductase activity of GO:0004085
* Changed synonym scope of GO:0004085 from "Related" to "Exact"
* Added synonym "butanoyl-CoA:acceptor 2,3-oxidoreductase activity" to GO:0004085
* Added general dbxref EC:1.3.99.2 to synonym butanoyl-CoA:acceptor 2,3-oxidoreductase activity of GO:0004085
* Changed synonym scope of GO:0004085 from "Related" to "Exact"
* Added synonym "butyryl coenzyme A dehydrogenase activity" to GO:0004085
* Added general dbxref EC:1.3.99.2 to synonym butyryl coenzyme A dehydrogenase activity of GO:0004085
* Changed synonym scope of GO:0004085 from "Related" to "Exact"
* Added synonym "enoyl-coenzyme A reductase activity" to GO:0004085
* Added general dbxref EC:1.3.99.2 to synonym enoyl-coenzyme A reductase activity of GO:0004085
* Changed synonym scope of GO:0004085 from "Related" to "Exact"
* Added synonym "ethylene reductase activity" to GO:0004085
* Added general dbxref EC:1.3.99.2 to synonym ethylene reductase activity of GO:0004085
* Changed synonym scope of GO:0004085 from "Related" to "Exact"
* Added synonym "short-chain acyl CoA dehydrogenase activity" to GO:0004085
* Added general dbxref EC:1.3.99.2 to synonym short-chain acyl CoA dehydrogenase activity of GO:0004085
* Changed synonym scope of GO:0004085 from "Related" to "Exact"
* Added synonym "short-chain acyl-coenzyme A dehydrogenase activity" to GO:0004085
* Added general dbxref EC:1.3.99.2 to synonym short-chain acyl-coenzyme A dehydrogenase activity of GO:0004085
* Changed synonym scope of GO:0004085 from "Related" to "Exact"
* Added synonym "unsaturated acyl coenzyme A reductase activity" to GO:0004085
* Added general dbxref EC:1.3.99.2 to synonym unsaturated acyl coenzyme A reductase activity of GO:0004085
* Changed synonym scope of GO:0004085 from "Related" to "Exact"
* Added synonym "carbamoylphosphate synthase (ammonia)" to GO:0004087
* Added general dbxref EC:6.3.4.16 to synonym carbamoylphosphate synthase (ammonia) of GO:0004087
* Changed synonym scope of GO:0004087 from "Related" to "Exact"
* Added synonym "carbamoylphosphate synthase activity" to GO:0004087
* Added general dbxref EC:6.3.4.16 to synonym carbamoylphosphate synthase activity of GO:0004087
* Changed synonym scope of GO:0004087 from "Related" to "Exact"
* Added synonym "carbamylphosphate synthetase activity" to GO:0004087
* Added general dbxref EC:6.3.4.16 to synonym carbamylphosphate synthetase activity of GO:0004087
* Changed synonym scope of GO:0004087 from "Related" to "Exact"
* Added synonym "carbamylphosphate synthetase I" to GO:0004087
* Added general dbxref EC:6.3.4.16 to synonym carbamylphosphate synthetase I of GO:0004087
* Added synonym "carbmoylphosphate synthetase activity" to GO:0004087
* Added general dbxref EC:6.3.4.16 to synonym carbmoylphosphate synthetase activity of GO:0004087
* Changed synonym scope of GO:0004087 from "Related" to "Exact"
* Added synonym "carbon-dioxide:ammonia ligase (ADP-forming, carbamate-phosphorylating)" to GO:0004087
* Added general dbxref EC:6.3.4.16 to synonym carbon-dioxide:ammonia ligase (ADP-forming, carbamate-phosphorylating) of GO:0004087
* Changed synonym scope of GO:0004087 from "Related" to "Exact"
* Added synonym "anhydrase activity" to GO:0004089
* Added general dbxref EC:4.2.1.1 to synonym anhydrase activity of GO:0004089
* Changed synonym scope of GO:0004089 from "Related" to "Exact"
* Added synonym "carbonate anhydrase activity" to GO:0004089
* Added general dbxref EC:4.2.1.1 to synonym carbonate anhydrase activity of GO:0004089
* Changed synonym scope of GO:0004089 from "Related" to "Exact"
* Added synonym "carbonate hydro-lyase (carbon-dioxide-forming)" to GO:0004089
* Added general dbxref EC:4.2.1.1 to synonym carbonate hydro-lyase (carbon-dioxide-forming) of GO:0004089
* Changed synonym scope of GO:0004089 from "Related" to "Exact"
* Added synonym "carbonic acid anhydrase activity" to GO:0004089
* Added general dbxref EC:4.2.1.1 to synonym carbonic acid anhydrase activity of GO:0004089
* Changed synonym scope of GO:0004089 from "Related" to "Exact"
* Added synonym "carbonic anhydrase A" to GO:0004089
* Added general dbxref EC:4.2.1.1 to synonym carbonic anhydrase A of GO:0004089
* Added synonym "carboxyanhydrase activity" to GO:0004089
* Added general dbxref EC:4.2.1.1 to synonym carboxyanhydrase activity of GO:0004089
* Changed synonym scope of GO:0004089 from "Related" to "Exact"
* Added synonym "aldehyde reductase 1" to GO:0004090
* Added general dbxref EC:1.1.1.184 to synonym aldehyde reductase 1 of GO:0004090
* Added synonym "ALR3" to GO:0004090
* Added general dbxref EC:1.1.1.184 to synonym ALR3 of GO:0004090
* Added synonym "carbonyl reductase activity" to GO:0004090
* Added general dbxref EC:1.1.1.184 to synonym carbonyl reductase activity of GO:0004090
* Changed synonym scope of GO:0004090 from "Related" to "Exact"
* Added synonym "NADPH2-dependent carbonyl reductase activity" to GO:0004090
* Added general dbxref EC:1.1.1.184 to synonym NADPH2-dependent carbonyl reductase activity of GO:0004090
* Changed synonym scope of GO:0004090 from "Related" to "Exact"
* Added synonym "nonspecific NADPH-dependent carbonyl reductase activity" to GO:0004090
* Added general dbxref EC:1.1.1.184 to synonym nonspecific NADPH-dependent carbonyl reductase activity of GO:0004090
* Changed synonym scope of GO:0004090 from "Related" to "Exact"
* Added synonym "secondary-alcohol:NADP+ oxidoreductase activity" to GO:0004090
* Added general dbxref EC:1.1.1.184 to synonym secondary-alcohol:NADP+ oxidoreductase activity of GO:0004090
* Changed synonym scope of GO:0004090 from "Related" to "Exact"
* Deleted synonym "carboxylic acid esterase" from GO:0004091
* Added synonym "ali-esterase activity" to GO:0004091
* Added general dbxref EC:3.1.1 to synonym ali-esterase activity of GO:0004091
* Changed synonym scope of GO:0004091 from "Related" to "Exact"
* Added synonym "alpha-carboxylesterase activity" to GO:0004091
* Added general dbxref EC:3.1.1 to synonym alpha-carboxylesterase activity of GO:0004091
* Changed synonym scope of GO:0004091 from "Related" to "Exact"
* Added synonym "butyrate esterase activity" to GO:0004091
* Added general dbxref EC:3.1.1 to synonym butyrate esterase activity of GO:0004091
* Changed synonym scope of GO:0004091 from "Related" to "Exact"
* Added synonym "butyryl esterase activity" to GO:0004091
* Added general dbxref EC:3.1.1 to synonym butyryl esterase activity of GO:0004091
* Changed synonym scope of GO:0004091 from "Related" to "Exact"
* Added synonym "carboxyesterase activity" to GO:0004091
* Added general dbxref EC:3.1.1 to synonym carboxyesterase activity of GO:0004091
* Changed synonym scope of GO:0004091 from "Related" to "Exact"
* Added synonym "carboxyl ester hydrolase activity" to GO:0004091
* Added general dbxref EC:3.1.1 to synonym carboxyl ester hydrolase activity of GO:0004091
* Changed synonym scope of GO:0004091 from "Related" to "Exact"
* Added synonym "carboxylate esterase activity" to GO:0004091
* Added general dbxref EC:3.1.1 to synonym carboxylate esterase activity of GO:0004091
* Changed synonym scope of GO:0004091 from "Related" to "Exact"
* Added synonym "carboxylic acid esterase activity" to GO:0004091
* Changed synonym scope of GO:0004091 from "Related" to "Exact"
* Added synonym "carboxylic esterase activity" to GO:0004091
* Added general dbxref EC:3.1.1 to synonym carboxylic esterase activity of GO:0004091
* Changed synonym scope of GO:0004091 from "Related" to "Exact"
* Added synonym "carboxylic-ester hydrolase activity" to GO:0004091
* Added general dbxref EC:3.1.1 to synonym carboxylic-ester hydrolase activity of GO:0004091
* Changed synonym scope of GO:0004091 from "Related" to "Exact"
* Added synonym "esterase A" to GO:0004091
* Added general dbxref EC:3.1.1 to synonym esterase A of GO:0004091
* Added synonym "esterase B" to GO:0004091
* Added general dbxref EC:3.1.1 to synonym esterase B of GO:0004091
* Added synonym "methylbutyrate esterase" to GO:0004091
* Added general dbxref EC:3.1.1 to synonym methylbutyrate esterase of GO:0004091
* Changed synonym scope of GO:0004091 from "Related" to "Narrow"
* Added synonym "nonspecific carboxylesterase activity" to GO:0004091
* Added general dbxref EC:3.1.1 to synonym nonspecific carboxylesterase activity of GO:0004091
* Changed synonym scope of GO:0004091 from "Related" to "Exact"
* Added synonym "propionyl esterase" to GO:0004091
* Added general dbxref EC:3.1.1 to synonym propionyl esterase of GO:0004091
* Changed synonym scope of GO:0004091 from "Related" to "Narrow"
* Added synonym "triacetin esterase" to GO:0004091
* Added general dbxref EC:3.1.1 to synonym triacetin esterase of GO:0004091
* Changed synonym scope of GO:0004091 from "Related" to "Narrow"
* Added synonym "vitamin A esterase" to GO:0004091
* Added general dbxref EC:3.1.1 to synonym vitamin A esterase of GO:0004091
* Changed synonym scope of GO:0004091 from "Related" to "Narrow"
* Added synonym "acetyl-CoA-carnitine O-acetyltransferase activity" to GO:0004092
* Added general dbxref EC:2.3.1.7 to synonym acetyl-CoA-carnitine O-acetyltransferase activity of GO:0004092
* Changed synonym scope of GO:0004092 from "Related" to "Exact"
* Added synonym "acetyl-CoA:carnitine O-acetyltransferase activity" to GO:0004092
* Added general dbxref EC:2.3.1.7 to synonym acetyl-CoA:carnitine O-acetyltransferase activity of GO:0004092
* Changed synonym scope of GO:0004092 from "Related" to "Exact"
* Added synonym "acetylcarnitine transferase activity" to GO:0004092
* Added general dbxref EC:2.3.1.7 to synonym acetylcarnitine transferase activity of GO:0004092
* Changed synonym scope of GO:0004092 from "Related" to "Exact"
* Added synonym "carnitine acetyl coenzyme A transferase activity" to GO:0004092
* Added general dbxref EC:2.3.1.7 to synonym carnitine acetyl coenzyme A transferase activity of GO:0004092
* Changed synonym scope of GO:0004092 from "Related" to "Exact"
* Added synonym "carnitine acetyltransferase activity" to GO:0004092
* Added general dbxref EC:2.3.1.7 to synonym carnitine acetyltransferase activity of GO:0004092
* Changed synonym scope of GO:0004092 from "Related" to "Exact"
* Added synonym "carnitine-acetyl-CoA transferase activity" to GO:0004092
* Added general dbxref EC:2.3.1.7 to synonym carnitine-acetyl-CoA transferase activity of GO:0004092
* Changed synonym scope of GO:0004092 from "Related" to "Exact"
* Added synonym "CATC" to GO:0004092
* Added general dbxref EC:2.3.1.7 to synonym CATC of GO:0004092
* Added synonym "acylcarnitine transferase activity" to GO:0004095
* Added general dbxref EC:2.3.1.21 to synonym acylcarnitine transferase activity of GO:0004095
* Changed synonym scope of GO:0004095 from "Related" to "Exact"
* Added synonym "carnitine palmitoyltransferase activity" to GO:0004095
* Added general dbxref EC:2.3.1.21 to synonym carnitine palmitoyltransferase activity of GO:0004095
* Changed synonym scope of GO:0004095 from "Related" to "Exact"
* Added synonym "carnitine palmitoyltransferase I" to GO:0004095
* Added general dbxref EC:2.3.1.21 to synonym carnitine palmitoyltransferase I of GO:0004095
* Added synonym "carnitine palmitoyltransferase II" to GO:0004095
* Added general dbxref EC:2.3.1.21 to synonym carnitine palmitoyltransferase II of GO:0004095
* Added synonym "carnitine palmitoyltransferase-A" to GO:0004095
* Added general dbxref EC:2.3.1.21 to synonym carnitine palmitoyltransferase-A of GO:0004095
* Added synonym "CPT" to GO:0004095
* Added general dbxref EC:2.3.1.21 to synonym CPT of GO:0004095
* Added synonym "CPT I (outer membrane carnitine palmitoyl transferase)" to GO:0004095
* Added general dbxref EC:2.3.1.21 to synonym CPT I (outer membrane carnitine palmitoyl transferase) of GO:0004095
* Added synonym "CPT-A" to GO:0004095
* Added general dbxref EC:2.3.1.21 to synonym CPT-A of GO:0004095
* Added synonym "CPT-B" to GO:0004095
* Added general dbxref EC:2.3.1.21 to synonym CPT-B of GO:0004095
* Added synonym "CPTi" to GO:0004095
* Added general dbxref EC:2.3.1.21 to synonym CPTi of GO:0004095
* Added synonym "CPTo" to GO:0004095
* Added general dbxref EC:2.3.1.21 to synonym CPTo of GO:0004095
* Added synonym "L-carnitine palmitoyltransferase activity" to GO:0004095
* Added general dbxref EC:2.3.1.21 to synonym L-carnitine palmitoyltransferase activity of GO:0004095
* Changed synonym scope of GO:0004095 from "Related" to "Exact"
* Added synonym "outer malonyl-CoA inhibitable carnitine palmitoyltransferase activity" to GO:0004095
* Added general dbxref EC:2.3.1.21 to synonym outer malonyl-CoA inhibitable carnitine palmitoyltransferase activity of GO:0004095
* Changed synonym scope of GO:0004095 from "Related" to "Exact"
* Added synonym "palmitoyl-CoA:L-carnitine O-palmitoyltransferase activity" to GO:0004095
* Added general dbxref EC:2.3.1.21 to synonym palmitoyl-CoA:L-carnitine O-palmitoyltransferase activity of GO:0004095
* Changed synonym scope of GO:0004095 from "Related" to "Exact"
* Added synonym "palmitoylcarnitine transferase activity" to GO:0004095
* Added general dbxref EC:2.3.1.21 to synonym palmitoylcarnitine transferase activity of GO:0004095
* Changed synonym scope of GO:0004095 from "Related" to "Exact"
* Added synonym "caperase activity" to GO:0004096
* Added general dbxref EC:1.11.1.6 to synonym caperase activity of GO:0004096
* Changed synonym scope of GO:0004096 from "Related" to "Exact"
* Added synonym "CAT" to GO:0004096
* Added general dbxref EC:1.11.1.6 to synonym CAT of GO:0004096
* Added synonym "catalase-peroxidase activity" to GO:0004096
* Added general dbxref EC:1.11.1.6 to synonym catalase-peroxidase activity of GO:0004096
* Changed synonym scope of GO:0004096 from "Related" to "Exact"
* Added synonym "equilase activity" to GO:0004096
* Added general dbxref EC:1.11.1.6 to synonym equilase activity of GO:0004096
* Changed synonym scope of GO:0004096 from "Related" to "Exact"
* Added synonym "hydrogen-peroxide:hydrogen-peroxide oxidoreductase activity" to GO:0004096
* Added general dbxref EC:1.11.1.6 to synonym hydrogen-peroxide:hydrogen-peroxide oxidoreductase activity of GO:0004096
* Changed synonym scope of GO:0004096 from "Related" to "Exact"
* Added synonym "optidase activity" to GO:0004096
* Added general dbxref EC:1.11.1.6 to synonym optidase activity of GO:0004096
* Changed synonym scope of GO:0004096 from "Related" to "Exact"
* Added synonym "1,2-benzenediol:oxygen oxidoreductase activity" to GO:0004097
* Added general dbxref EC:1.10.3.1 to synonym 1,2-benzenediol:oxygen oxidoreductase activity of GO:0004097
* Changed synonym scope of GO:0004097 from "Related" to "Exact"
* Added synonym "catecholase" to GO:0004097
* Added general dbxref EC:1.10.3.1 to synonym catecholase of GO:0004097
* Changed synonym scope of GO:0004097 from "Related" to "Broad"
* Added synonym "dopa oxidase" to GO:0004097
* Added general dbxref EC:1.10.3.1 to synonym dopa oxidase of GO:0004097
* Changed synonym scope of GO:0004097 from "Related" to "Broad"
* Added synonym "o-diphenol oxidoreductase" to GO:0004097
* Added general dbxref EC:1.10.3.1 to synonym o-diphenol oxidoreductase of GO:0004097
* Changed synonym scope of GO:0004097 from "Related" to "Broad"
* Added synonym "o-diphenol:oxygen oxidoreductase" to GO:0004097
* Added general dbxref EC:1.10.3.1 to synonym o-diphenol:oxygen oxidoreductase of GO:0004097
* Changed synonym scope of GO:0004097 from "Related" to "Broad"
* Added synonym "pyrocatechol oxidase" to GO:0004097
* Added general dbxref EC:1.10.3.1 to synonym pyrocatechol oxidase of GO:0004097
* Changed synonym scope of GO:0004097 from "Related" to "Broad"
* Added synonym "cerebroside sulfate sulfatase activity" to GO:0004098
* Added general dbxref EC:3.1.6.8 to synonym cerebroside sulfate sulfatase activity of GO:0004098
* Changed synonym scope of GO:0004098 from "Related" to "Exact"
* Added synonym "cerebroside-3-sulfate 3-sulfohydrolase activity" to GO:0004098
* Added general dbxref EC:3.1.6.8 to synonym cerebroside-3-sulfate 3-sulfohydrolase activity of GO:0004098
* Changed synonym scope of GO:0004098 from "Related" to "Exact"
* Added synonym "chitin amidohydrolase activity" to GO:0004099
* Added general dbxref EC:3.5.1.41 to synonym chitin amidohydrolase activity of GO:0004099
* Changed synonym scope of GO:0004099 from "Related" to "Exact"
* Added synonym "chitin synthetase activity" to GO:0004100
* Added general dbxref EC:2.4.1.16 to synonym chitin synthetase activity of GO:0004100
* Changed synonym scope of GO:0004100 from "Related" to "Exact"
* Added synonym "chitin-UDP N-acetylglucosaminyltransferase activity" to GO:0004100
* Added general dbxref EC:2.4.1.16 to synonym chitin-UDP N-acetylglucosaminyltransferase activity of GO:0004100
* Changed synonym scope of GO:0004100 from "Related" to "Exact"
* Added synonym "chitin-uridine diphosphate acetylglucosaminyltransferase activity" to GO:0004100
* Added general dbxref EC:2.4.1.16 to synonym chitin-uridine diphosphate acetylglucosaminyltransferase activity of GO:0004100
* Changed synonym scope of GO:0004100 from "Related" to "Exact"
* Added synonym "trans-N-acetylglucosaminosylase activity" to GO:0004100
* Added general dbxref EC:2.4.1.16 to synonym trans-N-acetylglucosaminosylase activity of GO:0004100
* Changed synonym scope of GO:0004100 from "Related" to "Exact"
* Added synonym "UDP-N-acetyl-D-glucosamine:chitin 4-beta-N-acetylglucosaminyl-transferase activity" to GO:0004100
* Added general dbxref EC:2.4.1.16 to synonym UDP-N-acetyl-D-glucosamine:chitin 4-beta-N-acetylglucosaminyl-transferase activity of GO:0004100
* Changed synonym scope of GO:0004100 from "Related" to "Exact"
* Added synonym "acetyl-CoA:choline O-acetyltransferase activity" to GO:0004102
* Added general dbxref EC:2.3.1.6 to synonym acetyl-CoA:choline O-acetyltransferase activity of GO:0004102
* Changed synonym scope of GO:0004102 from "Related" to "Exact"
* Added synonym "choline acetyltransferase activity" to GO:0004102
* Added general dbxref EC:2.3.1.6 to synonym choline acetyltransferase activity of GO:0004102
* Changed synonym scope of GO:0004102 from "Related" to "Exact"
* Added synonym "ATP:choline phosphotransferase activity" to GO:0004103
* Added general dbxref EC:2.7.1.32 to synonym ATP:choline phosphotransferase activity of GO:0004103
* Changed synonym scope of GO:0004103 from "Related" to "Exact"
* Added synonym "choline kinase (phosphorylating)" to GO:0004103
* Added general dbxref EC:2.7.1.32 to synonym choline kinase (phosphorylating) of GO:0004103
* Changed synonym scope of GO:0004103 from "Related" to "Exact"
* Added synonym "choline phosphokinase activity" to GO:0004103
* Added general dbxref EC:2.7.1.32 to synonym choline phosphokinase activity of GO:0004103
* Changed synonym scope of GO:0004103 from "Related" to "Exact"
* Added synonym "choline-ethanolamine kinase activity" to GO:0004103
* Added general dbxref EC:2.7.1.32 to synonym choline-ethanolamine kinase activity of GO:0004103
* Changed synonym scope of GO:0004103 from "Related" to "Exact"
* Added synonym "anticholineesterase activity" to GO:0004104
* Added general dbxref EC:3.1.1.8 to synonym anticholineesterase activity of GO:0004104
* Changed synonym scope of GO:0004104 from "Related" to "Exact"
* Added synonym "BtChoEase activity" to GO:0004104
* Added general dbxref EC:3.1.1.8 to synonym BtChoEase activity of GO:0004104
* Changed synonym scope of GO:0004104 from "Related" to "Exact"
* Added synonym "butyrylcholinesterase activity" to GO:0004104
* Added general dbxref EC:3.1.1.8 to synonym butyrylcholinesterase activity of GO:0004104
* Changed synonym scope of GO:0004104 from "Related" to "Exact"
* Added synonym "choline esterase activity" to GO:0004104
* Added general dbxref EC:3.1.1.8 to synonym choline esterase activity of GO:0004104
* Changed synonym scope of GO:0004104 from "Related" to "Exact"
* Added synonym "propionylcholinesterase activity" to GO:0004104
* Added general dbxref EC:3.1.1.8 to synonym propionylcholinesterase activity of GO:0004104
* Changed synonym scope of GO:0004104 from "Related" to "Exact"
* Added synonym "CDP-choline pyrophosphorylase activity" to GO:0004105
* Added general dbxref EC:2.7.7.15 to synonym CDP-choline pyrophosphorylase activity of GO:0004105
* Changed synonym scope of GO:0004105 from "Related" to "Exact"
* Added synonym "CDP-choline synthetase activity" to GO:0004105
* Added general dbxref EC:2.7.7.15 to synonym CDP-choline synthetase activity of GO:0004105
* Changed synonym scope of GO:0004105 from "Related" to "Exact"
* Added synonym "choline phosphate cytidylyltransferase activity" to GO:0004105
* Added general dbxref EC:2.7.7.15 to synonym choline phosphate cytidylyltransferase activity of GO:0004105
* Changed synonym scope of GO:0004105 from "Related" to "Exact"
* Added synonym "CTP-phosphocholine cytidylyltransferase activity" to GO:0004105
* Added general dbxref EC:2.7.7.15 to synonym CTP-phosphocholine cytidylyltransferase activity of GO:0004105
* Changed synonym scope of GO:0004105 from "Related" to "Exact"
* Added synonym "CTP:phosphorylcholine cytidylyltransferase activity" to GO:0004105
* Added general dbxref EC:2.7.7.15 to synonym CTP:phosphorylcholine cytidylyltransferase activity of GO:0004105
* Changed synonym scope of GO:0004105 from "Related" to "Exact"
* Added synonym "cytidine diphosphocholine pyrophosphorylase activity" to GO:0004105
* Added general dbxref EC:2.7.7.15 to synonym cytidine diphosphocholine pyrophosphorylase activity of GO:0004105
* Changed synonym scope of GO:0004105 from "Related" to "Exact"
* Added synonym "phosphocholine cytidylyltransferase activity" to GO:0004105
* Added general dbxref EC:2.7.7.15 to synonym phosphocholine cytidylyltransferase activity of GO:0004105
* Changed synonym scope of GO:0004105 from "Related" to "Exact"
* Added synonym "phosphorylcholine cytidylyltransferase activity" to GO:0004105
* Added general dbxref EC:2.7.7.15 to synonym phosphorylcholine cytidylyltransferase activity of GO:0004105
* Changed synonym scope of GO:0004105 from "Related" to "Exact"
* Added synonym "phosphorylcholine:CTP cytidylyltransferase activity" to GO:0004105
* Added general dbxref EC:2.7.7.15 to synonym phosphorylcholine:CTP cytidylyltransferase activity of GO:0004105
* Changed synonym scope of GO:0004105 from "Related" to "Exact"
* Added synonym "chorismate pyruvatemutase activity" to GO:0004106
* Added general dbxref EC:5.4.99.5 to synonym chorismate pyruvatemutase activity of GO:0004106
* Changed synonym scope of GO:0004106 from "Related" to "Exact"
* Added synonym "5-O-(1-carboxyvinyl)-3-phosphoshikimate phosphate-lyase (chorismate-forming)" to GO:0004107
* Added general dbxref EC:4.2.3.5 to synonym 5-O-(1-carboxyvinyl)-3-phosphoshikimate phosphate-lyase (chorismate-forming) of GO:0004107
* Changed synonym scope of GO:0004107 from "Related" to "Exact"
* Added synonym "5-O-(1-carboxyvinyl)-3-phosphoshikimate phosphate-lyase activity" to GO:0004107
* Added general dbxref EC:4.2.3.5 to synonym 5-O-(1-carboxyvinyl)-3-phosphoshikimate phosphate-lyase activity of GO:0004107
* Changed synonym scope of GO:0004107 from "Related" to "Exact"
* Added synonym "acetyl-CoA:oxaloacetate C-acetyltransferase [thioester-hydrolysing, (pro-S)-carboxymethyl forming]" to GO:0004108
* Added general dbxref EC:2.3.3.1 to synonym acetyl-CoA:oxaloacetate C-acetyltransferase [thioester-hydrolysing, (pro-S)-carboxymethyl forming] of GO:0004108
* Added synonym "citrate oxaloacetate-lyase ((pro-3S)-CH2COO-rightacetyl-CoA)" to GO:0004108
* Added general dbxref EC:2.3.3.1 to synonym citrate oxaloacetate-lyase ((pro-3S)-CH2COO-rightacetyl-CoA) of GO:0004108
* Changed synonym scope of GO:0004108 from "Related" to "Exact"
* Added synonym "citrate oxaloacetate-lyase [(pro-3S)-CH2COOrightacetyl-CoA]" to GO:0004108
* Added general dbxref EC:2.3.3.1 to synonym citrate oxaloacetate-lyase [(pro-3S)-CH2COOrightacetyl-CoA] of GO:0004108
* Added synonym "coproporphyrinogen:oxygen oxidoreductase (decarboxylating)" to GO:0004109
* Added general dbxref EC:1.3.3.3 to synonym coproporphyrinogen:oxygen oxidoreductase (decarboxylating) of GO:0004109
* Changed synonym scope of GO:0004109 from "Related" to "Exact"
* Added synonym "11-deoxycorticosterone aldose-ketose-isomerase activity" to GO:0004110
* Added general dbxref EC:5.3.1.21 to synonym 11-deoxycorticosterone aldose-ketose-isomerase activity of GO:0004110
* Changed synonym scope of GO:0004110 from "Related" to "Exact"
* Added synonym "11-deoxycorticosterone ketol-isomerase activity" to GO:0004110
* Added general dbxref EC:5.3.1.21 to synonym 11-deoxycorticosterone ketol-isomerase activity of GO:0004110
* Changed synonym scope of GO:0004110 from "Related" to "Exact"
* Added synonym "adenosine triphosphate-creatine transphosphorylase activity" to GO:0004111
* Added general dbxref EC:2.7.3.2 to synonym adenosine triphosphate-creatine transphosphorylase activity of GO:0004111
* Changed synonym scope of GO:0004111 from "Related" to "Exact"
* Added synonym "ATP:creatine N-phosphotransferase activity" to GO:0004111
* Added general dbxref EC:2.7.3.2 to synonym ATP:creatine N-phosphotransferase activity of GO:0004111
* Changed synonym scope of GO:0004111 from "Related" to "Exact"
* Added synonym "ATP:creatine phosphotransferase activity" to GO:0004111
* Added general dbxref EC:2.7.3.2 to synonym ATP:creatine phosphotransferase activity of GO:0004111
* Changed synonym scope of GO:0004111 from "Related" to "Exact"
* Added synonym "BB-CK" to GO:0004111
* Added general dbxref EC:2.7.3.2 to synonym BB-CK of GO:0004111
* Added synonym "CK" to GO:0004111
* Added general dbxref EC:2.7.3.2 to synonym CK of GO:0004111
* Added synonym "CK-BB" to GO:0004111
* Added general dbxref EC:2.7.3.2 to synonym CK-BB of GO:0004111
* Added synonym "CK-MB" to GO:0004111
* Added general dbxref EC:2.7.3.2 to synonym CK-MB of GO:0004111
* Added synonym "CK-MM" to GO:0004111
* Added general dbxref EC:2.7.3.2 to synonym CK-MM of GO:0004111
* Added synonym "CKMiMi" to GO:0004111
* Added general dbxref EC:2.7.3.2 to synonym CKMiMi of GO:0004111
* Added synonym "creatine phosphokinase activity" to GO:0004111
* Added general dbxref EC:2.7.3.2 to synonym creatine phosphokinase activity of GO:0004111
* Changed synonym scope of GO:0004111 from "Related" to "Exact"
* Added synonym "creatine phosphotransferase activity" to GO:0004111
* Added general dbxref EC:2.7.3.2 to synonym creatine phosphotransferase activity of GO:0004111
* Changed synonym scope of GO:0004111 from "Related" to "Exact"
* Added synonym "MB-CK" to GO:0004111
* Added general dbxref EC:2.7.3.2 to synonym MB-CK of GO:0004111
* Added synonym "Mi-CK" to GO:0004111
* Added general dbxref EC:2.7.3.2 to synonym Mi-CK of GO:0004111
* Added synonym "MiMi-CK" to GO:0004111
* Added general dbxref EC:2.7.3.2 to synonym MiMi-CK of GO:0004111
* Added synonym "MM-CK" to GO:0004111
* Added general dbxref EC:2.7.3.2 to synonym MM-CK of GO:0004111
* Added synonym "phosphocreatine kinase activity" to GO:0004111
* Added general dbxref EC:2.7.3.2 to synonym phosphocreatine kinase activity of GO:0004111
* Changed synonym scope of GO:0004111 from "Related" to "Exact"
* Added synonym "2',3'-cyclic AMP phosphodiesterase activity" to GO:0004113
* Added general dbxref EC:3.1.4.37 to synonym 2',3'-cyclic AMP phosphodiesterase activity of GO:0004113
* Changed synonym scope of GO:0004113 from "Related" to "Exact"
* Added synonym "2',3'-cyclic nucleoside monophosphate phosphodiesterase" to GO:0004113
* Added general dbxref EC:3.1.4.37 to synonym 2',3'-cyclic nucleoside monophosphate phosphodiesterase of GO:0004113
* Changed synonym scope of GO:0004113 from "Related" to "Broad"
* Added synonym "2',3'-cyclic nucleotide 3'-phosphohydrolase activity" to GO:0004113
* Added general dbxref EC:3.1.4.37 to synonym 2',3'-cyclic nucleotide 3'-phosphohydrolase activity of GO:0004113
* Changed synonym scope of GO:0004113 from "Related" to "Exact"
* Added synonym "2',3'-cyclic nucleotide phosphohydrolase" to GO:0004113
* Added general dbxref EC:3.1.4.37 to synonym 2',3'-cyclic nucleotide phosphohydrolase of GO:0004113
* Changed synonym scope of GO:0004113 from "Related" to "Broad"
* Added synonym "2':3'-CNMP-3'-ase activity" to GO:0004113
* Added general dbxref EC:3.1.4.37 to synonym 2':3'-CNMP-3'-ase activity of GO:0004113
* Changed synonym scope of GO:0004113 from "Related" to "Exact"
* Added synonym "2':3'-cyclic nucleotide 3'-phosphodiesterase activity" to GO:0004113
* Added general dbxref EC:3.1.4.37 to synonym 2':3'-cyclic nucleotide 3'-phosphodiesterase activity of GO:0004113
* Changed synonym scope of GO:0004113 from "Related" to "Exact"
* Added synonym "CNPase activity" to GO:0004113
* Added general dbxref EC:3.1.4.37 to synonym CNPase activity of GO:0004113
* Changed synonym scope of GO:0004113 from "Related" to "Exact"
* Added synonym "cyclic 2',3'-nucleotide 3'-phosphodiesterase activity" to GO:0004113
* Added general dbxref EC:3.1.4.37 to synonym cyclic 2',3'-nucleotide 3'-phosphodiesterase activity of GO:0004113
* Changed synonym scope of GO:0004113 from "Related" to "Exact"
* Added synonym "cyclic 2',3'-nucleotide phosphodiesterase" to GO:0004113
* Added general dbxref EC:3.1.4.37 to synonym cyclic 2',3'-nucleotide phosphodiesterase of GO:0004113
* Changed synonym scope of GO:0004113 from "Related" to "Broad"
* Added synonym "nucleoside-2',3'-cyclic-phosphate 2'-nucleotidohydrolase activity" to GO:0004113
* Added general dbxref EC:3.1.4.37 to synonym nucleoside-2',3'-cyclic-phosphate 2'-nucleotidohydrolase activity of GO:0004113
* Changed synonym scope of GO:0004113 from "Related" to "Exact"
* Added synonym "cystathionine L-homocysteine-lyase (deaminating)" to GO:0004121
* Added general dbxref EC:4.4.1.8 to synonym cystathionine L-homocysteine-lyase (deaminating) of GO:0004121
* Changed synonym scope of GO:0004121 from "Related" to "Exact"
* Added synonym "L-cystathionine L-homocysteine-lyase (deaminating)" to GO:0004121
* Added general dbxref EC:4.4.1.8 to synonym L-cystathionine L-homocysteine-lyase (deaminating) of GO:0004121
* Changed synonym scope of GO:0004121 from "Related" to "Exact"
* Added synonym "L-cystathionine L-homocysteine-lyase (deaminating; pyruvate-forming)" to GO:0004121
* Added general dbxref EC:4.4.1.8 to synonym L-cystathionine L-homocysteine-lyase (deaminating; pyruvate-forming) of GO:0004121
* Changed synonym scope of GO:0004121 from "Related" to "Exact"
* Added synonym "L-serine hydro-lyase (adding homocysteine)" to GO:0004122
* Added general dbxref EC:4.2.1.22 to synonym L-serine hydro-lyase (adding homocysteine) of GO:0004122
* Changed synonym scope of GO:0004122 from "Related" to "Exact"
* Added synonym "L-serine hydro-lyase (adding homocysteine; L-cystathionine-forming)" to GO:0004122
* Added general dbxref EC:4.2.1.22 to synonym L-serine hydro-lyase (adding homocysteine; L-cystathionine-forming) of GO:0004122
* Changed synonym scope of GO:0004122 from "Related" to "Exact"
* Added synonym "serine sulfhydrylase activity" to GO:0004122
* Added general dbxref EC:4.2.1.22 to synonym serine sulfhydrylase activity of GO:0004122
* Changed synonym scope of GO:0004122 from "Related" to "Exact"
* Added synonym "cystalysin" to GO:0004123
* Added general dbxref EC:4.4.1.1 to synonym cystalysin of GO:0004123
* Added synonym "gamma-CTL" to GO:0004123
* Added general dbxref EC:4.4.1.1 to synonym gamma-CTL of GO:0004123
* Added synonym "homoserine deaminase-cystathionase activity" to GO:0004123
* Added general dbxref EC:4.4.1.1 to synonym homoserine deaminase-cystathionase activity of GO:0004123
* Changed synonym scope of GO:0004123 from "Related" to "Exact"
* Added synonym "L-cystathionine cysteine-lyase (deaminating)" to GO:0004123
* Added general dbxref EC:4.4.1.1 to synonym L-cystathionine cysteine-lyase (deaminating) of GO:0004123
* Changed synonym scope of GO:0004123 from "Related" to "Exact"
* Added synonym "L-cystathionine cysteine-lyase (deaminating; 2-oxobutanoate-forming)" to GO:0004123
* Added general dbxref EC:4.4.1.1 to synonym L-cystathionine cysteine-lyase (deaminating; 2-oxobutanoate-forming) of GO:0004123
* Changed synonym scope of GO:0004123 from "Related" to "Exact"
* Added synonym "3-O-acetyl-L-serine:hydrogen-sulfide 2-amino-2-carboxyethyltransferase activity" to GO:0004124
* Added general dbxref EC:2.5.1.47 to synonym 3-O-acetyl-L-serine:hydrogen-sulfide 2-amino-2-carboxyethyltransferase activity of GO:0004124
* Changed synonym scope of GO:0004124 from "Related" to "Exact"
* Added synonym "O3-acetyl-L-serine acetate-lyase (adding hydrogen-sulfide)" to GO:0004124
* Added general dbxref EC:2.5.1.47 to synonym O3-acetyl-L-serine acetate-lyase (adding hydrogen-sulfide) of GO:0004124
* Changed synonym scope of GO:0004124 from "Related" to "Exact"
* Added synonym "O3-acetyl-L-serine:hydrogen-sulfide 2-amino-2-carboxyethyltransferase activity" to GO:0004124
* Added general dbxref EC:2.5.1.47 to synonym O3-acetyl-L-serine:hydrogen-sulfide 2-amino-2-carboxyethyltransferase activity of GO:0004124
* Changed synonym scope of GO:0004124 from "Related" to "Exact"
* Added synonym "cysteinyl-tRNASec-selenium transferase activity" to GO:0004125
* Added general dbxref EC:2.9.1.1 to synonym cysteinyl-tRNASec-selenium transferase activity of GO:0004125
* Changed synonym scope of GO:0004125 from "Related" to "Exact"
* Added synonym "cysteinyl-tRNASel-selenium transferase activity" to GO:0004125
* Added general dbxref EC:2.9.1.1 to synonym cysteinyl-tRNASel-selenium transferase activity of GO:0004125
* Changed synonym scope of GO:0004125 from "Related" to "Exact"
* Added synonym "L-selenocysteinyl-tRNASec synthase activity" to GO:0004125
* Added general dbxref EC:2.9.1.1 to synonym L-selenocysteinyl-tRNASec synthase activity of GO:0004125
* Changed synonym scope of GO:0004125 from "Related" to "Exact"
* Added synonym "L-selenocysteinyl-tRNASel synthase activity" to GO:0004125
* Added general dbxref EC:2.9.1.1 to synonym L-selenocysteinyl-tRNASel synthase activity of GO:0004125
* Changed synonym scope of GO:0004125 from "Related" to "Exact"
* Added synonym "selenophosphate:L-seryl-tRNASec selenium transferase activity" to GO:0004125
* Added general dbxref EC:2.9.1.1 to synonym selenophosphate:L-seryl-tRNASec selenium transferase activity of GO:0004125
* Changed synonym scope of GO:0004125 from "Related" to "Exact"
* Added synonym "ATP:CMP phosphotransferase activity" to GO:0004127
* Added general dbxref EC:2.7.4.14 to synonym ATP:CMP phosphotransferase activity of GO:0004127
* Changed synonym scope of GO:0004127 from "Related" to "Exact"
* Added synonym "ATP:UMP-CMP phosphotransferase activity" to GO:0004127
* Added general dbxref EC:2.7.4.14 to synonym ATP:UMP-CMP phosphotransferase activity of GO:0004127
* Changed synonym scope of GO:0004127 from "Related" to "Exact"
* Added synonym "CTP:CMP phosphotransferase activity" to GO:0004127
* Added general dbxref EC:2.7.4.14 to synonym CTP:CMP phosphotransferase activity of GO:0004127
* Changed synonym scope of GO:0004127 from "Related" to "Exact"
* Added synonym "deoxycytidine monophosphokinase activity" to GO:0004127
* Added general dbxref EC:2.7.4.14 to synonym deoxycytidine monophosphokinase activity of GO:0004127
* Changed synonym scope of GO:0004127 from "Related" to "Exact"
* Added synonym "pyrimidine nucleoside monophosphate kinase activity" to GO:0004127
* Added general dbxref EC:2.7.4.14 to synonym pyrimidine nucleoside monophosphate kinase activity of GO:0004127
* Changed synonym scope of GO:0004127 from "Related" to "Exact"
* Added synonym "UMP-CMP kinase activity" to GO:0004127
* Added general dbxref EC:2.7.4.14 to synonym UMP-CMP kinase activity of GO:0004127
* Changed synonym scope of GO:0004127 from "Related" to "Exact"
* Added synonym "cytochrome b5 reductase activity" to GO:0004128
* Added general dbxref EC:1.6.2.2 to synonym cytochrome b5 reductase activity of GO:0004128
* Changed synonym scope of GO:0004128 from "Related" to "Exact"
* Added synonym "dihydronicotinamide adenine dinucleotide-cytochrome b5 reductase activity" to GO:0004128
* Added general dbxref EC:1.6.2.2 to synonym dihydronicotinamide adenine dinucleotide-cytochrome b5 reductase activity of GO:0004128
* Changed synonym scope of GO:0004128 from "Related" to "Exact"
* Added synonym "NADH 5alpha-reductase activity" to GO:0004128
* Added general dbxref EC:1.6.2.2 to synonym NADH 5alpha-reductase activity of GO:0004128
* Changed synonym scope of GO:0004128 from "Related" to "Exact"
* Added synonym "NADH-cytochrome b5 reductase activity" to GO:0004128
* Added general dbxref EC:1.6.2.2 to synonym NADH-cytochrome b5 reductase activity of GO:0004128
* Changed synonym scope of GO:0004128 from "Related" to "Exact"
* Added synonym "NADH-cytochrome-b5 reductase activity" to GO:0004128
* Added general dbxref EC:1.6.2.2 to synonym NADH-cytochrome-b5 reductase activity of GO:0004128
* Changed synonym scope of GO:0004128 from "Related" to "Exact"
* Added synonym "NADH-ferricytochrome b5 oxidoreductase activity" to GO:0004128
* Added general dbxref EC:1.6.2.2 to synonym NADH-ferricytochrome b5 oxidoreductase activity of GO:0004128
* Changed synonym scope of GO:0004128 from "Related" to "Exact"
* Added synonym "NADH:ferricytochrome-b5 oxidoreductase activity" to GO:0004128
* Added general dbxref EC:1.6.2.2 to synonym NADH:ferricytochrome-b5 oxidoreductase activity of GO:0004128
* Changed synonym scope of GO:0004128 from "Related" to "Exact"
* Added synonym "reduced nicotinamide adeninedinucleotide-cytochrome b5 reductase activity" to GO:0004128
* Added general dbxref EC:1.6.2.2 to synonym reduced nicotinamide adeninedinucleotide-cytochrome b5 reductase activity of GO:0004128
* Changed synonym scope of GO:0004128 from "Related" to "Exact"
* Added synonym "apocytochrome c peroxidase activity" to GO:0004130
* Added general dbxref EC:1.11.1.5 to synonym apocytochrome c peroxidase activity of GO:0004130
* Changed synonym scope of GO:0004130 from "Related" to "Exact"
* Added synonym "cytochrome c peroxidase activity" to GO:0004130
* Added general dbxref EC:1.11.1.5 to synonym cytochrome c peroxidase activity of GO:0004130
* Changed synonym scope of GO:0004130 from "Related" to "Exact"
* Added synonym "cytochrome c-551 peroxidase activity" to GO:0004130
* Added general dbxref EC:1.11.1.5 to synonym cytochrome c-551 peroxidase activity of GO:0004130
* Changed synonym scope of GO:0004130 from "Related" to "Exact"
* Added synonym "cytochrome c-H2O oxidoreductase activity" to GO:0004130
* Added general dbxref EC:1.11.1.5 to synonym cytochrome c-H2O oxidoreductase activity of GO:0004130
* Changed synonym scope of GO:0004130 from "Related" to "Exact"
* Added synonym "cytochrome peroxidase activity" to GO:0004130
* Added general dbxref EC:1.11.1.5 to synonym cytochrome peroxidase activity of GO:0004130
* Changed synonym scope of GO:0004130 from "Related" to "Exact"
* Added synonym "ferrocytochrome-c:hydrogen-peroxide oxidoreductase activity" to GO:0004130
* Added general dbxref EC:1.11.1.5 to synonym ferrocytochrome-c:hydrogen-peroxide oxidoreductase activity of GO:0004130
* Changed synonym scope of GO:0004130 from "Related" to "Exact"
* Added synonym "mesocytochrome c peroxidase azide" to GO:0004130
* Added general dbxref EC:1.11.1.5 to synonym mesocytochrome c peroxidase azide of GO:0004130
* Added synonym "mesocytochrome c peroxidase cyanate" to GO:0004130
* Added general dbxref EC:1.11.1.5 to synonym mesocytochrome c peroxidase cyanate of GO:0004130
* Added synonym "mesocytochrome c peroxidase cyanide" to GO:0004130
* Added general dbxref EC:1.11.1.5 to synonym mesocytochrome c peroxidase cyanide of GO:0004130
* Added synonym "isocytosine deaminase activity" to GO:0004131
* Added general dbxref EC:3.5.4.1 to synonym isocytosine deaminase activity of GO:0004131
* Changed synonym scope of GO:0004131 from "Related" to "Exact"
* Added synonym "dCMP aminohydrolase activity" to GO:0004132
* Added general dbxref EC:3.5.4.12 to synonym dCMP aminohydrolase activity of GO:0004132
* Changed synonym scope of GO:0004132 from "Related" to "Exact"
* Added synonym "deoxy-CMP-deaminase activity" to GO:0004132
* Added general dbxref EC:3.5.4.12 to synonym deoxy-CMP-deaminase activity of GO:0004132
* Changed synonym scope of GO:0004132 from "Related" to "Exact"
* Added synonym "deoxycytidine monophosphate deaminase activity" to GO:0004132
* Added general dbxref EC:3.5.4.12 to synonym deoxycytidine monophosphate deaminase activity of GO:0004132
* Changed synonym scope of GO:0004132 from "Related" to "Exact"
* Added synonym "deoxycytidine-5'-monophosphate aminohydrolase activity" to GO:0004132
* Added general dbxref EC:3.5.4.12 to synonym deoxycytidine-5'-monophosphate aminohydrolase activity of GO:0004132
* Changed synonym scope of GO:0004132 from "Related" to "Exact"
* Added synonym "deoxycytidine-5'-phosphate deaminase activity" to GO:0004132
* Added general dbxref EC:3.5.4.12 to synonym deoxycytidine-5'-phosphate deaminase activity of GO:0004132
* Changed synonym scope of GO:0004132 from "Related" to "Exact"
* Added synonym "deoxycytidylate aminohydrolase activity" to GO:0004132
* Added general dbxref EC:3.5.4.12 to synonym deoxycytidylate aminohydrolase activity of GO:0004132
* Changed synonym scope of GO:0004132 from "Related" to "Exact"
* Added synonym "1,4-alpha-D-glucan:1,4-alpha-D-glucan 4-alpha-D-glycosyltransferase activity" to GO:0004134
* Added general dbxref EC:2.4.1.25 to synonym 1,4-alpha-D-glucan:1,4-alpha-D-glucan 4-alpha-D-glycosyltransferase activity of GO:0004134
* Changed synonym scope of GO:0004134 from "Related" to "Exact"
* Added synonym "amylomaltase activity" to GO:0004134
* Added general dbxref EC:2.4.1.25 to synonym amylomaltase activity of GO:0004134
* Changed synonym scope of GO:0004134 from "Related" to "Exact"
* Added synonym "debranching enzyme maltodextrin glycosyltransferase activity" to GO:0004134
* Added general dbxref EC:2.4.1.25 to synonym debranching enzyme maltodextrin glycosyltransferase activity of GO:0004134
* Changed synonym scope of GO:0004134 from "Related" to "Exact"
* Added synonym "dextrin transglycosylase activity" to GO:0004134
* Added general dbxref EC:2.4.1.25 to synonym dextrin transglycosylase activity of GO:0004134
* Changed synonym scope of GO:0004134 from "Related" to "Exact"
* Added synonym "amylopectin 1,6-glucosidase activity" to GO:0004135
* Added general dbxref EC:3.2.1.33 to synonym amylopectin 1,6-glucosidase activity of GO:0004135
* Changed synonym scope of GO:0004135 from "Related" to "Exact"
* Added synonym "dextrin-1,6-glucosidase activity" to GO:0004135
* Added general dbxref EC:3.2.1.33 to synonym dextrin-1,6-glucosidase activity of GO:0004135
* Changed synonym scope of GO:0004135 from "Related" to "Exact"
* Added synonym "glycogen phosphorylase-limit dextrin alpha-1,6-glucohydrolase activity" to GO:0004135
* Added general dbxref EC:3.2.1.33 to synonym glycogen phosphorylase-limit dextrin alpha-1,6-glucohydrolase activity of GO:0004135
* Changed synonym scope of GO:0004135 from "Related" to "Exact"
* Added synonym "ATP:deoxyadenosine 5'-phosphotransferase activity" to GO:0004136
* Added general dbxref EC:2.7.1.76 to synonym ATP:deoxyadenosine 5'-phosphotransferase activity of GO:0004136
* Changed synonym scope of GO:0004136 from "Related" to "Exact"
* Added synonym "deoxyadenosine kinase (phosphorylating)" to GO:0004136
* Added general dbxref EC:2.7.1.76 to synonym deoxyadenosine kinase (phosphorylating) of GO:0004136
* Changed synonym scope of GO:0004136 from "Related" to "Exact"
* Added synonym "purine-deoxyribonucleoside kinase activity" to GO:0004136
* Added general dbxref EC:2.7.1.76 to synonym purine-deoxyribonucleoside kinase activity of GO:0004136
* Changed synonym scope of GO:0004136 from "Related" to "Exact"
* Added synonym "2'-deoxycytidine kinase activity" to GO:0004137
* Added general dbxref EC:2.7.1.74 to synonym 2'-deoxycytidine kinase activity of GO:0004137
* Changed synonym scope of GO:0004137 from "Related" to "Exact"
* Added synonym "Ara-C kinase activity" to GO:0004137
* Added general dbxref EC:2.7.1.74 to synonym Ara-C kinase activity of GO:0004137
* Changed synonym scope of GO:0004137 from "Related" to "Exact"
* Added synonym "arabinofuranosylcytosine kinase activity" to GO:0004137
* Added general dbxref EC:2.7.1.74 to synonym arabinofuranosylcytosine kinase activity of GO:0004137
* Changed synonym scope of GO:0004137 from "Related" to "Exact"
* Added synonym "deoxycytidine kinase (phosphorylating)" to GO:0004137
* Added general dbxref EC:2.7.1.74 to synonym deoxycytidine kinase (phosphorylating) of GO:0004137
* Changed synonym scope of GO:0004137 from "Related" to "Exact"
* Added synonym "deoxycytidine-cytidine kinase activity" to GO:0004137
* Added general dbxref EC:2.7.1.74 to synonym deoxycytidine-cytidine kinase activity of GO:0004137
* Changed synonym scope of GO:0004137 from "Related" to "Exact"
* Added synonym "NTP:deoxycytidine 5'-phosphotransferase activity" to GO:0004137
* Added general dbxref EC:2.7.1.74 to synonym NTP:deoxycytidine 5'-phosphotransferase activity of GO:0004137
* Changed synonym scope of GO:0004137 from "Related" to "Exact"
* Added synonym "(dihydroxypropoxymethyl)guanine kinase activity" to GO:0004138
* Added general dbxref EC:2.7.1.113 to synonym (dihydroxypropoxymethyl)guanine kinase activity of GO:0004138
* Changed synonym scope of GO:0004138 from "Related" to "Exact"
* Added synonym "2'-deoxyguanosine kinase activity" to GO:0004138
* Added general dbxref EC:2.7.1.113 to synonym 2'-deoxyguanosine kinase activity of GO:0004138
* Changed synonym scope of GO:0004138 from "Related" to "Exact"
* Added synonym "ATP:deoxyguanosine 5'-phosphotransferase activity" to GO:0004138
* Added general dbxref EC:2.7.1.113 to synonym ATP:deoxyguanosine 5'-phosphotransferase activity of GO:0004138
* Changed synonym scope of GO:0004138 from "Related" to "Exact"
* Added synonym "deoxyguanosine kinase (phosphorylating)" to GO:0004138
* Added general dbxref EC:2.7.1.113 to synonym deoxyguanosine kinase (phosphorylating) of GO:0004138
* Changed synonym scope of GO:0004138 from "Related" to "Exact"
* Added synonym "NTP-deoxyguanosine 5'-phosphotransferase activity" to GO:0004138
* Added general dbxref EC:2.7.1.113 to synonym NTP-deoxyguanosine 5'-phosphotransferase activity of GO:0004138
* Changed synonym scope of GO:0004138 from "Related" to "Exact"
* Added synonym "2-deoxy-D-ribose-5-phosphate acetaldehyde-lyase (D-glyceraldehyde-3-phosphate-forming)" to GO:0004139
* Added general dbxref EC:4.1.2.4 to synonym 2-deoxy-D-ribose-5-phosphate acetaldehyde-lyase (D-glyceraldehyde-3-phosphate-forming) of GO:0004139
* Changed synonym scope of GO:0004139 from "Related" to "Exact"
* Added synonym "2-deoxyribose-5-phosphate aldolase activity" to GO:0004139
* Added general dbxref EC:4.1.2.4 to synonym 2-deoxyribose-5-phosphate aldolase activity of GO:0004139
* Changed synonym scope of GO:0004139 from "Related" to "Exact"
* Added synonym "deoxyribose-5-phosphate aldolase activity" to GO:0004139
* Added general dbxref EC:4.1.2.4 to synonym deoxyribose-5-phosphate aldolase activity of GO:0004139
* Changed synonym scope of GO:0004139 from "Related" to "Exact"
* Added synonym "3'-dephospho-CoA kinase activity" to GO:0004140
* Added general dbxref EC:2.7.1.24 to synonym 3'-dephospho-CoA kinase activity of GO:0004140
* Changed synonym scope of GO:0004140 from "Related" to "Exact"
* Added synonym "ATP:dephospho-CoA 3'-phosphotransferase activity" to GO:0004140
* Added general dbxref EC:2.7.1.24 to synonym ATP:dephospho-CoA 3'-phosphotransferase activity of GO:0004140
* Changed synonym scope of GO:0004140 from "Related" to "Exact"
* Added synonym "dephosphocoenzyme A kinase (phosphorylating)" to GO:0004140
* Added general dbxref EC:2.7.1.24 to synonym dephosphocoenzyme A kinase (phosphorylating) of GO:0004140
* Changed synonym scope of GO:0004140 from "Related" to "Exact"
* Added synonym "7,8-diaminononanoate:carbon-dioxide cyclo-ligase (ADP-forming)" to GO:0004141
* Added general dbxref EC:6.3.3.3 to synonym 7,8-diaminononanoate:carbon-dioxide cyclo-ligase (ADP-forming) of GO:0004141
* Changed synonym scope of GO:0004141 from "Related" to "Exact"
* Added synonym "desthiobiotin synthase activity" to GO:0004141
* Added general dbxref EC:6.3.3.3 to synonym desthiobiotin synthase activity of GO:0004141
* Changed synonym scope of GO:0004141 from "Related" to "Exact"
* Added synonym "1-alkyl-2-acetyl-m-glycerol:CDPcholine choline phosphotransferase activity" to GO:0004142
* Added general dbxref EC:2.7.8.2 to synonym 1-alkyl-2-acetyl-m-glycerol:CDPcholine choline phosphotransferase activity of GO:0004142
* Changed synonym scope of GO:0004142 from "Related" to "Exact"
* Added synonym "1-alkyl-2-acetyl-sn-glycerol cholinephosphotransferase activity" to GO:0004142
* Added general dbxref EC:2.7.8.2 to synonym 1-alkyl-2-acetyl-sn-glycerol cholinephosphotransferase activity of GO:0004142
* Changed synonym scope of GO:0004142 from "Related" to "Exact"
* Added synonym "alkylacylglycerol choline phosphotransferase activity" to GO:0004142
* Added general dbxref EC:2.7.8.2 to synonym alkylacylglycerol choline phosphotransferase activity of GO:0004142
* Changed synonym scope of GO:0004142 from "Related" to "Exact"
* Added synonym "CDP-choline diglyceride phosphotransferase activity" to GO:0004142
* Added general dbxref EC:2.7.8.2 to synonym CDP-choline diglyceride phosphotransferase activity of GO:0004142
* Changed synonym scope of GO:0004142 from "Related" to "Exact"
* Added synonym "CDP-choline:1,2-diacylglycerol cholinephosphotransferase activity" to GO:0004142
* Added general dbxref EC:2.7.8.2 to synonym CDP-choline:1,2-diacylglycerol cholinephosphotransferase activity of GO:0004142
* Changed synonym scope of GO:0004142 from "Related" to "Exact"
* Added synonym "CPT" to GO:0004142
* Added general dbxref EC:2.7.8.2 to synonym CPT of GO:0004142
* Added synonym "cytidine diphosphocholine glyceride transferase activity" to GO:0004142
* Added general dbxref EC:2.7.8.2 to synonym cytidine diphosphocholine glyceride transferase activity of GO:0004142
* Changed synonym scope of GO:0004142 from "Related" to "Exact"
* Added synonym "cytidine diphosphorylcholine diglyceride transferase activity" to GO:0004142
* Added general dbxref EC:2.7.8.2 to synonym cytidine diphosphorylcholine diglyceride transferase activity of GO:0004142
* Changed synonym scope of GO:0004142 from "Related" to "Exact"
* Added synonym "diacylglycerol choline phosphotransferase activity" to GO:0004142
* Added general dbxref EC:2.7.8.2 to synonym diacylglycerol choline phosphotransferase activity of GO:0004142
* Changed synonym scope of GO:0004142 from "Related" to "Exact"
* Added synonym "phosphocholine diacylglyceroltransferase activity" to GO:0004142
* Added general dbxref EC:2.7.8.2 to synonym phosphocholine diacylglyceroltransferase activity of GO:0004142
* Changed synonym scope of GO:0004142 from "Related" to "Exact"
* Added synonym "sn-1,2-diacylglycerol cholinephosphotransferase activity" to GO:0004142
* Added general dbxref EC:2.7.8.2 to synonym sn-1,2-diacylglycerol cholinephosphotransferase activity of GO:0004142
* Changed synonym scope of GO:0004142 from "Related" to "Exact"
* Added synonym "1,2-diacylglycerol kinase (phosphorylating)" to GO:0004143
* Added general dbxref EC:2.7.1.107 to synonym 1,2-diacylglycerol kinase (phosphorylating) of GO:0004143
* Changed synonym scope of GO:0004143 from "Related" to "Exact"
* Added synonym "1,2-diacylglycerol kinase activity" to GO:0004143
* Added general dbxref EC:2.7.1.107 to synonym 1,2-diacylglycerol kinase activity of GO:0004143
* Changed synonym scope of GO:0004143 from "Related" to "Exact"
* Added synonym "arachidonoyl-specific diacylglycerol kinase activity" to GO:0004143
* Added general dbxref EC:2.7.1.107 to synonym arachidonoyl-specific diacylglycerol kinase activity of GO:0004143
* Changed synonym scope of GO:0004143 from "Related" to "Exact"
* Added synonym "ATP:1,2-diacylglycerol 3-phosphotransferase activity" to GO:0004143
* Added general dbxref EC:2.7.1.107 to synonym ATP:1,2-diacylglycerol 3-phosphotransferase activity of GO:0004143
* Changed synonym scope of GO:0004143 from "Related" to "Exact"
* Added synonym "ATP:diacylglycerol phosphotransferase activity" to GO:0004143
* Added general dbxref EC:2.7.1.107 to synonym ATP:diacylglycerol phosphotransferase activity of GO:0004143
* Changed synonym scope of GO:0004143 from "Related" to "Exact"
* Added synonym "DG kinase activity" to GO:0004143
* Added general dbxref EC:2.7.1.107 to synonym DG kinase activity of GO:0004143
* Changed synonym scope of GO:0004143 from "Related" to "Exact"
* Added synonym "diacylglycerol:ATP kinase activity" to GO:0004143
* Added general dbxref EC:2.7.1.107 to synonym diacylglycerol:ATP kinase activity of GO:0004143
* Changed synonym scope of GO:0004143 from "Related" to "Exact"
* Added synonym "sn-1,2-diacylglycerol kinase activity" to GO:0004143
* Added general dbxref EC:2.7.1.107 to synonym sn-1,2-diacylglycerol kinase activity of GO:0004143
* Changed synonym scope of GO:0004143 from "Related" to "Exact"
* Added synonym "1,2-diacylglycerol acyltransferase activity" to GO:0004144
* Added general dbxref EC:2.3.1.20 to synonym 1,2-diacylglycerol acyltransferase activity of GO:0004144
* Changed synonym scope of GO:0004144 from "Related" to "Exact"
* Added synonym "acyl-CoA:1,2-diacylglycerol O-acyltransferase activity" to GO:0004144
* Added general dbxref EC:2.3.1.20 to synonym acyl-CoA:1,2-diacylglycerol O-acyltransferase activity of GO:0004144
* Changed synonym scope of GO:0004144 from "Related" to "Exact"
* Added synonym "diacylglycerol acyltransferase activity" to GO:0004144
* Added general dbxref EC:2.3.1.20 to synonym diacylglycerol acyltransferase activity of GO:0004144
* Changed synonym scope of GO:0004144 from "Related" to "Exact"
* Added synonym "diglyceride O-acyltransferase activity" to GO:0004144
* Added general dbxref EC:2.3.1.20 to synonym diglyceride O-acyltransferase activity of GO:0004144
* Changed synonym scope of GO:0004144 from "Related" to "Exact"
* Added synonym "palmitoyl-CoA-sn-1,2-diacylglycerol acyltransferase activity" to GO:0004144
* Added general dbxref EC:2.3.1.20 to synonym palmitoyl-CoA-sn-1,2-diacylglycerol acyltransferase activity of GO:0004144
* Changed synonym scope of GO:0004144 from "Related" to "Exact"
* Added synonym "acetyl-CoA:alkane-alpha,omega-diamine N-acetyltransferase activity" to GO:0004145
* Added general dbxref EC:2.3.1.57 to synonym acetyl-CoA:alkane-alpha,omega-diamine N-acetyltransferase activity of GO:0004145
* Changed synonym scope of GO:0004145 from "Related" to "Exact"
* Added synonym "spermidine N1-acetyltransferase activity" to GO:0004145
* Added general dbxref EC:2.3.1.57 to synonym spermidine N1-acetyltransferase activity of GO:0004145
* Changed synonym scope of GO:0004145 from "Related" to "Exact"
* Added synonym "spermidine/spermine N1-acetyltransferase activity" to GO:0004145
* Added general dbxref EC:2.3.1.57 to synonym spermidine/spermine N1-acetyltransferase activity of GO:0004145
* Changed synonym scope of GO:0004145 from "Related" to "Exact"
* Added synonym "5,6,7,8-tetrahydrofolate:NADP+ oxidoreductase activity" to GO:0004146
* Added general dbxref EC:1.5.1.3 to synonym 5,6,7,8-tetrahydrofolate:NADP+ oxidoreductase activity of GO:0004146
* Changed synonym scope of GO:0004146 from "Related" to "Exact"
* Added synonym "7,8-dihydrofolate reductase activity" to GO:0004146
* Added general dbxref EC:1.5.1.3 to synonym 7,8-dihydrofolate reductase activity of GO:0004146
* Changed synonym scope of GO:0004146 from "Related" to "Exact"
* Added synonym "DHFR" to GO:0004146
* Added general dbxref EC:1.5.1.3 to synonym DHFR of GO:0004146
* Added synonym "dihydrofolate reductase:thymidylate synthase activity" to GO:0004146
* Added general dbxref EC:1.5.1.3 to synonym dihydrofolate reductase:thymidylate synthase activity of GO:0004146
* Changed synonym scope of GO:0004146 from "Related" to "Exact"
* Added synonym "dihydrofolic acid reductase activity" to GO:0004146
* Added general dbxref EC:1.5.1.3 to synonym dihydrofolic acid reductase activity of GO:0004146
* Changed synonym scope of GO:0004146 from "Related" to "Exact"
* Added synonym "dihydrofolic reductase activity" to GO:0004146
* Added general dbxref EC:1.5.1.3 to synonym dihydrofolic reductase activity of GO:0004146
* Changed synonym scope of GO:0004146 from "Related" to "Exact"
* Added synonym "folic acid reductase activity" to GO:0004146
* Added general dbxref EC:1.5.1.3 to synonym folic acid reductase activity of GO:0004146
* Changed synonym scope of GO:0004146 from "Related" to "Exact"
* Added synonym "folic reductase activity" to GO:0004146
* Added general dbxref EC:1.5.1.3 to synonym folic reductase activity of GO:0004146
* Changed synonym scope of GO:0004146 from "Related" to "Exact"
* Added synonym "NADPH-dihydrofolate reductase activity" to GO:0004146
* Added general dbxref EC:1.5.1.3 to synonym NADPH-dihydrofolate reductase activity of GO:0004146
* Changed synonym scope of GO:0004146 from "Related" to "Exact"
* Added synonym "pteridine reductase:dihydrofolate reductase activity" to GO:0004146
* Added general dbxref EC:1.5.1.3 to synonym pteridine reductase:dihydrofolate reductase activity of GO:0004146
* Changed synonym scope of GO:0004146 from "Related" to "Exact"
* Added synonym "thymidylate synthetase-dihydrofolate reductase activity" to GO:0004146
* Added general dbxref EC:1.5.1.3 to synonym thymidylate synthetase-dihydrofolate reductase activity of GO:0004146
* Changed synonym scope of GO:0004146 from "Related" to "Exact"
* Deleted synonym "dihydrolipoamide branched chain transacylase" from GO:0004147
* Added synonym "dihydrolipoamide branched chain transacylase activity" to GO:0004147
* Changed synonym scope of GO:0004147 from "Related" to "Exact"
* Added synonym "2-amino-4-hydroxy-6-(D-erythro-1,2,3-trihydroxypropyl)-7,8-dihydropteridine glycolaldehyde-lyase (2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine-forming)" to GO:0004150
* Added general dbxref EC:4.1.2.25 to synonym 2-amino-4-hydroxy-6-(D-erythro-1,2,3-trihydroxypropyl)-7,8-dihydropteridine glycolaldehyde-lyase (2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine-forming) of GO:0004150
* Changed synonym scope of GO:0004150 from "Related" to "Exact"
* Added synonym "(S)-dihydroorotate amidohydrolase activity" to GO:0004151
* Added general dbxref EC:3.5.2.3 to synonym (S)-dihydroorotate amidohydrolase activity of GO:0004151
* Changed synonym scope of GO:0004151 from "Related" to "Exact"
* Added synonym "dihydroorotate hydrolase activity" to GO:0004151
* Added general dbxref EC:3.5.2.3 to synonym dihydroorotate hydrolase activity of GO:0004151
* Changed synonym scope of GO:0004151 from "Related" to "Exact"
* Added synonym "(S)-dihydroorotate:(acceptor) oxidoreductase activity" to GO:0004152
* Added general dbxref EC:1.3.99.11 to synonym (S)-dihydroorotate:(acceptor) oxidoreductase activity of GO:0004152
* Changed synonym scope of GO:0004152 from "Related" to "Exact"
* Added synonym "(S)-dihydroorotate:acceptor oxidoreductase activity" to GO:0004152
* Added general dbxref EC:1.3.99.11 to synonym (S)-dihydroorotate:acceptor oxidoreductase activity of GO:0004152
* Changed synonym scope of GO:0004152 from "Related" to "Exact"
* Added synonym "dihydroorotate:ubiquinone oxidoreductase activity" to GO:0004152
* Added general dbxref EC:1.3.99.11 to synonym dihydroorotate:ubiquinone oxidoreductase activity of GO:0004152
* Changed synonym scope of GO:0004152 from "Related" to "Exact"
* Added synonym "5,6,7,8-tetrahydropteridine:NAD(P)+ oxidoreductase activity" to GO:0004155
* Added general dbxref EC:1.5.1.34 to synonym 5,6,7,8-tetrahydropteridine:NAD(P)+ oxidoreductase activity of GO:0004155
* Changed synonym scope of GO:0004155 from "Related" to "Exact"
* Added synonym "5,6,7,8-tetrahydropteridine:NAD(P)H+ oxidoreductase activity" to GO:0004155
* Added general dbxref EC:1.5.1.34 to synonym 5,6,7,8-tetrahydropteridine:NAD(P)H+ oxidoreductase activity of GO:0004155
* Changed synonym scope of GO:0004155 from "Related" to "Exact"
* Added synonym "NAD(P)H2:6,7-dihydropteridine oxidoreductase activity" to GO:0004155
* Added general dbxref EC:1.5.1.34 to synonym NAD(P)H2:6,7-dihydropteridine oxidoreductase activity of GO:0004155
* Changed synonym scope of GO:0004155 from "Related" to "Exact"
* Added synonym "(2-amino-4-hydroxy-7,8-dihydropteridin-6-yl)methyl-diphosphate:4-aminobenzoate 2-amino-4-hydroxydihydropteridine-6-methenyltransferase activity" to GO:0004156
* Added general dbxref EC:2.5.1.15 to synonym (2-amino-4-hydroxy-7,8-dihydropteridin-6-yl)methyl-diphosphate:4-aminobenzoate 2-amino-4-hydroxydihydropteridine-6-methenyltransferase activity of GO:0004156
* Changed synonym scope of GO:0004156 from "Related" to "Exact"
* Added synonym "2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine-diphosphate:4-aminobenzoate 2-amino-4-hydroxydihydropteridine-6-methenyltransferase activity" to GO:0004156
* Added general dbxref EC:2.5.1.15 to synonym 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine-diphosphate:4-aminobenzoate 2-amino-4-hydroxydihydropteridine-6-methenyltransferase activity of GO:0004156
* Changed synonym scope of GO:0004156 from "Related" to "Exact"
* Added synonym "7,8-dihydropteroate synthase activity" to GO:0004156
* Added general dbxref EC:2.5.1.15 to synonym 7,8-dihydropteroate synthase activity of GO:0004156
* Changed synonym scope of GO:0004156 from "Related" to "Exact"
* Added synonym "7,8-dihydropteroate synthetase activity" to GO:0004156
* Added general dbxref EC:2.5.1.15 to synonym 7,8-dihydropteroate synthetase activity of GO:0004156
* Changed synonym scope of GO:0004156 from "Related" to "Exact"
* Added synonym "7,8-dihydropteroic acid synthetase activity" to GO:0004156
* Added general dbxref EC:2.5.1.15 to synonym 7,8-dihydropteroic acid synthetase activity of GO:0004156
* Changed synonym scope of GO:0004156 from "Related" to "Exact"
* Added synonym "dihydropteroate synthetase activity" to GO:0004156
* Added general dbxref EC:2.5.1.15 to synonym dihydropteroate synthetase activity of GO:0004156
* Changed synonym scope of GO:0004156 from "Related" to "Exact"
* Added synonym "dihydropteroic synthetase activity" to GO:0004156
* Added general dbxref EC:2.5.1.15 to synonym dihydropteroic synthetase activity of GO:0004156
* Changed synonym scope of GO:0004156 from "Related" to "Exact"
* Added synonym "5,6-dihydropyrimidine amidohydrolase activity" to GO:0004157
* Added general dbxref EC:3.5.2.2 to synonym 5,6-dihydropyrimidine amidohydrolase activity of GO:0004157
* Changed synonym scope of GO:0004157 from "Related" to "Exact"
* Added synonym "D-hydantoinase activity" to GO:0004157
* Added general dbxref EC:3.5.2.2 to synonym D-hydantoinase activity of GO:0004157
* Changed synonym scope of GO:0004157 from "Related" to "Exact"
* Added synonym "hydantoin peptidase activity" to GO:0004157
* Added general dbxref EC:3.5.2.2 to synonym hydantoin peptidase activity of GO:0004157
* Changed synonym scope of GO:0004157 from "Related" to "Exact"
* Added synonym "hydropyrimidine hydrase activity" to GO:0004157
* Added general dbxref EC:3.5.2.2 to synonym hydropyrimidine hydrase activity of GO:0004157
* Changed synonym scope of GO:0004157 from "Related" to "Exact"
* Added synonym "pyrimidine hydrase activity" to GO:0004157
* Added general dbxref EC:3.5.2.2 to synonym pyrimidine hydrase activity of GO:0004157
* Changed synonym scope of GO:0004157 from "Related" to "Exact"
* Added synonym "(DHO) dehydrogenase activity" to GO:0004158
* Added general dbxref EC:1.3.3.1 to synonym (DHO) dehydrogenase activity of GO:0004158
* Changed synonym scope of GO:0004158 from "Related" to "Exact"
* Added synonym "(S)-dihydroorotate:oxygen oxidoreductase activity" to GO:0004158
* Added general dbxref EC:1.3.3.1 to synonym (S)-dihydroorotate:oxygen oxidoreductase activity of GO:0004158
* Changed synonym scope of GO:0004158 from "Related" to "Exact"
* Added synonym "4,5-L-dihydroorotate:oxygen oxidoreductase activity" to GO:0004158
* Added general dbxref EC:1.3.3.1 to synonym 4,5-L-dihydroorotate:oxygen oxidoreductase activity of GO:0004158
* Changed synonym scope of GO:0004158 from "Related" to "Exact"
* Added synonym "dihydoorotic acid dehydrogenase activity" to GO:0004158
* Added general dbxref EC:1.3.3.1 to synonym dihydoorotic acid dehydrogenase activity of GO:0004158
* Changed synonym scope of GO:0004158 from "Related" to "Exact"
* Added synonym "5,6-dihydrouracil:NAD+ oxidoreductase activity" to GO:0004159
* Added general dbxref EC:1.3.1.1 to synonym 5,6-dihydrouracil:NAD+ oxidoreductase activity of GO:0004159
* Changed synonym scope of GO:0004159 from "Related" to "Exact"
* Added synonym "dehydrogenase, dihydrouracil" to GO:0004159
* Added general dbxref EC:1.3.1.1 to synonym dehydrogenase, dihydrouracil of GO:0004159
* Changed synonym scope of GO:0004159 from "Related" to "Exact"
* Added synonym "pyrimidine reductase activity" to GO:0004159
* Added general dbxref EC:1.3.1.1 to synonym pyrimidine reductase activity of GO:0004159
* Changed synonym scope of GO:0004159 from "Related" to "Exact"
* Added synonym "thymine reductase activity" to GO:0004159
* Added general dbxref EC:1.3.1.1 to synonym thymine reductase activity of GO:0004159
* Changed synonym scope of GO:0004159 from "Related" to "Exact"
* Added synonym "uracil reductase activity" to GO:0004159
* Added general dbxref EC:1.3.1.1 to synonym uracil reductase activity of GO:0004159
* Changed synonym scope of GO:0004159 from "Related" to "Exact"
* Added synonym "2,3-dihydroxy-acid hydro-lyase (3-methyl-2-oxobutanoate-forming)" to GO:0004160
* Added general dbxref EC:4.2.1.9 to synonym 2,3-dihydroxy-acid hydro-lyase (3-methyl-2-oxobutanoate-forming) of GO:0004160
* Changed synonym scope of GO:0004160 from "Related" to "Exact"
* Added synonym "2,3-dihydroxy-acid hydro-lyase activity" to GO:0004160
* Added general dbxref EC:4.2.1.9 to synonym 2,3-dihydroxy-acid hydro-lyase activity of GO:0004160
* Changed synonym scope of GO:0004160 from "Related" to "Exact"
* Added synonym "2,3-dihydroxyisovalerate dehydratase activity" to GO:0004160
* Added general dbxref EC:4.2.1.9 to synonym 2,3-dihydroxyisovalerate dehydratase activity of GO:0004160
* Changed synonym scope of GO:0004160 from "Related" to "Exact"
* Added synonym "acetohydroxyacid dehydratase activity" to GO:0004160
* Added general dbxref EC:4.2.1.9 to synonym acetohydroxyacid dehydratase activity of GO:0004160
* Changed synonym scope of GO:0004160 from "Related" to "Exact"
* Added synonym "alpha,beta-dihydroxyacid dehydratase activity" to GO:0004160
* Added general dbxref EC:4.2.1.9 to synonym alpha,beta-dihydroxyacid dehydratase activity of GO:0004160
* Changed synonym scope of GO:0004160 from "Related" to "Exact"
* Added synonym "alpha,beta-dihydroxyisovalerate dehydratase activity" to GO:0004160
* Added general dbxref EC:4.2.1.9 to synonym alpha,beta-dihydroxyisovalerate dehydratase activity of GO:0004160
* Changed synonym scope of GO:0004160 from "Related" to "Exact"
* Added synonym "DHAD" to GO:0004160
* Added general dbxref EC:4.2.1.9 to synonym DHAD of GO:0004160
* Added synonym "dihydroxy acid dehydrase activity" to GO:0004160
* Added general dbxref EC:4.2.1.9 to synonym dihydroxy acid dehydrase activity of GO:0004160
* Changed synonym scope of GO:0004160 from "Related" to "Exact"
* Added synonym "(2E,6E)-farnesyl diphosphate synthetase activity" to GO:0004161
* Added general dbxref EC:2.5.1.1 to synonym (2E,6E)-farnesyl diphosphate synthetase activity of GO:0004161
* Changed synonym scope of GO:0004161 from "Related" to "Exact"
* Added synonym "dimethylallyl-diphosphate:isopentenyl-diphosphate dimethylallyltranstransferase activity" to GO:0004161
* Added general dbxref EC:2.5.1.1 to synonym dimethylallyl-diphosphate:isopentenyl-diphosphate dimethylallyltranstransferase activity of GO:0004161
* Changed synonym scope of GO:0004161 from "Related" to "Exact"
* Added synonym "diprenyltransferase activity" to GO:0004161
* Added general dbxref EC:2.5.1.1 to synonym diprenyltransferase activity of GO:0004161
* Changed synonym scope of GO:0004161 from "Related" to "Exact"
* Added synonym "DMAPP:IPP-dimethylallyltransferase activity" to GO:0004161
* Added general dbxref EC:2.5.1.1 to synonym DMAPP:IPP-dimethylallyltransferase activity of GO:0004161
* Changed synonym scope of GO:0004161 from "Related" to "Exact"
* Added synonym "geranyl pyrophosphate synthase activity" to GO:0004161
* Added general dbxref EC:2.5.1.1 to synonym geranyl pyrophosphate synthase activity of GO:0004161
* Changed synonym scope of GO:0004161 from "Related" to "Exact"
* Added synonym "geranyl pyrophosphate synthetase activity" to GO:0004161
* Added general dbxref EC:2.5.1.1 to synonym geranyl pyrophosphate synthetase activity of GO:0004161
* Changed synonym scope of GO:0004161 from "Related" to "Exact"
* Added synonym "trans-farnesyl pyrophosphate synthetase activity" to GO:0004161
* Added general dbxref EC:2.5.1.1 to synonym trans-farnesyl pyrophosphate synthetase activity of GO:0004161
* Changed synonym scope of GO:0004161 from "Related" to "Exact"
* Added synonym "5-pyrophosphomevalonate decarboxylase activity" to GO:0004163
* Added general dbxref EC:4.1.1.33 to synonym 5-pyrophosphomevalonate decarboxylase activity of GO:0004163
* Changed synonym scope of GO:0004163 from "Related" to "Exact"
* Added synonym "ATP:(R)-5-diphosphomevalonate carboxy-lyase (adding ATP; isopentenyl-diphosphate-forming)" to GO:0004163
* Added general dbxref EC:4.1.1.33 to synonym ATP:(R)-5-diphosphomevalonate carboxy-lyase (adding ATP; isopentenyl-diphosphate-forming) of GO:0004163
* Changed synonym scope of GO:0004163 from "Related" to "Exact"
* Added synonym "ATP:(R)-5-diphosphomevalonate carboxy-lyase (dehydrating)" to GO:0004163
* Added general dbxref EC:4.1.1.33 to synonym ATP:(R)-5-diphosphomevalonate carboxy-lyase (dehydrating) of GO:0004163
* Changed synonym scope of GO:0004163 from "Related" to "Exact"
* Added synonym "mevalonate 5-diphosphate decarboxylase activity" to GO:0004163
* Added general dbxref EC:4.1.1.33 to synonym mevalonate 5-diphosphate decarboxylase activity of GO:0004163
* Changed synonym scope of GO:0004163 from "Related" to "Exact"
* Added synonym "mevalonate-5-pyrophosphate decarboxylase activity" to GO:0004163
* Added general dbxref EC:4.1.1.33 to synonym mevalonate-5-pyrophosphate decarboxylase activity of GO:0004163
* Changed synonym scope of GO:0004163 from "Related" to "Exact"
* Added synonym "pyrophosphomevalonate decarboxylase activity" to GO:0004163
* Added general dbxref EC:4.1.1.33 to synonym pyrophosphomevalonate decarboxylase activity of GO:0004163
* Changed synonym scope of GO:0004163 from "Related" to "Exact"
* Added synonym "pyrophosphomevalonic acid decarboxylase activity" to GO:0004163
* Added general dbxref EC:4.1.1.33 to synonym pyrophosphomevalonic acid decarboxylase activity of GO:0004163
* Changed synonym scope of GO:0004163 from "Related" to "Exact"
* Added synonym "diphthine methyltransferase activity" to GO:0004164
* Added general dbxref EC:2.1.1.98 to synonym diphthine methyltransferase activity of GO:0004164
* Changed synonym scope of GO:0004164 from "Related" to "Exact"
* Added synonym "S-adenosyl-L-methionine:2-(3-carboxy-3-aminopropyl)-L-histidine methyltransferase activity" to GO:0004164
* Added general dbxref EC:2.1.1.98 to synonym S-adenosyl-L-methionine:2-(3-carboxy-3-aminopropyl)-L-histidine methyltransferase activity of GO:0004164
* Changed synonym scope of GO:0004164 from "Related" to "Exact"
* Added synonym "S-adenosyl-L-methionine:elongation factor 2 methyltransferase activity" to GO:0004164
* Added general dbxref EC:2.1.1.98 to synonym S-adenosyl-L-methionine:elongation factor 2 methyltransferase activity of GO:0004164
* Changed synonym scope of GO:0004164 from "Related" to "Exact"
* Added synonym "delta3,Delta2-enoyl-CoA isomerase activity" to GO:0004165
* Added general dbxref EC:5.3.3.8 to synonym delta3,Delta2-enoyl-CoA isomerase activity of GO:0004165
* Changed synonym scope of GO:0004165 from "Related" to "Exact"
* Added synonym "delta3-cis-delta2-trans-enoyl-CoA isomerase" to GO:0004165
* Added general dbxref EC:5.3.3.8 to synonym delta3-cis-delta2-trans-enoyl-CoA isomerase of GO:0004165
* Changed synonym scope of GO:0004165 from "Related" to "Broad"
* Added synonym "dodecenoyl-CoA (3Z)-(2E)-isomerase activity" to GO:0004165
* Added general dbxref EC:5.3.3.8 to synonym dodecenoyl-CoA (3Z)-(2E)-isomerase activity of GO:0004165
* Changed synonym scope of GO:0004165 from "Related" to "Exact"
* Added synonym "dodecenoyl-CoA delta3-cis-delta2-trans-isomerase activity" to GO:0004165
* Added general dbxref EC:5.3.3.8 to synonym dodecenoyl-CoA delta3-cis-delta2-trans-isomerase activity of GO:0004165
* Changed synonym scope of GO:0004165 from "Related" to "Exact"
* Added synonym "dodecenoyl-CoA isomerase activity" to GO:0004165
* Added general dbxref EC:5.3.3.8 to synonym dodecenoyl-CoA isomerase activity of GO:0004165
* Changed synonym scope of GO:0004165 from "Related" to "Exact"
* Added synonym "dolichyl phosphate acetylglucosaminyltransferase activity" to GO:0004166
* Added general dbxref EC:2.4.1.153 to synonym dolichyl phosphate acetylglucosaminyltransferase activity of GO:0004166
* Changed synonym scope of GO:0004166 from "Related" to "Exact"
* Added synonym "dolichyl phosphate N-acetylglucosaminyltransferase activity" to GO:0004166
* Added general dbxref EC:2.4.1.153 to synonym dolichyl phosphate N-acetylglucosaminyltransferase activity of GO:0004166
* Changed synonym scope of GO:0004166 from "Related" to "Exact"
* Added synonym "UDP-N-acetyl-D-glucosamine:dolichyl-phosphate alpha-N-acetyl-D-glucosaminyltransferase activity" to GO:0004166
* Added general dbxref EC:2.4.1.153 to synonym UDP-N-acetyl-D-glucosamine:dolichyl-phosphate alpha-N-acetyl-D-glucosaminyltransferase activity of GO:0004166
* Changed synonym scope of GO:0004166 from "Related" to "Exact"
* Added synonym "UDP-N-acetylglucosamine-dolichol phosphate N-acetylglucosaminyltransferase activity" to GO:0004166
* Added general dbxref EC:2.4.1.153 to synonym UDP-N-acetylglucosamine-dolichol phosphate N-acetylglucosaminyltransferase activity of GO:0004166
* Changed synonym scope of GO:0004166 from "Related" to "Exact"
* Added synonym "uridine diphosphoacetylglucosamine-dolichol phosphate acetylglucosaminyltransferase activity" to GO:0004166
* Added general dbxref EC:2.4.1.153 to synonym uridine diphosphoacetylglucosamine-dolichol phosphate acetylglucosaminyltransferase activity of GO:0004166
* Changed synonym scope of GO:0004166 from "Related" to "Exact"
* Added synonym "dopachrome delta7,Delta2-isomerase activity" to GO:0004167
* Added general dbxref EC:5.3.3.12 to synonym dopachrome delta7,Delta2-isomerase activity of GO:0004167
* Changed synonym scope of GO:0004167 from "Related" to "Exact"
* Added synonym "dopachrome-rearranging enzyme" to GO:0004167
* Added general dbxref EC:5.3.3.12 to synonym dopachrome-rearranging enzyme of GO:0004167
* Added synonym "L-dopachrome isomerase activity" to GO:0004167
* Added general dbxref EC:5.3.3.12 to synonym L-dopachrome isomerase activity of GO:0004167
* Changed synonym scope of GO:0004167 from "Related" to "Exact"
* Added synonym "L-dopachrome keto-enol isomerase activity" to GO:0004167
* Added general dbxref EC:5.3.3.12 to synonym L-dopachrome keto-enol isomerase activity of GO:0004167
* Changed synonym scope of GO:0004167 from "Related" to "Exact"
* Added synonym "TRP-1" to GO:0004167
* Added general dbxref EC:5.3.3.12 to synonym TRP-1 of GO:0004167
* Added synonym "TRP-2" to GO:0004167
* Added general dbxref EC:5.3.3.12 to synonym TRP-2 of GO:0004167
* Added synonym "TRP2" to GO:0004167
* Added general dbxref EC:5.3.3.12 to synonym TRP2 of GO:0004167
* Added synonym "tryosinase-related protein-2" to GO:0004167
* Added general dbxref EC:5.3.3.12 to synonym tryosinase-related protein-2 of GO:0004167
* Added synonym "CTP:dolichol O-phosphotransferase activity" to GO:0004168
* Added general dbxref EC:2.7.1.108 to synonym CTP:dolichol O-phosphotransferase activity of GO:0004168
* Changed synonym scope of GO:0004168 from "Related" to "Exact"
* Added synonym "dolichol phosphokinase activity" to GO:0004168
* Added general dbxref EC:2.7.1.108 to synonym dolichol phosphokinase activity of GO:0004168
* Changed synonym scope of GO:0004168 from "Related" to "Exact"
* Deleted synonym "protein O-mannosyltransferase" from GO:0004169
* Added synonym "dolichol phosphomannose-protein mannosyltransferase activity" to GO:0004169
* Added general dbxref EC:2.4.1.109 to synonym dolichol phosphomannose-protein mannosyltransferase activity of GO:0004169
* Changed synonym scope of GO:0004169 from "Related" to "Exact"
* Added synonym "dolichyl-phosphate-D-mannose:protein O-D-mannosyltransferase activity" to GO:0004169
* Added general dbxref EC:2.4.1.109 to synonym dolichyl-phosphate-D-mannose:protein O-D-mannosyltransferase activity of GO:0004169
* Changed synonym scope of GO:0004169 from "Related" to "Exact"
* Added synonym "protein O-D-mannosyltransferase activity" to GO:0004169
* Added general dbxref EC:2.4.1.109 to synonym protein O-D-mannosyltransferase activity of GO:0004169
* Changed synonym scope of GO:0004169 from "Related" to "Exact"
* Added synonym "protein O-mannosyltransferase activity" to GO:0004169
* Changed synonym scope of GO:0004169 from "Related" to "Exact"
* Added synonym "dUTP nucleotidohydrolase activity" to GO:0004170
* Added general dbxref EC:3.6.1.23 to synonym dUTP nucleotidohydrolase activity of GO:0004170
* Changed synonym scope of GO:0004170 from "Related" to "Exact"
* Added synonym "acyl-CoA:ecdysone acyltransferase activity" to GO:0004173
* Added general dbxref EC:2.3.1.139 to synonym acyl-CoA:ecdysone acyltransferase activity of GO:0004173
* Changed synonym scope of GO:0004173 from "Related" to "Exact"
* Added synonym "fatty acyl-CoA:ecdysone acyltransferase activity" to GO:0004173
* Added general dbxref EC:2.3.1.139 to synonym fatty acyl-CoA:ecdysone acyltransferase activity of GO:0004173
* Changed synonym scope of GO:0004173 from "Related" to "Exact"
* Added synonym "palmitoyl-CoA:ecdysone palmitoyltransferase activity" to GO:0004173
* Added general dbxref EC:2.3.1.139 to synonym palmitoyl-CoA:ecdysone palmitoyltransferase activity of GO:0004173
* Changed synonym scope of GO:0004173 from "Related" to "Exact"
* Added synonym "electron transfer flavoprotein dehydrogenase activity" to GO:0004174
* Added general dbxref EC:1.5.5.1 to synonym electron transfer flavoprotein dehydrogenase activity of GO:0004174
* Changed synonym scope of GO:0004174 from "Related" to "Exact"
* Added synonym "electron transfer flavoprotein Q oxidoreductase activity" to GO:0004174
* Added general dbxref EC:1.5.5.1 to synonym electron transfer flavoprotein Q oxidoreductase activity of GO:0004174
* Changed synonym scope of GO:0004174 from "Related" to "Exact"
* Added synonym "electron transfer flavoprotein reductase activity" to GO:0004174
* Added general dbxref EC:1.5.5.1 to synonym electron transfer flavoprotein reductase activity of GO:0004174
* Changed synonym scope of GO:0004174 from "Related" to "Exact"
* Added synonym "electron-transferring-flavoprotein:ubiquinone oxidoreductase activity" to GO:0004174
* Added general dbxref EC:1.5.5.1 to synonym electron-transferring-flavoprotein:ubiquinone oxidoreductase activity of GO:0004174
* Changed synonym scope of GO:0004174 from "Related" to "Exact"
* Added synonym "ETF:ubiquinone oxidoreductase activity" to GO:0004174
* Added general dbxref EC:1.5.5.1 to synonym ETF:ubiquinone oxidoreductase activity of GO:0004174
* Changed synonym scope of GO:0004174 from "Related" to "Exact"
* Deleted synonym "endoprotease" from GO:0004175
* Added synonym "endoprotease activity" to GO:0004175
* Changed synonym scope of GO:0004175 from "Related" to "Exact"
* Added synonym "aminopeptidase II" to GO:0004178
* Added general dbxref EC:3.4.11.1 to synonym aminopeptidase II of GO:0004178
* Added synonym "cathepsin III" to GO:0004178
* Added general dbxref EC:3.4.11.1 to synonym cathepsin III of GO:0004178
* Added synonym "FTBL proteins" to GO:0004178
* Added general dbxref EC:3.4.11.1 to synonym FTBL proteins of GO:0004178
* Added synonym "L-leucine aminopeptidase activity" to GO:0004178
* Added general dbxref EC:3.4.11.1 to synonym L-leucine aminopeptidase activity of GO:0004178
* Changed synonym scope of GO:0004178 from "Related" to "Exact"
* Added synonym "leucinamide aminopeptidase activity" to GO:0004178
* Added general dbxref EC:3.4.11.1 to synonym leucinamide aminopeptidase activity of GO:0004178
* Changed synonym scope of GO:0004178 from "Related" to "Exact"
* Added synonym "leucinaminopeptidase activity" to GO:0004178
* Added general dbxref EC:3.4.11.1 to synonym leucinaminopeptidase activity of GO:0004178
* Changed synonym scope of GO:0004178 from "Related" to "Exact"
* Added synonym "leucyl peptidase activity" to GO:0004178
* Added general dbxref EC:3.4.11.1 to synonym leucyl peptidase activity of GO:0004178
* Changed synonym scope of GO:0004178 from "Related" to "Exact"
* Added synonym "proteinates FTBL" to GO:0004178
* Added general dbxref EC:3.4.11.1 to synonym proteinates FTBL of GO:0004178
* Added synonym "alanine-specific aminopeptidase activity" to GO:0004179
* Added general dbxref EC:3.4.11.2 to synonym alanine-specific aminopeptidase activity of GO:0004179
* Changed synonym scope of GO:0004179 from "Related" to "Exact"
* Added synonym "alanyl aminopeptidase activity" to GO:0004179
* Added general dbxref EC:3.4.11.2 to synonym alanyl aminopeptidase activity of GO:0004179
* Changed synonym scope of GO:0004179 from "Related" to "Exact"
* Added synonym "CD13" to GO:0004179
* Added general dbxref EC:3.4.11.2 to synonym CD13 of GO:0004179
* Added synonym "cysteinylglycinase activity" to GO:0004179
* Added general dbxref EC:3.4.11.2 to synonym cysteinylglycinase activity of GO:0004179
* Changed synonym scope of GO:0004179 from "Related" to "Exact"
* Added synonym "cysteinylglycine dipeptidase activity" to GO:0004179
* Added general dbxref EC:3.4.11.2 to synonym cysteinylglycine dipeptidase activity of GO:0004179
* Changed synonym scope of GO:0004179 from "Related" to "Exact"
* Added synonym "L-alanine aminopeptidase activity" to GO:0004179
* Added general dbxref EC:3.4.11.2 to synonym L-alanine aminopeptidase activity of GO:0004179
* Changed synonym scope of GO:0004179 from "Related" to "Exact"
* Added synonym "pseudo leucine aminopeptidase activity" to GO:0004179
* Added general dbxref EC:3.4.11.2 to synonym pseudo leucine aminopeptidase activity of GO:0004179
* Changed synonym scope of GO:0004179 from "Related" to "Exact"
* Added synonym "pancreatic carboxypeptidase A" to GO:0004182
* Added general dbxref EC:3.4.17.1 to synonym pancreatic carboxypeptidase A of GO:0004182
* Added synonym "tissue carboxypeptidase A" to GO:0004182
* Added general dbxref EC:3.4.17.1 to synonym tissue carboxypeptidase A of GO:0004182
* Added synonym "cobalt-stimulated chromaffin granule carboxypeptidase activity" to GO:0004183
* Added general dbxref EC:3.4.17.10 to synonym cobalt-stimulated chromaffin granule carboxypeptidase activity of GO:0004183
* Changed synonym scope of GO:0004183 from "Related" to "Exact"
* Added synonym "enkephalin precursor carboxypeptidase activity" to GO:0004183
* Added general dbxref EC:3.4.17.10 to synonym enkephalin precursor carboxypeptidase activity of GO:0004183
* Changed synonym scope of GO:0004183 from "Related" to "Exact"
* Added synonym "enkephalin-precursor endopeptidase activity" to GO:0004183
* Added general dbxref EC:3.4.17.10 to synonym enkephalin-precursor endopeptidase activity of GO:0004183
* Changed synonym scope of GO:0004183 from "Related" to "Exact"
* Added synonym "insulin granule-associated carboxypeptidase activity" to GO:0004183
* Added general dbxref EC:3.4.17.10 to synonym insulin granule-associated carboxypeptidase activity of GO:0004183
* Changed synonym scope of GO:0004183 from "Related" to "Exact"
* Added synonym "membrane-bound carboxypeptidase activity" to GO:0004183
* Added general dbxref EC:3.4.17.10 to synonym membrane-bound carboxypeptidase activity of GO:0004183
* Changed synonym scope of GO:0004183 from "Related" to "Exact"
* Added synonym "peptidyl-L-lysine(-L-arginine) hydrolase" to GO:0004183
* Added general dbxref EC:3.4.17.10 to synonym peptidyl-L-lysine(-L-arginine) hydrolase of GO:0004183
* Changed synonym scope of GO:0004183 from "Related" to "Broad"
* Added synonym "bradykinase activity" to GO:0004184
* Added general dbxref EC:3.4.17.3 to synonym bradykinase activity of GO:0004184
* Changed synonym scope of GO:0004184 from "Related" to "Exact"
* Added synonym "bradykinin-decomposing enzyme" to GO:0004184
* Added general dbxref EC:3.4.17.3 to synonym bradykinin-decomposing enzyme of GO:0004184
* Added synonym "CPase N" to GO:0004184
* Added general dbxref EC:3.4.17.3 to synonym CPase N of GO:0004184
* Added synonym "creatine kinase conversion factor" to GO:0004184
* Added general dbxref EC:3.4.17.3 to synonym creatine kinase conversion factor of GO:0004184
* Added synonym "creatinine kinase convertase activity" to GO:0004184
* Added general dbxref EC:3.4.17.3 to synonym creatinine kinase convertase activity of GO:0004184
* Changed synonym scope of GO:0004184 from "Related" to "Exact"
* Added synonym "hippuryllysine hydrolase activity" to GO:0004184
* Added general dbxref EC:3.4.17.3 to synonym hippuryllysine hydrolase activity of GO:0004184
* Changed synonym scope of GO:0004184 from "Related" to "Exact"
* Added synonym "kininase Ia" to GO:0004184
* Added general dbxref EC:3.4.17.3 to synonym kininase Ia of GO:0004184
* Added synonym "peptidyl-L-lysine(-L-arginine) hydrolase" to GO:0004184
* Added general dbxref EC:3.4.17.3 to synonym peptidyl-L-lysine(-L-arginine) hydrolase of GO:0004184
* Changed synonym scope of GO:0004184 from "Related" to "Broad"
* Added synonym "plasma carboxypeptidase B" to GO:0004184
* Added general dbxref EC:3.4.17.3 to synonym plasma carboxypeptidase B of GO:0004184
* Added synonym "carboxypeptidase Kex1" to GO:0004187
* Added general dbxref EC:3.4.16.6 to synonym carboxypeptidase Kex1 of GO:0004187
* Added synonym "cereal serine carboxypeptidase II" to GO:0004187
* Added general dbxref EC:3.4.16.6 to synonym cereal serine carboxypeptidase II of GO:0004187
* Added synonym "CPDW-II" to GO:0004187
* Added general dbxref EC:3.4.16.6 to synonym CPDW-II of GO:0004187
* Added synonym "gene KEX1 serine carboxypeptidase" to GO:0004187
* Added general dbxref EC:3.4.16.6 to synonym gene KEX1 serine carboxypeptidase of GO:0004187
* Changed synonym scope of GO:0004187 from "Related" to "Narrow"
* Added synonym "KEX1 carboxypeptidase activity" to GO:0004187
* Added general dbxref EC:3.4.16.6 to synonym KEX1 carboxypeptidase activity of GO:0004187
* Changed synonym scope of GO:0004187 from "Related" to "Exact"
* Added synonym "KEX1 proteinase activity" to GO:0004187
* Added general dbxref EC:3.4.16.6 to synonym KEX1 proteinase activity of GO:0004187
* Changed synonym scope of GO:0004187 from "Related" to "Exact"
* Added synonym "KEX1DELTAp" to GO:0004187
* Added general dbxref EC:3.4.16.6 to synonym KEX1DELTAp of GO:0004187
* Added synonym "saccharomyces cerevisiae KEX1 gene product" to GO:0004187
* Added general dbxref EC:3.4.16.6 to synonym saccharomyces cerevisiae KEX1 gene product of GO:0004187
* Added synonym "aminoacylproline carboxypeptidase activity" to GO:0004188
* Added general dbxref EC:3.4.16.2 to synonym aminoacylproline carboxypeptidase activity of GO:0004188
* Changed synonym scope of GO:0004188 from "Related" to "Exact"
* Added synonym "lysosomal Pro-Xaa carboxypeptidase activity" to GO:0004188
* Added general dbxref EC:3.4.16.2 to synonym lysosomal Pro-Xaa carboxypeptidase activity of GO:0004188
* Changed synonym scope of GO:0004188 from "Related" to "Exact"
* Added synonym "PCP" to GO:0004188
* Added general dbxref EC:3.4.16.2 to synonym PCP of GO:0004188
* Added synonym "peptidylprolylamino acid carboxypeptidase activity" to GO:0004188
* Added general dbxref EC:3.4.16.2 to synonym peptidylprolylamino acid carboxypeptidase activity of GO:0004188
* Changed synonym scope of GO:0004188 from "Related" to "Exact"
* Added synonym "proline-specific carboxypeptidase P" to GO:0004188
* Added general dbxref EC:3.4.16.2 to synonym proline-specific carboxypeptidase P of GO:0004188
* Added synonym "brain I carboxypeptidase activity" to GO:0004189
* Added general dbxref EC:3.4.17.17 to synonym brain I carboxypeptidase activity of GO:0004189
* Changed synonym scope of GO:0004189 from "Related" to "Exact"
* Added synonym "TTCPase activity" to GO:0004189
* Added general dbxref EC:3.4.17.17 to synonym TTCPase activity of GO:0004189
* Changed synonym scope of GO:0004189 from "Related" to "Exact"
* Added synonym "tubulin carboxypeptidase activity" to GO:0004189
* Added general dbxref EC:3.4.17.17 to synonym tubulin carboxypeptidase activity of GO:0004189
* Changed synonym scope of GO:0004189 from "Related" to "Exact"
* Added synonym "tubulin-tyrosine carboxypeptidase activity" to GO:0004189
* Added general dbxref EC:3.4.17.17 to synonym tubulin-tyrosine carboxypeptidase activity of GO:0004189
* Changed synonym scope of GO:0004189 from "Related" to "Exact"
* Added synonym "tubulinyltyrosine carboxypeptidase activity" to GO:0004189
* Added general dbxref EC:3.4.17.17 to synonym tubulinyltyrosine carboxypeptidase activity of GO:0004189
* Changed synonym scope of GO:0004189 from "Related" to "Exact"
* Added synonym "tyrosinotubulin carboxypeptidase activity" to GO:0004189
* Added general dbxref EC:3.4.17.17 to synonym tyrosinotubulin carboxypeptidase activity of GO:0004189
* Changed synonym scope of GO:0004189 from "Related" to "Exact"
* Added synonym "tyrosyltubulin carboxypeptidase activity" to GO:0004189
* Added general dbxref EC:3.4.17.17 to synonym tyrosyltubulin carboxypeptidase activity of GO:0004189
* Changed synonym scope of GO:0004189 from "Related" to "Exact"
* Added synonym "barrier proteinase activity" to GO:0004191
* Added general dbxref EC:3.4.23.35 to synonym barrier proteinase activity of GO:0004191
* Changed synonym scope of GO:0004191 from "Related" to "Exact"
* Added synonym "cathepsin D-like acid proteinase activity" to GO:0004193
* Added general dbxref EC:3.4.23.34 to synonym cathepsin D-like acid proteinase activity of GO:0004193
* Changed synonym scope of GO:0004193 from "Related" to "Exact"
* Added synonym "cathepsin D-type proteinase activity" to GO:0004193
* Added general dbxref EC:3.4.23.34 to synonym cathepsin D-type proteinase activity of GO:0004193
* Changed synonym scope of GO:0004193 from "Related" to "Exact"
* Added synonym "cathepsin E-like acid proteinase activity" to GO:0004193
* Added general dbxref EC:3.4.23.34 to synonym cathepsin E-like acid proteinase activity of GO:0004193
* Changed synonym scope of GO:0004193 from "Related" to "Exact"
* Added synonym "EMAP" to GO:0004193
* Added general dbxref EC:3.4.23.34 to synonym EMAP of GO:0004193
* Added synonym "non-pepsin proteinase activity" to GO:0004193
* Added general dbxref EC:3.4.23.34 to synonym non-pepsin proteinase activity of GO:0004193
* Changed synonym scope of GO:0004193 from "Related" to "Exact"
* Added synonym "SMP" to GO:0004193
* Added general dbxref EC:3.4.23.34 to synonym SMP of GO:0004193
* Added synonym "elixir lactate of pepsin" to GO:0004194
* Added general dbxref EC:3.4.23.1 to synonym elixir lactate of pepsin of GO:0004194
* Added synonym "fundus-pepsin" to GO:0004194
* Added general dbxref EC:3.4.23.1 to synonym fundus-pepsin of GO:0004194
* Added synonym "lactated pepsin" to GO:0004194
* Added general dbxref EC:3.4.23.1 to synonym lactated pepsin of GO:0004194
* Added synonym "lactated pepsin elixir" to GO:0004194
* Added general dbxref EC:3.4.23.1 to synonym lactated pepsin elixir of GO:0004194
* Added synonym "P I" to GO:0004194
* Added general dbxref EC:3.4.23.1 to synonym P I of GO:0004194
* Added synonym "P II" to GO:0004194
* Added general dbxref EC:3.4.23.1 to synonym P II of GO:0004194
* Added synonym "pepsin D" to GO:0004194
* Added general dbxref EC:3.4.23.1 to synonym pepsin D of GO:0004194
* Added synonym "pepsin fortior" to GO:0004194
* Added general dbxref EC:3.4.23.1 to synonym pepsin fortior of GO:0004194
* Added synonym "pepsin R" to GO:0004194
* Added general dbxref EC:3.4.23.1 to synonym pepsin R of GO:0004194
* Added synonym "aspartic proteinase yscA" to GO:0004196
* Added general dbxref EC:3.4.23.25 to synonym aspartic proteinase yscA of GO:0004196
* Added synonym "PRA" to GO:0004196
* Added general dbxref EC:3.4.23.25 to synonym PRA of GO:0004196
* Added synonym "proteinase A" to GO:0004196
* Added general dbxref EC:3.4.23.25 to synonym proteinase A of GO:0004196
* Added synonym "proteinase yscA" to GO:0004196
* Added general dbxref EC:3.4.23.25 to synonym proteinase yscA of GO:0004196
* Added synonym "saccharomyces aspartic proteinase activity" to GO:0004196
* Added general dbxref EC:3.4.23.25 to synonym saccharomyces aspartic proteinase activity of GO:0004196
* Changed synonym scope of GO:0004196 from "Related" to "Exact"
* Added synonym "saccharomyces cerevisiae aspartic proteinase A" to GO:0004196
* Added general dbxref EC:3.4.23.25 to synonym saccharomyces cerevisiae aspartic proteinase A of GO:0004196
* Added synonym "yeast proteinase A" to GO:0004196
* Added general dbxref EC:3.4.23.25 to synonym yeast proteinase A of GO:0004196
* Deleted synonym "thiol endopeptidase" from GO:0004197
* Added synonym "thiol endopeptidase activity" to GO:0004197
* Changed synonym scope of GO:0004197 from "Related" to "Exact"
* Added synonym "cathepsin II" to GO:0004213
* Added general dbxref EC:3.4.22.1 to synonym cathepsin II of GO:0004213
* Added synonym "DAP I" to GO:0004214
* Added general dbxref EC:3.4.14.1 to synonym DAP I of GO:0004214
* Added synonym "dipeptide arylamidase I" to GO:0004214
* Added general dbxref EC:3.4.14.1 to synonym dipeptide arylamidase I of GO:0004214
* Added synonym "benzoylarginine-naphthylamide (BANA) hydrolase activity" to GO:0004215
* Added general dbxref EC:3.4.22.16 to synonym benzoylarginine-naphthylamide (BANA) hydrolase activity of GO:0004215
* Changed synonym scope of GO:0004215 from "Related" to "Exact"
* Added synonym "cathepsin Ba" to GO:0004215
* Added general dbxref EC:3.4.22.16 to synonym cathepsin Ba of GO:0004215
* Added synonym "Aldrichina grahami cysteine proteinase" to GO:0004217
* Added general dbxref EC:3.4.22.15 to synonym Aldrichina grahami cysteine proteinase of GO:0004217
* Changed synonym scope of GO:0004217 from "Related" to "Narrow"
* Added synonym "L-pyroglutamyl peptide hydrolase activity" to GO:0004219
* Added general dbxref EC:3.4.19.3 to synonym L-pyroglutamyl peptide hydrolase activity of GO:0004219
* Changed synonym scope of GO:0004219 from "Related" to "Exact"
* Added synonym "L-pyrrolidonecarboxylate peptidase activity" to GO:0004219
* Added general dbxref EC:3.4.19.3 to synonym L-pyrrolidonecarboxylate peptidase activity of GO:0004219
* Changed synonym scope of GO:0004219 from "Related" to "Exact"
* Added synonym "pyrase activity" to GO:0004219
* Added general dbxref EC:3.4.19.3 to synonym pyrase activity of GO:0004219
* Changed synonym scope of GO:0004219 from "Related" to "Exact"
* Added synonym "pyroglutamate aminopeptidase activity" to GO:0004219
* Added general dbxref EC:3.4.19.3 to synonym pyroglutamate aminopeptidase activity of GO:0004219
* Changed synonym scope of GO:0004219 from "Related" to "Exact"
* Added synonym "pyroglutamidase activity" to GO:0004219
* Added general dbxref EC:3.4.19.3 to synonym pyroglutamidase activity of GO:0004219
* Changed synonym scope of GO:0004219 from "Related" to "Exact"
* Added synonym "pyrrolidone-carboxyl peptidase activity" to GO:0004219
* Added general dbxref EC:3.4.19.3 to synonym pyrrolidone-carboxyl peptidase activity of GO:0004219
* Changed synonym scope of GO:0004219 from "Related" to "Exact"
* Added synonym "pyrrolidonecarboxylyl peptidase activity" to GO:0004219
* Added general dbxref EC:3.4.19.3 to synonym pyrrolidonecarboxylyl peptidase activity of GO:0004219
* Changed synonym scope of GO:0004219 from "Related" to "Exact"
* Added synonym "pyrrolidonyl peptidase activity" to GO:0004219
* Added general dbxref EC:3.4.19.3 to synonym pyrrolidonyl peptidase activity of GO:0004219
* Changed synonym scope of GO:0004219 from "Related" to "Exact"
* Added synonym "isopeptidase activity" to GO:0004221
* Added general dbxref EC:3.1.2.15 to synonym isopeptidase activity of GO:0004221
* Changed synonym scope of GO:0004221 from "Related" to "Exact"
* Added synonym "isopeptidase T" to GO:0004221
* Added general dbxref EC:3.1.2.15 to synonym isopeptidase T of GO:0004221
* Added synonym "ubiquitin-C-terminal-thioester hydrolase activity" to GO:0004221
* Added general dbxref EC:3.1.2.15 to synonym ubiquitin-C-terminal-thioester hydrolase activity of GO:0004221
* Changed synonym scope of GO:0004221 from "Related" to "Exact"
* Added synonym "carboxypeptidase a" to GO:0004226
* Added general dbxref EC:3.4.17.4 to synonym carboxypeptidase a of GO:0004226
* Added synonym "Gly-Xaa carboxypeptidase activity" to GO:0004226
* Added general dbxref EC:3.4.17.4 to synonym Gly-Xaa carboxypeptidase activity of GO:0004226
* Changed synonym scope of GO:0004226 from "Related" to "Exact"
* Added synonym "peptidase alpha" to GO:0004226
* Added general dbxref EC:3.4.17.4 to synonym peptidase alpha of GO:0004226
* Added synonym "yeast carboxypeptidase activity" to GO:0004226
* Added general dbxref EC:3.4.17.4 to synonym yeast carboxypeptidase activity of GO:0004226
* Changed synonym scope of GO:0004226 from "Related" to "Exact"
* Added synonym "3/4 collagenase activity" to GO:0004228
* Added general dbxref EC:3.4.24.24 to synonym 3/4 collagenase activity of GO:0004228
* Changed synonym scope of GO:0004228 from "Related" to "Exact"
* Added synonym "72 kDa gelatinase type A" to GO:0004228
* Added general dbxref EC:3.4.24.24 to synonym 72 kDa gelatinase type A of GO:0004228
* Added synonym "collagenase IV" to GO:0004228
* Added general dbxref EC:3.4.24.24 to synonym collagenase IV of GO:0004228
* Added synonym "collagenase type IV" to GO:0004228
* Added general dbxref EC:3.4.24.24 to synonym collagenase type IV of GO:0004228
* Added synonym "matrix metalloproteinase 5" to GO:0004228
* Added general dbxref EC:3.4.24.24 to synonym matrix metalloproteinase 5 of GO:0004228
* Added synonym "MMP 2" to GO:0004228
* Added general dbxref EC:3.4.24.24 to synonym MMP 2 of GO:0004228
* Added synonym "type IV collagen metalloproteinase" to GO:0004228
* Added general dbxref EC:3.4.24.24 to synonym type IV collagen metalloproteinase of GO:0004228
* Changed synonym scope of GO:0004228 from "Related" to "Broad"
* Added synonym "type IV collagenase/gelatinase activity" to GO:0004228
* Added general dbxref EC:3.4.24.24 to synonym type IV collagenase/gelatinase activity of GO:0004228
* Changed synonym scope of GO:0004228 from "Related" to "Exact"
* Added synonym "95 kDa type IV collagenase/gelatinase activity" to GO:0004229
* Added general dbxref EC:3.4.24.35 to synonym 95 kDa type IV collagenase/gelatinase activity of GO:0004229
* Changed synonym scope of GO:0004229 from "Related" to "Exact"
* Added synonym "collagenase IV" to GO:0004229
* Added general dbxref EC:3.4.24.35 to synonym collagenase IV of GO:0004229
* Added synonym "collagenase type IV" to GO:0004229
* Added general dbxref EC:3.4.24.35 to synonym collagenase type IV of GO:0004229
* Added synonym "gelatinase MMP 9" to GO:0004229
* Added general dbxref EC:3.4.24.35 to synonym gelatinase MMP 9 of GO:0004229
* Added synonym "MMP 9" to GO:0004229
* Added general dbxref EC:3.4.24.35 to synonym MMP 9 of GO:0004229
* Added synonym "type IV collagen metalloproteinase" to GO:0004229
* Added general dbxref EC:3.4.24.35 to synonym type IV collagen metalloproteinase of GO:0004229
* Changed synonym scope of GO:0004229 from "Related" to "Broad"
* Added synonym "aminopeptidase A" to GO:0004230
* Added general dbxref EC:3.4.11.7 to synonym aminopeptidase A of GO:0004230
* Added synonym "angiotensinase A" to GO:0004230
* Added general dbxref EC:3.4.11.7 to synonym angiotensinase A of GO:0004230
* Added synonym "angiotensinase A2" to GO:0004230
* Added general dbxref EC:3.4.11.7 to synonym angiotensinase A2 of GO:0004230
* Added synonym "antigen BP-1/6C3 of mouse B lymphocytes" to GO:0004230
* Added general dbxref EC:3.4.11.7 to synonym antigen BP-1/6C3 of mouse B lymphocytes of GO:0004230
* Added synonym "aspartate aminopeptidase activity" to GO:0004230
* Added general dbxref EC:3.4.11.7 to synonym aspartate aminopeptidase activity of GO:0004230
* Changed synonym scope of GO:0004230 from "Related" to "Exact"
* Added synonym "Ca2+-activated glutamate aminopeptidase activity" to GO:0004230
* Added general dbxref EC:3.4.11.7 to synonym Ca2+-activated glutamate aminopeptidase activity of GO:0004230
* Changed synonym scope of GO:0004230 from "Related" to "Exact"
* Added synonym "glutamyl peptidase activity" to GO:0004230
* Added general dbxref EC:3.4.11.7 to synonym glutamyl peptidase activity of GO:0004230
* Changed synonym scope of GO:0004230 from "Related" to "Exact"
* Added synonym "L-aspartate aminopeptidase activity" to GO:0004230
* Added general dbxref EC:3.4.11.7 to synonym L-aspartate aminopeptidase activity of GO:0004230
* Changed synonym scope of GO:0004230 from "Related" to "Exact"
* Added synonym "membrane aminopeptidase II" to GO:0004230
* Added general dbxref EC:3.4.11.7 to synonym membrane aminopeptidase II of GO:0004230
* Added synonym "IDE" to GO:0004231
* Added general dbxref EC:3.4.24.56 to synonym IDE of GO:0004231
* Added synonym "insulin proteinase activity" to GO:0004231
* Added general dbxref EC:3.4.24.56 to synonym insulin proteinase activity of GO:0004231
* Changed synonym scope of GO:0004231 from "Related" to "Exact"
* Added synonym "insulin-degrading neutral proteinase activity" to GO:0004231
* Added general dbxref EC:3.4.24.56 to synonym insulin-degrading neutral proteinase activity of GO:0004231
* Changed synonym scope of GO:0004231 from "Related" to "Exact"
* Added synonym "insulin-glucagon protease activity" to GO:0004231
* Added general dbxref EC:3.4.24.56 to synonym insulin-glucagon protease activity of GO:0004231
* Changed synonym scope of GO:0004231 from "Related" to "Exact"
* Added synonym "insulin-specific protease activity" to GO:0004231
* Added general dbxref EC:3.4.24.56 to synonym insulin-specific protease activity of GO:0004231
* Changed synonym scope of GO:0004231 from "Related" to "Exact"
* Added synonym "metalloinsulinase activity" to GO:0004231
* Added general dbxref EC:3.4.24.56 to synonym metalloinsulinase activity of GO:0004231
* Changed synonym scope of GO:0004231 from "Related" to "Exact"
* Added synonym "vertebrate collagenase activity" to GO:0004232
* Added general dbxref EC:3.4.24.7 to synonym vertebrate collagenase activity of GO:0004232
* Changed synonym scope of GO:0004232 from "Related" to "Exact"
* Deleted synonym "metalloesterase" from GO:0004234
* Added synonym "human macrophage metalloelastase (HME)" to GO:0004234
* Added general dbxref EC:3.4.24.65 to synonym human macrophage metalloelastase (HME) of GO:0004234
* Changed synonym scope of GO:0004234 from "Related" to "Exact"
* Added synonym "metalloesterase activity" to GO:0004234
* Changed synonym scope of GO:0004234 from "Related" to "Exact"
* Added synonym "matrix metalloproteinase pump 1" to GO:0004235
* Added general dbxref EC:3.4.24.23 to synonym matrix metalloproteinase pump 1 of GO:0004235
* Added synonym "metalloproteinase pump-1" to GO:0004235
* Added general dbxref EC:3.4.24.23 to synonym metalloproteinase pump-1 of GO:0004235
* Added synonym "MMP" to GO:0004235
* Added general dbxref EC:3.4.24.23 to synonym MMP of GO:0004235
* Added synonym "MMP 7" to GO:0004235
* Added general dbxref EC:3.4.24.23 to synonym MMP 7 of GO:0004235
* Added synonym "PUMP" to GO:0004235
* Added general dbxref EC:3.4.24.23 to synonym PUMP of GO:0004235
* Added synonym "PUMP-1 proteinase activity" to GO:0004235
* Added general dbxref EC:3.4.24.23 to synonym PUMP-1 proteinase activity of GO:0004235
* Changed synonym scope of GO:0004235 from "Related" to "Exact"
* Added synonym "putative metalloproteinase activity" to GO:0004235
* Added general dbxref EC:3.4.24.23 to synonym putative metalloproteinase activity of GO:0004235
* Changed synonym scope of GO:0004235 from "Related" to "Exact"
* Added synonym "aminodipeptidase activity" to GO:0004237
* Added general dbxref EC:3.4.13.19 to synonym aminodipeptidase activity of GO:0004237
* Changed synonym scope of GO:0004237 from "Related" to "Exact"
* Added synonym "dehydropeptidase I (DPH I)" to GO:0004237
* Added general dbxref EC:3.4.13.19 to synonym dehydropeptidase I (DPH I) of GO:0004237
* Added synonym "dipeptide hydrolase" to GO:0004237
* Added general dbxref EC:3.4.13.19 to synonym dipeptide hydrolase of GO:0004237
* Changed synonym scope of GO:0004237 from "Related" to "Broad"
* Added synonym "dipeptidyl hydrolase activity" to GO:0004237
* Added general dbxref EC:3.4.13.19 to synonym dipeptidyl hydrolase activity of GO:0004237
* Changed synonym scope of GO:0004237 from "Related" to "Exact"
* Added synonym "glycosyl-phosphatidylinositol-anchored renal dipeptidase activity" to GO:0004237
* Added general dbxref EC:3.4.13.19 to synonym glycosyl-phosphatidylinositol-anchored renal dipeptidase activity of GO:0004237
* Changed synonym scope of GO:0004237 from "Related" to "Exact"
* Added synonym "MDP" to GO:0004237
* Added general dbxref EC:3.4.13.19 to synonym MDP of GO:0004237
* Added synonym "nonspecific dipeptidase activity" to GO:0004237
* Added general dbxref EC:3.4.13.19 to synonym nonspecific dipeptidase activity of GO:0004237
* Changed synonym scope of GO:0004237 from "Related" to "Exact"
* Added synonym "L-methionine aminopeptidase activity" to GO:0004239
* Added general dbxref EC:3.4.11.18 to synonym L-methionine aminopeptidase activity of GO:0004239
* Changed synonym scope of GO:0004239 from "Related" to "Exact"
* Added synonym "MAP" to GO:0004239
* Added general dbxref EC:3.4.11.18 to synonym MAP of GO:0004239
* Added synonym "mitochondrial intermediate precursor-processing proteinase activity" to GO:0004243
* Added general dbxref EC:3.4.24.59 to synonym mitochondrial intermediate precursor-processing proteinase activity of GO:0004243
* Changed synonym scope of GO:0004243 from "Related" to "Exact"
* Added synonym "acute lymphoblastic leukemia antigen" to GO:0004245
* Added general dbxref EC:3.4.24.11 to synonym acute lymphoblastic leukemia antigen of GO:0004245
* Added synonym "CALLA" to GO:0004245
* Added general dbxref EC:3.4.24.11 to synonym CALLA of GO:0004245
* Added synonym "CALLA (common acute lymphoblastic leukemia-associated) antigens" to GO:0004245
* Added general dbxref EC:3.4.24.11 to synonym CALLA (common acute lymphoblastic leukemia-associated) antigens of GO:0004245
* Added synonym "CALLA antigen" to GO:0004245
* Added general dbxref EC:3.4.24.11 to synonym CALLA antigen of GO:0004245
* Added synonym "CALLA glycoprotein" to GO:0004245
* Added general dbxref EC:3.4.24.11 to synonym CALLA glycoprotein of GO:0004245
* Added synonym "CALLA glycoproteins" to GO:0004245
* Added general dbxref EC:3.4.24.11 to synonym CALLA glycoproteins of GO:0004245
* Added synonym "CD10" to GO:0004245
* Added general dbxref EC:3.4.24.11 to synonym CD10 of GO:0004245
* Added synonym "common acute lymphoblastic leukemia antigen" to GO:0004245
* Added general dbxref EC:3.4.24.11 to synonym common acute lymphoblastic leukemia antigen of GO:0004245
* Added synonym "common acute lymphoblastic leukemia-associated antigens" to GO:0004245
* Added general dbxref EC:3.4.24.11 to synonym common acute lymphoblastic leukemia-associated antigens of GO:0004245
* Added synonym "endopeptidase 24.11" to GO:0004245
* Added general dbxref EC:3.4.24.11 to synonym endopeptidase 24.11 of GO:0004245
* Added synonym "kidney-brush-border neutral endopeptidase" to GO:0004245
* Added general dbxref EC:3.4.24.11 to synonym kidney-brush-border neutral endopeptidase of GO:0004245
* Changed synonym scope of GO:0004245 from "Related" to "Narrow"
* Added synonym "kidney-brush-border neutral peptidase" to GO:0004245
* Added general dbxref EC:3.4.24.11 to synonym kidney-brush-border neutral peptidase of GO:0004245
* Changed synonym scope of GO:0004245 from "Related" to "Narrow"
* Added synonym "neutral endopeptidase 24.11" to GO:0004245
* Added general dbxref EC:3.4.24.11 to synonym neutral endopeptidase 24.11 of GO:0004245
* Added synonym "neutral metallendopeptidase activity" to GO:0004245
* Added general dbxref EC:3.4.24.11 to synonym neutral metallendopeptidase activity of GO:0004245
* Changed synonym scope of GO:0004245 from "Related" to "Exact"
* Added synonym "angiotensin converting enzyme" to GO:0004246
* Added general dbxref EC:3.4.15.1 to synonym angiotensin converting enzyme of GO:0004246
* Added synonym "DCP" to GO:0004246
* Added general dbxref EC:3.4.15.1 to synonym DCP of GO:0004246
* Added synonym "dipeptide hydrolase" to GO:0004246
* Added general dbxref EC:3.4.15.1 to synonym dipeptide hydrolase of GO:0004246
* Changed synonym scope of GO:0004246 from "Related" to "Broad"
* Added synonym "endothelial cell peptidyl dipeptidase activity" to GO:0004246
* Added general dbxref EC:3.4.15.1 to synonym endothelial cell peptidyl dipeptidase activity of GO:0004246
* Changed synonym scope of GO:0004246 from "Related" to "Exact"
* Added synonym "PDH" to GO:0004246
* Added general dbxref EC:3.4.15.1 to synonym PDH of GO:0004246
* Added synonym "peptidyl dipeptidase A" to GO:0004246
* Added general dbxref EC:3.4.15.1 to synonym peptidyl dipeptidase A of GO:0004246
* Added synonym "peptidyl dipeptidase-4" to GO:0004246
* Added general dbxref EC:3.4.15.1 to synonym peptidyl dipeptidase-4 of GO:0004246
* Added synonym "peptidyl dipeptide hydrolase activity" to GO:0004246
* Added general dbxref EC:3.4.15.1 to synonym peptidyl dipeptide hydrolase activity of GO:0004246
* Changed synonym scope of GO:0004246 from "Related" to "Exact"
* Added synonym "peptidyl-dipeptide hydrolase activity" to GO:0004246
* Added general dbxref EC:3.4.15.1 to synonym peptidyl-dipeptide hydrolase activity of GO:0004246
* Changed synonym scope of GO:0004246 from "Related" to "Exact"
* Added synonym "peptidyldipeptide hydrolase activity" to GO:0004246
* Added general dbxref EC:3.4.15.1 to synonym peptidyldipeptide hydrolase activity of GO:0004246
* Changed synonym scope of GO:0004246 from "Related" to "Exact"
* Added synonym "saccharomyces cerevisiae proteinase yscD" to GO:0004247
* Added general dbxref EC:3.4.24.37 to synonym saccharomyces cerevisiae proteinase yscD of GO:0004247
* Added synonym "collagen-activating protein" to GO:0004248
* Added general dbxref EC:3.4.24.17 to synonym collagen-activating protein of GO:0004248
* Added synonym "collagenase activating protein" to GO:0004248
* Added general dbxref EC:3.4.24.17 to synonym collagenase activating protein of GO:0004248
* Added synonym "neutral proteoglycanase activity" to GO:0004248
* Added general dbxref EC:3.4.24.17 to synonym neutral proteoglycanase activity of GO:0004248
* Changed synonym scope of GO:0004248 from "Related" to "Exact"
* Added synonym "procollagenase activator" to GO:0004248
* Added general dbxref EC:3.4.24.17 to synonym procollagenase activator of GO:0004248
* Added synonym "stromelysin" to GO:0004248
* Added general dbxref EC:3.4.24.17 to synonym stromelysin of GO:0004248
* Added synonym "yeast aminopeptidase I" to GO:0004250
* Added general dbxref EC:3.4.11.22 to synonym yeast aminopeptidase I of GO:0004250
* Added synonym "gamma-peptidase activity" to GO:0004251
* Added general dbxref EC:3.4.13.9 to synonym gamma-peptidase activity of GO:0004251
* Changed synonym scope of GO:0004251 from "Related" to "Exact"
* Added synonym "imidodipeptidase activity" to GO:0004251
* Added general dbxref EC:3.4.13.9 to synonym imidodipeptidase activity of GO:0004251
* Changed synonym scope of GO:0004251 from "Related" to "Exact"
* Added synonym "peptidase D" to GO:0004251
* Added general dbxref EC:3.4.13.9 to synonym peptidase D of GO:0004251
* Added synonym "prolidase activity" to GO:0004251
* Added general dbxref EC:3.4.13.9 to synonym prolidase activity of GO:0004251
* Changed synonym scope of GO:0004251 from "Related" to "Exact"
* Added synonym "proline dipeptidase activity" to GO:0004251
* Added general dbxref EC:3.4.13.9 to synonym proline dipeptidase activity of GO:0004251
* Changed synonym scope of GO:0004251 from "Related" to "Exact"
* Deleted synonym "serine protease activity" from GO:0004252
* Added synonym "alpha-N-acylpeptide hydrolase activity" to GO:0004254
* Added general dbxref EC:3.4.19.1 to synonym alpha-N-acylpeptide hydrolase activity of GO:0004254
* Changed synonym scope of GO:0004254 from "Related" to "Exact"
* Added synonym "N-formylmethionine (fMet) aminopeptidase activity" to GO:0004254
* Added general dbxref EC:3.4.19.1 to synonym N-formylmethionine (fMet) aminopeptidase activity of GO:0004254
* Changed synonym scope of GO:0004254 from "Related" to "Exact"
* Added synonym "chymotrypsin-like proteinase activity" to GO:0004261
* Added general dbxref EC:3.4.21.20 to synonym chymotrypsin-like proteinase activity of GO:0004261
* Changed synonym scope of GO:0004261 from "Related" to "Exact"
* Added synonym "neutral proteinase activity" to GO:0004261
* Added general dbxref EC:3.4.21.20 to synonym neutral proteinase activity of GO:0004261
* Changed synonym scope of GO:0004261 from "Related" to "Exact"
* Added synonym "baker's yeast proteinase B" to GO:0004262
* Added general dbxref EC:3.4.21.48 to synonym baker's yeast proteinase B of GO:0004262
* Added synonym "brewer's yeast proteinase" to GO:0004262
* Added general dbxref EC:3.4.21.48 to synonym brewer's yeast proteinase of GO:0004262
* Changed synonym scope of GO:0004262 from "Related" to "Narrow"
* Added synonym "peptidase beta" to GO:0004262
* Added general dbxref EC:3.4.21.48 to synonym peptidase beta of GO:0004262
* Added synonym "alpha-chymar" to GO:0004263
* Added general dbxref EC:3.4.21.1 to synonym alpha-chymar of GO:0004263
* Added synonym "alpha-chymar ophth" to GO:0004263
* Added general dbxref EC:3.4.21.1 to synonym alpha-chymar ophth of GO:0004263
* Added synonym "alpha-chymotrypsin A" to GO:0004263
* Added general dbxref EC:3.4.21.1 to synonym alpha-chymotrypsin A of GO:0004263
* Added synonym "avazyme" to GO:0004263
* Added general dbxref EC:3.4.21.1 to synonym avazyme of GO:0004263
* Added synonym "chymar" to GO:0004263
* Added general dbxref EC:3.4.21.1 to synonym chymar of GO:0004263
* Added synonym "chymotest" to GO:0004263
* Added general dbxref EC:3.4.21.1 to synonym chymotest of GO:0004263
* Added synonym "chymotrypsins A and B" to GO:0004263
* Added general dbxref EC:3.4.21.1 to synonym chymotrypsins A and B of GO:0004263
* Added synonym "enzeon" to GO:0004263
* Added general dbxref EC:3.4.21.1 to synonym enzeon of GO:0004263
* Added synonym "quimar" to GO:0004263
* Added general dbxref EC:3.4.21.1 to synonym quimar of GO:0004263
* Added synonym "quimotrase activity" to GO:0004263
* Added general dbxref EC:3.4.21.1 to synonym quimotrase activity of GO:0004263
* Changed synonym scope of GO:0004263 from "Related" to "Exact"
* Added synonym "amino acyl-prolyl dipeptidyl aminopeptidase activity" to GO:0004274
* Added general dbxref EC:3.4.14.5 to synonym amino acyl-prolyl dipeptidyl aminopeptidase activity of GO:0004274
* Changed synonym scope of GO:0004274 from "Related" to "Exact"
* Added synonym "dipeptidyl peptidase IV" to GO:0004274
* Added general dbxref EC:3.4.14.5 to synonym dipeptidyl peptidase IV of GO:0004274
* Added synonym "dipeptidyl-aminopeptidase IV" to GO:0004274
* Added general dbxref EC:3.4.14.5 to synonym dipeptidyl-aminopeptidase IV of GO:0004274
* Added synonym "dipeptidyl-peptide hydrolase activity" to GO:0004274
* Added general dbxref EC:3.4.14.5 to synonym dipeptidyl-peptide hydrolase activity of GO:0004274
* Changed synonym scope of GO:0004274 from "Related" to "Exact"
* Added synonym "DPP IV/CD26" to GO:0004274
* Added general dbxref EC:3.4.14.5 to synonym DPP IV/CD26 of GO:0004274
* Added synonym "glycoprotein GP110" to GO:0004274
* Added general dbxref EC:3.4.14.5 to synonym glycoprotein GP110 of GO:0004274
* Added synonym "glycylproline aminopeptidase activity" to GO:0004274
* Added general dbxref EC:3.4.14.5 to synonym glycylproline aminopeptidase activity of GO:0004274
* Changed synonym scope of GO:0004274 from "Related" to "Exact"
* Added synonym "glycylprolyl aminopeptidase activity" to GO:0004274
* Added general dbxref EC:3.4.14.5 to synonym glycylprolyl aminopeptidase activity of GO:0004274
* Changed synonym scope of GO:0004274 from "Related" to "Exact"
* Added synonym "glycylprolyl dipeptidylaminopeptidase activity" to GO:0004274
* Added general dbxref EC:3.4.14.5 to synonym glycylprolyl dipeptidylaminopeptidase activity of GO:0004274
* Changed synonym scope of GO:0004274 from "Related" to "Exact"
* Added synonym "leukocyte antigen CD26" to GO:0004274
* Added general dbxref EC:3.4.14.5 to synonym leukocyte antigen CD26 of GO:0004274
* Added synonym "lymphocyte antigen CD26" to GO:0004274
* Added general dbxref EC:3.4.14.5 to synonym lymphocyte antigen CD26 of GO:0004274
* Added synonym "pep X" to GO:0004274
* Added general dbxref EC:3.4.14.5 to synonym pep X of GO:0004274
* Added synonym "postproline dipeptidyl aminopeptidase IV" to GO:0004274
* Added general dbxref EC:3.4.14.5 to synonym postproline dipeptidyl aminopeptidase IV of GO:0004274
* Added synonym "T cell triggering molecule Tp103" to GO:0004274
* Added general dbxref EC:3.4.14.5 to synonym T cell triggering molecule Tp103 of GO:0004274
* Added synonym "X-PDAP" to GO:0004274
* Added general dbxref EC:3.4.14.5 to synonym X-PDAP of GO:0004274
* Added synonym "Xaa-Pro-dipeptidyl-aminopeptidase activity" to GO:0004274
* Added general dbxref EC:3.4.14.5 to synonym Xaa-Pro-dipeptidyl-aminopeptidase activity of GO:0004274
* Changed synonym scope of GO:0004274 from "Related" to "Exact"
* Added synonym "PACE" to GO:0004276
* Added general dbxref EC:3.4.21.75 to synonym PACE of GO:0004276
* Added synonym "paired basic amino acid cleaving enzyme" to GO:0004276
* Added general dbxref EC:3.4.21.75 to synonym paired basic amino acid cleaving enzyme of GO:0004276
* Added synonym "paired basic amino acid converting enzyme" to GO:0004276
* Added general dbxref EC:3.4.21.75 to synonym paired basic amino acid converting enzyme of GO:0004276
* Added synonym "serine proteinase PACE" to GO:0004276
* Added general dbxref EC:3.4.21.75 to synonym serine proteinase PACE of GO:0004276
* Added synonym "SPC3" to GO:0004276
* Added general dbxref EC:3.4.21.75 to synonym SPC3 of GO:0004276
* Added synonym "CTLA3" to GO:0004277
* Added general dbxref EC:3.4.21.78 to synonym CTLA3 of GO:0004277
* Added synonym "cytotoxic T lymphocyte serine protease" to GO:0004277
* Added general dbxref EC:3.4.21.78 to synonym cytotoxic T lymphocyte serine protease of GO:0004277
* Changed synonym scope of GO:0004277 from "Related" to "Narrow"
* Added synonym "HuTPS" to GO:0004277
* Added general dbxref EC:3.4.21.78 to synonym HuTPS of GO:0004277
* Added synonym "T-cell associated protease 1" to GO:0004277
* Added general dbxref EC:3.4.21.78 to synonym T-cell associated protease 1 of GO:0004277
* Added synonym "T-cell derived serine proteinase" to GO:0004277
* Added general dbxref EC:3.4.21.78 to synonym T-cell derived serine proteinase of GO:0004277
* Changed synonym scope of GO:0004277 from "Related" to "Narrow"
* Added synonym "TSP-1" to GO:0004277
* Added general dbxref EC:3.4.21.78 to synonym TSP-1 of GO:0004277
* Added synonym "CCP1 proteinase" to GO:0004278
* Added general dbxref EC:3.4.21.79 to synonym CCP1 proteinase of GO:0004278
* Changed synonym scope of GO:0004278 from "Related" to "Narrow"
* Added synonym "CCPII" to GO:0004278
* Added general dbxref EC:3.4.21.79 to synonym CCPII of GO:0004278
* Added synonym "CTLA1" to GO:0004278
* Added general dbxref EC:3.4.21.79 to synonym CTLA1 of GO:0004278
* Added synonym "cytotoxic cell proteinase-1" to GO:0004278
* Added general dbxref EC:3.4.21.79 to synonym cytotoxic cell proteinase-1 of GO:0004278
* Added synonym "granzyme G" to GO:0004278
* Added general dbxref EC:3.4.21.79 to synonym granzyme G of GO:0004278
* Added synonym "granzyme H" to GO:0004278
* Added general dbxref EC:3.4.21.79 to synonym granzyme H of GO:0004278
* Added synonym "actase activity" to GO:0004283
* Added general dbxref EC:3.4.21.7 to synonym actase activity of GO:0004283
* Changed synonym scope of GO:0004283 from "Related" to "Exact"
* Added synonym "serum tryptase activity" to GO:0004283
* Added general dbxref EC:3.4.21.7 to synonym serum tryptase activity of GO:0004283
* Changed synonym scope of GO:0004283 from "Related" to "Exact"
* Added synonym "thrombolysin" to GO:0004283
* Added general dbxref EC:3.4.21.7 to synonym thrombolysin of GO:0004283
* Added synonym "acrosin amidase activity" to GO:0004284
* Added general dbxref EC:3.4.21.10 to synonym acrosin amidase activity of GO:0004284
* Changed synonym scope of GO:0004284 from "Related" to "Exact"
* Added synonym "acrosomal protease activity" to GO:0004284
* Added general dbxref EC:3.4.21.10 to synonym acrosomal protease activity of GO:0004284
* Changed synonym scope of GO:0004284 from "Related" to "Exact"
* Added synonym "acrosomal proteinase activity" to GO:0004284
* Added general dbxref EC:3.4.21.10 to synonym acrosomal proteinase activity of GO:0004284
* Changed synonym scope of GO:0004284 from "Related" to "Exact"
* Added synonym "acrozonase activity" to GO:0004284
* Added general dbxref EC:3.4.21.10 to synonym acrozonase activity of GO:0004284
* Changed synonym scope of GO:0004284 from "Related" to "Exact"
* Added synonym "alpha-acrosin" to GO:0004284
* Added general dbxref EC:3.4.21.10 to synonym alpha-acrosin of GO:0004284
* Added synonym "beta-acrosin" to GO:0004284
* Added general dbxref EC:3.4.21.10 to synonym beta-acrosin of GO:0004284
* Added synonym "psi-acrosin" to GO:0004284
* Added general dbxref EC:3.4.21.10 to synonym psi-acrosin of GO:0004284
* Added synonym "prohormone convertase 3" to GO:0004285
* Added general dbxref EC:3.4.21.93 to synonym prohormone convertase 3 of GO:0004285
* Added synonym "endoprolylpeptidase activity" to GO:0004287
* Added general dbxref EC:3.4.21.26 to synonym endoprolylpeptidase activity of GO:0004287
* Changed synonym scope of GO:0004287 from "Related" to "Exact"
* Added synonym "proline endopeptidase activity" to GO:0004287
* Added general dbxref EC:3.4.21.26 to synonym proline endopeptidase activity of GO:0004287
* Changed synonym scope of GO:0004287 from "Related" to "Exact"
* Added synonym "proline-specific endopeptidase activity" to GO:0004287
* Added general dbxref EC:3.4.21.26 to synonym proline-specific endopeptidase activity of GO:0004287
* Changed synonym scope of GO:0004287 from "Related" to "Exact"
* Added synonym "andrenorphin-Gly-generating enzyme" to GO:0004290
* Added general dbxref EC:3.4.21.61 to synonym andrenorphin-Gly-generating enzyme of GO:0004290
* Added synonym "endoproteinase Kex2p" to GO:0004290
* Added general dbxref EC:3.4.21.61 to synonym endoproteinase Kex2p of GO:0004290
* Added synonym "gene KEX2 dibasic proteinase" to GO:0004290
* Added general dbxref EC:3.4.21.61 to synonym gene KEX2 dibasic proteinase of GO:0004290
* Changed synonym scope of GO:0004290 from "Related" to "Narrow"
* Added synonym "Kex 2p proteinase" to GO:0004290
* Added general dbxref EC:3.4.21.61 to synonym Kex 2p proteinase of GO:0004290
* Changed synonym scope of GO:0004290 from "Related" to "Narrow"
* Added synonym "Kex2 endopeptidase" to GO:0004290
* Added general dbxref EC:3.4.21.61 to synonym Kex2 endopeptidase of GO:0004290
* Changed synonym scope of GO:0004290 from "Related" to "Narrow"
* Added synonym "Kex2 endoprotease" to GO:0004290
* Added general dbxref EC:3.4.21.61 to synonym Kex2 endoprotease of GO:0004290
* Changed synonym scope of GO:0004290 from "Related" to "Narrow"
* Added synonym "Kex2 endoproteinase" to GO:0004290
* Added general dbxref EC:3.4.21.61 to synonym Kex2 endoproteinase of GO:0004290
* Changed synonym scope of GO:0004290 from "Related" to "Narrow"
* Added synonym "Kex2 protease" to GO:0004290
* Added general dbxref EC:3.4.21.61 to synonym Kex2 protease of GO:0004290
* Changed synonym scope of GO:0004290 from "Related" to "Narrow"
* Added synonym "Kex2 proteinase" to GO:0004290
* Added general dbxref EC:3.4.21.61 to synonym Kex2 proteinase of GO:0004290
* Changed synonym scope of GO:0004290 from "Related" to "Narrow"
* Added synonym "Kex2-like endoproteinase" to GO:0004290
* Added general dbxref EC:3.4.21.61 to synonym Kex2-like endoproteinase of GO:0004290
* Changed synonym scope of GO:0004290 from "Related" to "Narrow"
* Added synonym "Kex2-like precursor protein processing endoprotease" to GO:0004290
* Added general dbxref EC:3.4.21.61 to synonym Kex2-like precursor protein processing endoprotease of GO:0004290
* Changed synonym scope of GO:0004290 from "Related" to "Narrow"
* Added synonym "prohormone-processing KEX2 proteinase" to GO:0004290
* Added general dbxref EC:3.4.21.61 to synonym prohormone-processing KEX2 proteinase of GO:0004290
* Changed synonym scope of GO:0004290 from "Related" to "Narrow"
* Added synonym "prohormone-processing proteinase activity" to GO:0004290
* Added general dbxref EC:3.4.21.61 to synonym prohormone-processing proteinase activity of GO:0004290
* Changed synonym scope of GO:0004290 from "Related" to "Exact"
* Added synonym "protease KEX2" to GO:0004290
* Added general dbxref EC:3.4.21.61 to synonym protease KEX2 of GO:0004290
* Added synonym "proteinase Kex2p" to GO:0004290
* Added general dbxref EC:3.4.21.61 to synonym proteinase Kex2p of GO:0004290
* Added synonym "yeast cysteine proteinase F" to GO:0004290
* Added general dbxref EC:3.4.21.61 to synonym yeast cysteine proteinase F of GO:0004290
* Added synonym "alcalase 0.6L" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym alcalase 0.6L of GO:0004291
* Added synonym "alcalase 2.5L" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym alcalase 2.5L of GO:0004291
* Added synonym "alcalase activity" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym alcalase activity of GO:0004291
* Changed synonym scope of GO:0004291 from "Related" to "Exact"
* Added synonym "ALK-enzyme" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym ALK-enzyme of GO:0004291
* Added synonym "bacillopeptidase A" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym bacillopeptidase A of GO:0004291
* Added synonym "bacillopeptidase B" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym bacillopeptidase B of GO:0004291
* Added synonym "bacillus subtilis alkaline proteinase activity" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym bacillus subtilis alkaline proteinase activity of GO:0004291
* Changed synonym scope of GO:0004291 from "Related" to "Exact"
* Added synonym "bacillus subtilis alkaline proteinase bioprase activity" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym bacillus subtilis alkaline proteinase bioprase activity of GO:0004291
* Changed synonym scope of GO:0004291 from "Related" to "Exact"
* Added synonym "bioprase AL 15" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym bioprase AL 15 of GO:0004291
* Added synonym "bioprase APL 30" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym bioprase APL 30 of GO:0004291
* Added synonym "colistinase activity" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym colistinase activity of GO:0004291
* Changed synonym scope of GO:0004291 from "Related" to "Exact"
* Added synonym "esperase activity" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym esperase activity of GO:0004291
* Changed synonym scope of GO:0004291 from "Related" to "Exact"
* Added synonym "genenase I" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym genenase I of GO:0004291
* Added synonym "kazusase activity" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym kazusase activity of GO:0004291
* Changed synonym scope of GO:0004291 from "Related" to "Exact"
* Added synonym "maxatase activity" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym maxatase activity of GO:0004291
* Changed synonym scope of GO:0004291 from "Related" to "Exact"
* Added synonym "opticlean" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym opticlean of GO:0004291
* Added synonym "orientase 10B" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym orientase 10B of GO:0004291
* Added synonym "protease S" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym protease S of GO:0004291
* Added synonym "protease VIII" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym protease VIII of GO:0004291
* Added synonym "protease XXVII" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym protease XXVII of GO:0004291
* Added synonym "protin A 3L" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym protin A 3L of GO:0004291
* Added synonym "savinase 16.0L" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym savinase 16.0L of GO:0004291
* Added synonym "savinase 32.0 L EX" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym savinase 32.0 L EX of GO:0004291
* Added synonym "savinase 4.0T" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym savinase 4.0T of GO:0004291
* Added synonym "savinase 8.0L" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym savinase 8.0L of GO:0004291
* Added synonym "savinase activity" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym savinase activity of GO:0004291
* Changed synonym scope of GO:0004291 from "Related" to "Exact"
* Added synonym "SP 266" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym SP 266 of GO:0004291
* Added synonym "subtilisin BL" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym subtilisin BL of GO:0004291
* Added synonym "subtilisin DY" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym subtilisin DY of GO:0004291
* Added synonym "subtilisin E" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym subtilisin E of GO:0004291
* Added synonym "subtilisin GX" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym subtilisin GX of GO:0004291
* Added synonym "subtilisin J" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym subtilisin J of GO:0004291
* Added synonym "subtilisin S41" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym subtilisin S41 of GO:0004291
* Added synonym "subtilisin sendai" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym subtilisin sendai of GO:0004291
* Added synonym "subtilopeptidase activity" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym subtilopeptidase activity of GO:0004291
* Changed synonym scope of GO:0004291 from "Related" to "Exact"
* Added synonym "superase activity" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym superase activity of GO:0004291
* Changed synonym scope of GO:0004291 from "Related" to "Exact"
* Added synonym "thermoase" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym thermoase of GO:0004291
* Changed synonym scope of GO:0004291 from "Related" to "Broad"
* Added synonym "thermoase PC 10" to GO:0004291
* Added general dbxref EC:3.4.21.62 to synonym thermoase PC 10 of GO:0004291
* Added synonym "bradykininogenase" to GO:0004293
* Added general dbxref EC:3.4.21.35 to synonym bradykininogenase of GO:0004293
* Changed synonym scope of GO:0004293 from "Related" to "Broad"
* Added synonym "callicrein" to GO:0004293
* Added general dbxref EC:3.4.21.35 to synonym callicrein of GO:0004293
* Added synonym "depot-padutin" to GO:0004293
* Added general dbxref EC:3.4.21.35 to synonym depot-padutin of GO:0004293
* Added synonym "dilminal D" to GO:0004293
* Added general dbxref EC:3.4.21.35 to synonym dilminal D of GO:0004293
* Added synonym "glumorin" to GO:0004293
* Added general dbxref EC:3.4.21.35 to synonym glumorin of GO:0004293
* Added synonym "kallidinogenase" to GO:0004293
* Added general dbxref EC:3.4.21.35 to synonym kallidinogenase of GO:0004293
* Changed synonym scope of GO:0004293 from "Related" to "Broad"
* Added synonym "kallikrein" to GO:0004293
* Added general dbxref EC:3.4.21.35 to synonym kallikrein of GO:0004293
* Added synonym "kidney kallikrein" to GO:0004293
* Added general dbxref EC:3.4.21.35 to synonym kidney kallikrein of GO:0004293
* Added synonym "kininogenase" to GO:0004293
* Added general dbxref EC:3.4.21.35 to synonym kininogenase of GO:0004293
* Changed synonym scope of GO:0004293 from "Related" to "Broad"
* Added synonym "onokrein P" to GO:0004293
* Added general dbxref EC:3.4.21.35 to synonym onokrein P of GO:0004293
* Added synonym "padreatin" to GO:0004293
* Added general dbxref EC:3.4.21.35 to synonym padreatin of GO:0004293
* Added synonym "padutin" to GO:0004293
* Added general dbxref EC:3.4.21.35 to synonym padutin of GO:0004293
* Added synonym "pancreatic kallikrein" to GO:0004293
* Added general dbxref EC:3.4.21.35 to synonym pancreatic kallikrein of GO:0004293
* Added synonym "salivary kallikrein" to GO:0004293
* Added general dbxref EC:3.4.21.35 to synonym salivary kallikrein of GO:0004293
* Added synonym "submandibular kallikrein" to GO:0004293
* Added general dbxref EC:3.4.21.35 to synonym submandibular kallikrein of GO:0004293
* Added synonym "submaxillary kallikrein" to GO:0004293
* Added general dbxref EC:3.4.21.35 to synonym submaxillary kallikrein of GO:0004293
* Added synonym "urinary kallikrein" to GO:0004293
* Added general dbxref EC:3.4.21.35 to synonym urinary kallikrein of GO:0004293
* Added synonym "urokallikrein" to GO:0004293
* Added general dbxref EC:3.4.21.35 to synonym urokallikrein of GO:0004293
* Added synonym "TPP" to GO:0004294
* Added general dbxref EC:3.4.14.10 to synonym TPP of GO:0004294
* Added synonym "tripeptidyl aminopeptidase II" to GO:0004294
* Added general dbxref EC:3.4.14.10 to synonym tripeptidyl aminopeptidase II of GO:0004294
* Added synonym "tripeptidyl peptidase II" to GO:0004294
* Added general dbxref EC:3.4.14.10 to synonym tripeptidyl peptidase II of GO:0004294
* Added synonym "cocoonase activity" to GO:0004295
* Added general dbxref EC:3.4.21.4 to synonym cocoonase activity of GO:0004295
* Changed synonym scope of GO:0004295 from "Related" to "Exact"
* Added synonym "parenzyme" to GO:0004295
* Added general dbxref EC:3.4.21.4 to synonym parenzyme of GO:0004295
* Added synonym "parenzymol" to GO:0004295
* Added general dbxref EC:3.4.21.4 to synonym parenzymol of GO:0004295
* Added synonym "pseudotrypsin" to GO:0004295
* Added general dbxref EC:3.4.21.4 to synonym pseudotrypsin of GO:0004295
* Added synonym "sperm receptor hydrolase activity" to GO:0004295
* Added general dbxref EC:3.4.21.4 to synonym sperm receptor hydrolase activity of GO:0004295
* Changed synonym scope of GO:0004295 from "Related" to "Exact"
* Added synonym "tripcellim" to GO:0004295
* Added general dbxref EC:3.4.21.4 to synonym tripcellim of GO:0004295
* Added synonym "tryptar" to GO:0004295
* Added general dbxref EC:3.4.21.4 to synonym tryptar of GO:0004295
* Added synonym "trypure" to GO:0004295
* Added general dbxref EC:3.4.21.4 to synonym trypure of GO:0004295
* Added synonym "(3S)-3-hydroxyacyl-CoA hydro-lyase activity" to GO:0004300
* Added general dbxref EC:4.2.1.17 to synonym (3S)-3-hydroxyacyl-CoA hydro-lyase activity of GO:0004300
* Changed synonym scope of GO:0004300 from "Related" to "Exact"
* Added synonym "2-enoyl-CoA hydratase activity" to GO:0004300
* Added general dbxref EC:4.2.1.17 to synonym 2-enoyl-CoA hydratase activity of GO:0004300
* Changed synonym scope of GO:0004300 from "Related" to "Exact"
* Added synonym "2-octenoyl coenzyme A hydrase activity" to GO:0004300
* Added general dbxref EC:4.2.1.17 to synonym 2-octenoyl coenzyme A hydrase activity of GO:0004300
* Changed synonym scope of GO:0004300 from "Related" to "Exact"
* Added synonym "acyl coenzyme A hydrase activity" to GO:0004300
* Added general dbxref EC:4.2.1.17 to synonym acyl coenzyme A hydrase activity of GO:0004300
* Changed synonym scope of GO:0004300 from "Related" to "Exact"
* Added synonym "beta-hydroxyacid dehydrase activity" to GO:0004300
* Added general dbxref EC:4.2.1.17 to synonym beta-hydroxyacid dehydrase activity of GO:0004300
* Changed synonym scope of GO:0004300 from "Related" to "Exact"
* Added synonym "beta-hydroxyacyl-CoA dehydrase activity" to GO:0004300
* Added general dbxref EC:4.2.1.17 to synonym beta-hydroxyacyl-CoA dehydrase activity of GO:0004300
* Changed synonym scope of GO:0004300 from "Related" to "Exact"
* Added synonym "crotonyl hydrase activity" to GO:0004300
* Added general dbxref EC:4.2.1.17 to synonym crotonyl hydrase activity of GO:0004300
* Changed synonym scope of GO:0004300 from "Related" to "Exact"
* Added synonym "D-3-hydroxyacyl-CoA dehydratase" to GO:0004300
* Added general dbxref EC:4.2.1.17 to synonym D-3-hydroxyacyl-CoA dehydratase of GO:0004300
* Changed synonym scope of GO:0004300 from "Related" to "Broad"
* Added synonym "ECH" to GO:0004300
* Added general dbxref EC:4.2.1.17 to synonym ECH of GO:0004300
* Added synonym "enol-CoA hydratase activity" to GO:0004300
* Added general dbxref EC:4.2.1.17 to synonym enol-CoA hydratase activity of GO:0004300
* Changed synonym scope of GO:0004300 from "Related" to "Exact"
* Added synonym "enoyl coenzyme A hydrase (D)" to GO:0004300
* Added general dbxref EC:4.2.1.17 to synonym enoyl coenzyme A hydrase (D) of GO:0004300
* Changed synonym scope of GO:0004300 from "Related" to "Broad"
* Added synonym "enoyl coenzyme A hydrase (L)" to GO:0004300
* Added general dbxref EC:4.2.1.17 to synonym enoyl coenzyme A hydrase (L) of GO:0004300
* Changed synonym scope of GO:0004300 from "Related" to "Exact"
* Added synonym "enoyl coenzyme A hydratase activity" to GO:0004300
* Added general dbxref EC:4.2.1.17 to synonym enoyl coenzyme A hydratase activity of GO:0004300
* Changed synonym scope of GO:0004300 from "Related" to "Exact"
* Added synonym "hydratase, enoyl coenzyme A" to GO:0004300
* Added general dbxref EC:4.2.1.17 to synonym hydratase, enoyl coenzyme A of GO:0004300
* Changed synonym scope of GO:0004300 from "Related" to "Exact"
* Added synonym "short chain enoyl coenzyme A hydratase activity" to GO:0004300
* Added general dbxref EC:4.2.1.17 to synonym short chain enoyl coenzyme A hydratase activity of GO:0004300
* Changed synonym scope of GO:0004300 from "Related" to "Exact"
* Added synonym "trans-2-enoyl-CoA hydratase activity" to GO:0004300
* Added general dbxref EC:4.2.1.17 to synonym trans-2-enoyl-CoA hydratase activity of GO:0004300
* Changed synonym scope of GO:0004300 from "Related" to "Exact"
* Added synonym "17beta,20alpha-hydroxysteroid dehydrogenase activity" to GO:0004303
* Added general dbxref EC:1.1.1.62 to synonym 17beta,20alpha-hydroxysteroid dehydrogenase activity of GO:0004303
* Changed synonym scope of GO:0004303 from "Related" to "Exact"
* Added synonym "17beta-estradiol dehydrogenase activity" to GO:0004303
* Added general dbxref EC:1.1.1.62 to synonym 17beta-estradiol dehydrogenase activity of GO:0004303
* Changed synonym scope of GO:0004303 from "Related" to "Exact"
* Added synonym "17beta-HSD" to GO:0004303
* Added general dbxref EC:1.1.1.62 to synonym 17beta-HSD of GO:0004303
* Added synonym "17beta-hydroxysteroid dehydrogenase activity" to GO:0004303
* Added general dbxref EC:1.1.1.62 to synonym 17beta-hydroxysteroid dehydrogenase activity of GO:0004303
* Changed synonym scope of GO:0004303 from "Related" to "Exact"
* Added synonym "20alpha-hydroxysteroid dehydrogenase" to GO:0004303
* Added general dbxref EC:1.1.1.62 to synonym 20alpha-hydroxysteroid dehydrogenase of GO:0004303
* Changed synonym scope of GO:0004303 from "Related" to "Broad"
* Added synonym "estradiol 17beta-dehydrogenase activity" to GO:0004303
* Added general dbxref EC:1.1.1.62 to synonym estradiol 17beta-dehydrogenase activity of GO:0004303
* Changed synonym scope of GO:0004303 from "Related" to "Exact"
* Added synonym "estradiol dehydrogenase activity" to GO:0004303
* Added general dbxref EC:1.1.1.62 to synonym estradiol dehydrogenase activity of GO:0004303
* Changed synonym scope of GO:0004303 from "Related" to "Exact"
* Added synonym "estradiol-17beta:NAD(P)+ 17-oxidoreductase activity" to GO:0004303
* Added general dbxref EC:1.1.1.62 to synonym estradiol-17beta:NAD(P)+ 17-oxidoreductase activity of GO:0004303
* Changed synonym scope of GO:0004303 from "Related" to "Exact"
* Added synonym "3'-phosphoadenylyl sulfate-estrone 3-sulfotransferase activity" to GO:0004304
* Added general dbxref EC:2.8.2.4 to synonym 3'-phosphoadenylyl sulfate-estrone 3-sulfotransferase activity of GO:0004304
* Changed synonym scope of GO:0004304 from "Related" to "Exact"
* Added synonym "3'-phosphoadenylyl-sulfate:estrone 3-sulfotransferase activity" to GO:0004304
* Added general dbxref EC:2.8.2.4 to synonym 3'-phosphoadenylyl-sulfate:estrone 3-sulfotransferase activity of GO:0004304
* Changed synonym scope of GO:0004304 from "Related" to "Exact"
* Added synonym "3'-phosphoadenylylsulfate:oestrone sulfotransferase activity" to GO:0004304
* Added general dbxref EC:2.8.2.4 to synonym 3'-phosphoadenylylsulfate:oestrone sulfotransferase activity of GO:0004304
* Changed synonym scope of GO:0004304 from "Related" to "Exact"
* Added synonym "estrogen sulfotransferase" to GO:0004304
* Added general dbxref EC:2.8.2.4 to synonym estrogen sulfotransferase of GO:0004304
* Changed synonym scope of GO:0004304 from "Related" to "Broad"
* Added synonym "estrogen sulphotransferase activity" to GO:0004304
* Added general dbxref EC:2.8.2.4 to synonym estrogen sulphotransferase activity of GO:0004304
* Changed synonym scope of GO:0004304 from "Related" to "Exact"
* Added synonym "oestrogen sulphotransferase activity" to GO:0004304
* Added general dbxref EC:2.8.2.4 to synonym oestrogen sulphotransferase activity of GO:0004304
* Changed synonym scope of GO:0004304 from "Related" to "Exact"
* Added synonym "ATP:ethanolamine O-phosphotransferase activity" to GO:0004305
* Added general dbxref EC:2.7.1.82 to synonym ATP:ethanolamine O-phosphotransferase activity of GO:0004305
* Changed synonym scope of GO:0004305 from "Related" to "Exact"
* Added synonym "ethanolamine kinase (phosphorylating)" to GO:0004305
* Added general dbxref EC:2.7.1.82 to synonym ethanolamine kinase (phosphorylating) of GO:0004305
* Changed synonym scope of GO:0004305 from "Related" to "Exact"
* Added synonym "ethanolamine phosphokinase activity" to GO:0004305
* Added general dbxref EC:2.7.1.82 to synonym ethanolamine phosphokinase activity of GO:0004305
* Changed synonym scope of GO:0004305 from "Related" to "Exact"
* Deleted synonym "phosphoethanolamine cytidylyltransferase" from GO:0004306
* Added synonym "CTP-phosphoethanolamine cytidylyltransferase activity" to GO:0004306
* Added general dbxref EC:2.7.7.14 to synonym CTP-phosphoethanolamine cytidylyltransferase activity of GO:0004306
* Changed synonym scope of GO:0004306 from "Related" to "Exact"
* Added synonym "ET" to GO:0004306
* Added general dbxref EC:2.7.7.14 to synonym ET of GO:0004306
* Added synonym "ethanolamine phosphate cytidylyltransferase activity" to GO:0004306
* Added general dbxref EC:2.7.7.14 to synonym ethanolamine phosphate cytidylyltransferase activity of GO:0004306
* Changed synonym scope of GO:0004306 from "Related" to "Exact"
* Added synonym "phosphoethanolamine cytidylyltransferase activity" to GO:0004306
* Changed synonym scope of GO:0004306 from "Related" to "Exact"
* Added synonym "CDP-ethanolamine:1,2-diacylglycerol ethanolaminephosphotransferase activity" to GO:0004307
* Added general dbxref EC:2.7.8.1 to synonym CDP-ethanolamine:1,2-diacylglycerol ethanolaminephosphotransferase activity of GO:0004307
* Changed synonym scope of GO:0004307 from "Related" to "Exact"
* Added synonym "CDPethanolamine diglyceride phosphotransferase activity" to GO:0004307
* Added general dbxref EC:2.7.8.1 to synonym CDPethanolamine diglyceride phosphotransferase activity of GO:0004307
* Changed synonym scope of GO:0004307 from "Related" to "Exact"
* Added synonym "diacylglycerol ethanolaminephosphotransferase activity" to GO:0004307
* Added general dbxref EC:2.7.8.1 to synonym diacylglycerol ethanolaminephosphotransferase activity of GO:0004307
* Changed synonym scope of GO:0004307 from "Related" to "Exact"
* Added synonym "EPT" to GO:0004307
* Added general dbxref EC:2.7.8.1 to synonym EPT of GO:0004307
* Added synonym "phosphorylethanolamine-glyceride transferase activity" to GO:0004307
* Added general dbxref EC:2.7.8.1 to synonym phosphorylethanolamine-glyceride transferase activity of GO:0004307
* Changed synonym scope of GO:0004307 from "Related" to "Exact"
* Added synonym "acetylneuraminidase activity" to GO:0004308
* Added general dbxref EC:3.2.1.18 to synonym acetylneuraminidase activity of GO:0004308
* Changed synonym scope of GO:0004308 from "Related" to "Exact"
* Added synonym "acetylneuraminyl hydrolase activity" to GO:0004308
* Added general dbxref EC:3.2.1.18 to synonym acetylneuraminyl hydrolase activity of GO:0004308
* Changed synonym scope of GO:0004308 from "Related" to "Exact"
* Added synonym "acid phosphoanhydride phosphohydrolase activity" to GO:0004309
* Added general dbxref EC:3.6.1.11 to synonym acid phosphoanhydride phosphohydrolase activity of GO:0004309
* Changed synonym scope of GO:0004309 from "Related" to "Exact"
* Added synonym "Gra-pase activity" to GO:0004309
* Added general dbxref EC:3.6.1.11 to synonym Gra-pase activity of GO:0004309
* Changed synonym scope of GO:0004309 from "Related" to "Exact"
* Added synonym "polyphosphate phosphohydrolase activity" to GO:0004309
* Added general dbxref EC:3.6.1.11 to synonym polyphosphate phosphohydrolase activity of GO:0004309
* Changed synonym scope of GO:0004309 from "Related" to "Exact"
* Added synonym "farnesyl-diphosphate:farnesyl-diphosphate farnesyltransferase activity" to GO:0004310
* Added general dbxref EC:2.5.1.21 to synonym farnesyl-diphosphate:farnesyl-diphosphate farnesyltransferase activity of GO:0004310
* Changed synonym scope of GO:0004310 from "Related" to "Exact"
* Added synonym "squalene synthase activity" to GO:0004310
* Added general dbxref EC:2.5.1.21 to synonym squalene synthase activity of GO:0004310
* Changed synonym scope of GO:0004310 from "Related" to "Exact"
* Added synonym "trans,trans-farnesyl-diphosphate:isopentenyl-diphosphate farnesyltranstransferase activity" to GO:0004311
* Added general dbxref EC:2.5.1.29 to synonym trans,trans-farnesyl-diphosphate:isopentenyl-diphosphate farnesyltranstransferase activity of GO:0004311
* Changed synonym scope of GO:0004311 from "Related" to "Exact"
* Added synonym "acyl-CoA:malonyl-CoA C-acyltransferase (decarboxylating, oxoacyl- and enoyl-reducing and thioester-hydrolysing)" to GO:0004312
* Added general dbxref EC:2.3.1.85 to synonym acyl-CoA:malonyl-CoA C-acyltransferase (decarboxylating, oxoacyl- and enoyl-reducing and thioester-hydrolysing) of GO:0004312
* Changed synonym scope of GO:0004312 from "Related" to "Exact"
* Added synonym "acetyl-CoA:acyl-carrier-protein S-acetyltransferase activity" to GO:0004313
* Added general dbxref EC:2.3.1.38 to synonym acetyl-CoA:acyl-carrier-protein S-acetyltransferase activity of GO:0004313
* Changed synonym scope of GO:0004313 from "Related" to "Exact"
* Added synonym "ACPacetyltransferase activity" to GO:0004313
* Added general dbxref EC:2.3.1.38 to synonym ACPacetyltransferase activity of GO:0004313
* Changed synonym scope of GO:0004313 from "Related" to "Exact"
* Added synonym "acyl-carrier-protein S-acetyltransferase activity" to GO:0004313
* Added general dbxref EC:2.3.1.38 to synonym acyl-carrier-protein S-acetyltransferase activity of GO:0004313
* Changed synonym scope of GO:0004313 from "Related" to "Exact"
* Added synonym "acyl-carrier-proteinacetyltransferase activity" to GO:0004313
* Added general dbxref EC:2.3.1.38 to synonym acyl-carrier-proteinacetyltransferase activity of GO:0004313
* Changed synonym scope of GO:0004313 from "Related" to "Exact"
* Added synonym "acyl carrier proteinmalonyltransferase activity" to GO:0004314
* Added general dbxref EC:2.3.1.39 to synonym acyl carrier proteinmalonyltransferase activity of GO:0004314
* Changed synonym scope of GO:0004314 from "Related" to "Exact"
* Added synonym "acyl-carrier-protein S-malonyltransferase activity" to GO:0004314
* Added general dbxref EC:2.3.1.39 to synonym acyl-carrier-protein S-malonyltransferase activity of GO:0004314
* Changed synonym scope of GO:0004314 from "Related" to "Exact"
* Added synonym "FabD" to GO:0004314
* Added general dbxref EC:2.3.1.39 to synonym FabD of GO:0004314
* Added synonym "malonyl-CoA:ACP transacylase activity" to GO:0004314
* Added general dbxref EC:2.3.1.39 to synonym malonyl-CoA:ACP transacylase activity of GO:0004314
* Changed synonym scope of GO:0004314 from "Related" to "Exact"
* Added synonym "malonyl-CoA:AcpM transacylase activity" to GO:0004314
* Added general dbxref EC:2.3.1.39 to synonym malonyl-CoA:AcpM transacylase activity of GO:0004314
* Changed synonym scope of GO:0004314 from "Related" to "Exact"
* Added synonym "malonyl-CoA:acyl carrier protein transacylase activity" to GO:0004314
* Added general dbxref EC:2.3.1.39 to synonym malonyl-CoA:acyl carrier protein transacylase activity of GO:0004314
* Changed synonym scope of GO:0004314 from "Related" to "Exact"
* Added synonym "malonyl-CoA:acyl-carrier-protein S-malonyltransferase activity" to GO:0004314
* Added general dbxref EC:2.3.1.39 to synonym malonyl-CoA:acyl-carrier-protein S-malonyltransferase activity of GO:0004314
* Changed synonym scope of GO:0004314 from "Related" to "Exact"
* Added synonym "MAT" to GO:0004314
* Added general dbxref EC:2.3.1.39 to synonym MAT of GO:0004314
* Added synonym "3-oxoacyl-acyl-carrier-protein synthase activity" to GO:0004315
* Added general dbxref EC:2.3.1.41 to synonym 3-oxoacyl-acyl-carrier-protein synthase activity of GO:0004315
* Changed synonym scope of GO:0004315 from "Related" to "Exact"
* Added synonym "3-oxoacyl:ACP synthase I" to GO:0004315
* Added general dbxref EC:2.3.1.41 to synonym 3-oxoacyl:ACP synthase I of GO:0004315
* Added synonym "acyl-acyl-carrier-protein:malonyl-acyl-carrier-protein C-acyltransferase (decarboxylating)" to GO:0004315
* Added general dbxref EC:2.3.1.41 to synonym acyl-acyl-carrier-protein:malonyl-acyl-carrier-protein C-acyltransferase (decarboxylating) of GO:0004315
* Changed synonym scope of GO:0004315 from "Related" to "Exact"
* Added synonym "beta-ketoacyl-acyl carrier protein synthase activity" to GO:0004315
* Added general dbxref EC:2.3.1.41 to synonym beta-ketoacyl-acyl carrier protein synthase activity of GO:0004315
* Changed synonym scope of GO:0004315 from "Related" to "Exact"
* Added synonym "beta-ketoacyl-acyl-carrier-protein synthase I" to GO:0004315
* Added general dbxref EC:2.3.1.41 to synonym beta-ketoacyl-acyl-carrier-protein synthase I of GO:0004315
* Added synonym "FabB" to GO:0004315
* Added general dbxref EC:2.3.1.41 to synonym FabB of GO:0004315
* Added synonym "FabF1" to GO:0004315
* Added general dbxref EC:2.3.1.41 to synonym FabF1 of GO:0004315
* Added synonym "KASI" to GO:0004315
* Added general dbxref EC:2.3.1.41 to synonym KASI of GO:0004315
* Added synonym "(3R)-3-hydroxyacyl-acyl-carrier-protein:NADP+ oxidoreductase activity" to GO:0004316
* Added general dbxref EC:1.1.1.100 to synonym (3R)-3-hydroxyacyl-acyl-carrier-protein:NADP+ oxidoreductase activity of GO:0004316
* Changed synonym scope of GO:0004316 from "Related" to "Exact"
* Added synonym "3-ketoacyl acyl carrier protein reductase activity" to GO:0004316
* Added general dbxref EC:1.1.1.100 to synonym 3-ketoacyl acyl carrier protein reductase activity of GO:0004316
* Changed synonym scope of GO:0004316 from "Related" to "Exact"
* Added synonym "3-oxoacyl-ACPreductase activity" to GO:0004316
* Added general dbxref EC:1.1.1.100 to synonym 3-oxoacyl-ACPreductase activity of GO:0004316
* Changed synonym scope of GO:0004316 from "Related" to "Exact"
* Added synonym "3-oxoacyl-acyl-carrier-protein reductase activity" to GO:0004316
* Added general dbxref EC:1.1.1.100 to synonym 3-oxoacyl-acyl-carrier-protein reductase activity of GO:0004316
* Changed synonym scope of GO:0004316 from "Related" to "Exact"
* Added synonym "beta-ketoacyl acyl carrier protein (ACP) reductase activity" to GO:0004316
* Added general dbxref EC:1.1.1.100 to synonym beta-ketoacyl acyl carrier protein (ACP) reductase activity of GO:0004316
* Changed synonym scope of GO:0004316 from "Related" to "Exact"
* Added synonym "beta-ketoacyl reductase activity" to GO:0004316
* Added general dbxref EC:1.1.1.100 to synonym beta-ketoacyl reductase activity of GO:0004316
* Changed synonym scope of GO:0004316 from "Related" to "Exact"
* Added synonym "beta-ketoacyl thioester reductase activity" to GO:0004316
* Added general dbxref EC:1.1.1.100 to synonym beta-ketoacyl thioester reductase activity of GO:0004316
* Changed synonym scope of GO:0004316 from "Related" to "Exact"
* Added synonym "beta-ketoacyl-ACP reductase activity" to GO:0004316
* Added general dbxref EC:1.1.1.100 to synonym beta-ketoacyl-ACP reductase activity of GO:0004316
* Changed synonym scope of GO:0004316 from "Related" to "Exact"
* Added synonym "beta-ketoacyl-acyl carrier protein reductase activity" to GO:0004316
* Added general dbxref EC:1.1.1.100 to synonym beta-ketoacyl-acyl carrier protein reductase activity of GO:0004316
* Changed synonym scope of GO:0004316 from "Related" to "Exact"
* Added synonym "beta-ketoacyl-acyl-carrier protein(ACP) reductase activity" to GO:0004316
* Added general dbxref EC:1.1.1.100 to synonym beta-ketoacyl-acyl-carrier protein(ACP) reductase activity of GO:0004316
* Changed synonym scope of GO:0004316 from "Related" to "Exact"
* Added synonym "NADPH-specific 3-oxoacyl-acylcarrier proteinreductase activity" to GO:0004316
* Added general dbxref EC:1.1.1.100 to synonym NADPH-specific 3-oxoacyl-acylcarrier proteinreductase activity of GO:0004316
* Changed synonym scope of GO:0004316 from "Related" to "Exact"
* Added synonym "(3R)-3-hydroxypalmitoyl-acyl-carrier-protein hydro-lyase (hexadec-2-enoyl-acyl-carrier protein-forming)" to GO:0004317
* Added general dbxref EC:4.2.1.61 to synonym (3R)-3-hydroxypalmitoyl-acyl-carrier-protein hydro-lyase (hexadec-2-enoyl-acyl-carrier protein-forming) of GO:0004317
* Changed synonym scope of GO:0004317 from "Related" to "Exact"
* Added synonym "(3R)-3-hydroxypalmitoyl-acyl-carrier-protein hydro-lyase activity" to GO:0004317
* Added general dbxref EC:4.2.1.61 to synonym (3R)-3-hydroxypalmitoyl-acyl-carrier-protein hydro-lyase activity of GO:0004317
* Changed synonym scope of GO:0004317 from "Related" to "Exact"
* Added synonym "3-hydroxypalmitoyl-acyl-carrier-protein dehydratase activity" to GO:0004317
* Added general dbxref EC:4.2.1.61 to synonym 3-hydroxypalmitoyl-acyl-carrier-protein dehydratase activity of GO:0004317
* Changed synonym scope of GO:0004317 from "Related" to "Exact"
* Added synonym "D-3-hydroxypalmitoyl-acyl-carrier-protein dehydratase activity" to GO:0004317
* Added general dbxref EC:4.2.1.61 to synonym D-3-hydroxypalmitoyl-acyl-carrier-protein dehydratase activity of GO:0004317
* Changed synonym scope of GO:0004317 from "Related" to "Exact"
* Added synonym "acyl-acyl-carrier-protein:NADP+ oxidoreductase (B-specific)" to GO:0004319
* Added general dbxref EC:1.3.1.10 to synonym acyl-acyl-carrier-protein:NADP+ oxidoreductase (B-specific) of GO:0004319
* Changed synonym scope of GO:0004319 from "Related" to "Exact"
* Added synonym "enoyl acyl-carrier-protein reductase activity" to GO:0004319
* Added general dbxref EC:1.3.1.10 to synonym enoyl acyl-carrier-protein reductase activity of GO:0004319
* Changed synonym scope of GO:0004319 from "Related" to "Exact"
* Added synonym "enoyl-acyl-carrier-protein reductase (NADPH, B-specific)" to GO:0004319
* Added general dbxref EC:1.3.1.10 to synonym enoyl-acyl-carrier-protein reductase (NADPH, B-specific) of GO:0004319
* Changed synonym scope of GO:0004319 from "Related" to "Exact"
* Added synonym "enoyl-acyl-carrier-protein reductase (NADPH2, B-specific)" to GO:0004319
* Added general dbxref EC:1.3.1.10 to synonym enoyl-acyl-carrier-protein reductase (NADPH2, B-specific) of GO:0004319
* Changed synonym scope of GO:0004319 from "Related" to "Exact"
* Added synonym "reductase, enoyl-acyl carrier protein (reduced nicotinamide adenine dinucleotide phosphate)" to GO:0004319
* Added general dbxref EC:1.3.1.10 to synonym reductase, enoyl-acyl carrier protein (reduced nicotinamide adenine dinucleotide phosphate) of GO:0004319
* Changed synonym scope of GO:0004319 from "Related" to "Exact"
* Added synonym "acyl-CoA:malonyl-CoA C-acyltransferase (decarboxylating, oxoacyl- and enoyl- reducing)" to GO:0004321
* Added general dbxref EC:2.3.1.86 to synonym acyl-CoA:malonyl-CoA C-acyltransferase (decarboxylating, oxoacyl- and enoyl- reducing) of GO:0004321
* Changed synonym scope of GO:0004321 from "Related" to "Exact"
* Added synonym "ferro-protoporphyrin chelatase activity" to GO:0004325
* Added general dbxref EC:4.99.1.1 to synonym ferro-protoporphyrin chelatase activity of GO:0004325
* Changed synonym scope of GO:0004325 from "Related" to "Exact"
* Added synonym "protoheme ferro-lyase (protoporphyrin-forming)" to GO:0004325
* Added general dbxref EC:4.99.1.1 to synonym protoheme ferro-lyase (protoporphyrin-forming) of GO:0004325
* Changed synonym scope of GO:0004325 from "Related" to "Exact"
* Added synonym "N10-formyltetrahydropteroyldiglutamate synthetase activity" to GO:0004326
* Added general dbxref EC:6.3.2.17 to synonym N10-formyltetrahydropteroyldiglutamate synthetase activity of GO:0004326
* Changed synonym scope of GO:0004326 from "Related" to "Exact"
* Added synonym "tetrahydrofolate synthase activity" to GO:0004326
* Added general dbxref EC:6.3.2.17 to synonym tetrahydrofolate synthase activity of GO:0004326
* Changed synonym scope of GO:0004326 from "Related" to "Exact"
* Added synonym "tetrahydrofolyl-[gamma-Glu]n:L-glutamate gamma-ligase (ADP-forming)" to GO:0004326
* Added general dbxref EC:6.3.2.17 to synonym tetrahydrofolyl-[gamma-Glu]n:L-glutamate gamma-ligase (ADP-forming) of GO:0004326
* Changed synonym scope of GO:0004326 from "Related" to "Exact"
* Added synonym "tetrahydropteroyl-[gamma-polyglutamate]:L-glutamate gamma-ligase (ADP-forming)" to GO:0004326
* Added general dbxref EC:6.3.2.17 to synonym tetrahydropteroyl-[gamma-polyglutamate]:L-glutamate gamma-ligase (ADP-forming) of GO:0004326
* Changed synonym scope of GO:0004326 from "Related" to "Exact"
* Added synonym "10-formyltetrahydrofolate synthetase activity" to GO:0004329
* Added general dbxref EC:6.3.4.3 to synonym 10-formyltetrahydrofolate synthetase activity of GO:0004329
* Changed synonym scope of GO:0004329 from "Related" to "Exact"
* Added synonym "formate:tetrahydrofolate ligase (ADP-forming)" to GO:0004329
* Added general dbxref EC:6.3.4.3 to synonym formate:tetrahydrofolate ligase (ADP-forming) of GO:0004329
* Changed synonym scope of GO:0004329 from "Related" to "Exact"
* Added synonym "beta-D-fructose-2,6-bisphosphate 2-phosphohydrolase activity" to GO:0004331
* Added general dbxref EC:3.1.3.46 to synonym beta-D-fructose-2,6-bisphosphate 2-phosphohydrolase activity of GO:0004331
* Changed synonym scope of GO:0004331 from "Related" to "Exact"
* Added synonym "D-fructose-2,6-bisphosphate 2-phosphohydrolase activity" to GO:0004331
* Added general dbxref EC:3.1.3.46 to synonym D-fructose-2,6-bisphosphate 2-phosphohydrolase activity of GO:0004331
* Changed synonym scope of GO:0004331 from "Related" to "Exact"
* Added synonym "1,6-diphosphofructose aldolase activity" to GO:0004332
* Added general dbxref EC:4.1.2.13 to synonym 1,6-diphosphofructose aldolase activity of GO:0004332
* Changed synonym scope of GO:0004332 from "Related" to "Exact"
* Added synonym "D-fructose-1,6-bisphosphate D-glyceraldehyde-3-phosphate-lyase (glycerone-phosphate-forming)" to GO:0004332
* Added general dbxref EC:4.1.2.13 to synonym D-fructose-1,6-bisphosphate D-glyceraldehyde-3-phosphate-lyase (glycerone-phosphate-forming) of GO:0004332
* Changed synonym scope of GO:0004332 from "Related" to "Exact"
* Added synonym "diphosphofructose aldolase activity" to GO:0004332
* Added general dbxref EC:4.1.2.13 to synonym diphosphofructose aldolase activity of GO:0004332
* Changed synonym scope of GO:0004332 from "Related" to "Exact"
* Added synonym "fructoaldolase activity" to GO:0004332
* Added general dbxref EC:4.1.2.13 to synonym fructoaldolase activity of GO:0004332
* Changed synonym scope of GO:0004332 from "Related" to "Exact"
* Added synonym "fructose 1,6-diphosphate aldolase activity" to GO:0004332
* Added general dbxref EC:4.1.2.13 to synonym fructose 1,6-diphosphate aldolase activity of GO:0004332
* Changed synonym scope of GO:0004332 from "Related" to "Exact"
* Added synonym "fructose 1-monophosphate aldolase activity" to GO:0004332
* Added general dbxref EC:4.1.2.13 to synonym fructose 1-monophosphate aldolase activity of GO:0004332
* Changed synonym scope of GO:0004332 from "Related" to "Exact"
* Added synonym "fructose 1-phosphate aldolase activity" to GO:0004332
* Added general dbxref EC:4.1.2.13 to synonym fructose 1-phosphate aldolase activity of GO:0004332
* Changed synonym scope of GO:0004332 from "Related" to "Exact"
* Added synonym "fructose diphosphate aldolase activity" to GO:0004332
* Added general dbxref EC:4.1.2.13 to synonym fructose diphosphate aldolase activity of GO:0004332
* Changed synonym scope of GO:0004332 from "Related" to "Exact"
* Added synonym "ketose 1-phosphate aldolase activity" to GO:0004332
* Added general dbxref EC:4.1.2.13 to synonym ketose 1-phosphate aldolase activity of GO:0004332
* Changed synonym scope of GO:0004332 from "Related" to "Exact"
* Added synonym "phosphofructoaldolase activity" to GO:0004332
* Added general dbxref EC:4.1.2.13 to synonym phosphofructoaldolase activity of GO:0004332
* Changed synonym scope of GO:0004332 from "Related" to "Exact"
* Added synonym "SMALDO" to GO:0004332
* Added general dbxref EC:4.1.2.13 to synonym SMALDO of GO:0004332
* Added synonym "zymohexase activity" to GO:0004332
* Added general dbxref EC:4.1.2.13 to synonym zymohexase activity of GO:0004332
* Changed synonym scope of GO:0004332 from "Related" to "Exact"
* Added synonym "(S)-malate hydro-lyase (fumarate-forming)" to GO:0004333
* Added general dbxref EC:4.2.1.2 to synonym (S)-malate hydro-lyase (fumarate-forming) of GO:0004333
* Changed synonym scope of GO:0004333 from "Related" to "Exact"
* Added synonym "(S)-malate hydro-lyase activity" to GO:0004333
* Added general dbxref EC:4.2.1.2 to synonym (S)-malate hydro-lyase activity of GO:0004333
* Changed synonym scope of GO:0004333 from "Related" to "Exact"
* Added synonym "L-malate hydro-lyase activity" to GO:0004333
* Added general dbxref EC:4.2.1.2 to synonym L-malate hydro-lyase activity of GO:0004333
* Changed synonym scope of GO:0004333 from "Related" to "Exact"
* Added synonym "4-fumarylacetoacetate fumarylhydrolase activity" to GO:0004334
* Added general dbxref EC:3.7.1.2 to synonym 4-fumarylacetoacetate fumarylhydrolase activity of GO:0004334
* Changed synonym scope of GO:0004334 from "Related" to "Exact"
* Added synonym "ATP:D-galactose 1-phosphotransferase activity" to GO:0004335
* Added general dbxref EC:2.7.1.6 to synonym ATP:D-galactose 1-phosphotransferase activity of GO:0004335
* Changed synonym scope of GO:0004335 from "Related" to "Exact"
* Added synonym "ATP:D-galactose-1-phosphotransferase activity" to GO:0004335
* Added general dbxref EC:2.7.1.6 to synonym ATP:D-galactose-1-phosphotransferase activity of GO:0004335
* Changed synonym scope of GO:0004335 from "Related" to "Exact"
* Added synonym "galactokinase (phosphorylating)" to GO:0004335
* Added general dbxref EC:2.7.1.6 to synonym galactokinase (phosphorylating) of GO:0004335
* Changed synonym scope of GO:0004335 from "Related" to "Exact"
* Added synonym "beta-galactocerebrosidase activity" to GO:0004336
* Added general dbxref EC:3.2.1.46 to synonym beta-galactocerebrosidase activity of GO:0004336
* Changed synonym scope of GO:0004336 from "Related" to "Exact"
* Added synonym "beta-galactosylceramidase activity" to GO:0004336
* Added general dbxref EC:3.2.1.46 to synonym beta-galactosylceramidase activity of GO:0004336
* Changed synonym scope of GO:0004336 from "Related" to "Exact"
* Added synonym "ceramide galactosidase activity" to GO:0004336
* Added general dbxref EC:3.2.1.46 to synonym ceramide galactosidase activity of GO:0004336
* Changed synonym scope of GO:0004336 from "Related" to "Exact"
* Added synonym "cerebroside beta-galactosidase activity" to GO:0004336
* Added general dbxref EC:3.2.1.46 to synonym cerebroside beta-galactosidase activity of GO:0004336
* Changed synonym scope of GO:0004336 from "Related" to "Exact"
* Added synonym "cerebroside galactosidase activity" to GO:0004336
* Added general dbxref EC:3.2.1.46 to synonym cerebroside galactosidase activity of GO:0004336
* Changed synonym scope of GO:0004336 from "Related" to "Exact"
* Added synonym "D-galactosyl-N-acylsphingosine galactohydrolase activity" to GO:0004336
* Added general dbxref EC:3.2.1.46 to synonym D-galactosyl-N-acylsphingosine galactohydrolase activity of GO:0004336
* Changed synonym scope of GO:0004336 from "Related" to "Exact"
* Added synonym "galactocerebroside galactosidase activity" to GO:0004336
* Added general dbxref EC:3.2.1.46 to synonym galactocerebroside galactosidase activity of GO:0004336
* Changed synonym scope of GO:0004336 from "Related" to "Exact"
* Added synonym "galactocerebroside-beta-D-galactosidase activity" to GO:0004336
* Added general dbxref EC:3.2.1.46 to synonym galactocerebroside-beta-D-galactosidase activity of GO:0004336
* Changed synonym scope of GO:0004336 from "Related" to "Exact"
* Added synonym "galactocerebroside.beta-galactosidase activity" to GO:0004336
* Added general dbxref EC:3.2.1.46 to synonym galactocerebroside.beta-galactosidase activity of GO:0004336
* Changed synonym scope of GO:0004336 from "Related" to "Exact"
* Added synonym "galactosylceramidase I" to GO:0004336
* Added general dbxref EC:3.2.1.46 to synonym galactosylceramidase I of GO:0004336
* Added synonym "galactosylceramide.beta-galactosidase activity" to GO:0004336
* Added general dbxref EC:3.2.1.46 to synonym galactosylceramide.beta-galactosidase activity of GO:0004336
* Changed synonym scope of GO:0004336 from "Related" to "Exact"
* Added synonym "galactosylcerebrosidase activity" to GO:0004336
* Added general dbxref EC:3.2.1.46 to synonym galactosylcerebrosidase activity of GO:0004336
* Changed synonym scope of GO:0004336 from "Related" to "Exact"
* Added synonym "lactosylceramidase activity" to GO:0004336
* Added general dbxref EC:3.2.1.46 to synonym lactosylceramidase activity of GO:0004336
* Changed synonym scope of GO:0004336 from "Related" to "Exact"
* Added synonym "lactosylceramidase I" to GO:0004336
* Added general dbxref EC:3.2.1.46 to synonym lactosylceramidase I of GO:0004336
* Added synonym "farnesylpyrophosphate synthetase activity" to GO:0004337
* Added general dbxref EC:2.5.1.10 to synonym farnesylpyrophosphate synthetase activity of GO:0004337
* Changed synonym scope of GO:0004337 from "Related" to "Exact"
* Added synonym "geranyl transferase I" to GO:0004337
* Added general dbxref EC:2.5.1.10 to synonym geranyl transferase I of GO:0004337
* Added synonym "geranyl-diphosphate:isopentenyl-diphosphate geranyltranstransferase activity" to GO:0004337
* Added general dbxref EC:2.5.1.10 to synonym geranyl-diphosphate:isopentenyl-diphosphate geranyltranstransferase activity of GO:0004337
* Changed synonym scope of GO:0004337 from "Related" to "Exact"
* Added synonym "1,3-beta-glucan glucohydrolase activity" to GO:0004338
* Added general dbxref EC:3.2.1.58 to synonym 1,3-beta-glucan glucohydrolase activity of GO:0004338
* Changed synonym scope of GO:0004338 from "Related" to "Exact"
* Added synonym "beta-1,3-glucan exo-hydrolase activity" to GO:0004338
* Added general dbxref EC:3.2.1.58 to synonym beta-1,3-glucan exo-hydrolase activity of GO:0004338
* Changed synonym scope of GO:0004338 from "Related" to "Exact"
* Added synonym "exo (1right3)-beta-glucanase activity" to GO:0004338
* Added general dbxref EC:3.2.1.58 to synonym exo (1right3)-beta-glucanase activity of GO:0004338
* Changed synonym scope of GO:0004338 from "Related" to "Exact"
* Added synonym "exo-1,3-beta-D-glucanase activity" to GO:0004338
* Added general dbxref EC:3.2.1.58 to synonym exo-1,3-beta-D-glucanase activity of GO:0004338
* Changed synonym scope of GO:0004338 from "Related" to "Exact"
* Added synonym "exo-beta-(1right3)-D-glucanase activity" to GO:0004338
* Added general dbxref EC:3.2.1.58 to synonym exo-beta-(1right3)-D-glucanase activity of GO:0004338
* Changed synonym scope of GO:0004338 from "Related" to "Exact"
* Added synonym "exo-beta-(1right3)-glucanohydrolase activity" to GO:0004338
* Added general dbxref EC:3.2.1.58 to synonym exo-beta-(1right3)-glucanohydrolase activity of GO:0004338
* Changed synonym scope of GO:0004338 from "Related" to "Exact"
* Added synonym "exo-beta-1,3-D-glucanase activity" to GO:0004338
* Added general dbxref EC:3.2.1.58 to synonym exo-beta-1,3-D-glucanase activity of GO:0004338
* Changed synonym scope of GO:0004338 from "Related" to "Exact"
* Added synonym "exo-beta-1,3-glucanase activity" to GO:0004338
* Added general dbxref EC:3.2.1.58 to synonym exo-beta-1,3-glucanase activity of GO:0004338
* Changed synonym scope of GO:0004338 from "Related" to "Exact"
* Added synonym "gamma-1,4-glucan glucohydrolase activity" to GO:0004339
* Added general dbxref EC:3.2.1.3 to synonym gamma-1,4-glucan glucohydrolase activity of GO:0004339
* Changed synonym scope of GO:0004339 from "Related" to "Exact"
* Added synonym "glucose amylase activity" to GO:0004339
* Added general dbxref EC:3.2.1.3 to synonym glucose amylase activity of GO:0004339
* Changed synonym scope of GO:0004339 from "Related" to "Exact"
* Added synonym "ATP:D-glucose 6-phosphotransferase activity" to GO:0004340
* Added general dbxref EC:2.7.1.2 to synonym ATP:D-glucose 6-phosphotransferase activity of GO:0004340
* Changed synonym scope of GO:0004340 from "Related" to "Exact"
* Added synonym "glucokinase (phosphorylating)" to GO:0004340
* Added general dbxref EC:2.7.1.2 to synonym glucokinase (phosphorylating) of GO:0004340
* Changed synonym scope of GO:0004340 from "Related" to "Exact"
* Added synonym "D-glucono-1,5-lactone lactonohydrolase activity" to GO:0004341
* Added general dbxref EC:3.1.1.17 to synonym D-glucono-1,5-lactone lactonohydrolase activity of GO:0004341
* Changed synonym scope of GO:0004341 from "Related" to "Exact"
* Added synonym "glucono-delta-lactonase activity" to GO:0004341
* Added general dbxref EC:3.1.1.17 to synonym glucono-delta-lactonase activity of GO:0004341
* Changed synonym scope of GO:0004341 from "Related" to "Exact"
* Added synonym "gulonolactonase activity" to GO:0004341
* Added general dbxref EC:3.1.1.17 to synonym gulonolactonase activity of GO:0004341
* Changed synonym scope of GO:0004341 from "Related" to "Exact"
* Added synonym "2-amino-2-deoxy-D-glucose-6-phosphate aminohydrolase (ketol isomerizing)" to GO:0004342
* Added general dbxref EC:3.5.99.6 to synonym 2-amino-2-deoxy-D-glucose-6-phosphate aminohydrolase (ketol isomerizing) of GO:0004342
* Changed synonym scope of GO:0004342 from "Related" to "Exact"
* Added synonym "aminodeoxyglucosephosphate isomerase activity" to GO:0004342
* Added general dbxref EC:3.5.99.6 to synonym aminodeoxyglucosephosphate isomerase activity of GO:0004342
* Changed synonym scope of GO:0004342 from "Related" to "Exact"
* Added synonym "glucosaminephosphate isomerase" to GO:0004342
* Added general dbxref EC:3.5.99.6 to synonym glucosaminephosphate isomerase of GO:0004342
* Changed synonym scope of GO:0004342 from "Related" to "Broad"
* Added synonym "acetyl-CoA:D-glucosamine-6-phosphate N-acetyltransferase activity" to GO:0004343
* Added general dbxref EC:2.3.1.4 to synonym acetyl-CoA:D-glucosamine-6-phosphate N-acetyltransferase activity of GO:0004343
* Changed synonym scope of GO:0004343 from "Related" to "Exact"
* Added synonym "D-glucose-6-phosphate:NADP+ 1-oxidoreductase activity" to GO:0004345
* Added general dbxref EC:1.1.1.49 to synonym D-glucose-6-phosphate:NADP+ 1-oxidoreductase activity of GO:0004345
* Changed synonym scope of GO:0004345 from "Related" to "Exact"
* Added synonym "Entner-doudoroff enzyme" to GO:0004345
* Added general dbxref EC:1.1.1.49 to synonym Entner-doudoroff enzyme of GO:0004345
* Added synonym "zwischenferment" to GO:0004345
* Added general dbxref EC:1.1.1.49 to synonym zwischenferment of GO:0004345
* Added synonym "D-glucose-6-phosphate phosphohydrolase activity" to GO:0004346
* Added general dbxref EC:3.1.3.9 to synonym D-glucose-6-phosphate phosphohydrolase activity of GO:0004346
* Changed synonym scope of GO:0004346 from "Related" to "Exact"
* Added synonym "glucose 6-phosphate phosphatase activity" to GO:0004346
* Added general dbxref EC:3.1.3.9 to synonym glucose 6-phosphate phosphatase activity of GO:0004346
* Changed synonym scope of GO:0004346 from "Related" to "Exact"
* Added synonym "D-glucose-6-phosphate aldose-ketose-isomerase activity" to GO:0004347
* Added general dbxref EC:5.3.1.9 to synonym D-glucose-6-phosphate aldose-ketose-isomerase activity of GO:0004347
* Changed synonym scope of GO:0004347 from "Related" to "Exact"
* Added synonym "D-glucose-6-phosphate ketol-isomerase activity" to GO:0004347
* Added general dbxref EC:5.3.1.9 to synonym D-glucose-6-phosphate ketol-isomerase activity of GO:0004347
* Changed synonym scope of GO:0004347 from "Related" to "Exact"
* Added synonym "glucose phosphate isomerase activity" to GO:0004347
* Added general dbxref EC:5.3.1.9 to synonym glucose phosphate isomerase activity of GO:0004347
* Changed synonym scope of GO:0004347 from "Related" to "Exact"
* Added synonym "hexose phosphate isomerase activity" to GO:0004347
* Added general dbxref EC:5.3.1.9 to synonym hexose phosphate isomerase activity of GO:0004347
* Changed synonym scope of GO:0004347 from "Related" to "Exact"
* Added synonym "beta-D-glucocerebrosidase activity" to GO:0004348
* Added general dbxref EC:3.2.1.45 to synonym beta-D-glucocerebrosidase activity of GO:0004348
* Changed synonym scope of GO:0004348 from "Related" to "Exact"
* Added synonym "beta-glucosylceramidase activity" to GO:0004348
* Added general dbxref EC:3.2.1.45 to synonym beta-glucosylceramidase activity of GO:0004348
* Changed synonym scope of GO:0004348 from "Related" to "Exact"
* Added synonym "ceramide glucosidase activity" to GO:0004348
* Added general dbxref EC:3.2.1.45 to synonym ceramide glucosidase activity of GO:0004348
* Changed synonym scope of GO:0004348 from "Related" to "Exact"
* Added synonym "GlcCer-beta-glucosidase activity" to GO:0004348
* Added general dbxref EC:3.2.1.45 to synonym GlcCer-beta-glucosidase activity of GO:0004348
* Changed synonym scope of GO:0004348 from "Related" to "Exact"
* Added synonym "glucocerebrosidase activity" to GO:0004348
* Added general dbxref EC:3.2.1.45 to synonym glucocerebrosidase activity of GO:0004348
* Changed synonym scope of GO:0004348 from "Related" to "Exa